chore: sync fork.
This commit is contained in:
commit
a381a485ec
48
.github/workflows/build.yml
vendored
48
.github/workflows/build.yml
vendored
@ -32,6 +32,7 @@ jobs:
|
|||||||
- uses: actions-rs/cargo@v1
|
- uses: actions-rs/cargo@v1
|
||||||
with:
|
with:
|
||||||
command: check
|
command: check
|
||||||
|
|
||||||
# typical build with various feature combinations
|
# typical build with various feature combinations
|
||||||
build:
|
build:
|
||||||
name: Build
|
name: Build
|
||||||
@ -59,19 +60,19 @@ jobs:
|
|||||||
- "--features no_object,serde,metadata,internals,debugging"
|
- "--features no_object,serde,metadata,internals,debugging"
|
||||||
- "--features no_function,serde,metadata,internals,debugging"
|
- "--features no_function,serde,metadata,internals,debugging"
|
||||||
- "--features no_module,serde,metadata,internals,debugging"
|
- "--features no_module,serde,metadata,internals,debugging"
|
||||||
|
- "--features no_time,serde,metadata,internals,debugging"
|
||||||
- "--features no_closure,serde,metadata,internals,debugging"
|
- "--features no_closure,serde,metadata,internals,debugging"
|
||||||
- "--features unicode-xid-ident,serde,metadata,internals,debugging"
|
- "--features unicode-xid-ident,serde,metadata,internals,debugging"
|
||||||
- "--features sync,no_function,no_float,no_position,no_optimize,no_module,no_closure,no_custom_syntax,metadata,serde,unchecked,debugging"
|
- "--features sync,no_time,no_function,no_float,no_position,no_optimize,no_module,no_closure,no_custom_syntax,metadata,serde,unchecked,debugging"
|
||||||
- "--features no_function,no_float,no_position,no_index,no_object,no_optimize,no_module,no_closure,no_custom_syntax,unchecked"
|
- "--features no_time,no_function,no_float,no_position,no_index,no_object,no_optimize,no_module,no_closure,no_custom_syntax,unchecked"
|
||||||
toolchain: [stable]
|
toolchain: [stable]
|
||||||
experimental: [false]
|
experimental: [false]
|
||||||
include:
|
include:
|
||||||
# smoketests for different toolchains
|
# smoketests for different toolchains
|
||||||
- {toolchain: stable, os: windows-latest, experimental: false, flags: ""}
|
- {toolchain: stable, os: windows-latest, experimental: false, flags: ""}
|
||||||
- {toolchain: stable, os: macos-latest, experimental: false, flags: ""}
|
- {toolchain: stable, os: macos-latest, experimental: false, flags: ""}
|
||||||
# data structure size changes - wait for beta to become stable and uncomment
|
- {toolchain: beta, os: ubuntu-latest, experimental: false, flags: ""}
|
||||||
#- {toolchain: beta, os: ubuntu-latest, experimental: false, flags: ""}
|
- {toolchain: nightly, os: ubuntu-latest, experimental: true, flags: ""}
|
||||||
#- {toolchain: nightly, os: ubuntu-latest, experimental: true, flags: ""}
|
|
||||||
fail-fast: false
|
fail-fast: false
|
||||||
steps:
|
steps:
|
||||||
- name: Checkout
|
- name: Checkout
|
||||||
@ -86,6 +87,7 @@ jobs:
|
|||||||
with:
|
with:
|
||||||
command: test
|
command: test
|
||||||
args: ${{matrix.flags}}
|
args: ${{matrix.flags}}
|
||||||
|
|
||||||
# no-std builds are a bit more extensive to test
|
# no-std builds are a bit more extensive to test
|
||||||
no_std_build:
|
no_std_build:
|
||||||
name: NoStdBuild
|
name: NoStdBuild
|
||||||
@ -110,6 +112,41 @@ jobs:
|
|||||||
with:
|
with:
|
||||||
command: build
|
command: build
|
||||||
args: --manifest-path=no_std/no_std_test/Cargo.toml ${{matrix.flags}}
|
args: --manifest-path=no_std/no_std_test/Cargo.toml ${{matrix.flags}}
|
||||||
|
|
||||||
|
wasm:
|
||||||
|
name: Check Wasm build
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
strategy:
|
||||||
|
matrix:
|
||||||
|
flags:
|
||||||
|
- "--target wasm32-wasi"
|
||||||
|
# These fail currently, future PR should fix them
|
||||||
|
# - "--target wasm32-unknown-unknown"
|
||||||
|
# - "--target wasm32-unknown-unknown --features wasm-bindgen"
|
||||||
|
- "--target wasm32-unknown-unknown --no-default-features"
|
||||||
|
- "--target wasm32-unknown-unknown --no-default-features --features wasm-bindgen"
|
||||||
|
fail-fast: false
|
||||||
|
steps:
|
||||||
|
- name: Checkout
|
||||||
|
uses: actions/checkout@v2
|
||||||
|
- name: Setup Generic Wasm Toolchain
|
||||||
|
uses: actions-rs/toolchain@v1
|
||||||
|
with:
|
||||||
|
toolchain: stable
|
||||||
|
override: true
|
||||||
|
target: wasm32-unknown-unknown
|
||||||
|
- name: Setup Wasi Toolchain
|
||||||
|
uses: actions-rs/toolchain@v1
|
||||||
|
with:
|
||||||
|
toolchain: stable
|
||||||
|
override: true
|
||||||
|
target: wasm32-wasi
|
||||||
|
- name: Build
|
||||||
|
uses: actions-rs/cargo@v1
|
||||||
|
with:
|
||||||
|
command: build
|
||||||
|
args: ${{matrix.flags}}
|
||||||
|
|
||||||
rustfmt:
|
rustfmt:
|
||||||
name: Check Formatting
|
name: Check Formatting
|
||||||
runs-on: windows-latest
|
runs-on: windows-latest
|
||||||
@ -133,6 +170,7 @@ jobs:
|
|||||||
with:
|
with:
|
||||||
command: clippy
|
command: clippy
|
||||||
args: --all -- -Aclippy::all -Dclippy::perf
|
args: --all -- -Aclippy::all -Dclippy::perf
|
||||||
|
|
||||||
codegen_build:
|
codegen_build:
|
||||||
name: Codegen Build
|
name: Codegen Build
|
||||||
runs-on: ${{matrix.os}}
|
runs-on: ${{matrix.os}}
|
||||||
|
3
.gitignore
vendored
3
.gitignore
vendored
@ -8,3 +8,6 @@ Rhai.toml
|
|||||||
**/*.bat
|
**/*.bat
|
||||||
doc/rhai-sync.json
|
doc/rhai-sync.json
|
||||||
doc/rhai.json
|
doc/rhai.json
|
||||||
|
.idea/
|
||||||
|
.idea
|
||||||
|
.idea/*
|
||||||
|
75
CHANGELOG.md
75
CHANGELOG.md
@ -1,6 +1,79 @@
|
|||||||
Rhai Release Notes
|
Rhai Release Notes
|
||||||
==================
|
==================
|
||||||
|
|
||||||
|
Version 1.11.0
|
||||||
|
==============
|
||||||
|
|
||||||
|
Speed Improvements
|
||||||
|
------------------
|
||||||
|
|
||||||
|
* Due to a code refactor, built-in operators for standard types now run even faster, in certain cases by 20-30%.
|
||||||
|
|
||||||
|
Bug fixes
|
||||||
|
---------
|
||||||
|
|
||||||
|
* `Engine::parse_json` now returns an error on unquoted keys to be consistent with JSON specifications.
|
||||||
|
* `import` statements inside `eval` no longer cause errors in subsequent code.
|
||||||
|
* Functions marked `global` in `import`ed modules with no alias names now work properly.
|
||||||
|
* Incorrect loop optimizations that are too aggressive (e.g. unrolling a `do { ... } until true` with a `break` statement inside) and cause crashes are removed.
|
||||||
|
|
||||||
|
Breaking changes
|
||||||
|
----------------
|
||||||
|
|
||||||
|
* `NativeCallContext::new` is completely deprecated and unimplemented (always panics) in favor of new API's.
|
||||||
|
|
||||||
|
New features
|
||||||
|
------------
|
||||||
|
|
||||||
|
### Loop expressions
|
||||||
|
|
||||||
|
* Loops (such as `loop`, `do`, `while` and `for`) can now act as _expressions_, with the `break` statement returning an optional value.
|
||||||
|
* Normal loops return `()` as the value.
|
||||||
|
* Loop expressions can be enabled/disabled via `Engine::set_allow_loop_expressions`
|
||||||
|
|
||||||
|
### Static hashing
|
||||||
|
|
||||||
|
* It is now possible to specify a fixed _seed_ for use with the `ahash` hasher, via a static function `rhai::config::hashing::set_ahash_seed` or an environment variable, in order to force static (i.e. deterministic) hashes for function signatures.
|
||||||
|
* This is necessary when using Rhai across shared-library boundaries.
|
||||||
|
* A build script is used to extract the environment variable (`RHAI_AHASH_SEED`, if any) and splice it into the source code before compilation.
|
||||||
|
|
||||||
|
### No Timestamps
|
||||||
|
|
||||||
|
* A new feature, `no_time`, is added to disable support timestamps.
|
||||||
|
* This may be necessary when building for architectures without time support, such as raw WASM.
|
||||||
|
|
||||||
|
### Serializable `Scope`
|
||||||
|
|
||||||
|
* `Scope` is now serializable and deserializable via `serde`.
|
||||||
|
|
||||||
|
### Store and recreate `NativeCallContext`
|
||||||
|
|
||||||
|
* A convenient API is added to store a `NativeCallContext` into a new `NativeCallContextStore` type.
|
||||||
|
* This allows a `NativeCallContext` to be stored and recreated later on.
|
||||||
|
|
||||||
|
### Call native Rust functions in `NativeCallContext`
|
||||||
|
|
||||||
|
* `NativeCallContext::call_native_fn` is added to call registered native Rust functions only.
|
||||||
|
* `NativeCallContext::call_native_fn_raw` is added as the advanced version.
|
||||||
|
* This is often desirable as Rust functions typically do not want a similar-named scripted function to hijack the process -- which will cause brittleness.
|
||||||
|
|
||||||
|
### Custom syntax improvements
|
||||||
|
|
||||||
|
* The look-ahead symbol for custom syntax now renders a string literal in quotes (instead of the generic term `string`).
|
||||||
|
* This facilitates more accurate parsing by separating strings and identifiers.
|
||||||
|
|
||||||
|
### Limits API
|
||||||
|
|
||||||
|
* Methods returning maximum limits (e.g. `Engine::max_string_len`) are now available even under `unchecked`.
|
||||||
|
* This helps avoid the proliferation of unnecessary feature flags in third-party library code.
|
||||||
|
|
||||||
|
Enhancements
|
||||||
|
------------
|
||||||
|
|
||||||
|
* `parse_json` function is added to parse a JSON string into an object map.
|
||||||
|
* `Error::ErrorNonPureMethodCallOnConstant` is added which is raised when a non-pure method is called on a constant value.
|
||||||
|
|
||||||
|
|
||||||
Version 1.10.1
|
Version 1.10.1
|
||||||
==============
|
==============
|
||||||
|
|
||||||
@ -8,7 +81,7 @@ Bug fixes
|
|||||||
---------
|
---------
|
||||||
|
|
||||||
* Compiling on 32-bit architectures no longer cause a compilation error.
|
* Compiling on 32-bit architectures no longer cause a compilation error.
|
||||||
* Fix type-size test fo 32-bit architectures without the `decimal` feature.
|
* Fix type-size test for 32-bit architectures without the `decimal` feature.
|
||||||
|
|
||||||
Custom syntax with state
|
Custom syntax with state
|
||||||
------------------------
|
------------------------
|
||||||
|
18
Cargo.toml
18
Cargo.toml
@ -3,7 +3,7 @@ members = [".", "codegen"]
|
|||||||
|
|
||||||
[package]
|
[package]
|
||||||
name = "rhai"
|
name = "rhai"
|
||||||
version = "1.10.1"
|
version = "1.11.0"
|
||||||
rust-version = "1.61.0"
|
rust-version = "1.61.0"
|
||||||
edition = "2018"
|
edition = "2018"
|
||||||
resolver = "2"
|
resolver = "2"
|
||||||
@ -19,7 +19,8 @@ categories = ["no-std", "embedded", "wasm", "parser-implementations"]
|
|||||||
|
|
||||||
[dependencies]
|
[dependencies]
|
||||||
smallvec = { version = "1.7", default-features = false, features = ["union", "const_new", "const_generics"] }
|
smallvec = { version = "1.7", default-features = false, features = ["union", "const_new", "const_generics"] }
|
||||||
ahash = { version = "0.8", default-features = false }
|
# 0.8.1 pulls in `getrandom/js` which breaks no-std
|
||||||
|
ahash = { version = "=0.8.0", default-features = false, features = ["compile-time-rng"] }
|
||||||
num-traits = { version = "0.2", default-features = false }
|
num-traits = { version = "0.2", default-features = false }
|
||||||
bitflags = { version = "1", default-features = false }
|
bitflags = { version = "1", default-features = false }
|
||||||
smartstring = { version = "1", default-features = false }
|
smartstring = { version = "1", default-features = false }
|
||||||
@ -33,6 +34,7 @@ serde = { version = "1.0", default-features = false, features = ["derive", "allo
|
|||||||
serde_json = { version = "1.0", default-features = false, features = ["alloc"], optional = true }
|
serde_json = { version = "1.0", default-features = false, features = ["alloc"], optional = true }
|
||||||
unicode-xid = { version = "0.2", default-features = false, optional = true }
|
unicode-xid = { version = "0.2", default-features = false, optional = true }
|
||||||
rust_decimal = { version = "1.16", default-features = false, features = ["maths"], optional = true }
|
rust_decimal = { version = "1.16", default-features = false, features = ["maths"], optional = true }
|
||||||
|
getrandom = { version = "0.2", optional = true }
|
||||||
rustyline = { version = "10", optional = true }
|
rustyline = { version = "10", optional = true }
|
||||||
|
|
||||||
[dev-dependencies]
|
[dev-dependencies]
|
||||||
@ -40,9 +42,8 @@ serde_bytes = "0.11"
|
|||||||
serde_json = { version = "1.0", default-features = false, features = ["alloc"] }
|
serde_json = { version = "1.0", default-features = false, features = ["alloc"] }
|
||||||
|
|
||||||
[features]
|
[features]
|
||||||
default = ["std"]
|
default = ["std", "ahash/runtime-rng"] # ahash/runtime-rng trumps ahash/compile-time-rng
|
||||||
std = ["ahash/std", "ahash/runtime-rng", "num-traits/std", "smartstring/std"]
|
std = ["ahash/std", "num-traits/std", "smartstring/std"]
|
||||||
base_std = ["ahash/std", "num-traits/std", "smartstring/std"] # Prevent ahash random seed, enabling dynamic libraries to be used.
|
|
||||||
unchecked = [] # unchecked arithmetic
|
unchecked = [] # unchecked arithmetic
|
||||||
sync = [] # restrict to only types that implement Send + Sync
|
sync = [] # restrict to only types that implement Send + Sync
|
||||||
no_position = [] # do not track position in the parser
|
no_position = [] # do not track position in the parser
|
||||||
@ -54,6 +55,7 @@ only_i64 = [] # set INT=i64 (default) and disable support for
|
|||||||
decimal = ["rust_decimal"] # add the Decimal number type
|
decimal = ["rust_decimal"] # add the Decimal number type
|
||||||
no_index = [] # no arrays and indexing
|
no_index = [] # no arrays and indexing
|
||||||
no_object = [] # no custom objects
|
no_object = [] # no custom objects
|
||||||
|
no_time = [] # no timestamps
|
||||||
no_function = ["no_closure"] # no script-defined functions (meaning no closures)
|
no_function = ["no_closure"] # no script-defined functions (meaning no closures)
|
||||||
no_closure = [] # no automatic sharing and capture of anonymous functions to external variables
|
no_closure = [] # no automatic sharing and capture of anonymous functions to external variables
|
||||||
no_module = [] # no modules
|
no_module = [] # no modules
|
||||||
@ -65,11 +67,11 @@ debugging = ["internals"] # enable debugging
|
|||||||
serde = ["dep:serde", "smartstring/serde", "smallvec/serde"] # implement serde for rhai types
|
serde = ["dep:serde", "smartstring/serde", "smallvec/serde"] # implement serde for rhai types
|
||||||
|
|
||||||
# compiling for no-std
|
# compiling for no-std
|
||||||
no_std = ["no-std-compat", "num-traits/libm", "core-error", "libm", "ahash/compile-time-rng", "hashbrown/ahash-compile-time-rng"]
|
no_std = ["no-std-compat", "num-traits/libm", "core-error", "libm", "hashbrown", "no_time"]
|
||||||
|
|
||||||
# compiling for WASM
|
# compiling for WASM
|
||||||
wasm-bindgen = ["instant/wasm-bindgen"]
|
wasm-bindgen = ["getrandom/js", "instant/wasm-bindgen"]
|
||||||
stdweb = ["instant/stdweb"]
|
stdweb = ["getrandom/js", "instant/stdweb"]
|
||||||
|
|
||||||
# compiling bin tools
|
# compiling bin tools
|
||||||
bin-features = ["decimal", "metadata", "serde", "debugging", "rustyline"]
|
bin-features = ["decimal", "metadata", "serde", "debugging", "rustyline"]
|
||||||
|
26
build.rs
Normal file
26
build.rs
Normal file
@ -0,0 +1,26 @@
|
|||||||
|
use std::{
|
||||||
|
env,
|
||||||
|
fs::File,
|
||||||
|
io::{Read, Write},
|
||||||
|
};
|
||||||
|
|
||||||
|
fn main() {
|
||||||
|
// Tell Cargo that if the given environment variable changes, to rerun this build script.
|
||||||
|
println!("cargo:rerun-if-changed=build.template");
|
||||||
|
println!("cargo:rerun-if-env-changed=RHAI_AHASH_SEED");
|
||||||
|
let mut contents = String::new();
|
||||||
|
|
||||||
|
File::open("build.template")
|
||||||
|
.expect("cannot open `build.template`")
|
||||||
|
.read_to_string(&mut contents)
|
||||||
|
.expect("cannot read from `build.template`");
|
||||||
|
|
||||||
|
let seed = env::var("RHAI_AHASH_SEED").map_or_else(|_| "None".into(), |s| format!("Some({s})"));
|
||||||
|
|
||||||
|
contents = contents.replace("{{AHASH_SEED}}", &seed);
|
||||||
|
|
||||||
|
File::create("src/config/hashing_env.rs")
|
||||||
|
.expect("cannot create `config.rs`")
|
||||||
|
.write_all(contents.as_bytes())
|
||||||
|
.expect("cannot write to `config/hashing_env.rs`");
|
||||||
|
}
|
3
build.template
Normal file
3
build.template
Normal file
@ -0,0 +1,3 @@
|
|||||||
|
//! This file is automatically recreated during build time by `build.rs` from `build.template`.
|
||||||
|
|
||||||
|
pub(crate) const AHASH_SEED: Option<[u64; 4]> = {{AHASH_SEED}};
|
@ -1,6 +1,6 @@
|
|||||||
[package]
|
[package]
|
||||||
name = "rhai_codegen"
|
name = "rhai_codegen"
|
||||||
version = "1.4.2"
|
version = "1.4.3"
|
||||||
edition = "2018"
|
edition = "2018"
|
||||||
resolver = "2"
|
resolver = "2"
|
||||||
authors = ["jhwgh1968", "Stephen Chung"]
|
authors = ["jhwgh1968", "Stephen Chung"]
|
||||||
@ -22,5 +22,5 @@ syn = { version = "1.0", features = ["full", "parsing", "printing", "proc-macro"
|
|||||||
quote = "1"
|
quote = "1"
|
||||||
|
|
||||||
[dev-dependencies]
|
[dev-dependencies]
|
||||||
rhai = { path = "..", version = "1.6", features = ["metadata"] }
|
rhai = { path = "..", version = "1.11", features = ["metadata"] }
|
||||||
trybuild = "1"
|
trybuild = "1"
|
||||||
|
@ -673,6 +673,7 @@ impl ExportedFn {
|
|||||||
let sig_name = self.name().clone();
|
let sig_name = self.name().clone();
|
||||||
let arg_count = self.arg_count();
|
let arg_count = self.arg_count();
|
||||||
let is_method_call = self.mutable_receiver();
|
let is_method_call = self.mutable_receiver();
|
||||||
|
let is_pure = !self.mutable_receiver() || self.params().pure.is_some();
|
||||||
|
|
||||||
let mut unpack_statements = Vec::new();
|
let mut unpack_statements = Vec::new();
|
||||||
let mut unpack_exprs = Vec::new();
|
let mut unpack_exprs = Vec::new();
|
||||||
@ -713,18 +714,6 @@ impl ExportedFn {
|
|||||||
})
|
})
|
||||||
.unwrap(),
|
.unwrap(),
|
||||||
);
|
);
|
||||||
if self.params().pure.is_none() {
|
|
||||||
let arg_lit_str =
|
|
||||||
syn::LitStr::new(&pat.to_token_stream().to_string(), pat.span());
|
|
||||||
unpack_statements.push(
|
|
||||||
syn::parse2::<syn::Stmt>(quote! {
|
|
||||||
if args[0usize].is_read_only() {
|
|
||||||
return Err(EvalAltResult::ErrorAssignmentToConstant(#arg_lit_str.to_string(), Position::NONE).into());
|
|
||||||
}
|
|
||||||
})
|
|
||||||
.unwrap(),
|
|
||||||
);
|
|
||||||
}
|
|
||||||
#[cfg(feature = "metadata")]
|
#[cfg(feature = "metadata")]
|
||||||
input_type_names.push(arg_name);
|
input_type_names.push(arg_name);
|
||||||
input_type_exprs.push(
|
input_type_exprs.push(
|
||||||
@ -877,6 +866,7 @@ impl ExportedFn {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { #is_method_call }
|
#[inline(always)] fn is_method_call(&self) -> bool { #is_method_call }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { #is_pure }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -285,6 +285,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
#[allow(unused)]
|
#[allow(unused)]
|
||||||
#[doc(hidden)]
|
#[doc(hidden)]
|
||||||
@ -323,6 +324,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
#[allow(unused)]
|
#[allow(unused)]
|
||||||
#[doc(hidden)]
|
#[doc(hidden)]
|
||||||
@ -361,6 +363,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
#[allow(unused)]
|
#[allow(unused)]
|
||||||
#[doc(hidden)]
|
#[doc(hidden)]
|
||||||
@ -401,6 +404,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
#[allow(unused)]
|
#[allow(unused)]
|
||||||
#[doc(hidden)]
|
#[doc(hidden)]
|
||||||
@ -434,6 +438,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
@ -467,6 +472,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
#[allow(unused)]
|
#[allow(unused)]
|
||||||
#[doc(hidden)]
|
#[doc(hidden)]
|
||||||
@ -500,15 +506,13 @@ mod generate_tests {
|
|||||||
impl PluginFunction for Token {
|
impl PluginFunction for Token {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
||||||
if args[0usize].is_read_only() {
|
|
||||||
return Err(EvalAltResult::ErrorAssignmentToConstant("x".to_string(), Position::NONE).into());
|
|
||||||
}
|
|
||||||
let arg1 = mem::take(args[1usize]).cast::<usize>();
|
let arg1 = mem::take(args[1usize]).cast::<usize>();
|
||||||
let arg0 = &mut args[0usize].write_lock::<usize>().unwrap();
|
let arg0 = &mut args[0usize].write_lock::<usize>().unwrap();
|
||||||
Ok(Dynamic::from(increment(arg0, arg1)))
|
Ok(Dynamic::from(increment(arg0, arg1)))
|
||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { false }
|
||||||
}
|
}
|
||||||
#[allow(unused)]
|
#[allow(unused)]
|
||||||
#[doc(hidden)]
|
#[doc(hidden)]
|
||||||
@ -548,6 +552,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
#[allow(unused)]
|
#[allow(unused)]
|
||||||
#[doc(hidden)]
|
#[doc(hidden)]
|
||||||
|
@ -390,6 +390,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -467,6 +468,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -525,6 +527,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -582,6 +585,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -653,6 +657,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
|
|
||||||
#[allow(non_camel_case_types)]
|
#[allow(non_camel_case_types)]
|
||||||
@ -672,6 +677,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -730,6 +736,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -795,6 +802,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -864,14 +872,12 @@ mod generate_tests {
|
|||||||
impl PluginFunction for get_mystic_number_token {
|
impl PluginFunction for get_mystic_number_token {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
||||||
if args[0usize].is_read_only() {
|
|
||||||
return Err(EvalAltResult::ErrorAssignmentToConstant("x".to_string(), Position::NONE).into());
|
|
||||||
}
|
|
||||||
let arg0 = &mut args[0usize].write_lock::<Hello>().unwrap();
|
let arg0 = &mut args[0usize].write_lock::<Hello>().unwrap();
|
||||||
Ok(Dynamic::from(get_mystic_number(arg0)))
|
Ok(Dynamic::from(get_mystic_number(arg0)))
|
||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { false }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -1080,6 +1086,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -1170,6 +1177,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -1227,6 +1235,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
#[inline(always)] fn is_method_call(&self) -> bool { false }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -1286,6 +1295,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { true }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -1338,14 +1348,12 @@ mod generate_tests {
|
|||||||
impl PluginFunction for increment_token {
|
impl PluginFunction for increment_token {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
||||||
if args[0usize].is_read_only() {
|
|
||||||
return Err(EvalAltResult::ErrorAssignmentToConstant("x".to_string(), Position::NONE).into());
|
|
||||||
}
|
|
||||||
let arg0 = &mut args[0usize].write_lock::<FLOAT>().unwrap();
|
let arg0 = &mut args[0usize].write_lock::<FLOAT>().unwrap();
|
||||||
Ok(Dynamic::from(increment(arg0)))
|
Ok(Dynamic::from(increment(arg0)))
|
||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { false }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -1401,14 +1409,12 @@ mod generate_tests {
|
|||||||
impl PluginFunction for increment_token {
|
impl PluginFunction for increment_token {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
||||||
if args[0usize].is_read_only() {
|
|
||||||
return Err(EvalAltResult::ErrorAssignmentToConstant("x".to_string(), Position::NONE).into());
|
|
||||||
}
|
|
||||||
let arg0 = &mut args[0usize].write_lock::<FLOAT>().unwrap();
|
let arg0 = &mut args[0usize].write_lock::<FLOAT>().unwrap();
|
||||||
Ok(Dynamic::from(increment(arg0)))
|
Ok(Dynamic::from(increment(arg0)))
|
||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { false }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
#[allow(unused_imports)]
|
#[allow(unused_imports)]
|
||||||
@ -1487,14 +1493,12 @@ mod generate_tests {
|
|||||||
impl PluginFunction for increment_token {
|
impl PluginFunction for increment_token {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
||||||
if args[0usize].is_read_only() {
|
|
||||||
return Err(EvalAltResult::ErrorAssignmentToConstant("x".to_string(), Position::NONE).into());
|
|
||||||
}
|
|
||||||
let arg0 = &mut args[0usize].write_lock::<FLOAT>().unwrap();
|
let arg0 = &mut args[0usize].write_lock::<FLOAT>().unwrap();
|
||||||
Ok(Dynamic::from(increment(arg0)))
|
Ok(Dynamic::from(increment(arg0)))
|
||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { false }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
#[allow(unused_imports)]
|
#[allow(unused_imports)]
|
||||||
@ -1574,14 +1578,12 @@ mod generate_tests {
|
|||||||
impl PluginFunction for int_foo_token {
|
impl PluginFunction for int_foo_token {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
||||||
if args[0usize].is_read_only() {
|
|
||||||
return Err(EvalAltResult::ErrorAssignmentToConstant("x".to_string(), Position::NONE).into());
|
|
||||||
}
|
|
||||||
let arg0 = &mut args[0usize].write_lock::<u64>().unwrap();
|
let arg0 = &mut args[0usize].write_lock::<u64>().unwrap();
|
||||||
Ok(Dynamic::from(int_foo(arg0)))
|
Ok(Dynamic::from(int_foo(arg0)))
|
||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { false }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -1638,14 +1640,12 @@ mod generate_tests {
|
|||||||
impl PluginFunction for int_foo_token {
|
impl PluginFunction for int_foo_token {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
||||||
if args[0usize].is_read_only() {
|
|
||||||
return Err(EvalAltResult::ErrorAssignmentToConstant("x".to_string(), Position::NONE).into());
|
|
||||||
}
|
|
||||||
let arg0 = &mut args[0usize].write_lock::<u64>().unwrap();
|
let arg0 = &mut args[0usize].write_lock::<u64>().unwrap();
|
||||||
Ok(Dynamic::from(int_foo(arg0)))
|
Ok(Dynamic::from(int_foo(arg0)))
|
||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { false }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -1699,15 +1699,13 @@ mod generate_tests {
|
|||||||
impl PluginFunction for int_foo_token {
|
impl PluginFunction for int_foo_token {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
||||||
if args[0usize].is_read_only() {
|
|
||||||
return Err(EvalAltResult::ErrorAssignmentToConstant("x".to_string(), Position::NONE).into());
|
|
||||||
}
|
|
||||||
let arg1 = mem::take(args[1usize]).cast::<u64>();
|
let arg1 = mem::take(args[1usize]).cast::<u64>();
|
||||||
let arg0 = &mut args[0usize].write_lock::<u64>().unwrap();
|
let arg0 = &mut args[0usize].write_lock::<u64>().unwrap();
|
||||||
Ok(Dynamic::from(int_foo(arg0, arg1)))
|
Ok(Dynamic::from(int_foo(arg0, arg1)))
|
||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { false }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -1764,15 +1762,13 @@ mod generate_tests {
|
|||||||
impl PluginFunction for int_foo_token {
|
impl PluginFunction for int_foo_token {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
||||||
if args[0usize].is_read_only() {
|
|
||||||
return Err(EvalAltResult::ErrorAssignmentToConstant("x".to_string(), Position::NONE).into());
|
|
||||||
}
|
|
||||||
let arg1 = mem::take(args[1usize]).cast::<u64>();
|
let arg1 = mem::take(args[1usize]).cast::<u64>();
|
||||||
let arg0 = &mut args[0usize].write_lock::<u64>().unwrap();
|
let arg0 = &mut args[0usize].write_lock::<u64>().unwrap();
|
||||||
Ok(Dynamic::from(int_foo(arg0, arg1)))
|
Ok(Dynamic::from(int_foo(arg0, arg1)))
|
||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { false }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -1826,15 +1822,13 @@ mod generate_tests {
|
|||||||
impl PluginFunction for get_by_index_token {
|
impl PluginFunction for get_by_index_token {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
||||||
if args[0usize].is_read_only() {
|
|
||||||
return Err(EvalAltResult::ErrorAssignmentToConstant("x".to_string(), Position::NONE).into());
|
|
||||||
}
|
|
||||||
let arg1 = mem::take(args[1usize]).cast::<u64>();
|
let arg1 = mem::take(args[1usize]).cast::<u64>();
|
||||||
let arg0 = &mut args[0usize].write_lock::<MyCollection>().unwrap();
|
let arg0 = &mut args[0usize].write_lock::<MyCollection>().unwrap();
|
||||||
Ok(Dynamic::from(get_by_index(arg0, arg1)))
|
Ok(Dynamic::from(get_by_index(arg0, arg1)))
|
||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { false }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -1896,15 +1890,13 @@ mod generate_tests {
|
|||||||
impl PluginFunction for get_by_index_token {
|
impl PluginFunction for get_by_index_token {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
||||||
if args[0usize].is_read_only() {
|
|
||||||
return Err(EvalAltResult::ErrorAssignmentToConstant("x".to_string(), Position::NONE).into());
|
|
||||||
}
|
|
||||||
let arg1 = mem::take(args[1usize]).cast::<u64>();
|
let arg1 = mem::take(args[1usize]).cast::<u64>();
|
||||||
let arg0 = &mut args[0usize].write_lock::<MyCollection>().unwrap();
|
let arg0 = &mut args[0usize].write_lock::<MyCollection>().unwrap();
|
||||||
Ok(Dynamic::from(get_by_index(arg0, arg1)))
|
Ok(Dynamic::from(get_by_index(arg0, arg1)))
|
||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { false }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -1961,15 +1953,13 @@ mod generate_tests {
|
|||||||
impl PluginFunction for get_by_index_token {
|
impl PluginFunction for get_by_index_token {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
||||||
if args[0usize].is_read_only() {
|
|
||||||
return Err(EvalAltResult::ErrorAssignmentToConstant("x".to_string(), Position::NONE).into());
|
|
||||||
}
|
|
||||||
let arg1 = mem::take(args[1usize]).cast::<u64>();
|
let arg1 = mem::take(args[1usize]).cast::<u64>();
|
||||||
let arg0 = &mut args[0usize].write_lock::<MyCollection>().unwrap();
|
let arg0 = &mut args[0usize].write_lock::<MyCollection>().unwrap();
|
||||||
Ok(Dynamic::from(get_by_index(arg0, arg1)))
|
Ok(Dynamic::from(get_by_index(arg0, arg1)))
|
||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { false }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -2023,9 +2013,6 @@ mod generate_tests {
|
|||||||
impl PluginFunction for set_by_index_token {
|
impl PluginFunction for set_by_index_token {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
||||||
if args[0usize].is_read_only() {
|
|
||||||
return Err(EvalAltResult::ErrorAssignmentToConstant("x".to_string(), Position::NONE).into());
|
|
||||||
}
|
|
||||||
let arg1 = mem::take(args[1usize]).cast::<u64>();
|
let arg1 = mem::take(args[1usize]).cast::<u64>();
|
||||||
let arg2 = mem::take(args[2usize]).cast::<FLOAT>();
|
let arg2 = mem::take(args[2usize]).cast::<FLOAT>();
|
||||||
let arg0 = &mut args[0usize].write_lock::<MyCollection>().unwrap();
|
let arg0 = &mut args[0usize].write_lock::<MyCollection>().unwrap();
|
||||||
@ -2033,6 +2020,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { false }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
@ -2089,9 +2077,6 @@ mod generate_tests {
|
|||||||
impl PluginFunction for set_by_index_token {
|
impl PluginFunction for set_by_index_token {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
fn call(&self, context: NativeCallContext, args: &mut [&mut Dynamic]) -> RhaiResult {
|
||||||
if args[0usize].is_read_only() {
|
|
||||||
return Err(EvalAltResult::ErrorAssignmentToConstant("x".to_string(), Position::NONE).into());
|
|
||||||
}
|
|
||||||
let arg1 = mem::take(args[1usize]).cast::<u64>();
|
let arg1 = mem::take(args[1usize]).cast::<u64>();
|
||||||
let arg2 = mem::take(args[2usize]).cast::<FLOAT>();
|
let arg2 = mem::take(args[2usize]).cast::<FLOAT>();
|
||||||
let arg0 = &mut args[0usize].write_lock::<MyCollection>().unwrap();
|
let arg0 = &mut args[0usize].write_lock::<MyCollection>().unwrap();
|
||||||
@ -2099,6 +2084,7 @@ mod generate_tests {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
#[inline(always)] fn is_method_call(&self) -> bool { true }
|
||||||
|
#[inline(always)] fn is_pure(&self) -> bool { false }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
@ -38,7 +38,7 @@ fn main() -> Result<(), Box<EvalAltResult>> {
|
|||||||
engine
|
engine
|
||||||
.gen_fn_signatures(false)
|
.gen_fn_signatures(false)
|
||||||
.into_iter()
|
.into_iter()
|
||||||
.for_each(|func| println!("{}", func));
|
.for_each(|func| println!("{func}"));
|
||||||
|
|
||||||
println!();
|
println!();
|
||||||
}
|
}
|
||||||
@ -51,7 +51,7 @@ fn main() -> Result<(), Box<EvalAltResult>> {
|
|||||||
",
|
",
|
||||||
)?;
|
)?;
|
||||||
|
|
||||||
println!("{:?}", result);
|
println!("{result:?}");
|
||||||
|
|
||||||
let result = engine.eval::<TestStruct>(
|
let result = engine.eval::<TestStruct>(
|
||||||
"
|
"
|
||||||
@ -61,7 +61,7 @@ fn main() -> Result<(), Box<EvalAltResult>> {
|
|||||||
",
|
",
|
||||||
)?;
|
)?;
|
||||||
|
|
||||||
println!("{:?}", result);
|
println!("{result:?}");
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
@ -36,7 +36,7 @@ fn main() -> Result<(), Box<EvalAltResult>> {
|
|||||||
let r2 = func(1, 2);
|
let r2 = func(1, 2);
|
||||||
let r3 = func(1, 2);
|
let r3 = func(1, 2);
|
||||||
|
|
||||||
println!("The Answers: {}, {}, {}", r1, r2, r3); // prints 40, 42, 44
|
println!("The Answers: {r1}, {r2}, {r3}"); // prints 40, 42, 44
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
@ -36,6 +36,8 @@ fn main() -> Result<(), Box<EvalAltResult>> {
|
|||||||
type Item = i64;
|
type Item = i64;
|
||||||
type IntoIter = std::vec::IntoIter<Self::Item>;
|
type IntoIter = std::vec::IntoIter<Self::Item>;
|
||||||
|
|
||||||
|
#[inline]
|
||||||
|
#[must_use]
|
||||||
fn into_iter(self) -> Self::IntoIter {
|
fn into_iter(self) -> Self::IntoIter {
|
||||||
vec![self.x - 1, self.x, self.x + 1].into_iter()
|
vec![self.x - 1, self.x, self.x + 1].into_iter()
|
||||||
}
|
}
|
||||||
@ -65,7 +67,7 @@ fn main() -> Result<(), Box<EvalAltResult>> {
|
|||||||
engine
|
engine
|
||||||
.gen_fn_signatures(false)
|
.gen_fn_signatures(false)
|
||||||
.into_iter()
|
.into_iter()
|
||||||
.for_each(|func| println!("{}", func));
|
.for_each(|func| println!("{func}"));
|
||||||
|
|
||||||
println!();
|
println!();
|
||||||
}
|
}
|
||||||
@ -87,7 +89,7 @@ fn main() -> Result<(), Box<EvalAltResult>> {
|
|||||||
",
|
",
|
||||||
)?;
|
)?;
|
||||||
|
|
||||||
println!("result: {}", result); // prints 1085764
|
println!("result: {result}"); // prints 1085764
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
@ -48,7 +48,7 @@ fn main() -> Result<(), Box<EvalAltResult>> {
|
|||||||
engine
|
engine
|
||||||
.gen_fn_signatures(false)
|
.gen_fn_signatures(false)
|
||||||
.into_iter()
|
.into_iter()
|
||||||
.for_each(|func| println!("{}", func));
|
.for_each(|func| println!("{func}"));
|
||||||
|
|
||||||
println!();
|
println!();
|
||||||
}
|
}
|
||||||
@ -62,7 +62,7 @@ fn main() -> Result<(), Box<EvalAltResult>> {
|
|||||||
",
|
",
|
||||||
)?;
|
)?;
|
||||||
|
|
||||||
println!("result: {}", result); // prints 1085764
|
println!("result: {result}"); // prints 1085764
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
@ -677,8 +677,6 @@ op **(u64, int) -> u64;
|
|||||||
|
|
||||||
op **(u8, int) -> u8;
|
op **(u8, int) -> u8;
|
||||||
|
|
||||||
op +(Decimal) -> Decimal;
|
|
||||||
|
|
||||||
op +(int) -> int;
|
op +(int) -> int;
|
||||||
|
|
||||||
op +(f32) -> f32;
|
op +(f32) -> f32;
|
||||||
@ -801,8 +799,6 @@ op +=(Instant, float) -> ();
|
|||||||
/// Add the specified number of `seconds` to the timestamp.
