//! Module defining script statements. use super::{ASTNode, Expr, FnCallExpr, Ident, OptionFlags, AST_OPTION_FLAGS::*}; use crate::engine::KEYWORD_EVAL; use crate::tokenizer::Token; use crate::{calc_fn_hash, Position, StaticVec, INT}; #[cfg(feature = "no_std")] use std::prelude::v1::*; use std::{ collections::BTreeMap, fmt, hash::Hash, mem, ops::{Deref, DerefMut}, }; /// _(internals)_ An op-assignment operator. /// Exported under the `internals` feature only. #[derive(Debug, Clone, Copy, Eq, PartialEq, Hash)] pub struct OpAssignment<'a> { /// Hash of the op-assignment call. pub hash_op_assign: u64, /// Hash of the underlying operator call (for fallback). pub hash_op: u64, /// Op-assignment operator. pub op: &'a str, } impl OpAssignment<'_> { /// Create a new [`OpAssignment`]. /// /// # Panics /// /// Panics if the name is not an op-assignment operator. #[must_use] #[inline(always)] pub fn new(name: &str) -> Self { Self::new_from_token(Token::lookup_from_syntax(name).expect("operator")) } /// Create a new [`OpAssignment`] from a [`Token`]. /// /// # Panics /// /// Panics if the token is not an op-assignment operator. #[must_use] pub fn new_from_token(op: Token) -> Self { let op_raw = op .get_base_op_from_assignment() .expect("op-assignment operator") .literal_syntax(); Self { hash_op_assign: calc_fn_hash(op.literal_syntax(), 2), hash_op: calc_fn_hash(op_raw, 2), op: op.literal_syntax(), } } /// Create a new [`OpAssignment`] from a base operator. /// /// # Panics /// /// Panics if the name is not an operator that can be converted into an op-operator. #[must_use] #[inline(always)] pub fn new_from_base(name: &str) -> Self { Self::new_from_base_token(Token::lookup_from_syntax(name).expect("operator")) } /// Convert a [`Token`] into a new [`OpAssignment`]. /// /// # Panics /// /// Panics if the token is cannot be converted into an op-assignment operator. #[inline(always)] #[must_use] pub fn new_from_base_token(op: Token) -> Self { Self::new_from_token(op.convert_to_op_assignment().expect("operator")) } } /// _(internals)_ A scoped block of statements. /// Exported under the `internals` feature only. #[derive(Clone, Hash, Default)] pub struct StmtBlock(StaticVec, Position); impl StmtBlock { /// A [`StmtBlock`] that does not exist. pub const NONE: Self = Self::empty(Position::NONE); /// Create a new [`StmtBlock`]. #[must_use] pub fn new(statements: impl IntoIterator, pos: Position) -> Self { let mut statements: StaticVec<_> = statements.into_iter().collect(); statements.shrink_to_fit(); Self(statements, pos) } /// Create an empty [`StmtBlock`]. #[inline(always)] #[must_use] pub const fn empty(pos: Position) -> Self { Self(StaticVec::new_const(), pos) } /// Is this statements block empty? #[inline(always)] #[must_use] pub fn is_empty(&self) -> bool { self.0.is_empty() } /// Number of statements in this statements block. #[inline(always)] #[must_use] pub fn len(&self) -> usize { self.0.len() } /// Get the statements of this statements block. #[inline(always)] #[must_use] pub fn statements(&self) -> &[Stmt] { &self.0 } /// Extract the statements. #[inline(always)] #[must_use] pub(crate) fn take_statements(&mut self) -> StaticVec { mem::take(&mut self.0) } /// Get an iterator over the statements of this statements block. #[inline(always)] #[must_use] pub fn iter(&self) -> impl Iterator { self.0.iter() } /// Get the position (location of the beginning `{`) of this statements block. #[inline(always)] #[must_use] pub const fn position(&self) -> Position { self.1 } /// Set the position (location of the beginning `{`) of this statements block. #[inline(always)] pub fn set_position(&mut self, pos: Position) { self.1 = pos; } } impl Deref for StmtBlock { type Target = StaticVec; #[inline(always)] fn deref(&self) -> &Self::Target { &self.0 } } impl DerefMut for StmtBlock { #[inline(always)] fn deref_mut(&mut self) -> &mut Self::Target { &mut self.0 } } impl fmt::Debug for StmtBlock { fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { f.write_str("Block")?; fmt::Debug::fmt(&self.0, f)?; self.1.debug_print(f) } } impl