|
/// Add the specified number of `seconds` to the timestamp.
|
||||||
op +=(Instant, int) -> ();
|
op +=(Instant, int) -> ();
|
||||||
|
|
||||||
op -(Decimal) -> Decimal;
|
|
||||||
|
|
||||||
op -(int) -> int;
|
op -(int) -> int;
|
||||||
|
|
||||||
op -(f32) -> f32;
|
op -(f32) -> f32;
|
||||||
@ -1131,9 +1127,6 @@ op ^(u64, u64) -> u64;
|
|||||||
|
|
||||||
op ^(u8, u8) -> u8;
|
op ^(u8, u8) -> u8;
|
||||||
|
|
||||||
/// Return the absolute value of the decimal number.
|
|
||||||
fn abs(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the absolute value of the number.
|
/// Return the absolute value of the number.
|
||||||
fn abs(x: int) -> int;
|
fn abs(x: int) -> int;
|
||||||
|
|
||||||
@ -1306,13 +1299,6 @@ fn atan(x: float, y: float) -> float;
|
|||||||
/// Return the arc-hyperbolic-tangent of the floating-point number, in radians.
|
/// Return the arc-hyperbolic-tangent of the floating-point number, in radians.
|
||||||
fn atanh(x: float) -> float;
|
fn atanh(x: float) -> float;
|
||||||
|
|
||||||
/// Get an array of object maps containing the function calls stack.
|
|
||||||
///
|
|
||||||
/// If there is no debugging interface registered, an empty array is returned.
|
|
||||||
///
|
|
||||||
/// An array of strings is returned under `no_object`.
|
|
||||||
fn back_trace() -> Array;
|
|
||||||
|
|
||||||
/// Return an iterator over all the bits in the number.
|
/// Return an iterator over all the bits in the number.
|
||||||
///
|
///
|
||||||
/// # Example
|
/// # Example
|
||||||
@ -1426,9 +1412,6 @@ fn blob(len: int, value: int) -> Blob;
|
|||||||
/// ```
|
/// ```
|
||||||
fn bytes(string: String) -> int;
|
fn bytes(string: String) -> int;
|
||||||
|
|
||||||
/// Return the smallest whole number larger than or equals to the decimal number.
|
|
||||||
fn ceiling(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the smallest whole number larger than or equals to the floating-point number.
|
/// Return the smallest whole number larger than or equals to the floating-point number.
|
||||||
fn ceiling(x: float) -> float;
|
fn ceiling(x: float) -> float;
|
||||||
|
|
||||||
@ -1570,8 +1553,63 @@ fn clear(string: String) -> ();
|
|||||||
/// ```
|
/// ```
|
||||||
fn contains(array: Array, value: ?) -> bool;
|
fn contains(array: Array, value: ?) -> bool;
|
||||||
|
|
||||||
/// Return the cosine of the decimal number in radians.
|
/// Return `true` if the BLOB contains a specified byte value.
|
||||||
fn cos(x: Decimal) -> Decimal;
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rhai
|
||||||
|
/// let text = "hello, world!";
|
||||||
|
///
|
||||||
|
/// print(text.contains('h')); // prints true
|
||||||
|
///
|
||||||
|
/// print(text.contains('x')); // prints false
|
||||||
|
/// ```
|
||||||
|
fn contains(blob: Blob, value: int) -> bool;
|
||||||
|
|
||||||
|
/// Returns `true` if the object map contains a specified property.
|
||||||
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rhai
|
||||||
|
/// let m = #{a: 1, b: 2, c: 3};
|
||||||
|
///
|
||||||
|
/// print(m.contains("b")); // prints true
|
||||||
|
///
|
||||||
|
/// print(m.contains("x")); // prints false
|
||||||
|
/// ```
|
||||||
|
fn contains(map: Map, property: String) -> bool;
|
||||||
|
|
||||||
|
/// Return `true` if the range contains a specified value.
|
||||||
|
fn contains(range: ExclusiveRange, value: int) -> bool;
|
||||||
|
|
||||||
|
/// Return `true` if the range contains a specified value.
|
||||||
|
fn contains(range: InclusiveRange, value: int) -> bool;
|
||||||
|
|
||||||
|
/// Return `true` if the string contains a specified character.
|
||||||
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rhai
|
||||||
|
/// let text = "hello, world!";
|
||||||
|
///
|
||||||
|
/// print(text.contains('h')); // prints true
|
||||||
|
///
|
||||||
|
/// print(text.contains('x')); // prints false
|
||||||
|
/// ```
|
||||||
|
fn contains(string: String, character: char) -> bool;
|
||||||
|
|
||||||
|
/// Return `true` if the string contains a specified string.
|
||||||
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rhai
|
||||||
|
/// let text = "hello, world!";
|
||||||
|
///
|
||||||
|
/// print(text.contains("hello")); // prints true
|
||||||
|
///
|
||||||
|
/// print(text.contains("hey")); // prints false
|
||||||
|
/// ```
|
||||||
|
fn contains(string: String, match_string: String) -> bool;
|
||||||
|
|
||||||
/// Return the cosine of the floating-point number in radians.
|
/// Return the cosine of the floating-point number in radians.
|
||||||
fn cos(x: float) -> float;
|
fn cos(x: float) -> float;
|
||||||
@ -1650,37 +1688,37 @@ fn crop(string: String, start: int) -> ();
|
|||||||
fn crop(string: String, start: int, len: int) -> ();
|
fn crop(string: String, start: int, len: int) -> ();
|
||||||
|
|
||||||
/// Return the empty string.
|
/// Return the empty string.
|
||||||
fn debug() -> String;
|
op debug() -> String;
|
||||||
|
|
||||||
/// Convert the array into a string.
|
/// Convert the array into a string.
|
||||||
fn debug(array: Array) -> String;
|
op debug(Array) -> String;
|
||||||
|
|
||||||
/// Convert the string into debug format.
|
/// Convert the string into debug format.
|
||||||
fn debug(character: char) -> String;
|
op debug(char) -> String;
|
||||||
|
|
||||||
/// Convert the function pointer into a string in debug format.
|
/// Convert the function pointer into a string in debug format.
|
||||||
fn debug(f: FnPtr) -> String;
|
op debug(FnPtr) -> String;
|
||||||
|
|
||||||
/// Convert the value of the `item` into a string in debug format.
|
/// Convert the value of the `item` into a string in debug format.
|
||||||
fn debug(item: ?) -> String;
|
op debug(?) -> String;
|
||||||
|
|
||||||
/// Convert the object map into a string.
|
/// Convert the object map into a string.
|
||||||
fn debug(map: Map) -> String;
|
op debug(Map) -> String;
|
||||||
|
|
||||||
/// Convert the value of `number` into a string.
|
/// Convert the value of `number` into a string.
|
||||||
fn debug(number: f32) -> String;
|
op debug(f32) -> String;
|
||||||
|
|
||||||
/// Convert the value of `number` into a string.
|
/// Convert the value of `number` into a string.
|
||||||
fn debug(number: float) -> String;
|
op debug(float) -> String;
|
||||||
|
|
||||||
/// Convert the string into debug format.
|
/// Convert the string into debug format.
|
||||||
fn debug(string: String) -> String;
|
op debug(String) -> String;
|
||||||
|
|
||||||
/// Convert the unit into a string in debug format.
|
/// Convert the unit into a string in debug format.
|
||||||
fn debug(unit: ()) -> String;
|
op debug(()) -> String;
|
||||||
|
|
||||||
/// Convert the boolean value into a string in debug format.
|
/// Convert the boolean value into a string in debug format.
|
||||||
fn debug(value: bool) -> String;
|
op debug(bool) -> String;
|
||||||
|
|
||||||
/// Remove duplicated _consecutive_ elements from the array.
|
/// Remove duplicated _consecutive_ elements from the array.
|
||||||
///
|
///
|
||||||
@ -1986,9 +2024,6 @@ fn end(range: InclusiveRange) -> int;
|
|||||||
/// ```
|
/// ```
|
||||||
fn ends_with(string: String, match_string: String) -> bool;
|
fn ends_with(string: String, match_string: String) -> bool;
|
||||||
|
|
||||||
/// Return the exponential of the decimal number.
|
|
||||||
fn exp(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the exponential of the floating-point number.
|
/// Return the exponential of the floating-point number.
|
||||||
fn exp(x: float) -> float;
|
fn exp(x: float) -> float;
|
||||||
|
|
||||||
@ -2199,15 +2234,9 @@ fn filter(array: Array, filter: FnPtr) -> Array;
|
|||||||
/// ```
|
/// ```
|
||||||
fn filter(array: Array, filter_func: String) -> Array;
|
fn filter(array: Array, filter_func: String) -> Array;
|
||||||
|
|
||||||
/// Return the largest whole number less than or equals to the decimal number.
|
|
||||||
fn floor(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the largest whole number less than or equals to the floating-point number.
|
/// Return the largest whole number less than or equals to the floating-point number.
|
||||||
fn floor(x: float) -> float;
|
fn floor(x: float) -> float;
|
||||||
|
|
||||||
/// Return the fractional part of the decimal number.
|
|
||||||
fn fraction(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the fractional part of the floating-point number.
|
/// Return the fractional part of the floating-point number.
|
||||||
fn fraction(x: float) -> float;
|
fn fraction(x: float) -> float;
|
||||||
|
|
||||||
@ -2309,9 +2338,6 @@ fn get bits(value: int) -> Iterator<bool>;
|
|||||||
/// ```
|
/// ```
|
||||||
fn get bytes(string: String) -> int;
|
fn get bytes(string: String) -> int;
|
||||||
|
|
||||||
/// Return the smallest whole number larger than or equals to the decimal number.
|
|
||||||
fn get ceiling(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the smallest whole number larger than or equals to the floating-point number.
|
/// Return the smallest whole number larger than or equals to the floating-point number.
|
||||||
fn get ceiling(x: float) -> float;
|
fn get ceiling(x: float) -> float;
|
||||||
|
|
||||||
@ -2345,21 +2371,12 @@ fn get end(range: ExclusiveRange) -> int;
|
|||||||
/// Return the end of the inclusive range.
|
/// Return the end of the inclusive range.
|
||||||
fn get end(range: InclusiveRange) -> int;
|
fn get end(range: InclusiveRange) -> int;
|
||||||
|
|
||||||
/// Return the largest whole number less than or equals to the decimal number.
|
|
||||||
fn get floor(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the largest whole number less than or equals to the floating-point number.
|
/// Return the largest whole number less than or equals to the floating-point number.
|
||||||
fn get floor(x: float) -> float;
|
fn get floor(x: float) -> float;
|
||||||
|
|
||||||
/// Return the fractional part of the decimal number.
|
|
||||||
fn get fraction(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the fractional part of the floating-point number.
|
/// Return the fractional part of the floating-point number.
|
||||||
fn get fraction(x: float) -> float;
|
fn get fraction(x: float) -> float;
|
||||||
|
|
||||||
/// Return the integral part of the decimal number.
|
|
||||||
fn get int(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the integral part of the floating-point number.
|
/// Return the integral part of the floating-point number.
|
||||||
fn get int(x: float) -> float;
|
fn get int(x: float) -> float;
|
||||||
|
|
||||||
@ -2470,9 +2487,6 @@ fn get is_odd(x: u64) -> bool;
|
|||||||
/// Return true if the number is odd.
|
/// Return true if the number is odd.
|
||||||
fn get is_odd(x: u8) -> bool;
|
fn get is_odd(x: u8) -> bool;
|
||||||
|
|
||||||
/// Return true if the decimal number is zero.
|
|
||||||
fn get is_zero(x: Decimal) -> bool;
|
|
||||||
|
|
||||||
/// Return true if the number is zero.
|
/// Return true if the number is zero.
|
||||||
fn get is_zero(x: int) -> bool;
|
fn get is_zero(x: int) -> bool;
|
||||||
|
|
||||||
@ -2549,10 +2563,6 @@ fn get len(string: String) -> int;
|
|||||||
/// ```
|
/// ```
|
||||||
fn get name(fn_ptr: FnPtr) -> String;
|
fn get name(fn_ptr: FnPtr) -> String;
|
||||||
|
|
||||||
/// Return the nearest whole number closest to the decimal number.
|
|
||||||
/// Always round mid-point towards the closest even number.
|
|
||||||
fn get round(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the nearest whole number closest to the floating-point number.
|
/// Return the nearest whole number closest to the floating-point number.
|
||||||
/// Rounds away from zero.
|
/// Rounds away from zero.
|
||||||
fn get round(x: float) -> float;
|
fn get round(x: float) -> float;
|
||||||
@ -2917,9 +2927,6 @@ fn insert(array: Array, index: int, item: ?) -> ();
|
|||||||
/// ```
|
/// ```
|
||||||
fn insert(blob: Blob, index: int, value: int) -> ();
|
fn insert(blob: Blob, index: int, value: int) -> ();
|
||||||
|
|
||||||
/// Return the integral part of the decimal number.
|
|
||||||
fn int(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the integral part of the floating-point number.
|
/// Return the integral part of the floating-point number.
|
||||||
fn int(x: float) -> float;
|
fn int(x: float) -> float;
|
||||||
|
|
||||||
@ -3033,9 +3040,6 @@ fn is_odd(x: u64) -> bool;
|
|||||||
/// Return true if the number is odd.
|
/// Return true if the number is odd.
|
||||||
fn is_odd(x: u8) -> bool;
|
fn is_odd(x: u8) -> bool;
|
||||||
|
|
||||||
/// Return true if the decimal number is zero.
|
|
||||||
fn is_zero(x: Decimal) -> bool;
|
|
||||||
|
|
||||||
/// Return true if the number is zero.
|
/// Return true if the number is zero.
|
||||||
fn is_zero(x: int) -> bool;
|
fn is_zero(x: int) -> bool;
|
||||||
|
|
||||||
@ -3113,15 +3117,9 @@ fn len(map: Map) -> int;
|
|||||||
/// ```
|
/// ```
|
||||||
fn len(string: String) -> int;
|
fn len(string: String) -> int;
|
||||||
|
|
||||||
/// Return the natural log of the decimal number.
|
|
||||||
fn ln(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the natural log of the floating-point number.
|
/// Return the natural log of the floating-point number.
|
||||||
fn ln(x: float) -> float;
|
fn ln(x: float) -> float;
|
||||||
|
|
||||||
/// Return the log of the decimal number with base 10.
|
|
||||||
fn log(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the log of the floating-point number with base 10.
|
/// Return the log of the floating-point number with base 10.
|
||||||
fn log(x: float) -> float;
|
fn log(x: float) -> float;
|
||||||
|
|
||||||
@ -3422,17 +3420,6 @@ fn parse_be_int(blob: Blob, range: RangeInclusive<int>) -> int;
|
|||||||
/// ```
|
/// ```
|
||||||
fn parse_be_int(blob: Blob, start: int, len: int) -> int;
|
fn parse_be_int(blob: Blob, start: int, len: int) -> int;
|
||||||
|
|
||||||
/// Parse a string into a decimal number.
|
|
||||||
///
|
|
||||||
/// # Example
|
|
||||||
///
|
|
||||||
/// ```rhai
|
|
||||||
/// let x = parse_decimal("123.456");
|
|
||||||
///
|
|
||||||
/// print(x); // prints 123.456
|
|
||||||
/// ```
|
|
||||||
fn parse_decimal(string: String) -> Decimal;
|
|
||||||
|
|
||||||
/// Parse a string into a floating-point number.
|
/// Parse a string into a floating-point number.
|
||||||
///
|
///
|
||||||
/// # Example
|
/// # Example
|
||||||
@ -3472,6 +3459,17 @@ fn parse_int(string: String) -> int;
|
|||||||
/// ```
|
/// ```
|
||||||
fn parse_int(string: String, radix: int) -> int;
|
fn parse_int(string: String, radix: int) -> int;
|
||||||
|
|
||||||
|
/// Parse a JSON string into a value.
|
||||||
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rhai
|
||||||
|
/// let m = parse_json(`{"a":1, "b":2, "c":3}`);
|
||||||
|
///
|
||||||
|
/// print(m); // prints #{"a":1, "b":2, "c":3}
|
||||||
|
/// ```
|
||||||
|
fn parse_json(json: String) -> ?;
|
||||||
|
|
||||||
/// Parse the bytes within an exclusive `range` in the BLOB as a `FLOAT`
|
/// Parse the bytes within an exclusive `range` in the BLOB as a `FLOAT`
|
||||||
/// in little-endian byte order.
|
/// in little-endian byte order.
|
||||||
///
|
///
|
||||||
@ -3621,34 +3619,34 @@ fn pop(string: String) -> ?;
|
|||||||
fn pop(string: String, len: int) -> String;
|
fn pop(string: String, len: int) -> String;
|
||||||
|
|
||||||
/// Return the empty string.
|
/// Return the empty string.
|
||||||
fn print() -> String;
|
op print() -> String;
|
||||||
|
|
||||||
/// Convert the array into a string.
|
/// Convert the array into a string.
|
||||||
fn print(array: Array) -> String;
|
op print(Array) -> String;
|
||||||
|
|
||||||
/// Return the character into a string.
|
/// Return the character into a string.
|
||||||
fn print(character: char) -> String;
|
op print(char) -> String;
|
||||||
|
|
||||||
/// Convert the value of the `item` into a string.
|
/// Convert the value of the `item` into a string.
|
||||||
fn print(item: ?) -> String;
|
op print(?) -> String;
|
||||||
|
|
||||||
/// Convert the object map into a string.
|
/// Convert the object map into a string.
|
||||||
fn print(map: Map) -> String;
|
op print(Map) -> String;
|
||||||
|
|
||||||
/// Convert the value of `number` into a string.
|
/// Convert the value of `number` into a string.
|
||||||
fn print(number: f32) -> String;
|
op print(f32) -> String;
|
||||||
|
|
||||||
/// Convert the value of `number` into a string.
|
/// Convert the value of `number` into a string.
|
||||||
fn print(number: float) -> String;
|
op print(float) -> String;
|
||||||
|
|
||||||
/// Return the `string`.
|
/// Return the `string`.
|
||||||
fn print(string: String) -> String;
|
op print(String) -> String;
|
||||||
|
|
||||||
/// Return the empty string.
|
/// Return the empty string.
|
||||||
fn print(unit: ()) -> String;
|
op print(()) -> String;
|
||||||
|
|
||||||
/// Return the boolean value into a string.
|
/// Return the boolean value into a string.
|
||||||
fn print(value: bool) -> String;
|
op print(bool) -> String;
|
||||||
|
|
||||||
/// Add a new element, which is not another array, to the end of the array.
|
/// Add a new element, which is not another array, to the end of the array.
|
||||||
///
|
///
|
||||||
@ -3810,27 +3808,6 @@ fn range(from: u64, to: u64) -> Iterator<u64>;
|
|||||||
/// ```
|
/// ```
|
||||||
fn range(from: u8, to: u8) -> Iterator<u8>;
|
fn range(from: u8, to: u8) -> Iterator<u8>;
|
||||||
|
|
||||||
/// Return an iterator over an exclusive range, each iteration increasing by `step`.
|
|
||||||
///
|
|
||||||
/// If `range` is reversed and `step` < 0, iteration goes backwards.
|
|
||||||
///
|
|
||||||
/// Otherwise, if `range` is empty, an empty iterator is returned.
|
|
||||||
///
|
|
||||||
/// # Example
|
|
||||||
///
|
|
||||||
/// ```rhai
|
|
||||||
/// // prints all values from 8 to 17 in steps of 3
|
|
||||||
/// for n in range(8..18, 3) {
|
|
||||||
/// print(n);
|
|
||||||
/// }
|
|
||||||
///
|
|
||||||
/// // prints all values down from 18 to 9 in steps of -3
|
|
||||||
/// for n in range(18..8, -3) {
|
|
||||||
/// print(n);
|
|
||||||
/// }
|
|
||||||
/// ```
|
|
||||||
fn range(range: Range<Decimal>, step: Decimal) -> Iterator<Decimal>;
|
|
||||||
|
|
||||||
/// Return an iterator over an exclusive range, each iteration increasing by `step`.
|
/// Return an iterator over an exclusive range, each iteration increasing by `step`.
|
||||||
///
|
///
|
||||||
/// If `range` is reversed and `step` < 0, iteration goes backwards.
|
/// If `range` is reversed and `step` < 0, iteration goes backwards.
|
||||||
@ -4062,28 +4039,6 @@ fn range(range: Range<u64>, step: u64) -> Iterator<u64>;
|
|||||||
/// ```
|
/// ```
|
||||||
fn range(range: Range<u8>, step: u8) -> Iterator<u8>;
|
fn range(range: Range<u8>, step: u8) -> Iterator<u8>;
|
||||||
|
|
||||||
/// Return an iterator over the exclusive range of `from..to`, each iteration increasing by `step`.
|
|
||||||
/// The value `to` is never included.
|
|
||||||
///
|
|
||||||
/// If `from` > `to` and `step` < 0, iteration goes backwards.
|
|
||||||
///
|
|
||||||
/// If `from` > `to` and `step` > 0 or `from` < `to` and `step` < 0, an empty iterator is returned.
|
|
||||||
///
|
|
||||||
/// # Example
|
|
||||||
///
|
|
||||||
/// ```rhai
|
|
||||||
/// // prints all values from 8 to 17 in steps of 3
|
|
||||||
/// for n in range(8, 18, 3) {
|
|
||||||
/// print(n);
|
|
||||||
/// }
|
|
||||||
///
|
|
||||||
/// // prints all values down from 18 to 9 in steps of -3
|
|
||||||
/// for n in range(18, 8, -3) {
|
|
||||||
/// print(n);
|
|
||||||
/// }
|
|
||||||
/// ```
|
|
||||||
fn range(from: Decimal, to: Decimal, step: Decimal) -> Iterator<Decimal>;
|
|
||||||
|
|
||||||
/// Return an iterator over the exclusive range of `from..to`, each iteration increasing by `step`.
|
/// Return an iterator over the exclusive range of `from..to`, each iteration increasing by `step`.
|
||||||
/// The value `to` is never included.
|
/// The value `to` is never included.
|
||||||
///
|
///
|
||||||
@ -4917,34 +4872,10 @@ fn reverse(array: Array) -> ();
|
|||||||
/// ```
|
/// ```
|
||||||
fn reverse(blob: Blob) -> ();
|
fn reverse(blob: Blob) -> ();
|
||||||
|
|
||||||
/// Return the nearest whole number closest to the decimal number.
|
|
||||||
/// Always round mid-point towards the closest even number.
|
|
||||||
fn round(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the nearest whole number closest to the floating-point number.
|
/// Return the nearest whole number closest to the floating-point number.
|
||||||
/// Rounds away from zero.
|
/// Rounds away from zero.
|
||||||
fn round(x: float) -> float;
|
fn round(x: float) -> float;
|
||||||
|
|
||||||
/// Round the decimal number to the specified number of `digits` after the decimal point and return it.
|
|
||||||
/// Always round mid-point towards the closest even number.
|
|
||||||
fn round(x: Decimal, digits: int) -> Decimal;
|
|
||||||
|
|
||||||
/// Round the decimal number to the specified number of `digits` after the decimal point and return it.
|
|
||||||
/// Always round towards zero.
|
|
||||||
fn round_down(x: Decimal, digits: int) -> Decimal;
|
|
||||||
|
|
||||||
/// Round the decimal number to the specified number of `digits` after the decimal point and return it.
|
|
||||||
/// Always round mid-points towards zero.
|
|
||||||
fn round_half_down(x: Decimal, digits: int) -> Decimal;
|
|
||||||
|
|
||||||
/// Round the decimal number to the specified number of `digits` after the decimal point and return it.
|
|
||||||
/// Always round mid-points away from zero.
|
|
||||||
fn round_half_up(x: Decimal, digits: int) -> Decimal;
|
|
||||||
|
|
||||||
/// Round the decimal number to the specified number of `digits` after the decimal point and return it.
|
|
||||||
/// Always round away from zero.
|
|
||||||
fn round_up(x: Decimal, digits: int) -> Decimal;
|
|
||||||
|
|
||||||
/// Set the element at the `index` position in the array to a new `value`.
|
/// Set the element at the `index` position in the array to a new `value`.
|
||||||
///
|
///
|
||||||
/// * If `index` < 0, position counts from the end of the array (`-1` is the last element).
|
/// * If `index` < 0, position counts from the end of the array (`-1` is the last element).
|
||||||
@ -5170,13 +5101,6 @@ fn shift(array: Array) -> ?;
|
|||||||
/// ```
|
/// ```
|
||||||
fn shift(blob: Blob) -> int;
|
fn shift(blob: Blob) -> int;
|
||||||
|
|
||||||
/// Return the sign (as an integer) of the decimal number according to the following:
|
|
||||||
///
|
|
||||||
/// * `0` if the number is zero
|
|
||||||
/// * `1` if the number is positive
|
|
||||||
/// * `-1` if the number is negative
|
|
||||||
fn sign(x: Decimal) -> int;
|
|
||||||
|
|
||||||
/// Return the sign (as an integer) of the number according to the following:
|
/// Return the sign (as an integer) of the number according to the following:
|
||||||
///
|
///
|
||||||
/// * `0` if the number is zero
|
/// * `0` if the number is zero
|
||||||
@ -5226,9 +5150,6 @@ fn sign(x: i32) -> int;
|
|||||||
/// * `-1` if the number is negative
|
/// * `-1` if the number is negative
|
||||||
fn sign(x: i8) -> int;
|
fn sign(x: i8) -> int;
|
||||||
|
|
||||||
/// Return the sine of the decimal number in radians.
|
|
||||||
fn sin(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the sine of the floating-point number in radians.
|
/// Return the sine of the floating-point number in radians.
|
||||||
fn sin(x: float) -> float;
|
fn sin(x: float) -> float;
|
||||||
|
|
||||||
@ -5658,9 +5579,6 @@ fn split_rev(string: String, delimiter: String, segments: int) -> Array;
|
|||||||
/// ```
|
/// ```
|
||||||
fn split_rev(string: String, delimiter: char, segments: int) -> Array;
|
fn split_rev(string: String, delimiter: char, segments: int) -> Array;
|
||||||
|
|
||||||
/// Return the square root of the decimal number.
|
|
||||||
fn sqrt(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the square root of the floating-point number.
|
/// Return the square root of the floating-point number.
|
||||||
fn sqrt(x: float) -> float;
|
fn sqrt(x: float) -> float;
|
||||||
|
|
||||||
@ -5755,9 +5673,6 @@ fn sub_string(string: String, start: int, len: int) -> String;
|
|||||||
/// ```
|
/// ```
|
||||||
fn tag(value: ?) -> int;
|
fn tag(value: ?) -> int;
|
||||||
|
|
||||||
/// Return the tangent of the decimal number in radians.
|
|
||||||
fn tan(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the tangent of the floating-point number in radians.
|
/// Return the tangent of the floating-point number in radians.
|
||||||
fn tan(x: float) -> float;
|
fn tan(x: float) -> float;
|
||||||
|
|
||||||
@ -5874,34 +5789,9 @@ fn to_debug(unit: ()) -> String;
|
|||||||
/// Convert the boolean value into a string in debug format.
|
/// Convert the boolean value into a string in debug format.
|
||||||
fn to_debug(value: bool) -> String;
|
fn to_debug(value: bool) -> String;
|
||||||
|
|
||||||
/// Convert the floating-point number to decimal.
|
|
||||||
fn to_decimal(x: f32) -> Decimal;
|
|
||||||
|
|
||||||
/// Convert the floating-point number to decimal.
|
|
||||||
fn to_decimal(x: float) -> Decimal;
|
|
||||||
|
|
||||||
fn to_decimal(x: i16) -> Decimal;
|
|
||||||
|
|
||||||
fn to_decimal(x: i32) -> Decimal;
|
|
||||||
|
|
||||||
fn to_decimal(x: int) -> Decimal;
|
|
||||||
|
|
||||||
fn to_decimal(x: i8) -> Decimal;
|
|
||||||
|
|
||||||
fn to_decimal(x: u16) -> Decimal;
|
|
||||||
|
|
||||||
fn to_decimal(x: u32) -> Decimal;
|
|
||||||
|
|
||||||
fn to_decimal(x: u64) -> Decimal;
|
|
||||||
|
|
||||||
fn to_decimal(x: u8) -> Decimal;
|
|
||||||
|
|
||||||
/// Convert radians to degrees.
|
/// Convert radians to degrees.
|
||||||
fn to_degrees(x: float) -> float;
|
fn to_degrees(x: float) -> float;
|
||||||
|
|
||||||
/// Convert the decimal number to floating-point.
|
|
||||||
fn to_float(x: Decimal) -> float;
|
|
||||||
|
|
||||||
/// Convert the 32-bit floating-point number to 64-bit.
|
/// Convert the 32-bit floating-point number to 64-bit.
|
||||||
fn to_float(x: f32) -> float;
|
fn to_float(x: f32) -> float;
|
||||||
|
|
||||||
@ -5953,9 +5843,6 @@ fn to_hex(value: u64) -> String;
|
|||||||
/// Convert the `value` into a string in hex format.
|
/// Convert the `value` into a string in hex format.
|
||||||
fn to_hex(value: u8) -> String;
|
fn to_hex(value: u8) -> String;
|
||||||
|
|
||||||
/// Convert the decimal number into an integer.
|
|
||||||
fn to_int(x: Decimal) -> int;
|
|
||||||
|
|
||||||
fn to_int(x: char) -> int;
|
fn to_int(x: char) -> int;
|
||||||
|
|
||||||
/// Convert the floating-point number into an integer.
|
/// Convert the floating-point number into an integer.
|
||||||
|
@ -159,8 +159,6 @@ op **(u64, int) -> u64;
|
|||||||
|
|
||||||
op **(u8, int) -> u8;
|
op **(u8, int) -> u8;
|
||||||
|
|
||||||
op +(Decimal) -> Decimal;
|
|
||||||
|
|
||||||
op +(int) -> int;
|
op +(int) -> int;
|
||||||
|
|
||||||
op +(f32) -> f32;
|
op +(f32) -> f32;
|
||||||
@ -283,8 +281,6 @@ op +=(Instant, float) -> ();
|
|||||||
/// Add the specified number of `seconds` to the timestamp.
|
/// Add the specified number of `seconds` to the timestamp.
|
||||||
op +=(Instant, int) -> ();
|
op +=(Instant, int) -> ();
|
||||||
|
|
||||||
op -(Decimal) -> Decimal;
|
|
||||||
|
|
||||||
op -(int) -> int;
|
op -(int) -> int;
|
||||||
|
|
||||||
op -(f32) -> f32;
|
op -(f32) -> f32;
|
||||||
@ -613,9 +609,6 @@ op ^(u64, u64) -> u64;
|
|||||||
|
|
||||||
op ^(u8, u8) -> u8;
|
op ^(u8, u8) -> u8;
|
||||||
|
|
||||||
/// Return the absolute value of the decimal number.
|
|
||||||
fn abs(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the absolute value of the number.
|
/// Return the absolute value of the number.
|
||||||
fn abs(x: int) -> int;
|
fn abs(x: int) -> int;
|
||||||
|
|
||||||
@ -788,13 +781,6 @@ fn atan(x: float, y: float) -> float;
|
|||||||
/// Return the arc-hyperbolic-tangent of the floating-point number, in radians.
|
/// Return the arc-hyperbolic-tangent of the floating-point number, in radians.
|
||||||
fn atanh(x: float) -> float;
|
fn atanh(x: float) -> float;
|
||||||
|
|
||||||
/// Get an array of object maps containing the function calls stack.
|
|
||||||
///
|
|
||||||
/// If there is no debugging interface registered, an empty array is returned.
|
|
||||||
///
|
|
||||||
/// An array of strings is returned under `no_object`.
|
|
||||||
fn back_trace() -> Array;
|
|
||||||
|
|
||||||
/// Return an iterator over all the bits in the number.
|
/// Return an iterator over all the bits in the number.
|
||||||
///
|
///
|
||||||
/// # Example
|
/// # Example
|
||||||
@ -908,9 +894,6 @@ fn blob(len: int, value: int) -> Blob;
|
|||||||
/// ```
|
/// ```
|
||||||
fn bytes(string: String) -> int;
|
fn bytes(string: String) -> int;
|
||||||
|
|
||||||
/// Return the smallest whole number larger than or equals to the decimal number.
|
|
||||||
fn ceiling(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the smallest whole number larger than or equals to the floating-point number.
|
/// Return the smallest whole number larger than or equals to the floating-point number.
|
||||||
fn ceiling(x: float) -> float;
|
fn ceiling(x: float) -> float;
|
||||||
|
|
||||||
@ -1052,8 +1035,63 @@ fn clear(string: String) -> ();
|
|||||||
/// ```
|
/// ```
|
||||||
fn contains(array: Array, value: ?) -> bool;
|
fn contains(array: Array, value: ?) -> bool;
|
||||||
|
|
||||||
/// Return the cosine of the decimal number in radians.
|
/// Return `true` if the BLOB contains a specified byte value.
|
||||||
fn cos(x: Decimal) -> Decimal;
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rhai
|
||||||
|
/// let text = "hello, world!";
|
||||||
|
///
|
||||||
|
/// print(text.contains('h')); // prints true
|
||||||
|
///
|
||||||
|
/// print(text.contains('x')); // prints false
|
||||||
|
/// ```
|
||||||
|
fn contains(blob: Blob, value: int) -> bool;
|
||||||
|
|
||||||
|
/// Returns `true` if the object map contains a specified property.
|
||||||
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rhai
|
||||||
|
/// let m = #{a: 1, b: 2, c: 3};
|
||||||
|
///
|
||||||
|
/// print(m.contains("b")); // prints true
|
||||||
|
///
|
||||||
|
/// print(m.contains("x")); // prints false
|
||||||
|
/// ```
|
||||||
|
fn contains(map: Map, property: String) -> bool;
|
||||||
|
|
||||||
|
/// Return `true` if the range contains a specified value.
|
||||||
|
fn contains(range: ExclusiveRange, value: int) -> bool;
|
||||||
|
|
||||||
|
/// Return `true` if the range contains a specified value.
|
||||||
|
fn contains(range: InclusiveRange, value: int) -> bool;
|
||||||
|
|
||||||
|
/// Return `true` if the string contains a specified character.
|
||||||
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rhai
|
||||||
|
/// let text = "hello, world!";
|
||||||
|
///
|
||||||
|
/// print(text.contains('h')); // prints true
|
||||||
|
///
|
||||||
|
/// print(text.contains('x')); // prints false
|
||||||
|
/// ```
|
||||||
|
fn contains(string: String, character: char) -> bool;
|
||||||
|
|
||||||
|
/// Return `true` if the string contains a specified string.
|
||||||
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rhai
|
||||||
|
/// let text = "hello, world!";
|
||||||
|
///
|
||||||
|
/// print(text.contains("hello")); // prints true
|
||||||
|
///
|
||||||
|
/// print(text.contains("hey")); // prints false
|
||||||
|
/// ```
|
||||||
|
fn contains(string: String, match_string: String) -> bool;
|
||||||
|
|
||||||
/// Return the cosine of the floating-point number in radians.
|
/// Return the cosine of the floating-point number in radians.
|
||||||
fn cos(x: float) -> float;
|
fn cos(x: float) -> float;
|
||||||
@ -1132,37 +1170,37 @@ fn crop(string: String, start: int) -> ();
|
|||||||
fn crop(string: String, start: int, len: int) -> ();
|
fn crop(string: String, start: int, len: int) -> ();
|
||||||
|
|
||||||
/// Return the empty string.
|
/// Return the empty string.
|
||||||
fn debug() -> String;
|
op debug() -> String;
|
||||||
|
|
||||||
/// Convert the array into a string.
|
/// Convert the array into a string.
|
||||||
fn debug(array: Array) -> String;
|
op debug(Array) -> String;
|
||||||
|
|
||||||
/// Convert the string into debug format.
|
/// Convert the string into debug format.
|
||||||
fn debug(character: char) -> String;
|
op debug(char) -> String;
|
||||||
|
|
||||||
/// Convert the function pointer into a string in debug format.
|
/// Convert the function pointer into a string in debug format.
|
||||||
fn debug(f: FnPtr) -> String;
|
op debug(FnPtr) -> String;
|
||||||
|
|
||||||
/// Convert the value of the `item` into a string in debug format.
|
/// Convert the value of the `item` into a string in debug format.
|
||||||
fn debug(item: ?) -> String;
|
op debug(?) -> String;
|
||||||
|
|
||||||
/// Convert the object map into a string.
|
/// Convert the object map into a string.
|
||||||
fn debug(map: Map) -> String;
|
op debug(Map) -> String;
|
||||||
|
|
||||||
/// Convert the value of `number` into a string.
|
/// Convert the value of `number` into a string.
|
||||||
fn debug(number: f32) -> String;
|
op debug(f32) -> String;
|
||||||
|
|
||||||
/// Convert the value of `number` into a string.
|
/// Convert the value of `number` into a string.
|
||||||
fn debug(number: float) -> String;
|
op debug(float) -> String;
|
||||||
|
|
||||||
/// Convert the string into debug format.
|
/// Convert the string into debug format.
|
||||||
fn debug(string: String) -> String;
|
op debug(String) -> String;
|
||||||
|
|
||||||
/// Convert the unit into a string in debug format.
|
/// Convert the unit into a string in debug format.
|
||||||
fn debug(unit: ()) -> String;
|
op debug(()) -> String;
|
||||||
|
|
||||||
/// Convert the boolean value into a string in debug format.
|
/// Convert the boolean value into a string in debug format.
|
||||||
fn debug(value: bool) -> String;
|
op debug(bool) -> String;
|
||||||
|
|
||||||
/// Remove duplicated _consecutive_ elements from the array.
|
/// Remove duplicated _consecutive_ elements from the array.
|
||||||
///
|
///
|
||||||
@ -1468,9 +1506,6 @@ fn end(range: InclusiveRange) -> int;
|
|||||||
/// ```
|
/// ```
|
||||||
fn ends_with(string: String, match_string: String) -> bool;
|
fn ends_with(string: String, match_string: String) -> bool;
|
||||||
|
|
||||||
/// Return the exponential of the decimal number.
|
|
||||||
fn exp(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the exponential of the floating-point number.
|
/// Return the exponential of the floating-point number.
|
||||||
fn exp(x: float) -> float;
|
fn exp(x: float) -> float;
|
||||||
|
|
||||||
@ -1681,15 +1716,9 @@ fn filter(array: Array, filter: FnPtr) -> Array;
|
|||||||
/// ```
|
/// ```
|
||||||
fn filter(array: Array, filter_func: String) -> Array;
|
fn filter(array: Array, filter_func: String) -> Array;
|
||||||
|
|
||||||
/// Return the largest whole number less than or equals to the decimal number.
|
|
||||||
fn floor(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the largest whole number less than or equals to the floating-point number.
|
/// Return the largest whole number less than or equals to the floating-point number.
|
||||||
fn floor(x: float) -> float;
|
fn floor(x: float) -> float;
|
||||||
|
|
||||||
/// Return the fractional part of the decimal number.
|
|
||||||
fn fraction(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the fractional part of the floating-point number.
|
/// Return the fractional part of the floating-point number.
|
||||||
fn fraction(x: float) -> float;
|
fn fraction(x: float) -> float;
|
||||||
|
|
||||||
@ -1791,9 +1820,6 @@ fn get bits(value: int) -> Iterator<bool>;
|
|||||||
/// ```
|
/// ```
|
||||||
fn get bytes(string: String) -> int;
|
fn get bytes(string: String) -> int;
|
||||||
|
|
||||||
/// Return the smallest whole number larger than or equals to the decimal number.
|
|
||||||
fn get ceiling(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the smallest whole number larger than or equals to the floating-point number.
|
/// Return the smallest whole number larger than or equals to the floating-point number.
|
||||||
fn get ceiling(x: float) -> float;
|
fn get ceiling(x: float) -> float;
|
||||||
|
|
||||||
@ -1827,21 +1853,12 @@ fn get end(range: ExclusiveRange) -> int;
|
|||||||
/// Return the end of the inclusive range.
|
/// Return the end of the inclusive range.
|
||||||
fn get end(range: InclusiveRange) -> int;
|
fn get end(range: InclusiveRange) -> int;
|
||||||
|
|
||||||
/// Return the largest whole number less than or equals to the decimal number.
|
|
||||||
fn get floor(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the largest whole number less than or equals to the floating-point number.
|
/// Return the largest whole number less than or equals to the floating-point number.
|
||||||
fn get floor(x: float) -> float;
|
fn get floor(x: float) -> float;
|
||||||
|
|
||||||
/// Return the fractional part of the decimal number.
|
|
||||||
fn get fraction(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the fractional part of the floating-point number.
|
/// Return the fractional part of the floating-point number.
|
||||||
fn get fraction(x: float) -> float;
|
fn get fraction(x: float) -> float;
|
||||||
|
|
||||||
/// Return the integral part of the decimal number.
|
|
||||||
fn get int(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the integral part of the floating-point number.
|
/// Return the integral part of the floating-point number.
|
||||||
fn get int(x: float) -> float;
|
fn get int(x: float) -> float;
|
||||||
|
|
||||||
@ -1952,9 +1969,6 @@ fn get is_odd(x: u64) -> bool;
|
|||||||
/// Return true if the number is odd.
|
/// Return true if the number is odd.
|
||||||
fn get is_odd(x: u8) -> bool;
|
fn get is_odd(x: u8) -> bool;
|
||||||
|
|
||||||
/// Return true if the decimal number is zero.
|
|
||||||
fn get is_zero(x: Decimal) -> bool;
|
|
||||||
|
|
||||||
/// Return true if the number is zero.
|
/// Return true if the number is zero.
|
||||||
fn get is_zero(x: int) -> bool;
|
fn get is_zero(x: int) -> bool;
|
||||||
|
|
||||||
@ -2031,10 +2045,6 @@ fn get len(string: String) -> int;
|
|||||||
/// ```
|
/// ```
|
||||||
fn get name(fn_ptr: FnPtr) -> String;
|
fn get name(fn_ptr: FnPtr) -> String;
|
||||||
|
|
||||||
/// Return the nearest whole number closest to the decimal number.
|
|
||||||
/// Always round mid-point towards the closest even number.
|
|
||||||
fn get round(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the nearest whole number closest to the floating-point number.
|
/// Return the nearest whole number closest to the floating-point number.
|
||||||
/// Rounds away from zero.
|
/// Rounds away from zero.
|
||||||
fn get round(x: float) -> float;
|
fn get round(x: float) -> float;
|
||||||
@ -2399,9 +2409,6 @@ fn insert(array: Array, index: int, item: ?) -> ();
|
|||||||
/// ```
|
/// ```
|
||||||
fn insert(blob: Blob, index: int, value: int) -> ();
|
fn insert(blob: Blob, index: int, value: int) -> ();
|
||||||
|
|
||||||
/// Return the integral part of the decimal number.
|
|
||||||
fn int(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the integral part of the floating-point number.
|
/// Return the integral part of the floating-point number.
|
||||||
fn int(x: float) -> float;
|
fn int(x: float) -> float;
|
||||||
|
|
||||||
@ -2515,9 +2522,6 @@ fn is_odd(x: u64) -> bool;
|
|||||||
/// Return true if the number is odd.
|
/// Return true if the number is odd.
|
||||||
fn is_odd(x: u8) -> bool;
|
fn is_odd(x: u8) -> bool;
|
||||||
|
|
||||||
/// Return true if the decimal number is zero.
|
|
||||||
fn is_zero(x: Decimal) -> bool;
|
|
||||||
|
|
||||||
/// Return true if the number is zero.
|
/// Return true if the number is zero.
|
||||||
fn is_zero(x: int) -> bool;
|
fn is_zero(x: int) -> bool;
|
||||||
|
|
||||||
@ -2595,15 +2599,9 @@ fn len(map: Map) -> int;
|
|||||||
/// ```
|
/// ```
|
||||||
fn len(string: String) -> int;
|
fn len(string: String) -> int;
|
||||||
|
|
||||||
/// Return the natural log of the decimal number.
|
|
||||||
fn ln(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the natural log of the floating-point number.
|
/// Return the natural log of the floating-point number.
|
||||||
fn ln(x: float) -> float;
|
fn ln(x: float) -> float;
|
||||||
|
|
||||||
/// Return the log of the decimal number with base 10.
|
|
||||||
fn log(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the log of the floating-point number with base 10.
|
/// Return the log of the floating-point number with base 10.
|
||||||
fn log(x: float) -> float;
|
fn log(x: float) -> float;
|
||||||
|
|
||||||
@ -2904,17 +2902,6 @@ fn parse_be_int(blob: Blob, range: RangeInclusive<int>) -> int;
|
|||||||
/// ```
|
/// ```
|
||||||
fn parse_be_int(blob: Blob, start: int, len: int) -> int;
|
fn parse_be_int(blob: Blob, start: int, len: int) -> int;
|
||||||
|
|
||||||
/// Parse a string into a decimal number.
|
|
||||||
///
|
|
||||||
/// # Example
|
|
||||||
///
|
|
||||||
/// ```rhai
|
|
||||||
/// let x = parse_decimal("123.456");
|
|
||||||
///
|
|
||||||
/// print(x); // prints 123.456
|
|
||||||
/// ```
|
|
||||||
fn parse_decimal(string: String) -> Decimal;
|
|
||||||
|
|
||||||
/// Parse a string into a floating-point number.
|
/// Parse a string into a floating-point number.
|
||||||
///
|
///
|
||||||
/// # Example
|
/// # Example
|
||||||
@ -2954,6 +2941,17 @@ fn parse_int(string: String) -> int;
|
|||||||
/// ```
|
/// ```
|
||||||
fn parse_int(string: String, radix: int) -> int;
|
fn parse_int(string: String, radix: int) -> int;
|
||||||
|
|
||||||
|
/// Parse a JSON string into a value.
|
||||||
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rhai
|
||||||
|
/// let m = parse_json(`{"a":1, "b":2, "c":3}`);
|
||||||
|
///
|
||||||
|
/// print(m); // prints #{"a":1, "b":2, "c":3}
|
||||||
|
/// ```
|
||||||
|
fn parse_json(json: String) -> ?;
|
||||||
|
|
||||||
/// Parse the bytes within an exclusive `range` in the BLOB as a `FLOAT`
|
/// Parse the bytes within an exclusive `range` in the BLOB as a `FLOAT`
|
||||||
/// in little-endian byte order.
|
/// in little-endian byte order.
|
||||||
///
|
///
|
||||||
@ -3103,34 +3101,34 @@ fn pop(string: String) -> ?;
|
|||||||
fn pop(string: String, len: int) -> String;
|
fn pop(string: String, len: int) -> String;
|
||||||
|
|
||||||
/// Return the empty string.
|
/// Return the empty string.
|
||||||
fn print() -> String;
|
op print() -> String;
|
||||||
|
|
||||||
/// Convert the array into a string.
|
/// Convert the array into a string.
|
||||||
fn print(array: Array) -> String;
|
op print(Array) -> String;
|
||||||
|
|
||||||
/// Return the character into a string.
|
/// Return the character into a string.
|
||||||
fn print(character: char) -> String;
|
op print(char) -> String;
|
||||||
|
|
||||||
/// Convert the value of the `item` into a string.
|
/// Convert the value of the `item` into a string.
|
||||||
fn print(item: ?) -> String;
|
op print(?) -> String;
|
||||||
|
|
||||||
/// Convert the object map into a string.
|
/// Convert the object map into a string.
|
||||||
fn print(map: Map) -> String;
|
op print(Map) -> String;
|
||||||
|
|
||||||
/// Convert the value of `number` into a string.
|
/// Convert the value of `number` into a string.
|
||||||
fn print(number: f32) -> String;
|
op print(f32) -> String;
|
||||||
|
|
||||||
/// Convert the value of `number` into a string.
|
/// Convert the value of `number` into a string.
|
||||||
fn print(number: float) -> String;
|
op print(float) -> String;
|
||||||
|
|
||||||
/// Return the `string`.
|
/// Return the `string`.
|
||||||
fn print(string: String) -> String;
|
op print(String) -> String;
|
||||||
|
|
||||||
/// Return the empty string.
|
/// Return the empty string.
|
||||||
fn print(unit: ()) -> String;
|
op print(()) -> String;
|
||||||
|
|
||||||
/// Return the boolean value into a string.
|
/// Return the boolean value into a string.
|
||||||
fn print(value: bool) -> String;
|
op print(bool) -> String;
|
||||||
|
|
||||||
/// Add a new element, which is not another array, to the end of the array.
|
/// Add a new element, which is not another array, to the end of the array.
|
||||||
///
|
///
|
||||||
@ -3292,27 +3290,6 @@ fn range(from: u64, to: u64) -> Iterator<u64>;
|
|||||||
/// ```
|
/// ```
|
||||||
fn range(from: u8, to: u8) -> Iterator<u8>;
|
fn range(from: u8, to: u8) -> Iterator<u8>;
|
||||||
|
|
||||||
/// Return an iterator over an exclusive range, each iteration increasing by `step`.
|
|
||||||
///
|
|
||||||
/// If `range` is reversed and `step` < 0, iteration goes backwards.
|
|
||||||
///
|
|
||||||
/// Otherwise, if `range` is empty, an empty iterator is returned.
|
|
||||||
///
|
|
||||||
/// # Example
|
|
||||||
///
|
|
||||||
/// ```rhai
|
|
||||||
/// // prints all values from 8 to 17 in steps of 3
|
|
||||||
/// for n in range(8..18, 3) {
|
|
||||||
/// print(n);
|
|
||||||
/// }
|
|
||||||
///
|
|
||||||
/// // prints all values down from 18 to 9 in steps of -3
|
|
||||||
/// for n in range(18..8, -3) {
|
|
||||||
/// print(n);
|
|
||||||
/// }
|
|
||||||
/// ```
|
|
||||||
fn range(range: Range<Decimal>, step: Decimal) -> Iterator<Decimal>;
|
|
||||||
|
|
||||||
/// Return an iterator over an exclusive range, each iteration increasing by `step`.
|
/// Return an iterator over an exclusive range, each iteration increasing by `step`.
|
||||||
///
|
///
|
||||||
/// If `range` is reversed and `step` < 0, iteration goes backwards.
|
/// If `range` is reversed and `step` < 0, iteration goes backwards.
|
||||||
@ -3544,28 +3521,6 @@ fn range(range: Range<u64>, step: u64) -> Iterator<u64>;
|
|||||||
/// ```
|
/// ```
|
||||||
fn range(range: Range<u8>, step: u8) -> Iterator<u8>;
|
fn range(range: Range<u8>, step: u8) -> Iterator<u8>;
|
||||||
|
|
||||||
/// Return an iterator over the exclusive range of `from..to`, each iteration increasing by `step`.
|
|
||||||
/// The value `to` is never included.
|
|
||||||
///
|
|
||||||
/// If `from` > `to` and `step` < 0, iteration goes backwards.
|
|
||||||
///
|
|
||||||
/// If `from` > `to` and `step` > 0 or `from` < `to` and `step` < 0, an empty iterator is returned.
|
|
||||||
///
|
|
||||||
/// # Example
|
|
||||||
///
|
|
||||||
/// ```rhai
|
|
||||||
/// // prints all values from 8 to 17 in steps of 3
|
|
||||||
/// for n in range(8, 18, 3) {
|
|
||||||
/// print(n);
|
|
||||||
/// }
|
|
||||||
///
|
|
||||||
/// // prints all values down from 18 to 9 in steps of -3
|
|
||||||
/// for n in range(18, 8, -3) {
|
|
||||||
/// print(n);
|
|
||||||
/// }
|
|
||||||
/// ```
|
|
||||||
fn range(from: Decimal, to: Decimal, step: Decimal) -> Iterator<Decimal>;
|
|
||||||
|
|
||||||
/// Return an iterator over the exclusive range of `from..to`, each iteration increasing by `step`.
|
/// Return an iterator over the exclusive range of `from..to`, each iteration increasing by `step`.
|
||||||
/// The value `to` is never included.
|
/// The value `to` is never included.
|
||||||
///
|
///
|
||||||
@ -4399,34 +4354,10 @@ fn reverse(array: Array) -> ();
|
|||||||
/// ```
|
/// ```
|
||||||
fn reverse(blob: Blob) -> ();
|
fn reverse(blob: Blob) -> ();
|
||||||
|
|
||||||
/// Return the nearest whole number closest to the decimal number.
|
|
||||||
/// Always round mid-point towards the closest even number.
|
|
||||||
fn round(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the nearest whole number closest to the floating-point number.
|
/// Return the nearest whole number closest to the floating-point number.
|
||||||
/// Rounds away from zero.
|
/// Rounds away from zero.
|
||||||
fn round(x: float) -> float;
|
fn round(x: float) -> float;
|
||||||
|
|
||||||
/// Round the decimal number to the specified number of `digits` after the decimal point and return it.
|
|
||||||
/// Always round mid-point towards the closest even number.
|
|
||||||
fn round(x: Decimal, digits: int) -> Decimal;
|
|
||||||
|
|
||||||
/// Round the decimal number to the specified number of `digits` after the decimal point and return it.
|
|
||||||
/// Always round towards zero.
|
|
||||||
fn round_down(x: Decimal, digits: int) -> Decimal;
|
|
||||||
|
|
||||||
/// Round the decimal number to the specified number of `digits` after the decimal point and return it.
|
|
||||||
/// Always round mid-points towards zero.
|
|
||||||
fn round_half_down(x: Decimal, digits: int) -> Decimal;
|
|
||||||
|
|
||||||
/// Round the decimal number to the specified number of `digits` after the decimal point and return it.
|
|
||||||
/// Always round mid-points away from zero.
|
|
||||||
fn round_half_up(x: Decimal, digits: int) -> Decimal;
|
|
||||||
|
|
||||||
/// Round the decimal number to the specified number of `digits` after the decimal point and return it.
|
|
||||||
/// Always round away from zero.
|
|
||||||
fn round_up(x: Decimal, digits: int) -> Decimal;
|
|
||||||
|
|
||||||
/// Set the element at the `index` position in the array to a new `value`.
|
/// Set the element at the `index` position in the array to a new `value`.
|
||||||
///
|
///
|
||||||
/// * If `index` < 0, position counts from the end of the array (`-1` is the last element).
|
/// * If `index` < 0, position counts from the end of the array (`-1` is the last element).
|
||||||
@ -4652,13 +4583,6 @@ fn shift(array: Array) -> ?;
|
|||||||
/// ```
|
/// ```
|
||||||
fn shift(blob: Blob) -> int;
|
fn shift(blob: Blob) -> int;
|
||||||
|
|
||||||
/// Return the sign (as an integer) of the decimal number according to the following:
|
|
||||||
///
|
|
||||||
/// * `0` if the number is zero
|
|
||||||
/// * `1` if the number is positive
|
|
||||||
/// * `-1` if the number is negative
|
|
||||||
fn sign(x: Decimal) -> int;
|
|
||||||
|
|
||||||
/// Return the sign (as an integer) of the number according to the following:
|
/// Return the sign (as an integer) of the number according to the following:
|
||||||
///
|
///
|
||||||
/// * `0` if the number is zero
|
/// * `0` if the number is zero
|
||||||
@ -4708,9 +4632,6 @@ fn sign(x: i32) -> int;
|
|||||||
/// * `-1` if the number is negative
|
/// * `-1` if the number is negative
|
||||||
fn sign(x: i8) -> int;
|
fn sign(x: i8) -> int;
|
||||||
|
|
||||||
/// Return the sine of the decimal number in radians.
|
|
||||||
fn sin(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the sine of the floating-point number in radians.
|
/// Return the sine of the floating-point number in radians.
|
||||||
fn sin(x: float) -> float;
|
fn sin(x: float) -> float;
|
||||||
|
|
||||||
@ -5140,9 +5061,6 @@ fn split_rev(string: String, delimiter: String, segments: int) -> Array;
|
|||||||
/// ```
|
/// ```
|
||||||
fn split_rev(string: String, delimiter: char, segments: int) -> Array;
|
fn split_rev(string: String, delimiter: char, segments: int) -> Array;
|
||||||
|
|
||||||
/// Return the square root of the decimal number.
|
|
||||||
fn sqrt(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the square root of the floating-point number.
|
/// Return the square root of the floating-point number.
|
||||||
fn sqrt(x: float) -> float;
|
fn sqrt(x: float) -> float;
|
||||||
|
|
||||||
@ -5237,9 +5155,6 @@ fn sub_string(string: String, start: int, len: int) -> String;
|
|||||||
/// ```
|
/// ```
|
||||||
fn tag(value: ?) -> int;
|
fn tag(value: ?) -> int;
|
||||||
|
|
||||||
/// Return the tangent of the decimal number in radians.
|
|
||||||
fn tan(x: Decimal) -> Decimal;
|
|
||||||
|
|
||||||
/// Return the tangent of the floating-point number in radians.
|
/// Return the tangent of the floating-point number in radians.
|
||||||
fn tan(x: float) -> float;
|
fn tan(x: float) -> float;
|
||||||
|
|
||||||
@ -5356,34 +5271,9 @@ fn to_debug(unit: ()) -> String;
|
|||||||
/// Convert the boolean value into a string in debug format.
|
/// Convert the boolean value into a string in debug format.
|
||||||
fn to_debug(value: bool) -> String;
|
fn to_debug(value: bool) -> String;
|
||||||
|
|
||||||
/// Convert the floating-point number to decimal.
|
|
||||||
fn to_decimal(x: f32) -> Decimal;
|
|
||||||
|
|
||||||
/// Convert the floating-point number to decimal.
|
|
||||||
fn to_decimal(x: float) -> Decimal;
|
|
||||||
|
|
||||||
fn to_decimal(x: i16) -> Decimal;
|
|
||||||
|
|
||||||
fn to_decimal(x: i32) -> Decimal;
|
|
||||||
|
|
||||||
fn to_decimal(x: int) -> Decimal;
|
|
||||||
|
|
||||||
fn to_decimal(x: i8) -> Decimal;
|
|
||||||
|
|
||||||
fn to_decimal(x: u16) -> Decimal;
|
|
||||||
|
|
||||||
fn to_decimal(x: u32) -> Decimal;
|
|
||||||
|
|
||||||
fn to_decimal(x: u64) -> Decimal;
|
|
||||||
|
|
||||||
fn to_decimal(x: u8) -> Decimal;
|
|
||||||
|
|
||||||
/// Convert radians to degrees.