From for StmtBlock { #[inline] fn from(stmt: Stmt) -> Self { match stmt { Stmt::Block(mut block, pos) => Self(block.iter_mut().map(mem::take).collect(), pos), Stmt::Noop(pos) => Self(StaticVec::new_const(), pos), _ => { let pos = stmt.position(); Self(vec![stmt].into(), pos) } } } } impl IntoIterator for StmtBlock { type Item = Stmt; type IntoIter = smallvec::IntoIter<[Stmt; 3]>; #[inline(always)] fn into_iter(self) -> Self::IntoIter { self.0.into_iter() } } impl Extend for StmtBlock { #[inline(always)] fn extend>(&mut self, iter: T) { self.0.extend(iter) } } /// _(internals)_ A statement. /// Exported under the `internals` feature only. #[derive(Debug, Clone, Hash)] pub enum Stmt { /// No-op. Noop(Position), /// `if` expr `{` stmt `}` `else` `{` stmt `}` If(Expr, Box<(StmtBlock, StmtBlock)>, Position), /// `switch` expr `{` literal or range or _ `if` condition `=>` stmt `,` ... `}` /// /// ### Data Structure /// /// 0) Hash table for (condition, block) /// 1) Default block /// 2) List of ranges: (start, end, inclusive, condition, statement) Switch( Expr, Box<( BTreeMap, StmtBlock)>>, StmtBlock, StaticVec<(INT, INT, bool, Option, StmtBlock)>, )>, Position, ), /// `while` expr `{` stmt `}` | `loop` `{` stmt `}` /// /// If the guard expression is [`UNIT`][Expr::Unit], then it is a `loop` statement. While(Expr, Box, Position), /// `do` `{` stmt `}` `while`|`until` expr /// /// ### Option Flags /// /// * [`AST_OPTION_NONE`] = `while` /// * [`AST_OPTION_NEGATED`] = `until` Do(Box, Expr, OptionFlags, Position), /// `for` `(` id `,` counter `)` `in` expr `{` stmt `}` For(Expr, Box<(Ident, Option, StmtBlock)>, Position), /// \[`export`\] `let`|`const` id `=` expr /// /// ### Option Flags /// /// * [`AST_OPTION_EXPORTED`] = `export` /// * [`AST_OPTION_CONSTANT`] = `const` Var(Expr, Box, OptionFlags, Position), /// expr op`=` expr Assignment(Box<(Expr, Option>, Expr)>, Position), /// func `(` expr `,` ... `)` /// /// Note - this is a duplicate of [`Expr::FnCall`] to cover the very common pattern of a single /// function call forming one statement. FnCall(Box, Position), /// `{` stmt`;` ... `}` Block(Box<[Stmt]>, Position), /// `try` `{` stmt; ... `}` `catch` `(` var `)` `{` stmt; ... `}` TryCatch(Box<(StmtBlock, Option, StmtBlock)>, Position), /// [expression][Expr] Expr(Expr), /// `continue`/`break` /// /// ### Option Flags /// /// * [`AST_OPTION_NONE`] = `continue` /// * [`AST_OPTION_BREAK`] = `break` BreakLoop(OptionFlags, Position), /// `return`/`throw` /// /// ### Option Flags /// /// * [`AST_OPTION_NONE`] = `return` /// * [`AST_OPTION_BREAK`] = `throw` Return(OptionFlags, Option, Position), /// `import` expr `as` var /// /// Not available under `no_module`. #[cfg(not(feature = "no_module"))] Import(Expr, Option>, Position), /// `export` var `as` var `,` ... /// /// Not available under `no_module`. #[cfg(not(feature = "no_module"))] Export(Box<[(Ident, Ident)]>, Position), /// Convert a variable to shared. /// /// Not available under `no_closure`. /// /// # Notes /// /// This variant does not map to any language structure. It is currently only used only to /// convert a normal variable into a shared variable when the variable is _captured_ by a closure. #[cfg(not(feature = "no_closure"))] Share(crate::Identifier), } impl Default for Stmt { #[inline(always)] fn default() -> Self { Self::Noop(Position::NONE) } } impl From for Stmt { #[inline(always)] fn from(block: StmtBlock) -> Self { Self::Block(block.0.into_boxed_slice(), block.1) } } impl Stmt { /// Is this statement [`Noop`][Stmt::Noop]? #[inline(always)] #[must_use] pub const fn is_noop(&self) -> bool { matches!