|
/// Convert radians to degrees.
|
||||||
fn to_degrees(x: float) -> float;
|
fn to_degrees(x: float) -> float;
|
||||||
|
|
||||||
/// Convert the decimal number to floating-point.
|
|
||||||
fn to_float(x: Decimal) -> float;
|
|
||||||
|
|
||||||
/// Convert the 32-bit floating-point number to 64-bit.
|
/// Convert the 32-bit floating-point number to 64-bit.
|
||||||
fn to_float(x: f32) -> float;
|
fn to_float(x: f32) -> float;
|
||||||
|
|
||||||
@ -5435,9 +5325,6 @@ fn to_hex(value: u64) -> String;
|
|||||||
/// Convert the `value` into a string in hex format.
|
/// Convert the `value` into a string in hex format.
|
||||||
fn to_hex(value: u8) -> String;
|
fn to_hex(value: u8) -> String;
|
||||||
|
|
||||||
/// Convert the decimal number into an integer.
|
|
||||||
fn to_int(x: Decimal) -> int;
|
|
||||||
|
|
||||||
fn to_int(x: char) -> int;
|
fn to_int(x: char) -> int;
|
||||||
|
|
||||||
/// Convert the floating-point number into an integer.
|
/// Convert the floating-point number into an integer.
|
||||||
|
@ -3,8 +3,8 @@
|
|||||||
"general_kenobi": {
|
"general_kenobi": {
|
||||||
"functions": [
|
"functions": [
|
||||||
{
|
{
|
||||||
"baseHash": 727795846011184342,
|
"baseHash": 3873007749982070651,
|
||||||
"fullHash": 5101524478338862216,
|
"fullHash": 5865213555928423624,
|
||||||
"namespace": "internal",
|
"namespace": "internal",
|
||||||
"access": "public",
|
"access": "public",
|
||||||
"name": "hello_there",
|
"name": "hello_there",
|
||||||
@ -27,8 +27,8 @@
|
|||||||
},
|
},
|
||||||
"functions": [
|
"functions": [
|
||||||
{
|
{
|
||||||
"baseHash": 17133166385977770750,
|
"baseHash": 12461724250411739075,
|
||||||
"fullHash": 11299449021188202345,
|
"fullHash": 14530626537296006176,
|
||||||
"namespace": "global",
|
"namespace": "global",
|
||||||
"access": "public",
|
"access": "public",
|
||||||
"name": "minus",
|
"name": "minus",
|
||||||
|
@ -78,12 +78,12 @@ pub fn main() {
|
|||||||
scope.push_constant("MY_CONSTANT", 42_i64);
|
scope.push_constant("MY_CONSTANT", 42_i64);
|
||||||
|
|
||||||
// Compile the handler script.
|
// Compile the handler script.
|
||||||
println!("> Loading script file: {}", path);
|
println!("> Loading script file: {path}");
|
||||||
|
|
||||||
let ast = match engine.compile_file_with_scope(&mut scope, path.into()) {
|
let ast = match engine.compile_file_with_scope(&mut scope, path.into()) {
|
||||||
Ok(ast) => ast,
|
Ok(ast) => ast,
|
||||||
Err(err) => {
|
Err(err) => {
|
||||||
eprintln!("! Error: {}", err);
|
eprintln!("! Error: {err}");
|
||||||
println!("Cannot continue. Bye!");
|
println!("Cannot continue. Bye!");
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
@ -101,7 +101,7 @@ pub fn main() {
|
|||||||
let result = engine.call_fn_raw(&mut scope, &ast, false, true, "init", Some(&mut states), []);
|
let result = engine.call_fn_raw(&mut scope, &ast, false, true, "init", Some(&mut states), []);
|
||||||
|
|
||||||
if let Err(err) = result {
|
if let Err(err) = result {
|
||||||
eprintln!("! {}", err)
|
eprintln!("! {err}")
|
||||||
}
|
}
|
||||||
|
|
||||||
// Create handler instance
|
// Create handler instance
|
||||||
@ -152,7 +152,7 @@ pub fn main() {
|
|||||||
engine.call_fn_raw(scope, ast, false, true, event, this_ptr, [arg.into()]);
|
engine.call_fn_raw(scope, ast, false, true, event, this_ptr, [arg.into()]);
|
||||||
|
|
||||||
if let Err(err) = result {
|
if let Err(err) = result {
|
||||||
eprintln!("! {}", err)
|
eprintln!("! {err}")
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -67,7 +67,7 @@ pub fn main() {
|
|||||||
scope.push_constant("MY_CONSTANT", 42_i64);
|
scope.push_constant("MY_CONSTANT", 42_i64);
|
||||||
|
|
||||||
// Compile the handler script.
|
// Compile the handler script.
|
||||||
println!("> Loading script file: {}", path);
|
println!("> Loading script file: {path}");
|
||||||
|
|
||||||
let ast = match engine.compile_file_with_scope(&mut scope, path.into()) {
|
let ast = match engine.compile_file_with_scope(&mut scope, path.into()) {
|
||||||
Ok(ast) => ast,
|
Ok(ast) => ast,
|
||||||
@ -89,7 +89,7 @@ pub fn main() {
|
|||||||
let result = engine.call_fn_raw(&mut scope, &ast, false, false, "init", None, []);
|
let result = engine.call_fn_raw(&mut scope, &ast, false, false, "init", None, []);
|
||||||
|
|
||||||
if let Err(err) = result {
|
if let Err(err) = result {
|
||||||
eprintln!("! {}", err)
|
eprintln!("! {err}")
|
||||||
}
|
}
|
||||||
|
|
||||||
// Create handler instance
|
// Create handler instance
|
||||||
@ -127,7 +127,7 @@ pub fn main() {
|
|||||||
let result = engine.call_fn::<()>(scope, ast, event, (arg.to_string(),));
|
let result = engine.call_fn::<()>(scope, ast, event, (arg.to_string(),));
|
||||||
|
|
||||||
if let Err(err) = result {
|
if let Err(err) = result {
|
||||||
eprintln!("! {}", err)
|
eprintln!("! {err}")
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -81,12 +81,12 @@ pub fn main() {
|
|||||||
scope.push("state", states);
|
scope.push("state", states);
|
||||||
|
|
||||||
// Compile the handler script.
|
// Compile the handler script.
|
||||||
println!("> Loading script file: {}", path);
|
println!("> Loading script file: {path}");
|
||||||
|
|
||||||
let ast = match engine.compile_file_with_scope(&mut scope, path.into()) {
|
let ast = match engine.compile_file_with_scope(&mut scope, path.into()) {
|
||||||
Ok(ast) => ast,
|
Ok(ast) => ast,
|
||||||
Err(err) => {
|
Err(err) => {
|
||||||
eprintln!("! Error: {}", err);
|
eprintln!("! Error: {err}");
|
||||||
println!("Cannot continue. Bye!");
|
println!("Cannot continue. Bye!");
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
@ -103,7 +103,7 @@ pub fn main() {
|
|||||||
let result = engine.call_fn::<()>(&mut scope, &ast, "init", ());
|
let result = engine.call_fn::<()>(&mut scope, &ast, "init", ());
|
||||||
|
|
||||||
if let Err(err) = result {
|
if let Err(err) = result {
|
||||||
eprintln!("! {}", err)
|
eprintln!("! {err}")
|
||||||
}
|
}
|
||||||
|
|
||||||
// Create handler instance
|
// Create handler instance
|
||||||
@ -141,7 +141,7 @@ pub fn main() {
|
|||||||
let result = engine.call_fn::<()>(scope, ast, event, (arg.to_string(),));
|
let result = engine.call_fn::<()>(scope, ast, event, (arg.to_string(),));
|
||||||
|
|
||||||
if let Err(err) = result {
|
if let Err(err) = result {
|
||||||
eprintln!("! {}", err)
|
eprintln!("! {err}")
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -9,7 +9,7 @@ fn main() -> Result<(), Box<EvalAltResult>> {
|
|||||||
|
|
||||||
let result = engine.eval::<i64>("40 + 2")?;
|
let result = engine.eval::<i64>("40 + 2")?;
|
||||||
|
|
||||||
println!("The Answer: {}", result); // prints 42
|
println!("The Answer: {result}"); // prints 42
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
@ -13,7 +13,7 @@ fn main() -> Result<(), Box<EvalAltResult>> {
|
|||||||
for _ in 0..10 {
|
for _ in 0..10 {
|
||||||
let result = engine.eval_with_scope::<i64>(&mut scope, "x += 1; x")?;
|
let result = engine.eval_with_scope::<i64>(&mut scope, "x += 1; x")?;
|
||||||
|
|
||||||
println!("result: {}", result);
|
println!("result: {result}");
|
||||||
}
|
}
|
||||||
|
|
||||||
println!("x = {}", scope.get_value::<i64>("x").unwrap());
|
println!("x = {}", scope.get_value::<i64>("x").unwrap());
|
||||||
|
@ -36,13 +36,13 @@ fn main() {
|
|||||||
},
|
},
|
||||||
};
|
};
|
||||||
|
|
||||||
println!("Source struct: {:#?}", x);
|
println!("Source struct: {x:#?}");
|
||||||
|
|
||||||
// Convert the 'MyStruct' into a 'Dynamic'
|
// Convert the 'MyStruct' into a 'Dynamic'
|
||||||
let map: Dynamic = to_dynamic(x).unwrap();
|
let map: Dynamic = to_dynamic(x).unwrap();
|
||||||
|
|
||||||
assert!(map.is::<Map>());
|
assert!(map.is::<Map>());
|
||||||
println!("Serialized to Dynamic: {:#?}", map);
|
println!("Serialized to Dynamic: {map:#?}");
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn de() {
|
pub fn de() {
|
||||||
@ -60,7 +60,7 @@ fn main() {
|
|||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
println!("Source Dynamic: {:#?}", result);
|
println!("Source Dynamic: {result:#?}");
|
||||||
|
|
||||||
// Convert the 'Dynamic' object map into 'MyStruct'
|
// Convert the 'Dynamic' object map into 'MyStruct'
|
||||||
let x: MyStruct = from_dynamic(&result).unwrap();
|
let x: MyStruct = from_dynamic(&result).unwrap();
|
||||||
@ -77,7 +77,7 @@ fn main() {
|
|||||||
},
|
},
|
||||||
}
|
}
|
||||||
);
|
);
|
||||||
println!("Deserialized to struct: {:#?}", x);
|
println!("Deserialized to struct: {x:#?}");
|
||||||
}
|
}
|
||||||
|
|
||||||
ser();
|
ser();
|
||||||
|
@ -13,7 +13,7 @@ fn main() -> Result<(), Box<EvalAltResult>> {
|
|||||||
|
|
||||||
let result = engine.eval::<i64>("add(40, 2)")?;
|
let result = engine.eval::<i64>("add(40, 2)")?;
|
||||||
|
|
||||||
println!("Answer: {}", result); // prints 42
|
println!("Answer: {result}"); // prints 42
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
@ -37,10 +37,10 @@ fn main() -> Result<(), Box<EvalAltResult>> {
|
|||||||
.register_fn("index_of", find_substring)
|
.register_fn("index_of", find_substring)
|
||||||
// Register string functions using closures
|
// Register string functions using closures
|
||||||
.register_fn("display", |label: &str, value: i64| {
|
.register_fn("display", |label: &str, value: i64| {
|
||||||
println!("{}: {}", label, value)
|
println!("{label}: {value}")
|
||||||
})
|
})
|
||||||
.register_fn("display", |label: ImmutableString, value: &str| {
|
.register_fn("display", |label: ImmutableString, value: &str| {
|
||||||
println!(r#"{}: "{}""#, label, value) // Quote the input string
|
println!(r#"{label}: "{value}""#) // Quote the input string
|
||||||
});
|
});
|
||||||
|
|
||||||
let mut scope = Scope::new();
|
let mut scope = Scope::new();
|
||||||
|
@ -60,7 +60,7 @@ fn main() {
|
|||||||
let mut value: i64 = 0;
|
let mut value: i64 = 0;
|
||||||
|
|
||||||
while value < 10 {
|
while value < 10 {
|
||||||
println!("Value: {}", value);
|
println!("Value: {value}");
|
||||||
// Send value to script
|
// Send value to script
|
||||||
tx_master.send(value).unwrap();
|
tx_master.send(value).unwrap();
|
||||||
// Receive value from script
|
// Receive value from script
|
||||||
|
@ -4,8 +4,8 @@
|
|||||||
use crate::eval::{Caches, GlobalRuntimeState};
|
use crate::eval::{Caches, GlobalRuntimeState};
|
||||||
use crate::types::dynamic::Variant;
|
use crate::types::dynamic::Variant;
|
||||||
use crate::{
|
use crate::{
|
||||||
reify, Dynamic, Engine, FuncArgs, Position, RhaiResult, RhaiResultOf, Scope, StaticVec, AST,
|
reify, Dynamic, Engine, FuncArgs, Position, RhaiResult, RhaiResultOf, Scope, SharedModule,
|
||||||
ERR,
|
StaticVec, AST, ERR,
|
||||||
};
|
};
|
||||||
use std::any::{type_name, TypeId};
|
use std::any::{type_name, TypeId};
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
@ -233,6 +233,7 @@ impl Engine {
|
|||||||
arg_values,
|
arg_values,
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Call a script function defined in an [`AST`] with multiple [`Dynamic`] arguments.
|
/// Call a script function defined in an [`AST`] with multiple [`Dynamic`] arguments.
|
||||||
fn _call_fn(
|
fn _call_fn(
|
||||||
&self,
|
&self,
|
||||||
@ -247,8 +248,10 @@ impl Engine {
|
|||||||
arg_values: &mut [Dynamic],
|
arg_values: &mut [Dynamic],
|
||||||
) -> RhaiResult {
|
) -> RhaiResult {
|
||||||
let statements = ast.statements();
|
let statements = ast.statements();
|
||||||
let lib = &[ast.as_ref()];
|
let lib = &[AsRef::<SharedModule>::as_ref(ast).clone()];
|
||||||
let mut this_ptr = this_ptr;
|
|
||||||
|
let mut no_this_ptr = Dynamic::NULL;
|
||||||
|
let this_ptr = this_ptr.unwrap_or(&mut no_this_ptr);
|
||||||
|
|
||||||
let orig_scope_len = scope.len();
|
let orig_scope_len = scope.len();
|
||||||
|
|
||||||
@ -257,54 +260,51 @@ impl Engine {
|
|||||||
&mut global.embedded_module_resolver,
|
&mut global.embedded_module_resolver,
|
||||||
ast.resolver().cloned(),
|
ast.resolver().cloned(),
|
||||||
);
|
);
|
||||||
|
#[cfg(not(feature = "no_module"))]
|
||||||
|
let global = &mut *crate::types::RestoreOnDrop::lock(global, move |g| {
|
||||||
|
g.embedded_module_resolver = orig_embedded_module_resolver
|
||||||
|
});
|
||||||
|
|
||||||
let mut result = Ok(Dynamic::UNIT);
|
let result = if eval_ast && !statements.is_empty() {
|
||||||
|
let r = self.eval_global_statements(global, caches, lib, scope, statements);
|
||||||
if eval_ast && !statements.is_empty() {
|
|
||||||
result = self.eval_global_statements(scope, global, caches, statements, lib, 0);
|
|
||||||
|
|
||||||
if rewind_scope {
|
if rewind_scope {
|
||||||
scope.rewind(orig_scope_len);
|
scope.rewind(orig_scope_len);
|
||||||
}
|
}
|
||||||
}
|
|
||||||
|
|
||||||
result = result.and_then(|_| {
|
r
|
||||||
let mut args: StaticVec<_> = arg_values.iter_mut().collect();
|
} else {
|
||||||
|
Ok(Dynamic::UNIT)
|
||||||
|
}
|
||||||
|
.and_then(|_| {
|
||||||
|
let args = &mut arg_values.iter_mut().collect::<StaticVec<_>>();
|
||||||
|
|
||||||
// Check for data race.
|
// Check for data race.
|
||||||
#[cfg(not(feature = "no_closure"))]
|
#[cfg(not(feature = "no_closure"))]
|
||||||
crate::func::call::ensure_no_data_race(name, &args, false).map(|_| Dynamic::UNIT)?;
|
crate::func::ensure_no_data_race(name, args, false).map(|_| Dynamic::UNIT)?;
|
||||||
|
|
||||||
if let Some(fn_def) = ast.shared_lib().get_script_fn(name, args.len()) {
|
if let Some(fn_def) = ast.shared_lib().get_script_fn(name, args.len()) {
|
||||||
self.call_script_fn(
|
self.call_script_fn(
|
||||||
scope,
|
|
||||||
global,
|
global,
|
||||||
caches,
|
caches,
|
||||||
lib,
|
lib,
|
||||||
&mut this_ptr,
|
scope,
|
||||||
|
this_ptr,
|
||||||
fn_def,
|
fn_def,
|
||||||
&mut args,
|
args,
|
||||||
rewind_scope,
|
rewind_scope,
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
0,
|
|
||||||
)
|
)
|
||||||
} else {
|
} else {
|
||||||
Err(ERR::ErrorFunctionNotFound(name.into(), Position::NONE).into())
|
Err(ERR::ErrorFunctionNotFound(name.into(), Position::NONE).into())
|
||||||
}
|
}
|
||||||
});
|
})?;
|
||||||
|
|
||||||
#[cfg(not(feature = "no_module"))]
|
|
||||||
{
|
|
||||||
global.embedded_module_resolver = orig_embedded_module_resolver;
|
|
||||||
}
|
|
||||||
|
|
||||||
let result = result?;
|
|
||||||
|
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
if self.debugger.is_some() {
|
if self.debugger.is_some() {
|
||||||
global.debugger.status = crate::eval::DebuggerStatus::Terminate;
|
global.debugger.status = crate::eval::DebuggerStatus::Terminate;
|
||||||
let node = &crate::ast::Stmt::Noop(Position::NONE);
|
let node = &crate::ast::Stmt::Noop(Position::NONE);
|
||||||
self.run_debugger(scope, global, lib, &mut this_ptr, node, 0)?;
|
self.run_debugger(global, caches, lib, scope, this_ptr, node)?;
|
||||||
}
|
}
|
||||||
|
|
||||||
Ok(result)
|
Ok(result)
|
||||||
|
@ -295,6 +295,6 @@ impl Engine {
|
|||||||
|
|
||||||
let mut peekable = stream.peekable();
|
let mut peekable = stream.peekable();
|
||||||
let mut state = ParseState::new(self, scope, Default::default(), tokenizer_control);
|
let mut state = ParseState::new(self, scope, Default::default(), tokenizer_control);
|
||||||
self.parse_global_expr(&mut peekable, &mut state, self.optimization_level)
|
self.parse_global_expr(&mut peekable, &mut state, |_| {}, self.optimization_level)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -10,9 +10,9 @@ use crate::{
|
|||||||
reify, Dynamic, Engine, EvalContext, Identifier, ImmutableString, LexError, Position,
|
reify, Dynamic, Engine, EvalContext, Identifier, ImmutableString, LexError, Position,
|
||||||
RhaiResult, StaticVec,
|
RhaiResult, StaticVec,
|
||||||
};
|
};
|
||||||
use std::ops::Deref;
|
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
|
use std::{borrow::Borrow, ops::Deref};
|
||||||
|
|
||||||
/// Collection of special markers for custom syntax definition.
|
/// Collection of special markers for custom syntax definition.
|
||||||
pub mod markers {
|
pub mod markers {
|
||||||
@ -145,8 +145,17 @@ impl Expression<'_> {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl Borrow<Expr> for Expression<'_> {
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
fn borrow(&self) -> &Expr {
|
||||||
|
self.0
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
impl AsRef<Expr> for Expression<'_> {
|
impl AsRef<Expr> for Expression<'_> {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn as_ref(&self) -> &Expr {
|
fn as_ref(&self) -> &Expr {
|
||||||
self.0
|
self.0
|
||||||
}
|
}
|
||||||
@ -219,7 +228,13 @@ impl Engine {
|
|||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
|
|
||||||
let token = Token::lookup_from_syntax(s);
|
let token = Token::lookup_symbol_from_syntax(s).or_else(|| {
|
||||||
|
if Token::is_reserved_keyword(s) {
|
||||||
|
Some(Token::Reserved(Box::new(s.into())))
|
||||||
|
} else {
|
||||||
|
None
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
let seg = match s {
|
let seg = match s {
|
||||||
// Markers not in first position
|
// Markers not in first position
|
||||||
@ -264,7 +279,7 @@ impl Engine {
|
|||||||
.into_err(Position::NONE));
|
.into_err(Position::NONE));
|
||||||
}
|
}
|
||||||
// Identifier in first position
|
// Identifier in first position
|
||||||
_ if segments.is_empty() && is_valid_identifier(s.chars()) => {
|
_ if segments.is_empty() && is_valid_identifier(s) => {
|
||||||
// Make it a custom keyword/symbol if it is disabled or reserved
|
// Make it a custom keyword/symbol if it is disabled or reserved
|
||||||
if (!self.disabled_symbols.is_empty() && self.disabled_symbols.contains(s))
|
if (!self.disabled_symbols.is_empty() && self.disabled_symbols.contains(s))
|
||||||
|| token.map_or(false, |v| v.is_reserved())
|
|| token.map_or(false, |v| v.is_reserved())
|
||||||
|
@ -77,6 +77,7 @@ pub struct DefinitionsConfig {
|
|||||||
|
|
||||||
impl Default for DefinitionsConfig {
|
impl Default for DefinitionsConfig {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
Self {
|
Self {
|
||||||
write_headers: false,
|
write_headers: false,
|
||||||
@ -439,19 +440,17 @@ impl Module {
|
|||||||
}
|
}
|
||||||
first = false;
|
first = false;
|
||||||
|
|
||||||
if f.access == FnAccess::Private {
|
if f.access != FnAccess::Private {
|
||||||
continue;
|
|
||||||
}
|
|
||||||
|
|
||||||
#[cfg(not(feature = "no_custom_syntax"))]
|
#[cfg(not(feature = "no_custom_syntax"))]
|
||||||
let operator = def.engine.custom_keywords.contains_key(&f.name)
|
let operator = def.engine.custom_keywords.contains_key(f.name.as_str())
|
||||||
|| (!f.name.contains('$') && !is_valid_function_name(&f.name));
|
|| (!f.name.contains('$') && !is_valid_function_name(f.name.as_str()));
|
||||||
|
|
||||||
#[cfg(feature = "no_custom_syntax")]
|
#[cfg(feature = "no_custom_syntax")]
|
||||||
let operator = !f.name.contains('$') && !is_valid_function_name(&f.name);
|
let operator = !f.name.contains('$') && !is_valid_function_name(&f.name);
|
||||||
|
|
||||||
f.write_definition(writer, def, operator)?;
|
f.write_definition(writer, def, operator)?;
|
||||||
}
|
}
|
||||||
|
}
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
@ -554,7 +553,7 @@ fn def_type_name<'a>(ty: &'a str, engine: &'a Engine) -> Cow<'a, str> {
|
|||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
let ty = ty.replace(type_name::<crate::Map>(), "Map");
|
let ty = ty.replace(type_name::<crate::Map>(), "Map");
|
||||||
|
|
||||||
#[cfg(not(feature = "no_std"))]
|
#[cfg(not(feature = "no_time"))]
|
||||||
let ty = ty.replace(type_name::<crate::Instant>(), "Instant");
|
let ty = ty.replace(type_name::<crate::Instant>(), "Instant");
|
||||||
|
|
||||||
let ty = ty.replace(type_name::<FnPtr>(), "FnPtr");
|
let ty = ty.replace(type_name::<FnPtr>(), "FnPtr");
|
||||||
|
@ -4,7 +4,7 @@ use crate::func::RegisterNativeFunction;
|
|||||||
use crate::types::dynamic::Variant;
|
use crate::types::dynamic::Variant;
|
||||||
use crate::{
|
use crate::{
|
||||||
Dynamic, Engine, EvalAltResult, FnPtr, Identifier, ImmutableString, NativeCallContext,
|
Dynamic, Engine, EvalAltResult, FnPtr, Identifier, ImmutableString, NativeCallContext,
|
||||||
Position, RhaiResult, RhaiResultOf, Scope, AST,
|
Position, RhaiResult, RhaiResultOf, Scope, SharedModule, AST,
|
||||||
};
|
};
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
@ -354,6 +354,26 @@ impl Dynamic {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl NativeCallContext<'_> {
|
impl NativeCallContext<'_> {
|
||||||
|
/// Create a new [`NativeCallContext`].
|
||||||
|
///
|
||||||
|
/// # Unimplemented
|
||||||
|
///
|
||||||
|
/// This method is deprecated. It is no longer implemented and always panics.
|
||||||
|
///
|
||||||
|
/// Use [`FnPtr::call`] to call a function pointer directly.
|
||||||
|
///
|
||||||
|
/// This method will be removed in the next major version.
|
||||||
|
#[deprecated(
|
||||||
|
since = "1.3.0",
|
||||||
|
note = "use `FnPtr::call` to call a function pointer directly."
|
||||||
|
)]
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
#[allow(unused_variables)]
|
||||||
|
pub fn new(engine: &Engine, fn_name: &str, lib: &[SharedModule]) -> Self {
|
||||||
|
unimplemented!("`NativeCallContext::new` is deprecated");
|
||||||
|
}
|
||||||
|
|
||||||
/// Call a function inside the call context.
|
/// Call a function inside the call context.
|
||||||
///
|
///
|
||||||
/// # Deprecated
|
/// # Deprecated
|
||||||
|
@ -122,6 +122,7 @@ impl Engine {
|
|||||||
let ast = self.parse_global_expr(
|
let ast = self.parse_global_expr(
|
||||||
&mut stream.peekable(),
|
&mut stream.peekable(),
|
||||||
&mut state,
|
&mut state,
|
||||||
|
|_| {},
|
||||||
#[cfg(not(feature = "no_optimize"))]
|
#[cfg(not(feature = "no_optimize"))]
|
||||||
OptimizationLevel::None,
|
OptimizationLevel::None,
|
||||||
#[cfg(feature = "no_optimize")]
|
#[cfg(feature = "no_optimize")]
|
||||||
@ -185,18 +186,21 @@ impl Engine {
|
|||||||
ast: &AST,
|
ast: &AST,
|
||||||
) -> RhaiResultOf<T> {
|
) -> RhaiResultOf<T> {
|
||||||
let global = &mut GlobalRuntimeState::new(self);
|
let global = &mut GlobalRuntimeState::new(self);
|
||||||
|
let caches = &mut Caches::new();
|
||||||
|
|
||||||
let result = self.eval_ast_with_scope_raw(scope, global, ast, 0)?;
|
let result = self.eval_ast_with_scope_raw(global, caches, scope, ast)?;
|
||||||
|
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
if self.debugger.is_some() {
|
if self.debugger.is_some() {
|
||||||
global.debugger.status = crate::eval::DebuggerStatus::Terminate;
|
global.debugger.status = crate::eval::DebuggerStatus::Terminate;
|
||||||
let lib = &[
|
let lib = &[
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
ast.as_ref(),
|
AsRef::<crate::SharedModule>::as_ref(ast).clone(),
|
||||||
];
|
];
|
||||||
|
let mut this = Dynamic::NULL;
|
||||||
let node = &crate::ast::Stmt::Noop(Position::NONE);
|
let node = &crate::ast::Stmt::Noop(Position::NONE);
|
||||||
self.run_debugger(scope, global, lib, &mut None, node, 0)?;
|
|
||||||
|
self.run_debugger(global, caches, lib, scope, &mut this, node)?;
|
||||||
}
|
}
|
||||||
|
|
||||||
let typ = self.map_type_name(result.type_name());
|
let typ = self.map_type_name(result.type_name());
|
||||||
@ -210,19 +214,23 @@ impl Engine {
|
|||||||
#[inline]
|
#[inline]
|
||||||
pub(crate) fn eval_ast_with_scope_raw<'a>(
|
pub(crate) fn eval_ast_with_scope_raw<'a>(
|
||||||
&self,
|
&self,
|
||||||
scope: &mut Scope,
|
|
||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
|
caches: &mut Caches,
|
||||||
|
|
||||||
|
scope: &mut Scope,
|
||||||
ast: &'a AST,
|
ast: &'a AST,
|
||||||
level: usize,
|
|
||||||
) -> RhaiResult {
|
) -> RhaiResult {
|
||||||
let mut caches = Caches::new();
|
global.source = ast.source_raw().cloned();
|
||||||
global.source = ast.source_raw().clone();
|
|
||||||
|
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
let orig_embedded_module_resolver = std::mem::replace(
|
let orig_embedded_module_resolver = std::mem::replace(
|
||||||
&mut global.embedded_module_resolver,
|
&mut global.embedded_module_resolver,
|
||||||
ast.resolver().cloned(),
|
ast.resolver().cloned(),
|
||||||
);
|
);
|
||||||
|
#[cfg(not(feature = "no_module"))]
|
||||||
|
let global = &mut *crate::types::RestoreOnDrop::lock(global, move |g| {
|
||||||
|
g.embedded_module_resolver = orig_embedded_module_resolver
|
||||||
|
});
|
||||||
|
|
||||||
let statements = ast.statements();
|
let statements = ast.statements();
|
||||||
|
|
||||||
@ -230,24 +238,12 @@ impl Engine {
|
|||||||
return Ok(Dynamic::UNIT);
|
return Ok(Dynamic::UNIT);
|
||||||
}
|
}
|
||||||
|
|
||||||
let mut _lib = &[
|
let lib = &[
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
ast.as_ref(),
|
AsRef::<crate::SharedModule>::as_ref(ast).clone(),
|
||||||
][..];
|
];
|
||||||
#[cfg(not(feature = "no_function"))]
|
|
||||||
if !ast.has_functions() {
|
|
||||||
_lib = &[];
|
|
||||||
}
|
|
||||||
|
|
||||||
let result =
|
self.eval_global_statements(global, caches, lib, scope, statements)
|
||||||
self.eval_global_statements(scope, global, &mut caches, statements, _lib, level);
|
|
||||||
|
|
||||||
#[cfg(not(feature = "no_module"))]
|
|
||||||
{
|
|
||||||
global.embedded_module_resolver = orig_embedded_module_resolver;
|
|
||||||
}
|
|
||||||
|
|
||||||
result
|
|
||||||
}
|
}
|
||||||
/// _(internals)_ Evaluate a list of statements with no `this` pointer.
|
/// _(internals)_ Evaluate a list of statements with no `this` pointer.
|
||||||
/// Exported under the `internals` feature only.
|
/// Exported under the `internals` feature only.
|
||||||
@ -261,14 +257,14 @@ impl Engine {
|
|||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn eval_statements_raw(
|
pub fn eval_statements_raw(
|
||||||
&self,
|
&self,
|
||||||
scope: &mut Scope,
|
|
||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
caches: &mut Caches,
|
caches: &mut Caches,
|
||||||
|
lib: &[crate::SharedModule],
|
||||||
|
|
||||||
|
scope: &mut Scope,
|
||||||
statements: &[crate::ast::Stmt],
|
statements: &[crate::ast::Stmt],
|
||||||
lib: &[&crate::Module],
|
|
||||||
level: usize,
|
|
||||||
) -> RhaiResult {
|
) -> RhaiResult {
|
||||||
self.eval_global_statements(scope, global, caches, statements, lib, level)
|
self.eval_global_statements(global, caches, lib, scope, statements)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -169,10 +169,11 @@ impl Engine {
|
|||||||
/// let mut engine = Engine::new();
|
/// let mut engine = Engine::new();
|
||||||
///
|
///
|
||||||
/// // Register a token mapper.
|
/// // Register a token mapper.