(self, Self::Noop(_)) } /// Get the [position][Position] of this statement. #[must_use] pub const fn position(&self) -> Position { match self { Self::Noop(pos) | Self::BreakLoop(_, pos) | Self::Block(_, pos) | Self::Assignment(_, pos) | Self::FnCall(_, pos) | Self::If(_, _, pos) | Self::Switch(_, _, pos) | Self::While(_, _, pos) | Self::Do(_, _, _, pos) | Self::For(_, _, pos) | Self::Return(_, _, pos) | Self::Var(_, _, _, pos) | Self::TryCatch(_, pos) => *pos, Self::Expr(x) => x.position(), #[cfg(not(feature = "no_module"))] Self::Import(_, _, pos) => *pos, #[cfg(not(feature = "no_module"))] Self::Export(_, pos) => *pos, #[cfg(not(feature = "no_closure"))] Self::Share(_) => Position::NONE, } } /// Override the [position][Position] of this statement. pub fn set_position(&mut self, new_pos: Position) -> &mut Self { match self { Self::Noop(pos) | Self::BreakLoop(_, pos) | Self::Block(_, pos) | Self::Assignment(_, pos) | Self::FnCall(_, pos) | Self::If(_, _, pos) | Self::Switch(_, _, pos) | Self::While(_, _, pos) | Self::Do(_, _, _, pos) | Self::For(_, _, pos) | Self::Return(_, _, pos) | Self::Var(_, _, _, pos) | Self::TryCatch(_, pos) => *pos = new_pos, Self::Expr(x) => { x.set_position(new_pos); } #[cfg(not(feature = "no_module"))] Self::Import(_, _, pos) => *pos = new_pos, #[cfg(not(feature = "no_module"))] Self::Export(_, pos) => *pos = new_pos, #[cfg(not(feature = "no_closure"))] Self::Share(_) => (), } self } /// Does this statement return a value? #[must_use] pub const fn returns_value(&self) -> bool { match self { Self::If(_, _, _) | Self::Switch(_, _, _) | Self::Block(_, _) | Self::Expr(_) | Self::FnCall(_, _) => true, Self::Noop(_) | Self::While(_, _, _) | Self::Do(_, _, _, _) | Self::For(_, _, _) | Self::TryCatch(_, _) => false, Self::Var(_, _, _, _) | Self::Assignment(_, _) | Self::BreakLoop(_, _) | Self::Return(_, _, _) => false, #[cfg(not(feature = "no_module"))] Self::Import(_, _, _) | Self::Export(_, _) => false, #[cfg(not(feature = "no_closure"))] Self::Share(_) => false, } } /// Is this statement self-terminated (i.e. no need for a semicolon terminator)? #[must_use] pub const fn is_self_terminated(&self) -> bool { match self { Self::If(_, _, _) | Self::Switch(_, _, _) | Self::While(_, _, _) | Self::For(_, _, _) | Self::Block(_, _) | Self::TryCatch(_, _) => true, // A No-op requires a semicolon in order to know it is an empty statement! Self::Noop(_) => false, Self::Expr(Expr::Custom(x, _)) if x.is_self_terminated() => true, Self::Var(_, _, _, _) | Self::Assignment(_, _) | Self::Expr(_) | Self::FnCall(_, _) | Self::Do(_, _, _, _) | Self::BreakLoop(_, _) | Self::Return(_, _, _) => false, #[cfg(not(feature = "no_module"))] Self::Import(_, _, _) | Self::Export(_, _) => false, #[cfg(not(feature = "no_closure"))] Self::Share(_) => false, } } /// Is this statement _pure_? /// /// A pure statement has no side effects. #[must_use] pub fn is_pure(&self) -> bool { match self { Self::Noop(_) => true, Self::Expr(expr) => expr.is_pure(), Self::If(condition, x, _) => { condition.is_pure() && (x.0).0.iter().all(Stmt::is_pure) && (x.1).0.iter().all(Stmt::is_pure) } Self::Switch(expr, x, _) => { expr.is_pure() && x.0.values().all(|block| { block.0.as_ref().map(Expr::is_pure).unwrap_or(true) && (block.1).0.iter().all(Stmt::is_pure) }) && (x.2).iter().all(|(_, _, _, condition, stmt)| { condition.as_ref().map(Expr::is_pure).unwrap_or(true) && stmt.0.iter().all(Stmt::is_pure) }) && (x.1).0.iter().all(Stmt::is_pure) } // Loops that exit can be pure because it can never be infinite. Self::While(Expr::BoolConstant(false, _), _, _) => true, Self::Do(body, Expr::BoolConstant(x, _), options, _) if *x == options.contains(AST_OPTION_NEGATED) => { body.iter().all(Stmt::is_pure) } // Loops are never pure since they can be infinite - and that's a side effect. Self::While(_, _, _) | Self::Do(_, _, _, _) => false, // For loops can be pure because if the iterable is pure, it is finite, // so infinite loops can never occur. Self::For(iterable, x, _) => iterable.is_pure() && (x.2).0.iter().all(Stmt::is_pure), Self::Var(_, _, _, _) | Self::Assignment(_, _) | Self::FnCall(_, _) => false, Self::Block(block, _) => block.iter().all(|stmt| stmt.is_pure()), Self::BreakLoop(_, _) | Self::Return(_, _, _) => false, Self::TryCatch(x, _) => { (x.0).0.iter().all(Stmt::is_pure) && (x.2).0.iter().all(Stmt::is_pure) } #[cfg(not(feature = "no_module"))] Self::Import(_, _, _) => false, #[cfg(not(feature = "no_module"))] Self::Export(_, _) => false, #[cfg(not(feature = "no_closure"))] Self::Share(_) => false, } } /// Does this statement's behavior depend on its containing block? /// /// A statement that depends on its containing block behaves differently when promoted /// to an upper block. /// /// Currently only variable definitions (i.e. `let` and `const`), `import`/`export` statements, /// and `eval` calls (which may in turn call define variables) fall under this category. #[inline] #[must_use] pub fn is_block_dependent(&self) -> bool { match self { Self::Var(_, _, _, _) => true, Self::Expr(Expr::Stmt(s)) => s.iter().all(Stmt::is_block_dependent), Self::FnCall(x, _) | Self::Expr(Expr::FnCall(x, _)) => { !x.is_qualified() && x.name == KEYWORD_EVAL } #[cfg(not(feature = "no_module"))] Self::Import(_, _, _) | Self::Export(_, _) => true, _ => false, } } /// Is this statement _pure_ within the containing block? /// /// An internally pure statement only has side effects that disappear outside the block. /// /// Currently only variable definitions (i.e. `let` and `const`) and `import`/`export` /// statements are internally pure, other than pure expressions. #[inline] #[must_use] pub fn is_internally_pure(&self) -> bool { match self { Self::Var(expr, _, _, _) => expr.is_pure(), Self::Expr(Expr::Stmt(s)) => s.iter().all(Stmt::is_internally_pure), #[cfg(not(feature = "no_module"))] Self::Import(expr, _, _) => expr.is_pure(), #[cfg(not(feature = "no_module"))] Self::Export(_, _) => true, _ => self.is_pure(), } } /// Does this statement break the current control flow through the containing block? /// /// Currently this is only true for `return`, `throw`, `break` and `continue`. /// /// All statements following this statement will essentially be dead code. #[inline] #[must_use] pub const fn is_control_flow_break(&self) -> bool { match self { Self::Return(_, _, _) | Self::BreakLoop(_, _) => true, _ => false, } } /// Recursively walk this statement. /// Return `false` from the callback to terminate the walk. pub fn walk<'a>( &'a self, path: &mut Vec>, on_node: &mut impl FnMut(&[ASTNode]) -> bool, ) -> bool { // Push the current node onto the path path.push(self.into()); if !on_node(path) { return false; } match self { Self::Var(e, _, _, _) => { if !e.walk(path, on_node) { return false; } } Self::If(e, x, _) => { if !e.walk(path, on_node) { return false; } for s in &(x.0).0 { if !s.walk(path, on_node) { return false; } } for s in &(x.1).0 { if !s.walk(path, on_node) { return false; } } } Self::Switch(e, x, _) => { if !e.walk(path, on_node) { return false; } for b in x.0.values() { if !b.0.as_ref().map(|e| e.walk(path, on_node)).unwrap_or(true) { return false; } for s in &(b.1).0 { if !s.walk(path, on_node) { return false; } } } for (_, _, _, c, stmt) in &x.2 { if !c.as_ref().map(|e| e.walk(path, on_node)).unwrap_or(true) { return false; } for s in &stmt.0 { if !s.walk(path, on_node) { return false; } } } for s in &(x.1).0 { if !s.walk(path, on_node) { return false; } } } Self::While(e, s, _) | Self::Do(s, e, _, _) => { if !e.walk(path, on_node) { return false; } for s in &s.0 { if !s.walk(path, on_node) { return false; } } } Self::For(e, x, _) => { if !e.walk(path, on_node) { return false; } for s in &(x.2).0 { if !s.walk(path, on_node) { return false; } } } Self::Assignment(x, _) => { if !x.0.walk(path, on_node) { return false; } if !x.2.walk(path, on_node) { return false; } } Self::FnCall(x, _) => { for s in &x.args { if !s.walk(path, on_node) { return false; } } } Self::Block(x, _) => { for s in x.iter() { if !s.walk(path, on_node) { return false; } } } Self::TryCatch(x, _) => { for s in &(x.0).0 { if !s.walk(path, on_node) { return false; } } for s in &(x.2).0 { if !s.walk(path, on_node) { return false; } } } Self::Expr(e) | Self::Return(_, Some(e), _) => { if !e.walk(path, on_node) { return false; } } #[cfg(not(feature = "no_module"))] Self::Import(e, _, _) => { if !e.walk(path, on_node) { return false; } } _ => (), } path.pop().unwrap(); true } }