|
||||||
|
/// # #[allow(deprecated)]
|
||||||
/// engine.on_parse_token(|token, _, _| {
|
/// engine.on_parse_token(|token, _, _| {
|
||||||
/// match token {
|
/// match token {
|
||||||
/// // Convert all integer literals to strings
|
/// // Convert all integer literals to strings
|
||||||
/// Token::IntegerConstant(n) => Token::StringConstant(n.to_string().into()),
|
/// Token::IntegerConstant(n) => Token::StringConstant(Box::new(n.to_string().into())),
|
||||||
/// // Convert 'begin' .. 'end' to '{' .. '}'
|
/// // Convert 'begin' .. 'end' to '{' .. '}'
|
||||||
/// Token::Identifier(s) if &*s == "begin" => Token::LeftBrace,
|
/// Token::Identifier(s) if &*s == "begin" => Token::LeftBrace,
|
||||||
/// Token::Identifier(s) if &*s == "end" => Token::RightBrace,
|
/// Token::Identifier(s) if &*s == "end" => Token::RightBrace,
|
||||||
|
@ -108,7 +108,7 @@ impl Engine {
|
|||||||
pub fn compile_file_with_scope(&self, scope: &Scope, path: PathBuf) -> RhaiResultOf<AST> {
|
pub fn compile_file_with_scope(&self, scope: &Scope, path: PathBuf) -> RhaiResultOf<AST> {
|
||||||
Self::read_file(&path).and_then(|contents| {
|
Self::read_file(&path).and_then(|contents| {
|
||||||
let mut ast = self.compile_with_scope(scope, &contents)?;
|
let mut ast = self.compile_with_scope(scope, &contents)?;
|
||||||
ast.set_source(path.to_string_lossy());
|
ast.set_source(path.to_string_lossy().as_ref());
|
||||||
Ok(ast)
|
Ok(ast)
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
|
@ -23,7 +23,7 @@ impl Engine {
|
|||||||
/// JSON sub-objects are handled transparently.
|
/// JSON sub-objects are handled transparently.
|
||||||
///
|
///
|
||||||
/// This function can be used together with [`format_map_as_json`] to work with JSON texts
|
/// This function can be used together with [`format_map_as_json`] to work with JSON texts
|
||||||
/// without using the [`serde`](https://crates.io/crates/serde) crate (which is heavy).
|
/// without using the [`serde_json`](https://crates.io/crates/serde_json) crate (which is heavy).
|
||||||
///
|
///
|
||||||
/// # Example
|
/// # Example
|
||||||
///
|
///
|
||||||
@ -122,6 +122,7 @@ impl Engine {
|
|||||||
let ast = self.parse_global_expr(
|
let ast = self.parse_global_expr(
|
||||||
&mut stream.peekable(),
|
&mut stream.peekable(),
|
||||||
&mut state,
|
&mut state,
|
||||||
|
|s| s.allow_unquoted_map_properties = false,
|
||||||
#[cfg(not(feature = "no_optimize"))]
|
#[cfg(not(feature = "no_optimize"))]
|
||||||
OptimizationLevel::None,
|
OptimizationLevel::None,
|
||||||
#[cfg(feature = "no_optimize")]
|
#[cfg(feature = "no_optimize")]
|
||||||
@ -137,7 +138,7 @@ impl Engine {
|
|||||||
/// Not available under `no_std`.
|
/// Not available under `no_std`.
|
||||||
///
|
///
|
||||||
/// This function can be used together with [`Engine::parse_json`] to work with JSON texts
|
/// This function can be used together with [`Engine::parse_json`] to work with JSON texts
|
||||||
/// without using the [`serde`](https://crates.io/crates/serde) crate (which is heavy).
|
/// without using the [`serde_json`](https://crates.io/crates/serde_json) crate (which is heavy).
|
||||||
///
|
///
|
||||||
/// # Data types
|
/// # Data types
|
||||||
///
|
///
|
||||||
@ -165,10 +166,7 @@ pub fn format_map_as_json(map: &Map) -> String {
|
|||||||
|
|
||||||
if let Some(val) = value.read_lock::<Map>() {
|
if let Some(val) = value.read_lock::<Map>() {
|
||||||
result.push_str(&format_map_as_json(&*val));
|
result.push_str(&format_map_as_json(&*val));
|
||||||
continue;
|
} else if value.is::<()>() {
|
||||||
}
|
|
||||||
|
|
||||||
if value.is::<()>() {
|
|
||||||
result.push_str("null");
|
result.push_str("null");
|
||||||
} else {
|
} else {
|
||||||
write!(result, "{:?}", value).unwrap();
|
write!(result, "{:?}", value).unwrap();
|
||||||
|
@ -1,12 +1,31 @@
|
|||||||
//! Settings for [`Engine`]'s limitations.
|
//! Settings for [`Engine`]'s limitations.
|
||||||
#![cfg(not(feature = "unchecked"))]
|
#![cfg(not(feature = "unchecked"))]
|
||||||
|
|
||||||
use super::default_limits;
|
|
||||||
use crate::Engine;
|
use crate::Engine;
|
||||||
use std::num::{NonZeroU64, NonZeroUsize};
|
use std::num::{NonZeroU64, NonZeroUsize};
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
|
|
||||||
|
pub mod default_limits {
|
||||||
|
#[cfg(debug_assertions)]
|
||||||
|
#[cfg(not(feature = "no_function"))]
|
||||||
|
pub const MAX_CALL_STACK_DEPTH: usize = 8;
|
||||||
|
#[cfg(debug_assertions)]
|
||||||
|
pub const MAX_EXPR_DEPTH: usize = 32;
|
||||||
|
#[cfg(not(feature = "no_function"))]
|
||||||
|
#[cfg(debug_assertions)]
|
||||||
|
pub const MAX_FUNCTION_EXPR_DEPTH: usize = 16;
|
||||||
|
|
||||||
|
#[cfg(not(debug_assertions))]
|
||||||
|
#[cfg(not(feature = "no_function"))]
|
||||||
|
pub const MAX_CALL_STACK_DEPTH: usize = 64;
|
||||||
|
#[cfg(not(debug_assertions))]
|
||||||
|
pub const MAX_EXPR_DEPTH: usize = 64;
|
||||||
|
#[cfg(not(feature = "no_function"))]
|
||||||
|
#[cfg(not(debug_assertions))]
|
||||||
|
pub const MAX_FUNCTION_EXPR_DEPTH: usize = 32;
|
||||||
|
}
|
||||||
|
|
||||||
/// A type containing all the limits imposed by the [`Engine`].
|
/// A type containing all the limits imposed by the [`Engine`].
|
||||||
///
|
///
|
||||||
/// Not available under `unchecked`.
|
/// Not available under `unchecked`.
|
||||||
@ -75,12 +94,34 @@ impl Limits {
|
|||||||
|
|
||||||
impl Default for Limits {
|
impl Default for Limits {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
Self::new()
|
Self::new()
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Engine {
|
impl Engine {
|
||||||
|
/// Is there a data size limit set?
|
||||||
|
#[inline]
|
||||||
|
pub(crate) const fn has_data_size_limit(&self) -> bool {
|
||||||
|
self.limits.max_string_size.is_some()
|
||||||
|
|| {
|
||||||
|
#[cfg(not(feature = "no_index"))]
|
||||||
|
{
|
||||||
|
self.limits.max_array_size.is_some()
|
||||||
|
}
|
||||||
|
#[cfg(feature = "no_index")]
|
||||||
|
false
|
||||||
|
}
|
||||||
|
|| {
|
||||||
|
#[cfg(not(feature = "no_object"))]
|
||||||
|
{
|
||||||
|
self.limits.max_map_size.is_some()
|
||||||
|
}
|
||||||
|
#[cfg(feature = "no_object")]
|
||||||
|
false
|
||||||
|
}
|
||||||
|
}
|
||||||
/// Set the maximum levels of function calls allowed for a script in order to avoid
|
/// Set the maximum levels of function calls allowed for a script in order to avoid
|
||||||
/// infinite recursion and stack overflows.
|
/// infinite recursion and stack overflows.
|
||||||
///
|
///
|
||||||
@ -93,12 +134,14 @@ impl Engine {
|
|||||||
}
|
}
|
||||||
/// The maximum levels of function calls allowed for a script.
|
/// The maximum levels of function calls allowed for a script.
|
||||||
///
|
///
|
||||||
/// Not available under `unchecked` or `no_function`.
|
/// Zero under `no_function`.
|
||||||
#[cfg(not(feature = "no_function"))]
|
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn max_call_levels(&self) -> usize {
|
pub const fn max_call_levels(&self) -> usize {
|
||||||
self.limits.max_call_stack_depth
|
#[cfg(not(feature = "no_function"))]
|
||||||
|
return self.limits.max_call_stack_depth;
|
||||||
|
#[cfg(feature = "no_function")]
|
||||||
|
return 0;
|
||||||
}
|
}
|
||||||
/// Set the maximum number of operations allowed for a script to run to avoid
|
/// Set the maximum number of operations allowed for a script to run to avoid
|
||||||
/// consuming too much resources (0 for unlimited).
|
/// consuming too much resources (0 for unlimited).
|
||||||
@ -115,10 +158,9 @@ impl Engine {
|
|||||||
#[inline]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn max_operations(&self) -> u64 {
|
pub const fn max_operations(&self) -> u64 {
|
||||||
if let Some(n) = self.limits.max_operations {
|
match self.limits.max_operations {
|
||||||
n.get()
|
Some(n) => n.get(),
|
||||||
} else {
|
None => 0,
|
||||||
0
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
/// Set the maximum number of imported [modules][crate::Module] allowed for a script.
|
/// Set the maximum number of imported [modules][crate::Module] allowed for a script.
|
||||||
@ -132,12 +174,14 @@ impl Engine {
|
|||||||
}
|
}
|
||||||
/// The maximum number of imported [modules][crate::Module] allowed for a script.
|
/// The maximum number of imported [modules][crate::Module] allowed for a script.
|
||||||
///
|
///
|
||||||
/// Not available under `unchecked` or `no_module`.
|
/// Zero under `no_module`.
|
||||||
#[cfg(not(feature = "no_module"))]
|
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn max_modules(&self) -> usize {
|
pub const fn max_modules(&self) -> usize {
|
||||||
self.limits.max_modules
|
#[cfg(not(feature = "no_module"))]
|
||||||
|
return self.limits.max_modules;
|
||||||
|
#[cfg(feature = "no_module")]
|
||||||
|
return 0;
|
||||||
}
|
}
|
||||||
/// Set the depth limits for expressions (0 for unlimited).
|
/// Set the depth limits for expressions (0 for unlimited).
|
||||||
///
|
///
|
||||||
@ -156,29 +200,27 @@ impl Engine {
|
|||||||
self
|
self
|
||||||
}
|
}
|
||||||
/// The depth limit for expressions (0 for unlimited).
|
/// The depth limit for expressions (0 for unlimited).
|
||||||
///
|
|
||||||
/// Not available under `unchecked`.
|
|
||||||
#[inline]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn max_expr_depth(&self) -> usize {
|
pub const fn max_expr_depth(&self) -> usize {
|
||||||
if let Some(n) = self.limits.max_expr_depth {
|
match self.limits.max_expr_depth {
|
||||||
n.get()
|
Some(n) => n.get(),
|
||||||
} else {
|
None => 0,
|
||||||
0
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
/// The depth limit for expressions in functions (0 for unlimited).
|
/// The depth limit for expressions in functions (0 for unlimited).
|
||||||
///
|
///
|
||||||
/// Not available under `unchecked` or `no_function`.
|
/// Zero under `no_function`.
|
||||||
#[cfg(not(feature = "no_function"))]
|
|
||||||
#[inline]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn max_function_expr_depth(&self) -> usize {
|
pub const fn max_function_expr_depth(&self) -> usize {
|
||||||
if let Some(n) = self.limits.max_function_expr_depth {
|
#[cfg(not(feature = "no_function"))]
|
||||||
n.get()
|
return match self.limits.max_function_expr_depth {
|
||||||
} else {
|
Some(n) => n.get(),
|
||||||
0
|
None => 0,
|
||||||
}
|
};
|
||||||
|
#[cfg(feature = "no_function")]
|
||||||
|
return 0;
|
||||||
}
|
}
|
||||||
/// Set the maximum length of [strings][crate::ImmutableString] (0 for unlimited).
|
/// Set the maximum length of [strings][crate::ImmutableString] (0 for unlimited).
|
||||||
///
|
///
|
||||||
@ -189,15 +231,12 @@ impl Engine {
|
|||||||
self
|
self
|
||||||
}
|
}
|
||||||
/// The maximum length of [strings][crate::ImmutableString] (0 for unlimited).
|
/// The maximum length of [strings][crate::ImmutableString] (0 for unlimited).
|
||||||
///
|
|
||||||
/// Not available under `unchecked`.
|
|
||||||
#[inline]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn max_string_size(&self) -> usize {
|
pub const fn max_string_size(&self) -> usize {
|
||||||
if let Some(n) = self.limits.max_string_size {
|
match self.limits.max_string_size {
|
||||||
n.get()
|
Some(n) => n.get(),
|
||||||
} else {
|
None => 0,
|
||||||
0
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
/// Set the maximum length of [arrays][crate::Array] (0 for unlimited).
|
/// Set the maximum length of [arrays][crate::Array] (0 for unlimited).
|
||||||
@ -211,16 +250,17 @@ impl Engine {
|
|||||||
}
|
}
|
||||||
/// The maximum length of [arrays][crate::Array] (0 for unlimited).
|
/// The maximum length of [arrays][crate::Array] (0 for unlimited).
|
||||||
///
|
///
|
||||||
/// Not available under `unchecked` or `no_index`.
|
/// Zero under `no_index`.
|
||||||
#[cfg(not(feature = "no_index"))]
|
|
||||||
#[inline]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn max_array_size(&self) -> usize {
|
pub const fn max_array_size(&self) -> usize {
|
||||||
if let Some(n) = self.limits.max_array_size {
|
#[cfg(not(feature = "no_index"))]
|
||||||
n.get()
|
return match self.limits.max_array_size {
|
||||||
} else {
|
Some(n) => n.get(),
|
||||||
0
|
None => 0,
|
||||||
}
|
};
|
||||||
|
#[cfg(feature = "no_index")]
|
||||||
|
return 0;
|
||||||
}
|
}
|
||||||
/// Set the maximum size of [object maps][crate::Map] (0 for unlimited).
|
/// Set the maximum size of [object maps][crate::Map] (0 for unlimited).
|
||||||
///
|
///
|
||||||
@ -233,15 +273,16 @@ impl Engine {
|
|||||||
}
|
}
|
||||||
/// The maximum size of [object maps][crate::Map] (0 for unlimited).
|
/// The maximum size of [object maps][crate::Map] (0 for unlimited).
|
||||||
///
|
///
|
||||||
/// Not available under `unchecked` or `no_object`.
|
/// Zero under `no_object`.
|
||||||
#[cfg(not(feature = "no_object"))]
|
|
||||||
#[inline]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn max_map_size(&self) -> usize {
|
pub const fn max_map_size(&self) -> usize {
|
||||||
if let Some(n) = self.limits.max_map_size {
|
#[cfg(not(feature = "no_object"))]
|
||||||
n.get()
|
return match self.limits.max_map_size {
|
||||||
} else {
|
Some(n) => n.get(),
|
||||||
0
|
None => 0,
|
||||||
}
|
};
|
||||||
|
#[cfg(feature = "no_object")]
|
||||||
|
return 0;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
103
src/api/mod.rs
103
src/api/mod.rs
@ -35,36 +35,12 @@ pub mod definitions;
|
|||||||
|
|
||||||
use crate::{Dynamic, Engine, Identifier};
|
use crate::{Dynamic, Engine, Identifier};
|
||||||
|
|
||||||
#[cfg(not(feature = "no_custom_syntax"))]
|
|
||||||
use crate::{engine::Precedence, tokenizer::Token};
|
|
||||||
|
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
|
|
||||||
pub mod default_limits {
|
pub mod default_limits {
|
||||||
#[cfg(not(feature = "unchecked"))]
|
#[cfg(not(feature = "unchecked"))]
|
||||||
#[cfg(debug_assertions)]
|
pub use super::limits::default_limits::*;
|
||||||
#[cfg(not(feature = "no_function"))]
|
|
||||||
pub const MAX_CALL_STACK_DEPTH: usize = 8;
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
#[cfg(debug_assertions)]
|
|
||||||
pub const MAX_EXPR_DEPTH: usize = 32;
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
#[cfg(not(feature = "no_function"))]
|
|
||||||
#[cfg(debug_assertions)]
|
|
||||||
pub const MAX_FUNCTION_EXPR_DEPTH: usize = 16;
|
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
#[cfg(not(debug_assertions))]
|
|
||||||
#[cfg(not(feature = "no_function"))]
|
|
||||||
pub const MAX_CALL_STACK_DEPTH: usize = 64;
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
#[cfg(not(debug_assertions))]
|
|
||||||
pub const MAX_EXPR_DEPTH: usize = 64;
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
#[cfg(not(feature = "no_function"))]
|
|
||||||
#[cfg(not(debug_assertions))]
|
|
||||||
pub const MAX_FUNCTION_EXPR_DEPTH: usize = 32;
|
|
||||||
|
|
||||||
pub const MAX_DYNAMIC_PARAMETERS: usize = 16;
|
pub const MAX_DYNAMIC_PARAMETERS: usize = 16;
|
||||||
}
|
}
|
||||||
@ -75,6 +51,7 @@ impl Engine {
|
|||||||
/// Not available under `no_module`.
|
/// Not available under `no_module`.
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
pub fn module_resolver(&self) -> &dyn crate::ModuleResolver {
|
pub fn module_resolver(&self) -> &dyn crate::ModuleResolver {
|
||||||
&*self.module_resolver
|
&*self.module_resolver
|
||||||
}
|
}
|
||||||
@ -170,12 +147,14 @@ impl Engine {
|
|||||||
keyword: impl AsRef<str>,
|
keyword: impl AsRef<str>,
|
||||||
precedence: u8,
|
precedence: u8,
|
||||||
) -> Result<&mut Self, String> {
|
) -> Result<&mut Self, String> {
|
||||||
let precedence =
|
use crate::tokenizer::Token;
|
||||||
Precedence::new(precedence).ok_or_else(|| "precedence cannot be zero".to_string())?;
|
|
||||||
|
let precedence = crate::engine::Precedence::new(precedence)
|
||||||
|
.ok_or_else(|| "precedence cannot be zero".to_string())?;
|
||||||
|
|
||||||
let keyword = keyword.as_ref();
|
let keyword = keyword.as_ref();
|
||||||
|
|
||||||
match Token::lookup_from_syntax(keyword) {
|
match Token::lookup_symbol_from_syntax(keyword) {
|
||||||
// Standard identifiers and reserved keywords are OK
|
// Standard identifiers and reserved keywords are OK
|
||||||
None | Some(Token::Reserved(..)) => (),
|
None | Some(Token::Reserved(..)) => (),
|
||||||
// custom keywords are OK
|
// custom keywords are OK
|
||||||
@ -235,3 +214,71 @@ impl Engine {
|
|||||||
self
|
self
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "unchecked")]
|
||||||
|
impl Engine {
|
||||||
|
/// The maximum levels of function calls allowed for a script.
|
||||||
|
///
|
||||||
|
/// Always returns [`usize::MAX`] under `unchecked`.
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
pub const fn max_call_levels(&self) -> usize {
|
||||||
|
usize::MAX
|
||||||
|
}
|
||||||
|
/// The maximum number of operations allowed for a script to run (0 for unlimited).
|
||||||
|
///
|
||||||
|
/// Always returns zero under `unchecked`.
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
pub const fn max_operations(&self) -> u64 {
|
||||||
|
0
|
||||||
|
}
|
||||||
|
/// The maximum number of imported [modules][crate::Module] allowed for a script.
|
||||||
|
///
|
||||||
|
/// Always returns [`usize::MAX`] under `unchecked`.
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
pub const fn max_modules(&self) -> usize {
|
||||||
|
usize::MAX
|
||||||
|
}
|
||||||
|
/// The depth limit for expressions (0 for unlimited).
|
||||||
|
///
|
||||||
|
/// Always returns zero under `unchecked`.
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
pub const fn max_expr_depth(&self) -> usize {
|
||||||
|
0
|
||||||
|
}
|
||||||
|
/// The depth limit for expressions in functions (0 for unlimited).
|
||||||
|
///
|
||||||
|
/// Always returns zero under `unchecked`.
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
pub const fn max_function_expr_depth(&self) -> usize {
|
||||||
|
0
|
||||||
|
}
|
||||||
|
/// The maximum length of [strings][crate::ImmutableString] (0 for unlimited).
|
||||||
|
///
|
||||||
|
/// Always returns zero under `unchecked`.
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
pub const fn max_string_size(&self) -> usize {
|
||||||
|
0
|
||||||
|
}
|
||||||
|
/// The maximum length of [arrays][crate::Array] (0 for unlimited).
|
||||||
|
///
|
||||||
|
/// Always returns zero under `unchecked`.
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
pub const fn max_array_size(&self) -> usize {
|
||||||
|
0
|
||||||
|
}
|
||||||
|
/// The maximum size of [object maps][crate::Map] (0 for unlimited).
|
||||||
|
///
|
||||||
|
/// Always returns zero under `unchecked`.
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
pub const fn max_map_size(&self) -> usize {
|
||||||
|
0
|
||||||
|
}
|
||||||
|
}
|
||||||
|
@ -12,23 +12,25 @@ bitflags! {
|
|||||||
const IF_EXPR = 0b_0000_0000_0001;
|
const IF_EXPR = 0b_0000_0000_0001;
|
||||||
/// Is `switch` expression allowed?
|
/// Is `switch` expression allowed?
|
||||||
const SWITCH_EXPR = 0b_0000_0000_0010;
|
const SWITCH_EXPR = 0b_0000_0000_0010;
|
||||||
|
/// Are loop expressions allowed?
|
||||||
|
const LOOP_EXPR = 0b_0000_0000_0100;
|
||||||
/// Is statement-expression allowed?
|
/// Is statement-expression allowed?
|
||||||
const STMT_EXPR = 0b_0000_0000_0100;
|
const STMT_EXPR = 0b_0000_0000_1000;
|
||||||
/// Is anonymous function allowed?
|
/// Is anonymous function allowed?
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
const ANON_FN = 0b_0000_0000_1000;
|
const ANON_FN = 0b_0000_0001_0000;
|
||||||
/// Is looping allowed?
|
/// Is looping allowed?
|
||||||
const LOOPING = 0b_0000_0001_0000;
|
const LOOPING = 0b_0000_0010_0000;
|
||||||
/// Is variables shadowing allowed?
|
/// Is variables shadowing allowed?
|
||||||
const SHADOW = 0b_0000_0010_0000;
|
const SHADOW = 0b_0000_0100_0000;
|
||||||
/// Strict variables mode?
|
/// Strict variables mode?
|
||||||
const STRICT_VAR = 0b_0000_0100_0000;
|
const STRICT_VAR = 0b_0000_1000_0000;
|
||||||
/// Raise error if an object map property does not exist?
|
/// Raise error if an object map property does not exist?
|
||||||
/// Returns `()` if `false`.
|
/// Returns `()` if `false`.
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
const FAIL_ON_INVALID_MAP_PROPERTY = 0b_0000_1000_0000;
|
const FAIL_ON_INVALID_MAP_PROPERTY = 0b_0001_0000_0000;
|
||||||
/// Fast operators mode?
|
/// Fast operators mode?
|
||||||
const FAST_OPS = 0b_0001_0000_0000;
|
const FAST_OPS = 0b_0010_0000_0000;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -81,6 +83,18 @@ impl Engine {
|
|||||||
pub fn set_allow_switch_expression(&mut self, enable: bool) {
|
pub fn set_allow_switch_expression(&mut self, enable: bool) {
|
||||||
self.options.set(LangOptions::SWITCH_EXPR, enable);
|
self.options.set(LangOptions::SWITCH_EXPR, enable);
|
||||||
}
|
}
|
||||||
|
/// Are loop expressions allowed?
|
||||||
|
/// Default is `true`.
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
pub const fn allow_loop_expressions(&self) -> bool {
|
||||||
|
self.options.contains(LangOptions::LOOP_EXPR)
|
||||||
|
}
|
||||||
|
/// Set whether loop expressions are allowed.
|
||||||
|
#[inline(always)]
|
||||||
|
pub fn set_allow_loop_expressions(&mut self, enable: bool) {
|
||||||
|
self.options.set(LangOptions::LOOP_EXPR, enable);
|
||||||
|
}
|
||||||
/// Is statement-expression allowed?
|
/// Is statement-expression allowed?
|
||||||
/// Default is `true`.
|
/// Default is `true`.
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
@ -4,6 +4,7 @@ use crate::func::{FnCallArgs, RegisterNativeFunction, SendSync};
|
|||||||
use crate::types::dynamic::Variant;
|
use crate::types::dynamic::Variant;
|
||||||
use crate::{
|
use crate::{
|
||||||
Engine, FnAccess, FnNamespace, Identifier, Module, NativeCallContext, RhaiResultOf, Shared,
|
Engine, FnAccess, FnNamespace, Identifier, Module, NativeCallContext, RhaiResultOf, Shared,
|
||||||
|
SharedModule,
|
||||||
};
|
};
|
||||||
use std::any::{type_name, TypeId};
|
use std::any::{type_name, TypeId};
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
@ -16,12 +17,14 @@ impl Engine {
|
|||||||
/// Get the global namespace module (which is the fist module in `global_modules`).
|
/// Get the global namespace module (which is the fist module in `global_modules`).
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[allow(dead_code)]
|
#[allow(dead_code)]
|
||||||
|
#[must_use]
|
||||||
pub(crate) fn global_namespace(&self) -> &Module {
|
pub(crate) fn global_namespace(&self) -> &Module {
|
||||||
self.global_modules.first().unwrap()
|
self.global_modules.first().unwrap()
|
||||||
}
|
}
|
||||||
/// Get a mutable reference to the global namespace module
|
/// Get a mutable reference to the global namespace module
|
||||||
/// (which is the first module in `global_modules`).
|
/// (which is the first module in `global_modules`).
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
pub(crate) fn global_namespace_mut(&mut self) -> &mut Module {
|
pub(crate) fn global_namespace_mut(&mut self) -> &mut Module {
|
||||||
let module = self.global_modules.first_mut().unwrap();
|
let module = self.global_modules.first_mut().unwrap();
|
||||||
Shared::get_mut(module).expect("not shared")
|
Shared::get_mut(module).expect("not shared")
|
||||||
@ -224,12 +227,12 @@ impl Engine {
|
|||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn register_type_with_name_raw(
|
pub fn register_type_with_name_raw(
|
||||||
&mut self,
|
&mut self,
|
||||||
fully_qualified_type_path: impl Into<Identifier>,
|
type_path: impl Into<Identifier>,
|
||||||
name: impl Into<Identifier>,
|
name: impl Into<Identifier>,
|
||||||
) -> &mut Self {
|
) -> &mut Self {
|
||||||
// Add the pretty-print type name into the map
|
// Add the pretty-print type name into the map
|
||||||
self.global_namespace_mut()
|
self.global_namespace_mut()
|
||||||
.set_custom_type_raw(fully_qualified_type_path, name);
|
.set_custom_type_raw(type_path, name);
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
/// Register a type iterator for an iterable type with the [`Engine`].
|
/// Register a type iterator for an iterable type with the [`Engine`].
|
||||||
@ -634,7 +637,7 @@ impl Engine {
|
|||||||
/// When searching for functions, modules loaded later are preferred. In other words, loaded
|
/// When searching for functions, modules loaded later are preferred. In other words, loaded
|
||||||
/// modules are searched in reverse order.
|
/// modules are searched in reverse order.
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn register_global_module(&mut self, module: Shared<Module>) -> &mut Self {
|
pub fn register_global_module(&mut self, module: SharedModule) -> &mut Self {
|
||||||
// Insert the module into the front.
|
// Insert the module into the front.
|
||||||
// The first module is always the global namespace.
|
// The first module is always the global namespace.
|
||||||
self.global_modules.insert(1, module);
|
self.global_modules.insert(1, module);
|
||||||
@ -678,12 +681,12 @@ impl Engine {
|
|||||||
pub fn register_static_module(
|
pub fn register_static_module(
|
||||||
&mut self,
|
&mut self,
|
||||||
name: impl AsRef<str>,
|
name: impl AsRef<str>,
|
||||||
module: Shared<Module>,
|
module: SharedModule,
|
||||||
) -> &mut Self {
|
) -> &mut Self {
|
||||||
fn register_static_module_raw(
|
fn register_static_module_raw(
|
||||||
root: &mut std::collections::BTreeMap<Identifier, Shared<Module>>,
|
root: &mut std::collections::BTreeMap<Identifier, SharedModule>,
|
||||||
name: &str,
|
name: &str,
|
||||||
module: Shared<Module>,
|
module: SharedModule,
|
||||||
) {
|
) {
|
||||||
let separator = crate::tokenizer::Token::DoubleColon.syntax();
|
let separator = crate::tokenizer::Token::DoubleColon.syntax();
|
||||||
let separator = separator.as_ref();
|
let separator = separator.as_ref();
|
||||||
|
@ -2,7 +2,7 @@
|
|||||||
|
|
||||||
use crate::eval::{Caches, GlobalRuntimeState};
|
use crate::eval::{Caches, GlobalRuntimeState};
|
||||||
use crate::parser::ParseState;
|
use crate::parser::ParseState;
|
||||||
use crate::{Engine, Module, RhaiResultOf, Scope, AST};
|
use crate::{Engine, RhaiResultOf, Scope, SharedModule, AST};
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
|
|
||||||
@ -113,7 +113,7 @@ impl Engine {
|
|||||||
pub fn run_ast_with_scope(&self, scope: &mut Scope, ast: &AST) -> RhaiResultOf<()> {
|
pub fn run_ast_with_scope(&self, scope: &mut Scope, ast: &AST) -> RhaiResultOf<()> {
|
||||||
let caches = &mut Caches::new();
|
let caches = &mut Caches::new();
|
||||||
let global = &mut GlobalRuntimeState::new(self);
|
let global = &mut GlobalRuntimeState::new(self);
|
||||||
global.source = ast.source_raw().clone();
|
global.source = ast.source_raw().cloned();
|
||||||
|
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
{
|
{
|
||||||
@ -122,16 +122,16 @@ impl Engine {
|
|||||||
|
|
||||||
let statements = ast.statements();
|
let statements = ast.statements();
|
||||||
if !statements.is_empty() {
|
if !statements.is_empty() {
|
||||||
let lib = [
|
let lib: &[SharedModule] = &[
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
ast.as_ref(),
|
AsRef::<SharedModule>::as_ref(ast).clone(),
|
||||||
];
|
];
|
||||||
let lib = if lib.first().map_or(true, |m: &&Module| m.is_empty()) {
|
let lib = if lib.first().map_or(true, |m| m.is_empty()) {
|
||||||
&lib[0..0]
|
&[][..]
|
||||||
} else {
|
} else {
|
||||||
&lib
|
&lib
|
||||||
};
|
};
|
||||||
self.eval_global_statements(scope, global, caches, statements, lib, 0)?;
|
self.eval_global_statements(global, caches, lib, scope, statements)?;
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
@ -139,10 +139,11 @@ impl Engine {
|
|||||||
global.debugger.status = crate::eval::DebuggerStatus::Terminate;
|
global.debugger.status = crate::eval::DebuggerStatus::Terminate;
|
||||||
let lib = &[
|
let lib = &[
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
ast.as_ref(),
|
AsRef::<crate::SharedModule>::as_ref(ast).clone(),
|
||||||
];
|
];
|
||||||
|
let mut this = crate::Dynamic::NULL;
|
||||||
let node = &crate::ast::Stmt::Noop(crate::Position::NONE);
|
let node = &crate::ast::Stmt::Noop(crate::Position::NONE);
|
||||||
self.run_debugger(scope, global, lib, &mut None, node, 0)?;
|
self.run_debugger(global, caches, lib, scope, &mut this, node)?;
|
||||||
}
|
}
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
|
@ -44,7 +44,7 @@ fn map_std_type_name(name: &str, shorthands: bool) -> &str {
|
|||||||
if name == type_name::<crate::Map>() || name == "Map" {
|
if name == type_name::<crate::Map>() || name == "Map" {
|
||||||
return if shorthands { "map" } else { "Map" };
|
return if shorthands { "map" } else { "Map" };
|
||||||
}
|
}
|
||||||
#[cfg(not(feature = "no_std"))]
|
#[cfg(not(feature = "no_time"))]
|
||||||
if name == type_name::<crate::Instant>() || name == "Instant" {
|
if name == type_name::<crate::Instant>() || name == "Instant" {
|
||||||
return if shorthands { "timestamp" } else { "Instant" };
|
return if shorthands { "timestamp" } else { "Instant" };
|
||||||
}
|
}
|
||||||
@ -108,11 +108,15 @@ fn map_std_type_name(name: &str, shorthands: bool) -> &str {
|
|||||||
|
|
||||||
/// Format a Rust type to be display-friendly.
|
/// Format a Rust type to be display-friendly.
|
||||||
///
|
///
|
||||||
|
/// * `rhai::` prefix is cleared.
|
||||||
/// * `()` is cleared.
|
/// * `()` is cleared.
|
||||||
|
/// * `&mut` is cleared.
|
||||||
/// * `INT` and `FLOAT` are expanded.
|
/// * `INT` and `FLOAT` are expanded.
|
||||||
/// * [`RhaiResult`][crate::RhaiResult] and [`RhaiResultOf<T>`][crate::RhaiResultOf] are expanded.
|
/// * [`RhaiResult`][crate::RhaiResult] and [`RhaiResultOf<T>`][crate::RhaiResultOf] are expanded.
|
||||||
#[cfg(feature = "metadata")]
|
#[cfg(feature = "metadata")]
|
||||||
pub fn format_type(typ: &str, is_return_type: bool) -> std::borrow::Cow<str> {
|
pub fn format_type(typ: &str, is_return_type: bool) -> std::borrow::Cow<str> {
|
||||||
|
const RESULT_TYPE: &str = "Result<";
|
||||||
|
const ERROR_TYPE: &str = ",Box<EvalAltResult>>";
|
||||||
const RHAI_RESULT_TYPE: &str = "RhaiResult";
|
const RHAI_RESULT_TYPE: &str = "RhaiResult";
|
||||||
const RHAI_RESULT_TYPE_EXPAND: &str = "Result<Dynamic, Box<EvalAltResult>>";
|
const RHAI_RESULT_TYPE_EXPAND: &str = "Result<Dynamic, Box<EvalAltResult>>";
|
||||||
const RHAI_RESULT_OF_TYPE: &str = "RhaiResultOf<";
|
const RHAI_RESULT_OF_TYPE: &str = "RhaiResultOf<";
|
||||||
@ -135,6 +139,10 @@ pub fn format_type(typ: &str, is_return_type: bool) -> std::borrow::Cow<str> {
|
|||||||
} else {
|
} else {
|
||||||
format!("&mut {r}").into()
|
format!("&mut {r}").into()
|
||||||
};
|
};
|
||||||
|
} else if typ.contains(" ") {
|
||||||
|
let typ = typ.replace(" ", "");
|
||||||
|
let r = format_type(&typ, is_return_type);
|
||||||
|
return r.into_owned().into();
|
||||||
}
|
}
|
||||||
|
|
||||||
match typ {
|
match typ {
|
||||||
@ -167,6 +175,12 @@ pub fn format_type(typ: &str, is_return_type: bool) -> std::borrow::Cow<str> {
|
|||||||
.replace("{}", format_type(inner, false).trim())
|
.replace("{}", format_type(inner, false).trim())
|
||||||
.into()
|
.into()
|
||||||
}
|
}
|
||||||
|
ty if ty.starts_with(RESULT_TYPE) && ty.ends_with(ERROR_TYPE) => {
|
||||||
|
let inner = &ty[RESULT_TYPE.len()..ty.len() - ERROR_TYPE.len()];
|
||||||
|
RHAI_RESULT_OF_TYPE_EXPAND
|
||||||
|
.replace("{}", format_type(inner, false).trim())
|
||||||
|
.into()
|
||||||
|
}
|
||||||
ty => ty.into(),
|
ty => ty.into(),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
122
src/ast/ast.rs
122
src/ast/ast.rs
@ -1,10 +1,11 @@
|
|||||||
//! Module defining the AST (abstract syntax tree).
|
//! Module defining the AST (abstract syntax tree).
|
||||||
|
|
||||||
use super::{ASTFlags, Expr, FnAccess, Stmt, StmtBlock, StmtBlockContainer};
|
use super::{ASTFlags, Expr, FnAccess, Stmt, StmtBlock, StmtBlockContainer};
|
||||||
use crate::{Dynamic, FnNamespace, Identifier, Position};
|
use crate::{Dynamic, FnNamespace, ImmutableString, Position};
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
use std::{
|
use std::{
|
||||||
|
borrow::Borrow,
|
||||||
fmt,
|
fmt,
|
||||||
hash::Hash,
|
hash::Hash,
|
||||||
ops::{Add, AddAssign},
|
ops::{Add, AddAssign},
|
||||||
@ -19,8 +20,7 @@ use std::{
|
|||||||
#[derive(Clone)]
|
#[derive(Clone)]
|
||||||
pub struct AST {
|
pub struct AST {
|
||||||
/// Source of the [`AST`].
|
/// Source of the [`AST`].
|
||||||
/// No source if string is empty.
|
source: Option<ImmutableString>,
|
||||||
source: Identifier,
|
|
||||||
/// [`AST`] documentation.
|
/// [`AST`] documentation.
|
||||||
#[cfg(feature = "metadata")]
|
#[cfg(feature = "metadata")]
|
||||||
doc: crate::SmartString,
|
doc: crate::SmartString,
|
||||||
@ -28,7 +28,7 @@ pub struct AST {
|
|||||||
body: StmtBlock,
|
body: StmtBlock,
|
||||||
/// Script-defined functions.
|
/// Script-defined functions.
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
lib: crate::Shared<crate::Module>,
|
lib: crate::SharedModule,
|
||||||
/// Embedded module resolver, if any.
|
/// Embedded module resolver, if any.
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
resolver: Option<crate::Shared<crate::module::resolvers::StaticModuleResolver>>,
|
resolver: Option<crate::Shared<crate::module::resolvers::StaticModuleResolver>>,
|
||||||
@ -36,12 +36,15 @@ pub struct AST {
|
|||||||
|
|
||||||
impl Default for AST {
|
impl Default for AST {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
Self::empty()
|
Self::empty()
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl fmt::Debug for AST {
|
impl fmt::Debug for AST {
|
||||||
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
let mut fp = f.debug_struct("AST");
|
let mut fp = f.debug_struct("AST");
|
||||||
|
|
||||||
@ -67,14 +70,14 @@ impl fmt::Debug for AST {
|
|||||||
impl AST {
|
impl AST {
|
||||||
/// Create a new [`AST`].
|
/// Create a new [`AST`].
|
||||||
#[cfg(not(feature = "internals"))]
|
#[cfg(not(feature = "internals"))]
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub(crate) fn new(
|
pub(crate) fn new(
|
||||||
statements: impl IntoIterator<Item = Stmt>,
|
statements: impl IntoIterator<Item = Stmt>,
|
||||||
#[cfg(not(feature = "no_function"))] functions: impl Into<crate::Shared<crate::Module>>,
|
#[cfg(not(feature = "no_function"))] functions: impl Into<crate::SharedModule>,
|
||||||
) -> Self {
|
) -> Self {
|
||||||
Self {
|
Self {
|
||||||
source: Identifier::new_const(),
|
source: None,
|
||||||
#[cfg(feature = "metadata")]
|
#[cfg(feature = "metadata")]
|
||||||
doc: crate::SmartString::new_const(),
|
doc: crate::SmartString::new_const(),
|
||||||
body: StmtBlock::new(statements, Position::NONE, Position::NONE),
|
body: StmtBlock::new(statements, Position::NONE, Position::NONE),
|
||||||
@ -87,14 +90,14 @@ impl AST {
|
|||||||
/// _(internals)_ Create a new [`AST`].
|
/// _(internals)_ Create a new [`AST`].
|
||||||
/// Exported under the `internals` feature only.
|
/// Exported under the `internals` feature only.
|
||||||
#[cfg(feature = "internals")]
|
#[cfg(feature = "internals")]
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn new(
|
pub fn new(
|
||||||
statements: impl IntoIterator<Item = Stmt>,
|
statements: impl IntoIterator<Item = Stmt>,
|
||||||
#[cfg(not(feature = "no_function"))] functions: impl Into<crate::Shared<crate::Module>>,
|
#[cfg(not(feature = "no_function"))] functions: impl Into<crate::SharedModule>,
|
||||||
) -> Self {
|
) -> Self {
|
||||||
Self {
|
Self {
|
||||||
source: Identifier::new_const(),
|
source: None,
|
||||||
#[cfg(feature = "metadata")]
|
#[cfg(feature = "metadata")]
|
||||||
doc: crate::SmartString::new_const(),
|
doc: crate::SmartString::new_const(),
|
||||||
body: StmtBlock::new(statements, Position::NONE, Position::NONE),
|
body: StmtBlock::new(statements, Position::NONE, Position::NONE),
|
||||||
@ -106,12 +109,12 @@ impl AST {
|
|||||||
}
|
}
|
||||||
/// Create a new [`AST`] with a source name.
|
/// Create a new [`AST`] with a source name.
|
||||||
#[cfg(not(feature = "internals"))]
|
#[cfg(not(feature = "internals"))]
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub(crate) fn new_with_source(
|
pub(crate) fn new_with_source(
|
||||||
statements: impl IntoIterator<Item = Stmt>,
|
statements: impl IntoIterator<Item = Stmt>,
|
||||||
#[cfg(not(feature = "no_function"))] functions: impl Into<crate::Shared<crate::Module>>,
|
#[cfg(not(feature = "no_function"))] functions: impl Into<crate::SharedModule>,
|
||||||
source: impl Into<Identifier>,
|
source: impl Into<ImmutableString>,
|
||||||
) -> Self {
|
) -> Self {
|
||||||
let mut ast = Self::new(
|
let mut ast = Self::new(
|
||||||
statements,
|
statements,
|
||||||
@ -124,12 +127,12 @@ impl AST {
|
|||||||
/// _(internals)_ Create a new [`AST`] with a source name.
|
/// _(internals)_ Create a new [`AST`] with a source name.
|
||||||
/// Exported under the `internals` feature only.
|
/// Exported under the `internals` feature only.
|
||||||
#[cfg(feature = "internals")]
|
#[cfg(feature = "internals")]
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn new_with_source(
|
pub fn new_with_source(
|
||||||
statements: impl IntoIterator<Item = Stmt>,
|
statements: impl IntoIterator<Item = Stmt>,
|
||||||
#[cfg(not(feature = "no_function"))] functions: impl Into<crate::Shared<crate::Module>>,
|
#[cfg(not(feature = "no_function"))] functions: impl Into<crate::SharedModule>,
|
||||||
source: impl Into<Identifier>,
|
source: impl Into<ImmutableString>,
|
||||||
) -> Self {
|
) -> Self {
|
||||||
let mut ast = Self::new(
|
let mut ast = Self::new(
|
||||||
statements,
|
statements,
|
||||||
@ -144,7 +147,7 @@ impl AST {
|
|||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn empty() -> Self {
|
pub fn empty() -> Self {
|
||||||
Self {
|
Self {
|
||||||
source: Identifier::new_const(),
|
source: None,
|
||||||
#[cfg(feature = "metadata")]
|
#[cfg(feature = "metadata")]
|
||||||
doc: crate::SmartString::new_const(),
|
doc: crate::SmartString::new_const(),
|
||||||
body: StmtBlock::NONE,
|
body: StmtBlock::NONE,
|
||||||
@ -158,33 +161,36 @@ impl AST {
|
|||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn source(&self) -> Option<&str> {
|
pub fn source(&self) -> Option<&str> {
|
||||||
if self.source.is_empty() {
|
self.source.as_ref().map(|s| s.as_str())
|
||||||
None
|
|
||||||
} else {
|
|
||||||
Some(self.source.as_str())
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
/// Get a reference to the source.
|
/// Get a reference to the source.
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub(crate) const fn source_raw(&self) -> &Identifier {
|
pub(crate) const fn source_raw(&self) -> Option<&ImmutableString> {
|
||||||
&self.source
|
self.source.as_ref()
|
||||||
}
|
}
|
||||||
/// Set the source.
|
/// Set the source.
|
||||||
#[inline]
|
#[inline]
|
||||||
pub fn set_source(&mut self, source: impl Into<Identifier>) -> &mut Self {
|
pub fn set_source(&mut self, source: impl Into<ImmutableString>) -> &mut Self {
|
||||||
let source = source.into();
|
let source = source.into();
|
||||||
|
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
crate::Shared::get_mut(&mut self.lib)
|
crate::Shared::get_mut(&mut self.lib)
|
||||||
.as_mut()
|
.as_mut()
|
||||||
.map(|m| m.set_id(source.clone()));
|
.map(|m| m.set_id(source.clone()));
|
||||||
self.source = source;
|
|
||||||
|
if source.is_empty() {
|
||||||
|
self.source = None;
|
||||||
|
} else {
|
||||||
|
self.source = Some(source);
|
||||||
|
}
|
||||||
|
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
/// Clear the source.
|
/// Clear the source.
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn clear_source(&mut self) -> &mut Self {
|
pub fn clear_source(&mut self) -> &mut Self {
|
||||||
self.source.clear();
|
self.source = None;
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
/// Get the documentation (if any).
|
/// Get the documentation (if any).
|
||||||
@ -261,7 +267,7 @@ impl AST {
|
|||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub(crate) const fn shared_lib(&self) -> &crate::Shared<crate::Module> {
|
pub(crate) const fn shared_lib(&self) -> &crate::SharedModule {
|
||||||
&self.lib
|
&self.lib
|
||||||
}
|
}
|
||||||
/// _(internals)_ Get the internal shared [`Module`][crate::Module] containing all script-defined functions.
|
/// _(internals)_ Get the internal shared [`Module`][crate::Module] containing all script-defined functions.
|
||||||
@ -272,7 +278,7 @@ impl AST {
|
|||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn shared_lib(&self) -> &crate::Shared<crate::Module> {
|
pub const fn shared_lib(&self) -> &crate::SharedModule {
|
||||||
&self.lib
|
&self.lib
|
||||||
}
|
}
|
||||||
/// Get the embedded [module resolver][crate::ModuleResolver].
|
/// Get the embedded [module resolver][crate::ModuleResolver].
|
||||||
@ -555,18 +561,18 @@ impl AST {
|
|||||||
lib
|
lib
|
||||||
};
|
};
|
||||||
|
|
||||||
let mut _ast = if other.source.is_empty() {
|
let mut _ast = if let Some(ref source) = other.source {
|
||||||
Self::new(
|
|
||||||
merged,
|
|
||||||
#[cfg(not(feature = "no_function"))]
|
|
||||||
lib,
|
|
||||||
)
|
|
||||||
} else {
|
|
||||||
Self::new_with_source(
|
Self::new_with_source(
|
||||||
merged,
|
merged,
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
lib,
|
lib,
|
||||||
other.source.clone(),
|
source.clone(),
|
||||||
|
)
|
||||||
|
} else {
|
||||||
|
Self::new(
|
||||||
|
merged,
|
||||||
|
#[cfg(not(feature = "no_function"))]
|
||||||
|
lib,
|
||||||
)
|
)
|
||||||
};
|
};
|
||||||
|
|
||||||
@ -662,7 +668,6 @@ impl AST {
|
|||||||
self.combine_filtered_impl(other, filter)
|
self.combine_filtered_impl(other, filter)
|
||||||
}
|
}
|
||||||
/// Combine one [`AST`] with another. The second [`AST`] is consumed.
|
/// Combine one [`AST`] with another. The second [`AST`] is consumed.
|
||||||
#[inline]
|
|
||||||
fn combine_filtered_impl(
|
fn combine_filtered_impl(
|
||||||
&mut self,
|
&mut self,
|
||||||
other: Self,
|
other: Self,
|
||||||
@ -917,25 +922,54 @@ impl<A: Into<Self>> AddAssign<A> for AST {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl Borrow<[Stmt]> for AST {
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
fn borrow(&self) -> &[Stmt] {
|
||||||
|
self.statements()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
impl AsRef<[Stmt]> for AST {
|
impl AsRef<[Stmt]> for AST {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn as_ref(&self) -> &[Stmt] {
|
fn as_ref(&self) -> &[Stmt] {
|
||||||
self.statements()
|
self.statements()
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[cfg(not(feature = "no_function"))]
|
||||||
|
impl Borrow<crate::Module> for AST {
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
fn borrow(&self) -> &crate::Module {
|
||||||
|
&self.shared_lib()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
impl AsRef<crate::Module> for AST {
|
impl AsRef<crate::Module> for AST {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn as_ref(&self) -> &crate::Module {
|
fn as_ref(&self) -> &crate::Module {
|
||||||
self.shared_lib().as_ref()
|
self.shared_lib().as_ref()
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
impl AsRef<crate::Shared<crate::Module>> for AST {
|
impl Borrow<crate::SharedModule> for AST {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn as_ref(&self) -> &crate::Shared<crate::Module> {
|
#[must_use]
|
||||||
|
fn borrow(&self) -> &crate::SharedModule {
|
||||||
|
self.shared_lib()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(not(feature = "no_function"))]
|
||||||
|
impl AsRef<crate::SharedModule> for AST {
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
fn as_ref(&self) -> &crate::SharedModule {
|
||||||
self.shared_lib()
|
self.shared_lib()
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -952,19 +986,21 @@ pub enum ASTNode<'a> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl<'a> From<&'a Stmt> for ASTNode<'a> {
|
impl<'a> From<&'a Stmt> for ASTNode<'a> {
|
||||||
|
#[inline(always)]
|
||||||
fn from(stmt: &'a Stmt) -> Self {
|
fn from(stmt: &'a Stmt) -> Self {
|
||||||
Self::Stmt(stmt)
|
Self::Stmt(stmt)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<'a> From<&'a Expr> for ASTNode<'a> {
|
impl<'a> From<&'a Expr> for ASTNode<'a> {
|
||||||
|
#[inline(always)]
|
||||||
fn from(expr: &'a Expr) -> Self {
|
fn from(expr: &'a Expr) -> Self {
|
||||||
Self::Expr(expr)
|
Self::Expr(expr)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl PartialEq for ASTNode<'_> {
|
impl PartialEq for ASTNode<'_> {
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
fn eq(&self, other: &Self) -> bool {
|
fn eq(&self, other: &Self) -> bool {
|
||||||
match (self, other) {
|
match (self, other) {
|
||||||
(Self::Stmt(x), Self::Stmt(y)) => ptr::eq(*x, *y),
|
(Self::Stmt(x), Self::Stmt(y)) => ptr::eq(*x, *y),
|
||||||
@ -981,8 +1017,8 @@ impl ASTNode<'_> {
|
|||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn position(&self) -> Position {
|
pub fn position(&self) -> Position {
|
||||||
match self {
|
match self {
|
||||||
ASTNode::Stmt(stmt) => stmt.position(),
|
Self::Stmt(stmt) => stmt.position(),
|
||||||
ASTNode::Expr(expr) => expr.position(),
|
Self::Expr(expr) => expr.position(),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
153
src/ast/expr.rs
153
src/ast/expr.rs
@ -17,7 +17,7 @@ use std::{
|
|||||||
fmt::Write,
|
fmt::Write,
|
||||||
hash::Hash,
|
hash::Hash,
|
||||||
iter::once,
|
iter::once,
|
||||||
num::{NonZeroU8, NonZeroUsize},
|
num::{NonZeroU64, NonZeroU8, NonZeroUsize},
|
||||||
};
|
};
|
||||||
|
|
||||||
#[cfg(not(feature = "no_float"))]
|
#[cfg(not(feature = "no_float"))]
|
||||||
@ -75,8 +75,8 @@ impl CustomExpr {
|
|||||||
/// Is this custom syntax self-terminated (i.e. no need for a semicolon terminator)?
|
/// Is this custom syntax self-terminated (i.e. no need for a semicolon terminator)?
|
||||||
///
|
///
|
||||||
/// A self-terminated custom syntax always ends in `$block$`, `}` or `;`
|
/// A self-terminated custom syntax always ends in `$block$`, `}` or `;`
|
||||||
#[must_use]
|
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
pub const fn is_self_terminated(&self) -> bool {
|
pub const fn is_self_terminated(&self) -> bool {
|
||||||
self.self_terminated
|
self.self_terminated
|
||||||
}
|
}
|
||||||
@ -86,7 +86,7 @@ impl CustomExpr {
|
|||||||
///
|
///
|
||||||
/// Two separate hashes are pre-calculated because of the following patterns:
|
/// Two separate hashes are pre-calculated because of the following patterns:
|
||||||
///
|
///
|
||||||
/// ```js
|
/// ```rhai
|
||||||
/// func(a, b, c); // Native: func(a, b, c) - 3 parameters
|
/// func(a, b, c); // Native: func(a, b, c) - 3 parameters
|
||||||
/// // Script: func(a, b, c) - 3 parameters
|
/// // Script: func(a, b, c) - 3 parameters
|
||||||
///
|
///
|
||||||
@ -100,30 +100,34 @@ impl CustomExpr {
|
|||||||
///
|
///
|
||||||
/// Function call hashes are used in the following manner:
|
/// Function call hashes are used in the following manner:
|
||||||
///
|
///
|
||||||
/// * First, the script hash is tried, which contains only the called function's name plus the
|
/// * First, the script hash (if any) is tried, which contains only the called function's name plus
|
||||||
/// number of parameters.
|
/// the number of parameters.
|
||||||
///
|
///
|
||||||
/// * Next, the actual types of arguments are hashed and _combined_ with the native hash, which is
|
/// * Next, the actual types of arguments are hashed and _combined_ with the native hash, which is
|
||||||
/// then used to search for a native function. In other words, a complete native function call
|
/// then used to search for a native function.
|
||||||
/// hash always contains the called function's name plus the types of the arguments. This is due
|
///
|
||||||
/// to possible function overloading for different parameter types.
|
/// In other words, a complete native function call hash always contains the called function's
|
||||||
#[derive(Clone, Copy, Eq, PartialEq, Hash, Default)]
|
/// name plus the types of the arguments. This is due to possible function overloading for
|
||||||
|
/// different parameter types.
|
||||||
|
#[derive(Clone, Copy, Eq, PartialEq, Hash)]
|
||||||
pub struct FnCallHashes {
|
pub struct FnCallHashes {
|
||||||
/// Pre-calculated hash for a script-defined function (zero if native functions only).
|
/// Pre-calculated hash for a script-defined function ([`None`] if native functions only).
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
pub script: u64,
|
script: Option<NonZeroU64>,
|
||||||
/// Pre-calculated hash for a native Rust function with no parameter types.
|
/// Pre-calculated hash for a native Rust function with no parameter types.
|
||||||
pub native: u64,
|
native: NonZeroU64,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl fmt::Debug for FnCallHashes {
|
impl fmt::Debug for FnCallHashes {
|
||||||
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
if self.script != 0 {
|
if let Some(script) = self.script {
|
||||||
return if self.script == self.native {
|
return if script == self.native {
|
||||||
fmt::Debug::fmt(&self.native, f)
|
fmt::Debug::fmt(&self.native, f)
|
||||||
} else {
|
} else {
|
||||||
write!(f, "({}, {})", self.script, self.native)
|
write!(f, "({}, {})", script, self.native)
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -132,13 +136,13 @@ impl fmt::Debug for FnCallHashes {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl From<u64> for FnCallHashes {
|
impl From<u64> for FnCallHashes {
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
fn from(hash: u64) -> Self {
|
fn from(hash: u64) -> Self {
|
||||||
let hash = if hash == 0 { ALT_ZERO_HASH } else { hash };
|
let hash = NonZeroU64::new(if hash == 0 { ALT_ZERO_HASH } else { hash }).unwrap();
|
||||||
|
|
||||||
Self {
|
Self {
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
script: hash,
|
script: Some(hash),
|
||||||
native: hash,
|
native: hash,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -146,40 +150,61 @@ impl From<u64> for FnCallHashes {
|
|||||||
|
|
||||||
impl FnCallHashes {
|
impl FnCallHashes {
|
||||||
/// Create a [`FnCallHashes`] with only the native Rust hash.
|
/// Create a [`FnCallHashes`] with only the native Rust hash.
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn from_native(hash: u64) -> Self {
|
pub fn from_native(hash: u64) -> Self {
|
||||||
Self {
|
Self {
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
script: 0,
|
script: None,
|
||||||
native: if hash == 0 { ALT_ZERO_HASH } else { hash },
|
native: NonZeroU64::new(if hash == 0 { ALT_ZERO_HASH } else { hash }).unwrap(),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
/// Create a [`FnCallHashes`] with both native Rust and script function hashes.
|
/// Create a [`FnCallHashes`] with both native Rust and script function hashes.
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn from_all(#[cfg(not(feature = "no_function"))] script: u64, native: u64) -> Self {
|
pub fn from_all(#[cfg(not(feature = "no_function"))] script: u64, native: u64) -> Self {
|
||||||
Self {
|
Self {
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
script: if script == 0 { ALT_ZERO_HASH } else { script },
|
script: NonZeroU64::new(if script == 0 { ALT_ZERO_HASH } else { script }),
|
||||||
native: if native == 0 { ALT_ZERO_HASH } else { native },
|
native: NonZeroU64::new(if native == 0 { ALT_ZERO_HASH } else { native }).unwrap(),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
/// Is this [`FnCallHashes`] native Rust only?
|
/// Is this [`FnCallHashes`] native-only?
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn is_native_only(&self) -> bool {
|
pub const fn is_native_only(&self) -> bool {
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
return self.script == 0;
|
return self.script.is_none();
|
||||||
|
|
||||||
#[cfg(feature = "no_function")]
|
#[cfg(feature = "no_function")]
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
|
/// Get the native hash.
|
||||||
|
///
|
||||||
|
/// The hash returned is never zero.
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
pub fn native(&self) -> u64 {
|
||||||
|
self.native.get()
|
||||||
|
}
|
||||||
|
/// Get the script hash.
|
||||||
|
///
|
||||||
|
/// The hash returned is never zero.
|
||||||
|
///
|
||||||
|
/// # Panics
|
||||||
|
///
|
||||||
|
/// Panics if this [`FnCallHashes`] is native-only.
|
||||||
|
#[cfg(not(feature = "no_function"))]
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
pub fn script(&self) -> u64 {
|
||||||
|
assert!(self.script.is_some());
|
||||||
|
self.script.as_ref().unwrap().get()
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// _(internals)_ A function call.
|
/// _(internals)_ A function call.
|
||||||
/// Exported under the `internals` feature only.
|
/// Exported under the `internals` feature only.
|
||||||
#[derive(Clone, Default, Hash)]
|
#[derive(Clone, Hash)]
|
||||||
pub struct FnCallExpr {
|
pub struct FnCallExpr {
|
||||||
/// Namespace of the function, if any.
|
/// Namespace of the function, if any.
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
@ -193,28 +218,27 @@ pub struct FnCallExpr {
|
|||||||
/// Does this function call capture the parent scope?
|
/// Does this function call capture the parent scope?
|
||||||
pub capture_parent_scope: bool,
|
pub capture_parent_scope: bool,
|
||||||
/// Is this function call a native operator?
|
/// Is this function call a native operator?
|
||||||
pub is_native_operator: bool,
|
pub op_token: Option<Token>,
|
||||||
/// [Position] of the function name.
|
|
||||||
pub pos: Position,
|
|
||||||
}
|
}
|
||||||
|
|
||||||
impl fmt::Debug for FnCallExpr {
|
impl fmt::Debug for FnCallExpr {
|
||||||
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
let mut ff = f.debug_struct("FnCallExpr");
|
let mut ff = f.debug_struct("FnCallExpr");
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
if !self.namespace.is_empty() {
|
if !self.namespace.is_empty() {
|
||||||
ff.field("namespace", &self.namespace);
|
ff.field("namespace", &self.namespace);
|
||||||
}
|
}
|
||||||
if self.capture_parent_scope {
|
|
||||||
ff.field("capture_parent_scope", &self.capture_parent_scope);
|
|
||||||
}
|
|
||||||
if self.is_native_operator {
|
|
||||||
ff.field("is_native_operator", &self.is_native_operator);
|
|
||||||
}
|
|
||||||
ff.field("hash", &self.hashes)
|
ff.field("hash", &self.hashes)
|
||||||
.field("name", &self.name)
|
.field("name", &self.name)
|
||||||
.field("args", &self.args);
|
.field("args", &self.args);
|
||||||
ff.field("pos", &self.pos);
|
if let Some(ref token) = self.op_token {
|
||||||
|
ff.field("op_token", token);
|
||||||
|
}
|
||||||
|
if self.capture_parent_scope {
|
||||||
|
ff.field("capture_parent_scope", &self.capture_parent_scope);
|
||||||
|
}
|
||||||
ff.finish()
|
ff.finish()
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -237,6 +261,16 @@ impl FnCallExpr {
|
|||||||
pub fn into_fn_call_expr(self, pos: Position) -> Expr {
|
pub fn into_fn_call_expr(self, pos: Position) -> Expr {
|
||||||
Expr::FnCall(self.into(), pos)
|
Expr::FnCall(self.into(), pos)
|
||||||
}
|
}
|
||||||
|
/// Are all arguments constant?
|
||||||
|
#[inline]
|
||||||
|
#[must_use]
|
||||||
|
pub fn constant_args(&self) -> bool {
|
||||||
|
if self.args.is_empty() {
|
||||||
|
true
|
||||||
|
} else {
|
||||||
|
self.args.iter().all(Expr::is_constant)
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// A type that wraps a floating-point number and implements [`Hash`].
|
/// A type that wraps a floating-point number and implements [`Hash`].
|
||||||
@ -248,7 +282,7 @@ pub struct FloatWrapper<F>(F);
|
|||||||
|
|
||||||
#[cfg(not(feature = "no_float"))]
|
#[cfg(not(feature = "no_float"))]
|
||||||
impl Hash for FloatWrapper<crate::FLOAT> {
|
impl Hash for FloatWrapper<crate::FLOAT> {
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
fn hash<H: Hasher>(&self, state: &mut H) {
|
fn hash<H: Hasher>(&self, state: &mut H) {
|
||||||
self.0.to_ne_bytes().hash(state);
|
self.0.to_ne_bytes().hash(state);
|
||||||
}
|
}
|
||||||
@ -257,6 +291,7 @@ impl Hash for FloatWrapper<crate::FLOAT> {
|
|||||||
#[cfg(not(feature = "no_float"))]
|
#[cfg(not(feature = "no_float"))]
|
||||||
impl<F: Float> AsRef<F> for FloatWrapper<F> {
|
impl<F: Float> AsRef<F> for FloatWrapper<F> {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn as_ref(&self) -> &F {
|
fn as_ref(&self) -> &F {
|
||||||
&self.0
|
&self.0
|
||||||
}
|
}
|
||||||
@ -265,6 +300,7 @@ impl<F: Float> AsRef<F> for FloatWrapper<F> {
|
|||||||
#[cfg(not(feature = "no_float"))]
|
#[cfg(not(feature = "no_float"))]
|
||||||
impl<F: Float> AsMut<F> for FloatWrapper<F> {
|
impl<F: Float> AsMut<F> for FloatWrapper<F> {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn as_mut(&mut self) -> &mut F {
|
fn as_mut(&mut self) -> &mut F {
|
||||||
&mut self.0
|
&mut self.0
|
||||||
}
|
}
|
||||||
@ -290,7 +326,8 @@ impl<F: Float> DerefMut for FloatWrapper<F> {
|
|||||||
|
|
||||||
#[cfg(not(feature = "no_float"))]
|
#[cfg(not(feature = "no_float"))]
|
||||||
impl<F: Float + fmt::Debug> fmt::Debug for FloatWrapper<F> {
|
impl<F: Float + fmt::Debug> fmt::Debug for FloatWrapper<F> {
|
||||||
#[inline(always)]
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
fmt::Debug::fmt(&self.0, f)
|
fmt::Debug::fmt(&self.0, f)
|
||||||
}
|
}
|
||||||
@ -438,23 +475,26 @@ pub enum Expr {
|
|||||||
|
|
||||||
impl Default for Expr {
|
impl Default for Expr {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
Self::Unit(Position::NONE)
|
Self::Unit(Position::NONE)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl fmt::Debug for Expr {
|
impl fmt::Debug for Expr {
|
||||||
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
let mut display_pos = format!(" @ {:?}", self.start_position());
|
let mut display_pos = format!(" @ {:?}", self.start_position());
|
||||||
|
|
||||||
match self {
|
match self {
|
||||||
Self::DynamicConstant(value, ..) => write!(f, "{:?}", value),
|
Self::DynamicConstant(value, ..) => write!(f, "{value:?}"),
|
||||||
Self::BoolConstant(value, ..) => write!(f, "{:?}", value),
|
Self::BoolConstant(value, ..) => write!(f, "{value:?}"),
|
||||||
Self::IntegerConstant(value, ..) => write!(f, "{:?}", value),
|
Self::IntegerConstant(value, ..) => write!(f, "{value:?}"),
|
||||||
#[cfg(not(feature = "no_float"))]
|
#[cfg(not(feature = "no_float"))]
|
||||||
Self::FloatConstant(value, ..) => write!(f, "{:?}", value),
|
Self::FloatConstant(value, ..) => write!(f, "{value:?}"),
|
||||||
Self::CharConstant(value, ..) => write!(f, "{:?}", value),
|
Self::CharConstant(value, ..) => write!(f, "{value:?}"),
|
||||||
Self::StringConstant(value, ..) => write!(f, "{:?}", value),
|
Self::StringConstant(value, ..) => write!(f, "{value:?}"),
|
||||||
Self::Unit(..) => f.write_str("()"),
|
Self::Unit(..) => f.write_str("()"),
|
||||||
|
|
||||||
Self::InterpolatedString(x, ..) => {
|
Self::InterpolatedString(x, ..) => {
|
||||||
@ -483,8 +523,12 @@ impl fmt::Debug for Expr {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
f.write_str(&x.3)?;
|
f.write_str(&x.3)?;
|
||||||
|
#[cfg(not(feature = "no_module"))]
|
||||||
|
if let Some(n) = x.1.index() {
|
||||||
|
write!(f, " #{n}")?;
|
||||||
|
}
|
||||||
if let Some(n) = i.map_or_else(|| x.0, |n| NonZeroUsize::new(n.get() as usize)) {
|
if let Some(n) = i.map_or_else(|| x.0, |n| NonZeroUsize::new(n.get() as usize)) {
|
||||||
write!(f, " #{}", n)?;
|
write!(f, " #{n}")?;
|
||||||
}
|
}
|
||||||
f.write_str(")")
|
f.write_str(")")
|
||||||
}
|
}
|
||||||
@ -588,7 +632,7 @@ impl Expr {
|
|||||||
let mut s = SmartString::new_const();
|
let mut s = SmartString::new_const();
|
||||||
for segment in x.iter() {
|
for segment in x.iter() {
|
||||||
let v = segment.get_literal_value().unwrap();
|
let v = segment.get_literal_value().unwrap();
|
||||||
write!(&mut s, "{}", v).unwrap();
|
write!(&mut s, "{v}").unwrap();
|
||||||
}
|
}
|
||||||
s.into()
|
s.into()
|
||||||
}
|
}
|
||||||
@ -598,7 +642,7 @@ impl Expr {
|
|||||||
if !x.is_qualified() && x.args.len() == 1 && x.name == KEYWORD_FN_PTR =>
|
if !x.is_qualified() && x.args.len() == 1 && x.name == KEYWORD_FN_PTR =>
|
||||||
{
|
{
|
||||||
if let Self::StringConstant(ref s, ..) = x.args[0] {
|
if let Self::StringConstant(ref s, ..) = x.args[0] {
|
||||||
FnPtr::new(s).ok()?.into()
|
FnPtr::new(s.clone()).ok()?.into()
|
||||||
} else {
|
} else {
|
||||||
return None;
|
return None;
|
||||||
}
|
}
|
||||||
@ -669,8 +713,7 @@ impl Expr {
|
|||||||
hashes: calc_fn_hash(None, f.fn_name(), 1).into(),
|
hashes: calc_fn_hash(None, f.fn_name(), 1).into(),
|
||||||
args: once(Self::StringConstant(f.fn_name().into(), pos)).collect(),
|
args: once(Self::StringConstant(f.fn_name().into(), pos)).collect(),
|
||||||
capture_parent_scope: false,
|
capture_parent_scope: false,
|
||||||
is_native_operator: false,
|
op_token: None,
|
||||||
pos,
|
|
||||||
}
|
}
|
||||||
.into(),
|
.into(),
|
||||||
pos,
|
pos,
|
||||||
@ -725,6 +768,8 @@ impl Expr {
|
|||||||
| Self::And(.., pos)
|
| Self::And(.., pos)
|
||||||
| Self::Or(.., pos)
|
| Self::Or(.., pos)
|
||||||
| Self::Coalesce(.., pos)
|
| Self::Coalesce(.., pos)
|
||||||
|
| Self::FnCall(.., pos)
|
||||||
|
| Self::MethodCall(.., pos)
|
||||||
| Self::Index(.., pos)
|
| Self::Index(.., pos)
|
||||||
| Self::Dot(.., pos)
|
| Self::Dot(.., pos)
|
||||||
| Self::InterpolatedString(.., pos)
|
| Self::InterpolatedString(.., pos)
|
||||||
@ -733,8 +778,6 @@ impl Expr {
|
|||||||
#[cfg(not(feature = "no_custom_syntax"))]
|
#[cfg(not(feature = "no_custom_syntax"))]
|
||||||
Self::Custom(.., pos) => *pos,
|
Self::Custom(.., pos) => *pos,
|
||||||
|
|
||||||
Self::FnCall(x, ..) | Self::MethodCall(x, ..) => x.pos,
|
|
||||||
|
|
||||||
Self::Stmt(x) => x.position(),
|
Self::Stmt(x) => x.position(),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -4,6 +4,7 @@ use crate::{ImmutableString, Position};
|
|||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
use std::{
|
use std::{
|
||||||
|
borrow::Borrow,
|
||||||
fmt,
|
fmt,
|
||||||
hash::Hash,
|
hash::Hash,
|
||||||
ops::{Deref, DerefMut},
|
ops::{Deref, DerefMut},
|
||||||
@ -20,14 +21,25 @@ pub struct Ident {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl fmt::Debug for Ident {
|
impl fmt::Debug for Ident {
|
||||||
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
write!(f, "{:?}", self.name)?;
|
write!(f, "{:?}", self.name)?;
|
||||||
self.pos.debug_print(f)
|
self.pos.debug_print(f)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl Borrow<str> for Ident {
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
fn borrow(&self) -> &str {
|
||||||
|
self.name.as_ref()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
impl AsRef<str> for Ident {
|
impl AsRef<str> for Ident {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn as_ref(&self) -> &str {
|
fn as_ref(&self) -> &str {
|
||||||
self.name.as_ref()
|
self.name.as_ref()
|
||||||
}
|
}
|
||||||
|
@ -29,13 +29,15 @@ pub struct Namespace {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl fmt::Debug for Namespace {
|
impl fmt::Debug for Namespace {
|
||||||
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
if self.is_empty() {
|
if self.is_empty() {
|
||||||
return f.write_str("NONE");
|
return f.write_str("NONE");
|
||||||
}
|
}
|
||||||
|
|
||||||
if let Some(index) = self.index {
|
if let Some(index) = self.index {
|
||||||
write!(f, "{} -> ", index)?;
|
write!(f, "{index} -> ")?;
|
||||||
}
|
}
|
||||||
|
|
||||||
f.write_str(
|
f.write_str(
|
||||||
@ -83,7 +85,7 @@ impl DerefMut for Namespace {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl From<Vec<Ident>> for Namespace {
|
impl From<Vec<Ident>> for Namespace {
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
fn from(mut path: Vec<Ident>) -> Self {
|
fn from(mut path: Vec<Ident>) -> Self {
|
||||||
path.shrink_to_fit();
|
path.shrink_to_fit();
|
||||||
Self {
|
Self {
|
||||||
@ -94,7 +96,7 @@ impl From<Vec<Ident>> for Namespace {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl From<StaticVec<Ident>> for Namespace {
|
impl From<StaticVec<Ident>> for Namespace {
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
fn from(mut path: StaticVec<Ident>) -> Self {
|
fn from(mut path: StaticVec<Ident>) -> Self {
|
||||||
path.shrink_to_fit();
|
path.shrink_to_fit();
|
||||||
Self { index: None, path }
|
Self { index: None, path }
|
||||||
|
@ -20,9 +20,9 @@ use std::{fmt, hash::Hash};
|
|||||||
#[derive(Debug, Clone)]
|
#[derive(Debug, Clone)]
|
||||||
pub struct EncapsulatedEnviron {
|
pub struct EncapsulatedEnviron {
|
||||||
/// Functions defined within the same [`AST`][crate::AST].
|
/// Functions defined within the same [`AST`][crate::AST].
|
||||||
pub lib: crate::Shared<crate::Module>,
|
pub lib: crate::SharedModule,
|
||||||
/// Imported [modules][crate::Module].
|
/// Imported [modules][crate::Module].
|
||||||
pub imports: Box<[(ImmutableString, crate::Shared<crate::Module>)]>,
|
pub imports: Box<[(ImmutableString, crate::SharedModule)]>,
|
||||||
/// Globally-defined constants.
|
/// Globally-defined constants.
|
||||||
pub constants: Option<crate::eval::GlobalConstants>,
|
pub constants: Option<crate::eval::GlobalConstants>,
|
||||||
}
|
}
|
||||||
|
@ -7,6 +7,7 @@ use crate::{calc_fn_hash, Position, StaticVec, INT};
|
|||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
use std::{
|
use std::{
|
||||||
|
borrow::Borrow,
|
||||||
collections::BTreeMap,
|
collections::BTreeMap,
|
||||||
fmt,
|
fmt,
|
||||||
hash::Hash,
|
hash::Hash,
|
||||||
@ -19,16 +20,16 @@ use std::{
|
|||||||
/// Exported under the `internals` feature only.
|
/// Exported under the `internals` feature only.
|
||||||
///
|
///
|
||||||
/// This type may hold a straight assignment (i.e. not an op-assignment).
|
/// This type may hold a straight assignment (i.e. not an op-assignment).
|
||||||
#[derive(Clone, Copy, Eq, PartialEq, Hash)]
|
#[derive(Clone, PartialEq, Hash)]
|
||||||
pub struct OpAssignment {
|
pub struct OpAssignment {
|
||||||
/// Hash of the op-assignment call.
|
/// Hash of the op-assignment call.
|
||||||
pub hash_op_assign: u64,
|
pub hash_op_assign: u64,
|
||||||
/// Hash of the underlying operator call (for fallback).
|
/// Hash of the underlying operator call (for fallback).
|
||||||
pub hash_op: u64,
|
pub hash_op: u64,
|
||||||
/// Op-assignment operator.
|
/// Op-assignment operator.
|
||||||
pub op_assign: &'static str,
|
pub op_assign: Token,
|
||||||
/// Underlying operator.
|
/// Underlying operator.
|
||||||
pub op: &'static str,
|
pub op: Token,
|
||||||
/// [Position] of the op-assignment operator.
|
/// [Position] of the op-assignment operator.
|
||||||
pub pos: Position,
|
pub pos: Position,
|
||||||
}
|
}
|
||||||
@ -41,8 +42,8 @@ impl OpAssignment {
|
|||||||
Self {
|
Self {
|
||||||
hash_op_assign: 0,
|
hash_op_assign: 0,
|
||||||
hash_op: 0,
|
hash_op: 0,
|
||||||
op_assign: "=",
|
op_assign: Token::Equals,
|
||||||
op: "=",
|
op: Token::Equals,
|
||||||
pos,
|
pos,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -60,7 +61,10 @@ impl OpAssignment {
|
|||||||
#[must_use]
|
#[must_use]
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn new_op_assignment(name: &str, pos: Position) -> Self {
|
pub fn new_op_assignment(name: &str, pos: Position) -> Self {
|
||||||
Self::new_op_assignment_from_token(&Token::lookup_from_syntax(name).expect("operator"), pos)
|
Self::new_op_assignment_from_token(
|
||||||
|
&Token::lookup_symbol_from_syntax(name).expect("operator"),
|
||||||
|
pos,
|
||||||
|
)
|
||||||
}
|
}
|
||||||
/// Create a new [`OpAssignment`] from a [`Token`].
|
/// Create a new [`OpAssignment`] from a [`Token`].
|
||||||
///
|
///
|
||||||
@ -71,12 +75,11 @@ impl OpAssignment {
|
|||||||
pub fn new_op_assignment_from_token(op: &Token, pos: Position) -> Self {
|
pub fn new_op_assignment_from_token(op: &Token, pos: Position) -> Self {
|
||||||
let op_raw = op
|
let op_raw = op
|
||||||
.get_base_op_from_assignment()
|
.get_base_op_from_assignment()
|
||||||
.expect("op-assignment operator")
|
.expect("op-assignment operator");
|
||||||
.literal_syntax();
|
|
||||||
Self {
|
Self {
|
||||||
hash_op_assign: calc_fn_hash(None, op.literal_syntax(), 2),
|
hash_op_assign: calc_fn_hash(None, op.literal_syntax(), 2),
|
||||||
hash_op: calc_fn_hash(None, op_raw, 2),
|
hash_op: calc_fn_hash(None, op_raw.literal_syntax(), 2),
|
||||||
op_assign: op.literal_syntax(),
|
op_assign: op.clone(),
|
||||||
op: op_raw,
|
op: op_raw,
|
||||||
pos,
|
pos,
|
||||||
}
|
}
|
||||||
@ -90,7 +93,7 @@ impl OpAssignment {
|
|||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn new_op_assignment_from_base(name: &str, pos: Position) -> Self {
|
pub fn new_op_assignment_from_base(name: &str, pos: Position) -> Self {
|
||||||
Self::new_op_assignment_from_base_token(
|
Self::new_op_assignment_from_base_token(
|
||||||
&Token::lookup_from_syntax(name).expect("operator"),
|
&Token::lookup_symbol_from_syntax(name).expect("operator"),
|
||||||
pos,
|
pos,
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
@ -107,6 +110,8 @@ impl OpAssignment {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl fmt::Debug for OpAssignment {
|
impl fmt::Debug for OpAssignment {
|
||||||
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
if self.is_op_assignment() {
|
if self.is_op_assignment() {
|
||||||
f.debug_struct("OpAssignment")
|
f.debug_struct("OpAssignment")
|
||||||
@ -179,11 +184,12 @@ pub enum RangeCase {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl fmt::Debug for RangeCase {
|
impl fmt::Debug for RangeCase {
|
||||||
#[inline]
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
match self {
|
match self {
|
||||||
Self::ExclusiveInt(r, n) => write!(f, "{}..{} => {}", r.start, r.end, n),
|
Self::ExclusiveInt(r, n) => write!(f, "{}..{} => {n}", r.start, r.end),
|
||||||
Self::InclusiveInt(r, n) => write!(f, "{}..={} => {}", *r.start(), *r.end(), n),
|
Self::InclusiveInt(r, n) => write!(f, "{}..={} => {n}", *r.start(), *r.end()),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -207,6 +213,7 @@ impl IntoIterator for RangeCase {
|
|||||||
type IntoIter = Box<dyn Iterator<Item = Self::Item>>;
|
type IntoIter = Box<dyn Iterator<Item = Self::Item>>;
|
||||||
|
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn into_iter(self) -> Self::IntoIter {
|
fn into_iter(self) -> Self::IntoIter {
|
||||||
match self {
|
match self {
|
||||||
Self::ExclusiveInt(r, ..) => Box::new(r),
|
Self::ExclusiveInt(r, ..) => Box::new(r),
|
||||||
@ -299,6 +306,10 @@ pub struct TryCatchBlock {
|
|||||||
pub catch_block: StmtBlock,
|
pub catch_block: StmtBlock,
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// Number of items to keep inline for [`StmtBlockContainer`].
|
||||||
|
#[cfg(not(feature = "no_std"))]
|
||||||
|
const STMT_BLOCK_INLINE_SIZE: usize = 8;
|
||||||
|
|
||||||
/// _(internals)_ The underlying container type for [`StmtBlock`].
|
/// _(internals)_ The underlying container type for [`StmtBlock`].
|
||||||
/// Exported under the `internals` feature only.
|
/// Exported under the `internals` feature only.
|
||||||
///
|
///
|
||||||
@ -306,7 +317,7 @@ pub struct TryCatchBlock {
|
|||||||
/// hold a statements block, with the assumption that most program blocks would container fewer than
|
/// hold a statements block, with the assumption that most program blocks would container fewer than
|
||||||
/// 8 statements, and those that do have a lot more statements.
|
/// 8 statements, and those that do have a lot more statements.
|
||||||
#[cfg(not(feature = "no_std"))]
|
#[cfg(not(feature = "no_std"))]
|
||||||
pub type StmtBlockContainer = smallvec::SmallVec<[Stmt; 8]>;
|
pub type StmtBlockContainer = smallvec::SmallVec<[Stmt; STMT_BLOCK_INLINE_SIZE]>;
|
||||||
|
|
||||||
/// _(internals)_ The underlying container type for [`StmtBlock`].
|
/// _(internals)_ The underlying container type for [`StmtBlock`].
|
||||||
/// Exported under the `internals` feature only.
|
/// Exported under the `internals` feature only.
|
||||||
@ -436,8 +447,17 @@ impl DerefMut for StmtBlock {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl Borrow<[Stmt]> for StmtBlock {
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
fn borrow(&self) -> &[Stmt] {
|
||||||
|
&self.block
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
impl AsRef<[Stmt]> for StmtBlock {
|
impl AsRef<[Stmt]> for StmtBlock {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn as_ref(&self) -> &[Stmt] {
|
fn as_ref(&self) -> &[Stmt] {
|
||||||
&self.block
|
&self.block
|
||||||
}
|
}
|
||||||
@ -445,12 +465,15 @@ impl AsRef<[Stmt]> for StmtBlock {
|
|||||||
|
|
||||||
impl AsMut<[Stmt]> for StmtBlock {
|
impl AsMut<[Stmt]> for StmtBlock {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn as_mut(&mut self) -> &mut [Stmt] {
|
fn as_mut(&mut self) -> &mut [Stmt] {
|
||||||
&mut self.block
|
&mut self.block
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl fmt::Debug for StmtBlock {
|
impl fmt::Debug for StmtBlock {
|
||||||
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
f.write_str("Block")?;
|
f.write_str("Block")?;
|
||||||
fmt::Debug::fmt(&self.block, f)?;
|
fmt::Debug::fmt(&self.block, f)?;
|
||||||
@ -484,9 +507,9 @@ impl From<Stmt> for StmtBlock {
|
|||||||
impl IntoIterator for StmtBlock {
|
impl IntoIterator for StmtBlock {
|
||||||
type Item = Stmt;
|
type Item = Stmt;
|
||||||
#[cfg(not(feature = "no_std"))]
|
#[cfg(not(feature = "no_std"))]
|
||||||
type IntoIter = smallvec::IntoIter<[Stmt; 8]>;
|
type IntoIter = smallvec::IntoIter<[Stmt; STMT_BLOCK_INLINE_SIZE]>;
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
type IntoIter = smallvec::IntoIter<[Stmt; 3]>;
|
type IntoIter = smallvec::IntoIter<[Stmt; crate::STATIC_VEC_INLINE_SIZE]>;
|
||||||
|
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn into_iter(self) -> Self::IntoIter {
|
fn into_iter(self) -> Self::IntoIter {
|
||||||
@ -561,14 +584,14 @@ pub enum Stmt {
|
|||||||
TryCatch(Box<TryCatchBlock>, Position),
|
TryCatch(Box<TryCatchBlock>, Position),
|
||||||
/// [expression][Expr]
|
/// [expression][Expr]
|
||||||
Expr(Box<Expr>),
|
Expr(Box<Expr>),
|
||||||
/// `continue`/`break`
|
/// `continue`/`break` expr
|
||||||
///
|
///
|
||||||
/// ### Flags
|
/// ### Flags
|
||||||
///
|
///
|
||||||
/// * [`NONE`][ASTFlags::NONE] = `continue`
|
/// * [`NONE`][ASTFlags::NONE] = `continue`
|
||||||
/// * [`BREAK`][ASTFlags::BREAK] = `break`
|
/// * [`BREAK`][ASTFlags::BREAK] = `break`
|
||||||
BreakLoop(ASTFlags, Position),
|
BreakLoop(Option<Box<Expr>>, ASTFlags, Position),
|
||||||
/// `return`/`throw`
|
/// `return`/`throw` expr
|
||||||
///
|
///
|
||||||
/// ### Flags
|
/// ### Flags
|
||||||
///
|
///
|
||||||
@ -585,20 +608,21 @@ pub enum Stmt {
|
|||||||
/// Not available under `no_module`.
|
/// Not available under `no_module`.
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
Export(Box<(Ident, Ident)>, Position),
|
Export(Box<(Ident, Ident)>, Position),
|
||||||
/// Convert a variable to shared.
|
/// Convert a list of variables to shared.
|
||||||
///
|
///
|
||||||
/// Not available under `no_closure`.
|
/// Not available under `no_closure`.
|
||||||
///
|
///
|
||||||
/// # Notes
|
/// # Notes
|
||||||
///
|
///
|
||||||
/// This variant does not map to any language structure. It is currently only used only to
|
/// This variant does not map to any language structure. It is currently only used only to
|
||||||
/// convert a normal variable into a shared variable when the variable is _captured_ by a closure.
|
/// convert normal variables into shared variables when they are _captured_ by a closure.
|
||||||
#[cfg(not(feature = "no_closure"))]
|
#[cfg(not(feature = "no_closure"))]
|
||||||
Share(crate::ImmutableString, Position),
|
Share(Box<crate::FnArgsVec<(crate::ImmutableString, Option<NonZeroUsize>, Position)>>),
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Default for Stmt {
|
impl Default for Stmt {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
Self::Noop(Position::NONE)
|
Self::Noop(Position::NONE)
|
||||||
}
|
}
|
||||||
@ -660,7 +684,7 @@ impl Stmt {
|
|||||||
Self::Export(.., pos) => *pos,
|
Self::Export(.., pos) => *pos,
|
||||||
|
|
||||||
#[cfg(not(feature = "no_closure"))]
|
#[cfg(not(feature = "no_closure"))]
|
||||||
Self::Share(.., pos) => *pos,
|
Self::Share(x) => x[0].2,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
/// Override the [position][Position] of this statement.
|
/// Override the [position][Position] of this statement.
|
||||||
@ -692,7 +716,7 @@ impl Stmt {
|
|||||||
Self::Export(.., pos) => *pos = new_pos,
|
Self::Export(.., pos) => *pos = new_pos,
|
||||||
|
|
||||||
#[cfg(not(feature = "no_closure"))]
|
#[cfg(not(feature = "no_closure"))]
|
||||||
Self::Share(.., pos) => *pos = new_pos,
|
Self::Share(x) => x.iter_mut().for_each(|(_, _, pos)| *pos = new_pos),
|
||||||
}
|
}
|
||||||
|
|
||||||
self
|
self
|
||||||
|
@ -45,7 +45,6 @@ fn print_source(lines: &[String], pos: Position, offset: usize, window: (usize,
|
|||||||
if n == line {
|
if n == line {
|
||||||
if let Some(pos) = pos.position() {
|
if let Some(pos) = pos.position() {
|
||||||
let shift = offset + line_no_len + marker.len() + 2;
|
let shift = offset + line_no_len + marker.len() + 2;
|
||||||
|
|
||||||
println!("{0:>1$}{2:>3$}", "│ ", shift, "\x1b[36m^\x1b[39m", pos + 10);
|
println!("{0:>1$}{2:>3$}", "│ ", shift, "\x1b[36m^\x1b[39m", pos + 10);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -76,7 +75,7 @@ fn print_current_source(
|
|||||||
}
|
}
|
||||||
if !src.is_empty() {
|
if !src.is_empty() {
|
||||||
// Print just a line number for imported modules
|
// Print just a line number for imported modules
|
||||||
println!("{} @ {:?}", src, pos);
|
println!("{src} @ {pos:?}");
|
||||||
} else {
|
} else {
|
||||||
// Print the current source line
|
// Print the current source line
|
||||||
print_source(lines, pos, 0, window);
|
print_source(lines, pos, 0, window);
|
||||||
@ -101,17 +100,16 @@ fn print_error(input: &str, mut err: EvalAltResult) {
|
|||||||
// Print error position
|
// Print error position
|
||||||
if pos.is_none() {
|
if pos.is_none() {
|
||||||
// No position
|
// No position
|
||||||
println!("{}", err);
|
println!("{err}");
|
||||||
} else {
|
} else {
|
||||||
// Specific position - print line text
|
// Specific position - print line text
|
||||||
println!("{}{}", line_no, lines[pos.line().unwrap() - 1]);
|
println!("{line_no}{}", lines[pos.line().unwrap() - 1]);
|
||||||
|
|
||||||
// Display position marker
|
// Display position marker
|
||||||
println!(
|
println!(
|
||||||
"{0:>1$} {2}",
|
"{0:>1$} {err}",
|
||||||
"^",
|
"^",
|
||||||
line_no.len() + pos.position().unwrap(),
|
line_no.len() + pos.position().unwrap(),
|
||||||
err
|
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -248,11 +246,11 @@ fn debug_callback(
|
|||||||
BreakPoint::AtPosition { .. } => (),
|
BreakPoint::AtPosition { .. } => (),
|
||||||
BreakPoint::AtFunctionName { ref name, .. }
|
BreakPoint::AtFunctionName { ref name, .. }
|
||||||
| BreakPoint::AtFunctionCall { ref name, .. } => {
|
| BreakPoint::AtFunctionCall { ref name, .. } => {
|
||||||
println!("! Call to function {}.", name)
|
println!("! Call to function {name}.")
|
||||||
}
|
}
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
BreakPoint::AtProperty { ref name, .. } => {
|
BreakPoint::AtProperty { ref name, .. } => {
|
||||||
println!("! Property {} accessed.", name)
|
println!("! Property {name} accessed.")
|
||||||
}
|
}
|
||||||
_ => unreachable!(),
|
_ => unreachable!(),
|
||||||
}
|
}
|
||||||
@ -310,10 +308,11 @@ fn debug_callback(
|
|||||||
["node"] => {
|
["node"] => {
|
||||||
if pos.is_none() {
|
if pos.is_none() {
|
||||||
println!("{:?}", node);
|
println!("{:?}", node);
|
||||||
} else if let Some(source) = source {
|
|
||||||
println!("{:?} {} @ {:?}", node, source, pos);
|
|
||||||
} else {
|
} else {
|
||||||
println!("{:?} @ {:?}", node, pos);
|
match source {
|
||||||
|
Some(source) => println!("{node:?} {source} @ {pos:?}"),
|
||||||
|
None => println!("{node:?} @ {pos:?}"),
|
||||||
|
}
|
||||||
}
|
}
|
||||||
println!();
|
println!();
|
||||||
}
|
}
|
||||||
@ -327,7 +326,7 @@ fn debug_callback(
|
|||||||
["list" | "l", n] if n.parse::<usize>().is_ok() => {
|
["list" | "l", n] if n.parse::<usize>().is_ok() => {
|
||||||
let num = n.parse::<usize>().unwrap();
|
let num = n.parse::<usize>().unwrap();
|
||||||
if num == 0 || num > lines.len() {
|
if num == 0 || num > lines.len() {
|
||||||
eprintln!("\x1b[31mInvalid line: {}\x1b[39m", num);
|
eprintln!("\x1b[31mInvalid line: {num}\x1b[39m");
|
||||||
} else {
|
} else {
|
||||||
let pos = Position::new(num as u16, 0);
|
let pos = Position::new(num as u16, 0);
|
||||||
print_current_source(&mut context, source, pos, lines, (3, 6));
|
print_current_source(&mut context, source, pos, lines, (3, 6));
|
||||||
@ -339,24 +338,18 @@ fn debug_callback(
|
|||||||
["over" | "o"] => break Ok(DebuggerCommand::StepOver),
|
["over" | "o"] => break Ok(DebuggerCommand::StepOver),
|
||||||
["next" | "n"] => break Ok(DebuggerCommand::Next),
|
["next" | "n"] => break Ok(DebuggerCommand::Next),
|
||||||
["scope"] => println!("{}", context.scope()),
|
["scope"] => println!("{}", context.scope()),
|
||||||
["print" | "p", "this"] => {
|
["print" | "p", "this"] => match context.this_ptr() {
|
||||||
if let Some(value) = context.this_ptr() {
|
Some(value) => println!("=> {value:?}"),
|
||||||
println!("=> {:?}", value);
|
None => println!("`this` pointer is unbound."),
|
||||||
} else {
|
},
|
||||||
println!("`this` pointer is unbound.");
|
["print" | "p", var_name] => match context.scope().get_value::<Dynamic>(var_name) {
|
||||||
}
|
Some(value) => println!("=> {value:?}"),
|
||||||
}
|
None => eprintln!("Variable not found: {var_name}"),
|
||||||
["print" | "p", var_name] => {
|
},
|
||||||
if let Some(value) = context.scope().get_value::<Dynamic>(var_name) {
|
|
||||||
println!("=> {:?}", value);
|
|
||||||
} else {
|
|
||||||
eprintln!("Variable not found: {}", var_name);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
["print" | "p"] => {
|
["print" | "p"] => {
|
||||||
println!("{}", context.scope().clone_visible());
|
println!("{}", context.scope().clone_visible());
|
||||||
if let Some(value) = context.this_ptr() {
|
if let Some(value) = context.this_ptr() {
|
||||||
println!("this = {:?}", value);
|
println!("this = {value:?}");
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
@ -385,7 +378,7 @@ fn debug_callback(
|
|||||||
.iter()
|
.iter()
|
||||||
.rev()
|
.rev()
|
||||||
{
|
{
|
||||||
println!("{}", frame)
|
println!("{frame}")
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
["info" | "i", "break" | "b"] => Iterator::for_each(
|
["info" | "i", "break" | "b"] => Iterator::for_each(
|
||||||
@ -402,7 +395,7 @@ fn debug_callback(
|
|||||||
print!("{}", line_num);
|
print!("{}", line_num);
|
||||||
print_source(lines, *pos, line_num.len(), (0, 0));
|
print_source(lines, *pos, line_num.len(), (0, 0));
|
||||||
}
|
}
|
||||||
_ => println!("[{}] {}", i + 1, bp),
|
_ => println!("[{}] {bp}", i + 1),
|
||||||
},
|
},
|
||||||
),
|
),
|
||||||
["enable" | "en", n] => {
|
["enable" | "en", n] => {
|
||||||
@ -420,12 +413,12 @@ fn debug_callback(
|
|||||||
.get_mut(n - 1)
|
.get_mut(n - 1)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.enable(true);
|
.enable(true);
|
||||||
println!("Break-point #{} enabled.", n)
|
println!("Break-point #{n} enabled.")
|
||||||
} else {
|
} else {
|
||||||
eprintln!("\x1b[31mInvalid break-point: {}\x1b[39m", n);
|
eprintln!("\x1b[31mInvalid break-point: {n}\x1b[39m");
|
||||||
}
|
}
|
||||||
} else {
|
} else {
|
||||||
eprintln!("\x1b[31mInvalid break-point: '{}'\x1b[39m", n);
|
eprintln!("\x1b[31mInvalid break-point: '{n}'\x1b[39m");
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
["disable" | "dis", n] => {
|
["disable" | "dis", n] => {
|
||||||
@ -443,12 +436,12 @@ fn debug_callback(
|
|||||||
.get_mut(n - 1)
|
.get_mut(n - 1)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.enable(false);
|
.enable(false);
|
||||||
println!("Break-point #{} disabled.", n)
|
println!("Break-point #{n} disabled.")
|
||||||
} else {
|
} else {
|
||||||
eprintln!("\x1b[31mInvalid break-point: {}\x1b[39m", n);
|
eprintln!("\x1b[31mInvalid break-point: {n}\x1b[39m");
|
||||||
}
|
}
|
||||||
} else {
|
} else {
|
||||||
eprintln!("\x1b[31mInvalid break-point: '{}'\x1b[39m", n);
|
eprintln!("\x1b[31mInvalid break-point: '{n}'\x1b[39m");
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
["delete" | "d", n] => {
|
["delete" | "d", n] => {
|
||||||
@ -464,12 +457,12 @@ fn debug_callback(
|
|||||||
.debugger
|
.debugger
|
||||||
.break_points_mut()
|
.break_points_mut()
|
||||||
.remove(n - 1);
|
.remove(n - 1);
|
||||||
println!("Break-point #{} deleted.", n)
|
println!("Break-point #{n} deleted.")
|
||||||
} else {
|
} else {
|
||||||
eprintln!("\x1b[31mInvalid break-point: {}\x1b[39m", n);
|
eprintln!("\x1b[31mInvalid break-point: {n}\x1b[39m");
|
||||||
}
|
}
|
||||||
} else {
|
} else {
|
||||||
eprintln!("\x1b[31mInvalid break-point: '{}'\x1b[39m", n);
|
eprintln!("\x1b[31mInvalid break-point: '{n}'\x1b[39m");
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
["delete" | "d"] => {
|
["delete" | "d"] => {
|
||||||
@ -487,14 +480,14 @@ fn debug_callback(
|
|||||||
args,
|
args,
|
||||||
enabled: true,
|
enabled: true,
|
||||||
};
|
};
|
||||||
println!("Break-point added for {}", bp);
|
println!("Break-point added for {bp}");
|
||||||
context
|
context
|
||||||
.global_runtime_state_mut()
|
.global_runtime_state_mut()
|
||||||
.debugger
|
.debugger
|
||||||
.break_points_mut()
|
.break_points_mut()
|
||||||
.push(bp);
|
.push(bp);
|
||||||
} else {
|
} else {
|
||||||
eprintln!("\x1b[31mInvalid number of arguments: '{}'\x1b[39m", args);
|
eprintln!("\x1b[31mInvalid number of arguments: '{args}'\x1b[39m");
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
// Property name
|
// Property name
|
||||||
@ -504,7 +497,7 @@ fn debug_callback(
|
|||||||
name: param[1..].into(),
|
name: param[1..].into(),
|
||||||
enabled: true,
|
enabled: true,
|
||||||
};
|
};
|
||||||
println!("Break-point added for {}", bp);
|
println!("Break-point added for {bp}");
|
||||||
context
|
context
|
||||||
.global_runtime_state_mut()
|
.global_runtime_state_mut()
|
||||||
.debugger
|
.debugger
|
||||||
@ -523,18 +516,18 @@ fn debug_callback(
|
|||||||
|
|
||||||
if range.contains(&n) {
|
if range.contains(&n) {
|
||||||
let bp = rhai::debugger::BreakPoint::AtPosition {
|
let bp = rhai::debugger::BreakPoint::AtPosition {
|
||||||
source: source.unwrap_or("").into(),
|
source: source.map(|s| s.into()),
|
||||||
pos: Position::new(n as u16, 0),
|
pos: Position::new(n as u16, 0),
|
||||||
enabled: true,
|
enabled: true,
|
||||||
};
|
};
|
||||||
println!("Break-point added {}", bp);
|
println!("Break-point added {bp}");
|
||||||
context
|
context
|
||||||
.global_runtime_state_mut()
|
.global_runtime_state_mut()
|
||||||
.debugger
|
.debugger
|
||||||
.break_points_mut()
|
.break_points_mut()
|
||||||
.push(bp);
|
.push(bp);
|
||||||
} else {
|
} else {
|
||||||
eprintln!("\x1b[31mInvalid line number: '{}'\x1b[39m", n);
|
eprintln!("\x1b[31mInvalid line number: '{n}'\x1b[39m");
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
// Function name parameter
|
// Function name parameter
|
||||||
@ -543,7 +536,7 @@ fn debug_callback(
|
|||||||
name: param.trim().into(),
|
name: param.trim().into(),
|
||||||
enabled: true,
|
enabled: true,
|
||||||
};
|
};
|
||||||
println!("Break-point added for {}", bp);
|
println!("Break-point added for {bp}");
|
||||||
context
|
context
|
||||||
.global_runtime_state_mut()
|
.global_runtime_state_mut()
|
||||||
.debugger
|
.debugger
|
||||||
@ -553,11 +546,11 @@ fn debug_callback(
|
|||||||
#[cfg(not(feature = "no_position"))]
|
#[cfg(not(feature = "no_position"))]
|
||||||
["break" | "b"] => {
|
["break" | "b"] => {
|
||||||
let bp = rhai::debugger::BreakPoint::AtPosition {
|
let bp = rhai::debugger::BreakPoint::AtPosition {
|
||||||
source: source.unwrap_or("").into(),
|
source: source.map(|s| s.into()),
|
||||||
pos,
|
pos,
|
||||||
enabled: true,
|
enabled: true,
|
||||||
};
|
};
|
||||||
println!("Break-point added {}", bp);
|
println!("Break-point added {bp}");
|
||||||
context
|
context
|
||||||
.global_runtime_state_mut()
|
.global_runtime_state_mut()
|
||||||
.debugger
|
.debugger
|
||||||
@ -594,7 +587,7 @@ fn debug_callback(
|
|||||||
|
|
||||||
fn main() {
|
fn main() {
|
||||||
let title = format!("Rhai Debugger (version {})", env!("CARGO_PKG_VERSION"));
|
let title = format!("Rhai Debugger (version {})", env!("CARGO_PKG_VERSION"));
|
||||||
println!("{}", title);
|
println!("{title}");
|
||||||
println!("{0:=<1$}", "", title.len());
|
println!("{0:=<1$}", "", title.len());
|
||||||
|
|
||||||
// Initialize scripting engine
|
// Initialize scripting engine
|
||||||
|
@ -26,17 +26,16 @@ fn print_error(input: &str, mut err: EvalAltResult) {
|
|||||||
// Print error position
|
// Print error position
|
||||||
if pos.is_none() {
|
if pos.is_none() {
|
||||||
// No position
|
// No position
|
||||||
println!("{}", err);
|
println!("{err}");
|
||||||
} else {
|
} else {
|
||||||
// Specific position - print line text
|
// Specific position - print line text
|
||||||
println!("{}{}", line_no, lines[pos.line().unwrap() - 1]);
|
println!("{line_no}{}", lines[pos.line().unwrap() - 1]);
|
||||||
|
|
||||||
// Display position marker
|
// Display position marker
|
||||||
println!(
|
println!(
|
||||||
"{0:>1$} {2}",
|
"{0:>1$} {err}",
|
||||||
"^",
|
"^",
|
||||||
line_no.len() + pos.position().unwrap(),
|
line_no.len() + pos.position().unwrap(),
|
||||||
err
|
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -119,7 +118,7 @@ fn load_script_files(engine: &mut Engine) {
|
|||||||
for filename in env::args().skip(1) {
|
for filename in env::args().skip(1) {
|
||||||
let filename = match Path::new(&filename).canonicalize() {
|
let filename = match Path::new(&filename).canonicalize() {
|
||||||
Err(err) => {
|
Err(err) => {
|
||||||
eprintln!("Error script file path: {}\n{}", filename, err);
|
eprintln!("Error script file path: {filename}\n{err}");
|
||||||
exit(1);
|
exit(1);
|
||||||
}
|
}
|
||||||
Ok(f) => {
|
Ok(f) => {
|
||||||
@ -164,7 +163,7 @@ fn load_script_files(engine: &mut Engine) {
|
|||||||
let filename = filename.to_string_lossy();
|
let filename = filename.to_string_lossy();
|
||||||
|
|
||||||
eprintln!("{:=<1$}", "", filename.len());
|
eprintln!("{:=<1$}", "", filename.len());
|
||||||
eprintln!("{}", filename);
|
eprintln!("{filename}");
|
||||||
eprintln!("{:=<1$}", "", filename.len());
|
eprintln!("{:=<1$}", "", filename.len());
|
||||||
eprintln!();
|
eprintln!();
|
||||||
|
|
||||||
@ -277,13 +276,13 @@ mod sample_functions {
|
|||||||
#[rhai_fn(name = "test")]
|
#[rhai_fn(name = "test")]
|
||||||
pub fn test2(x: &mut INT, y: INT, z: &str) {
|
pub fn test2(x: &mut INT, y: INT, z: &str) {
|
||||||
*x += y + (z.len() as INT);
|
*x += y + (z.len() as INT);
|
||||||
println!("{} {} {}", x, y, z);
|
println!("{x} {y} {z}");
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn main() {
|
fn main() {
|
||||||
let title = format!("Rhai REPL tool (version {})", env!("CARGO_PKG_VERSION"));
|
let title = format!("Rhai REPL tool (version {})", env!("CARGO_PKG_VERSION"));
|
||||||
println!("{}", title);
|
println!("{title}");
|
||||||
println!("{0:=<1$}", "", title.len());
|
println!("{0:=<1$}", "", title.len());
|
||||||
|
|
||||||
#[cfg(not(feature = "no_optimize"))]
|
#[cfg(not(feature = "no_optimize"))]
|
||||||
@ -338,11 +337,11 @@ fn main() {
|
|||||||
history_offset += 1;
|
history_offset += 1;
|
||||||
}
|
}
|
||||||
if input.contains('\n') {
|
if input.contains('\n') {
|
||||||
println!("[{}] ~~~~", replacement_index);
|
println!("[{replacement_index}] ~~~~");
|
||||||
println!("{}", input);
|
println!("{input}");
|
||||||
println!("~~~~");
|
println!("~~~~");
|
||||||
} else {
|
} else {
|
||||||
println!("[{}] {}", replacement_index, input);
|
println!("[{replacement_index}] {input}");
|
||||||
}
|
}
|
||||||
replacement_index = 0;
|
replacement_index = 0;
|
||||||
} else {
|
} else {
|
||||||
@ -374,7 +373,7 @@ fn main() {
|
|||||||
Err(ReadlineError::Interrupted) | Err(ReadlineError::Eof) => break 'main_loop,
|
Err(ReadlineError::Interrupted) | Err(ReadlineError::Eof) => break 'main_loop,
|
||||||
|
|
||||||
Err(err) => {
|
Err(err) => {
|
||||||
eprintln!("Error: {:?}", err);
|
eprintln!("Error: {err:?}");
|
||||||
break 'main_loop;
|
break 'main_loop;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -401,12 +400,12 @@ fn main() {
|
|||||||
"history" => {
|
"history" => {
|
||||||
for (i, h) in rl.history().iter().enumerate() {
|
for (i, h) in rl.history().iter().enumerate() {
|
||||||
match &h.split('\n').collect::<Vec<_>>()[..] {
|
match &h.split('\n').collect::<Vec<_>>()[..] {
|
||||||
[line] => println!("[{}] {}", history_offset + i, line),
|
[line] => println!("[{}] {line}", history_offset + i),
|
||||||
lines => {
|
lines => {
|
||||||
for (x, line) in lines.iter().enumerate() {
|
for (x, line) in lines.iter().enumerate() {
|
||||||
let number = format!("[{}]", history_offset + i);
|
let number = format!("[{}]", history_offset + i);
|
||||||
if x == 0 {
|
if x == 0 {
|
||||||
println!("{} {}", number, line.trim_end());
|
println!("{number} {}", line.trim_end());
|
||||||
} else {
|
} else {
|
||||||
println!("{0:>1$} {2}", "", number.len(), line.trim_end());
|
println!("{0:>1$} {2}", "", number.len(), line.trim_end());
|
||||||
}
|
}
|
||||||
@ -439,30 +438,30 @@ fn main() {
|
|||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
"scope" => {
|
"scope" => {
|
||||||
println!("{}", scope);
|
println!("{scope}");
|
||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
#[cfg(not(feature = "no_optimize"))]
|
#[cfg(not(feature = "no_optimize"))]
|
||||||
"astu" => {
|
"astu" => {
|
||||||
// print the last un-optimized AST
|
// print the last un-optimized AST
|
||||||
println!("{:#?}\n", ast_u);
|
println!("{ast_u:#?}\n");
|
||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
"ast" => {
|
"ast" => {
|
||||||
// print the last AST
|
// print the last AST
|
||||||
println!("{:#?}\n", ast);
|
println!("{ast:#?}\n");
|
||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
#[cfg(feature = "metadata")]
|
#[cfg(feature = "metadata")]
|
||||||
"functions" => {
|
"functions" => {
|
||||||
// print a list of all registered functions
|
// print a list of all registered functions
|
||||||
for f in engine.gen_fn_signatures(false) {
|
for f in engine.gen_fn_signatures(false) {
|
||||||
println!("{}", f)
|
println!("{f}")
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
for f in main_ast.iter_functions() {
|
for f in main_ast.iter_functions() {
|
||||||
println!("{}", f)
|
println!("{f}")
|
||||||
}
|
}
|
||||||
|
|
||||||
println!();
|
println!();
|
||||||
@ -482,27 +481,30 @@ fn main() {
|
|||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
"!!" => {
|
"!!" => {
|
||||||
if let Some(line) = rl.history().last() {
|
match rl.history().last() {
|
||||||
|
Some(line) => {
|
||||||
replacement = Some(line.clone());
|
replacement = Some(line.clone());
|
||||||
replacement_index = history_offset + rl.history().len() - 1;
|
replacement_index = history_offset + rl.history().len() - 1;
|
||||||
} else {
|
}
|
||||||
eprintln!("No lines history!");
|
None => eprintln!("No lines history!"),
|
||||||
}
|
}
|
||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
_ if cmd.starts_with("!?") => {
|
_ if cmd.starts_with("!?") => {
|
||||||
let text = cmd[2..].trim();
|
let text = cmd[2..].trim();
|
||||||
if let Some((n, line)) = rl
|
let history = rl
|
||||||
.history()
|
.history()
|
||||||
.iter()
|
.iter()
|
||||||
.rev()
|
.rev()
|
||||||
.enumerate()
|
.enumerate()
|
||||||
.find(|&(.., h)| h.contains(text))
|
.find(|&(.., h)| h.contains(text));
|
||||||
{
|
|
||||||
|
match history {
|
||||||
|
Some((n, line)) => {
|
||||||
replacement = Some(line.clone());
|
replacement = Some(line.clone());
|
||||||
replacement_index = history_offset + (rl.history().len() - 1 - n);
|
replacement_index = history_offset + (rl.history().len() - 1 - n);
|
||||||
} else {
|
}
|
||||||
eprintln!("History line not found: {}", text);
|
None => eprintln!("History line not found: {text}"),
|
||||||
}
|
}
|
||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
@ -558,7 +560,7 @@ fn main() {
|
|||||||
engine.eval_ast_with_scope::<Dynamic>(&mut scope, &main_ast)
|
engine.eval_ast_with_scope::<Dynamic>(&mut scope, &main_ast)
|
||||||
}) {
|
}) {
|
||||||
Ok(result) if !result.is::<()>() => {
|
Ok(result) if !result.is::<()>() => {
|
||||||
println!("=> {:?}", result);
|
println!("=> {result:?}");
|
||||||
println!();
|
println!();
|
||||||
}
|
}
|
||||||
Ok(_) => (),
|
Ok(_) => (),
|
||||||
|
@ -7,12 +7,11 @@ fn eprint_error(input: &str, mut err: EvalAltResult) {
|
|||||||
let line = pos.line().unwrap();
|
let line = pos.line().unwrap();
|
||||||
let line_no = format!("{line}: ");
|
let line_no = format!("{line}: ");
|
||||||
|
|
||||||
eprintln!("{}{}", line_no, lines[line - 1]);
|
eprintln!("{line_no}{}", lines[line - 1]);
|
||||||
eprintln!(
|
eprintln!(
|
||||||
"{:>1$} {2}",
|
"{:>1$} {err_msg}",
|
||||||
"^",
|
"^",
|
||||||
line_no.len() + pos.position().unwrap(),
|
line_no.len() + pos.position().unwrap(),
|
||||||
err_msg
|
|
||||||
);
|
);
|
||||||
eprintln!();
|
eprintln!();
|
||||||
}
|
}
|
||||||
@ -24,7 +23,7 @@ fn eprint_error(input: &str, mut err: EvalAltResult) {
|
|||||||
|
|
||||||
if pos.is_none() {
|
if pos.is_none() {
|
||||||
// No position
|
// No position
|
||||||
eprintln!("{}", err);
|
eprintln!("{err}");
|
||||||
} else {
|
} else {
|
||||||
// Specific position
|
// Specific position
|
||||||
eprint_line(&lines, pos, &err.to_string())
|
eprint_line(&lines, pos, &err.to_string())
|
||||||
@ -37,7 +36,7 @@ fn main() {
|
|||||||
for filename in env::args().skip(1) {
|
for filename in env::args().skip(1) {
|
||||||
let filename = match Path::new(&filename).canonicalize() {
|
let filename = match Path::new(&filename).canonicalize() {
|
||||||
Err(err) => {
|
Err(err) => {
|
||||||
eprintln!("Error script file path: {}\n{}", filename, err);
|
eprintln!("Error script file path: {filename}\n{err}");
|
||||||
exit(1);
|
exit(1);
|
||||||
}
|
}
|
||||||
Ok(f) => match f.strip_prefix(std::env::current_dir().unwrap().canonicalize().unwrap())
|
Ok(f) => match f.strip_prefix(std::env::current_dir().unwrap().canonicalize().unwrap())
|
||||||
@ -94,7 +93,7 @@ fn main() {
|
|||||||
let filename = filename.to_string_lossy();
|
let filename = filename.to_string_lossy();
|
||||||
|
|
||||||
eprintln!("{:=<1$}", "", filename.len());
|
eprintln!("{:=<1$}", "", filename.len());
|
||||||
eprintln!("{}", filename);
|
eprintln!("{filename}");
|
||||||
eprintln!("{:=<1$}", "", filename.len());
|
eprintln!("{:=<1$}", "", filename.len());
|
||||||
eprintln!();
|
eprintln!();
|
||||||
|
|
||||||
|
226
src/config/hashing.rs
Normal file
226
src/config/hashing.rs
Normal file
@ -0,0 +1,226 @@
|
|||||||
|
//! Fixed hashing seeds for stable hashing.
|
||||||
|
//!
|
||||||
|
//! Set to [`None`] to disable stable hashing.
|
||||||
|
//!
|
||||||
|
//! See [`set_rhai_ahash_seed`].
|
||||||
|
//!
|
||||||
|
//! # Example
|
||||||
|
//!
|
||||||
|
//! ```rust
|
||||||
|
//! // Set the hashing seed to [1, 2, 3, 4]
|
||||||
|
//! rhai::config::hashing::set_ahash_seed(Some([1, 2, 3, 4])).unwrap();
|
||||||
|
//! ```
|
||||||
|
//! Alternatively, set this at compile time via the `RHAI_AHASH_SEED` environment variable.
|
||||||
|
//!
|
||||||
|
//! # Example
|
||||||
|
//!
|
||||||
|
//! ```sh
|
||||||
|
//! env RHAI_AHASH_SEED ="[236,800,954,213]"
|
||||||
|
//! ```
|
||||||
|
// [236,800,954,213], haha funny yume nikki reference epic uboachan face numberworld nexus moment 100
|
||||||
|
|
||||||
|
use crate::config::hashing_env;
|
||||||
|
use core::panic::{RefUnwindSafe, UnwindSafe};
|
||||||
|
#[cfg(feature = "no_std")]
|
||||||
|
use std::prelude::v1::*;
|
||||||
|
use std::{
|
||||||
|
cell::UnsafeCell,
|
||||||
|
marker::PhantomData,
|
||||||
|
mem,
|
||||||
|
mem::MaybeUninit,
|
||||||
|
sync::atomic::{AtomicBool, AtomicUsize, Ordering},
|
||||||
|
};
|
||||||
|
|
||||||
|
// omg its hokma from record team here to record our locks
|
||||||
|
// what does this do?
|
||||||
|
// so what this does is keep track of a global address in memory that acts as a global lock
|
||||||
|
// i stole this from crossbeam so read their docs for more
|
||||||
|
#[must_use]
|
||||||
|
struct HokmaLock {
|
||||||
|
lock: AtomicUsize,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl HokmaLock {
|
||||||
|
#[inline(always)]
|
||||||
|
pub const fn new() -> Self {
|
||||||
|
Self {
|
||||||
|
lock: AtomicUsize::new(0),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn write(&'static self) -> WhenTheHokmaSuppression {
|
||||||
|
loop {
|
||||||
|
let previous = self.lock.swap(1, Ordering::SeqCst);
|
||||||
|
|
||||||
|
if previous != 1 {
|
||||||
|
return WhenTheHokmaSuppression {
|
||||||
|
hokma: self,
|
||||||
|
state: previous,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
struct WhenTheHokmaSuppression {
|
||||||
|
hokma: &'static HokmaLock,
|
||||||
|
state: usize,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl WhenTheHokmaSuppression {
|
||||||
|
#[inline]
|
||||||
|
pub fn the_price_of_silence(self) {
|
||||||
|
self.hokma.lock.store(self.state, Ordering::SeqCst);
|
||||||
|
mem::forget(self)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Drop for WhenTheHokmaSuppression {
|
||||||
|
#[inline]
|
||||||
|
fn drop(&mut self) {
|
||||||
|
self.hokma
|
||||||
|
.lock
|
||||||
|
.store(self.state.wrapping_add(2), Ordering::SeqCst)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
fn hokmalock(address: usize) -> &'static HokmaLock {
|
||||||
|
const LEN: usize = 787;
|
||||||
|
const LCK: HokmaLock = HokmaLock::new();
|
||||||
|
static RECORDS: [HokmaLock; LEN] = [LCK; LEN];
|
||||||
|
|
||||||
|
&RECORDS[address % LEN]
|
||||||
|
}
|
||||||
|
|
||||||
|
// Safety: lol, there is a reason its called "SusLock<T>"
|
||||||
|
#[must_use]
|
||||||
|
struct SusLock<T>
|
||||||
|
where
|
||||||
|
T: 'static,
|
||||||
|
{
|
||||||
|
initialized: AtomicBool,
|
||||||
|
data: UnsafeCell<MaybeUninit<T>>,
|
||||||
|
_marker: PhantomData<T>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<T> SusLock<T>
|
||||||
|
where
|
||||||
|
T: 'static,
|
||||||
|
{
|
||||||
|
#[inline]
|
||||||
|
pub const fn new() -> SusLock<T> {
|
||||||
|
SusLock {
|
||||||
|
initialized: AtomicBool::new(false),
|
||||||
|
data: UnsafeCell::new(MaybeUninit::uninit()),
|
||||||
|
_marker: PhantomData,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[must_use]
|
||||||
|
pub fn get(&self) -> Option<&'static T> {
|
||||||
|
if self.initialized.load(Ordering::SeqCst) {
|
||||||
|
let hokma = hokmalock(unsafe { mem::transmute(self.data.get()) });
|
||||||
|
// we forgo the optimistic read, because we don't really care
|
||||||
|
let guard = hokma.write();
|
||||||
|
let val = {
|
||||||
|
let cast: *const T = self.data.get().cast();
|
||||||
|
unsafe { mem::transmute::<*const T, &'static T>(cast) }
|
||||||
|
};
|
||||||
|
guard.the_price_of_silence();
|
||||||
|
Some(val)
|
||||||
|
} else {
|
||||||
|
return None;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[must_use]
|
||||||
|
pub fn get_or_init(&self, f: impl FnOnce() -> T) -> Option<&'static T> {
|
||||||
|
if !self.initialized.load(Ordering::SeqCst) {
|
||||||
|
let value = f();
|
||||||
|
self.initialized.store(true, Ordering::SeqCst);
|
||||||
|
let hokma = hokmalock(unsafe { mem::transmute(self.data.get()) });
|
||||||
|
hokma.write();
|
||||||
|
unsafe {
|
||||||
|
self.data.get().write(MaybeUninit::new(value));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
self.get()
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn set(&self, value: T) -> Result<(), T> {
|
||||||
|
if self.initialized.load(Ordering::SeqCst) {
|
||||||
|
Err(value)
|
||||||
|
} else {
|
||||||
|
let _ = self.get_or_init(|| value);
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
unsafe impl<T: Sync + Send> Sync for SusLock<T> where T: 'static {}
|
||||||
|
unsafe impl<T: Send> Send for SusLock<T> where T: 'static {}
|
||||||
|
impl<T: RefUnwindSafe + UnwindSafe> RefUnwindSafe for SusLock<T> where T: 'static {}
|
||||||
|
|
||||||
|
impl<T> Drop for SusLock<T>
|
||||||
|
where
|
||||||
|
T: 'static,
|
||||||
|
{
|
||||||
|
#[inline]
|
||||||
|
fn drop(&mut self) {
|
||||||
|
if self.initialized.load(Ordering::SeqCst) {
|
||||||
|
unsafe { (&mut *self.data.get()).assume_init_drop() };
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
static AHASH_SEED: SusLock<Option<[u64; 4]>> = SusLock::new();
|
||||||
|
|
||||||
|
/// Set the hashing seed. This is used to hash functions etc.
|
||||||
|
///
|
||||||
|
/// This is a static global value and affects every Rhai instance.
|
||||||
|
/// This should not be used _unless_ you know you need it.
|
||||||
|
///
|
||||||
|
/// # Warning
|
||||||
|
///
|
||||||
|
/// * You can only call this function **ONCE** for the entire duration of program execution.
|
||||||
|
/// * You **MUST** call this before performing **ANY** Rhai operation (e.g. creating an [`Engine`]).
|
||||||
|
///
|
||||||
|
/// # Error
|
||||||
|
///
|
||||||
|
/// Returns an error containing the existing hashing seed if already set.
|
||||||
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rust
|
||||||
|
/// # use rhai::Engine;
|
||||||
|
/// // Set the hashing seed to [1, 2, 3, 4]
|
||||||
|
/// rhai::config::hashing::set_ahash_seed(Some([1, 2, 3, 4])).unwrap();
|
||||||
|
///
|
||||||
|
/// // Use Rhai AFTER setting the hashing seed
|
||||||
|
/// let engine = Engine::new();
|
||||||
|
/// ```
|
||||||
|
#[inline(always)]
|
||||||
|
pub fn set_ahash_seed(new_seed: Option<[u64; 4]>) -> Result<(), Option<[u64; 4]>> {
|
||||||
|
AHASH_SEED.set(new_seed)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the current hashing Seed.
|
||||||
|
///
|
||||||
|
/// If the seed is not yet defined, the `RHAI_AHASH_SEED` environment variable (if any) is used.
|
||||||
|
///
|
||||||
|
/// Otherwise, the hashing seed is randomized to protect against DOS attacks.
|
||||||
|
///
|
||||||
|
/// See [`set_rhai_ahash_seed`] for more.
|
||||||
|
#[inline]
|
||||||
|
#[must_use]
|
||||||
|
pub fn get_ahash_seed() -> &'static Option<[u64; 4]> {
|
||||||
|
const NONE: &'static Option<[u64; 4]> = &None;
|
||||||
|
|
||||||
|
match AHASH_SEED.get_or_init(|| hashing_env::AHASH_SEED) {
|
||||||
|
Some(ash) => ash,
|
||||||
|
None => NONE,
|
||||||
|
}
|
||||||
|
}
|
3
src/config/hashing_env.rs
Normal file
3
src/config/hashing_env.rs
Normal file
@ -0,0 +1,3 @@
|
|||||||
|
//! This file is automatically recreated during build time by `build.rs` from `build.template`.
|
||||||
|
|
||||||
|
pub(crate) const AHASH_SEED: Option<[u64; 4]> = None;
|
4
src/config/mod.rs
Normal file
4
src/config/mod.rs
Normal file
@ -0,0 +1,4 @@
|
|||||||
|
//! Configuration for Rhai.
|
||||||
|
|
||||||
|
pub mod hashing;
|
||||||
|
mod hashing_env;
|
@ -9,8 +9,8 @@ use crate::packages::{Package, StandardPackage};
|
|||||||
use crate::tokenizer::Token;
|
use crate::tokenizer::Token;
|
||||||
use crate::types::StringsInterner;
|
use crate::types::StringsInterner;
|
||||||
use crate::{
|
use crate::{
|
||||||
Dynamic, Identifier, ImmutableString, Locked, Module, OptimizationLevel, Position, RhaiResult,
|
Dynamic, Identifier, ImmutableString, Locked, Module, OptimizationLevel, SharedModule,
|
||||||
Shared, StaticVec,
|
StaticVec,
|
||||||
};
|
};
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
@ -86,16 +86,16 @@ pub const OP_INCLUSIVE_RANGE: &str = Token::InclusiveRange.literal_syntax();
|
|||||||
///
|
///
|
||||||
/// let result = engine.eval::<i64>("40 + 2")?;
|
/// let result = engine.eval::<i64>("40 + 2")?;
|
||||||
///
|
///
|
||||||
/// println!("Answer: {}", result); // prints 42
|
/// println!("Answer: {result}"); // prints 42
|
||||||
/// # Ok(())
|
/// # Ok(())
|
||||||
/// # }
|
/// # }
|
||||||
/// ```
|
/// ```
|
||||||
pub struct Engine {
|
pub struct Engine {
|
||||||
/// A collection of all modules loaded into the global namespace of the Engine.
|
/// A collection of all modules loaded into the global namespace of the Engine.
|
||||||
pub(crate) global_modules: StaticVec<Shared<Module>>,
|
pub(crate) global_modules: StaticVec<SharedModule>,
|
||||||
/// A collection of all sub-modules directly loaded into the Engine.
|
/// A collection of all sub-modules directly loaded into the Engine.
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
pub(crate) global_sub_modules: std::collections::BTreeMap<Identifier, Shared<Module>>,
|
pub(crate) global_sub_modules: std::collections::BTreeMap<Identifier, SharedModule>,
|
||||||
|
|
||||||
/// A module resolution service.
|
/// A module resolution service.
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
@ -150,7 +150,8 @@ pub struct Engine {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl fmt::Debug for Engine {
|
impl fmt::Debug for Engine {
|
||||||
#[inline]
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
let mut f = f.debug_struct("Engine");
|
let mut f = f.debug_struct("Engine");
|
||||||
|
|
||||||
@ -189,6 +190,7 @@ impl fmt::Debug for Engine {
|
|||||||
|
|
||||||
impl Default for Engine {
|
impl Default for Engine {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
Self::new()
|
Self::new()
|
||||||
}
|
}
|
||||||
@ -235,18 +237,14 @@ impl Engine {
|
|||||||
#[cfg(not(feature = "no_std"))]
|
#[cfg(not(feature = "no_std"))]
|
||||||
#[cfg(not(target_family = "wasm"))]
|
#[cfg(not(target_family = "wasm"))]
|
||||||
{
|
{
|
||||||
engine.print = Box::new(|s| println!("{}", s));
|
engine.print = Box::new(|s| println!("{s}"));
|
||||||
engine.debug = Box::new(|s, source, pos| {
|
engine.debug = Box::new(|s, source, pos| match (source, pos) {
|
||||||
source.map_or_else(
|
(Some(source), crate::Position::NONE) => println!("{source} | {s}"),
|
||||||
|| {
|
#[cfg(not(feature = "no_position"))]
|
||||||
if pos.is_none() {
|
(Some(source), pos) => println!("{source} @ {pos:?} | {s}"),
|
||||||
println!("{}", s);
|
(None, crate::Position::NONE) => println!("{s}"),
|
||||||
} else {
|
#[cfg(not(feature = "no_position"))]
|
||||||
println!("{:?} | {}", pos, s);
|
(None, pos) => println!("{pos:?} | {s}"),
|
||||||
}
|
|
||||||
},
|
|
||||||
|source| println!("{} @ {:?} | {}", source, pos, s),
|
|
||||||
)
|
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -343,15 +341,4 @@ impl Engine {
|
|||||||
pub fn const_empty_string(&self) -> ImmutableString {
|
pub fn const_empty_string(&self) -> ImmutableString {
|
||||||
self.get_interned_string("")
|
self.get_interned_string("")
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Check a result to ensure that it is valid.
|
|
||||||
#[inline]
|
|
||||||
pub(crate) fn check_return_value(&self, result: RhaiResult, _pos: Position) -> RhaiResult {
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
if let Ok(ref r) = result {
|
|
||||||
self.check_data_size(r, _pos)?;
|
|
||||||
}
|
|
||||||
|
|
||||||
result
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
@ -2,8 +2,7 @@
|
|||||||
|
|
||||||
use crate::func::{CallableFunction, StraightHashMap};
|
use crate::func::{CallableFunction, StraightHashMap};
|
||||||
use crate::types::BloomFilterU64;
|
use crate::types::BloomFilterU64;
|
||||||
use crate::{Identifier, StaticVec};
|
use crate::{ImmutableString, StaticVec};
|
||||||
use std::marker::PhantomData;
|
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
|
|
||||||
@ -14,7 +13,7 @@ pub struct FnResolutionCacheEntry {
|
|||||||
/// Function.
|
/// Function.
|
||||||
pub func: CallableFunction,
|
pub func: CallableFunction,
|
||||||
/// Optional source.
|
/// Optional source.
|
||||||
pub source: Option<Box<Identifier>>,
|
pub source: Option<ImmutableString>,
|
||||||
}
|
}
|
||||||
|
|
||||||
/// _(internals)_ A function resolution cache with a bloom filter.
|
/// _(internals)_ A function resolution cache with a bloom filter.
|
||||||
@ -45,21 +44,18 @@ impl FnResolutionCache {
|
|||||||
/// The following caches are contained inside this type:
|
/// The following caches are contained inside this type:
|
||||||
/// * A stack of [function resolution caches][FnResolutionCache]
|
/// * A stack of [function resolution caches][FnResolutionCache]
|
||||||
#[derive(Debug, Clone)]
|
#[derive(Debug, Clone)]
|
||||||
pub struct Caches<'a> {
|
pub struct Caches {
|
||||||
/// Stack of [function resolution caches][FnResolutionCache].
|
/// Stack of [function resolution caches][FnResolutionCache].
|
||||||
stack: StaticVec<FnResolutionCache>,
|
stack: StaticVec<FnResolutionCache>,
|
||||||
/// Take care of the lifetime parameter.
|
|
||||||
dummy: PhantomData<&'a ()>,
|
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Caches<'_> {
|
impl Caches {
|
||||||
/// Create an empty [`Caches`].
|
/// Create an empty [`Caches`].
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn new() -> Self {
|
pub const fn new() -> Self {
|
||||||
Self {
|
Self {
|
||||||
stack: StaticVec::new_const(),
|
stack: StaticVec::new_const(),
|
||||||
dummy: PhantomData,
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
/// Get the number of function resolution cache(s) in the stack.
|
/// Get the number of function resolution cache(s) in the stack.
|
||||||
|
@ -4,7 +4,10 @@
|
|||||||
use super::{Caches, GlobalRuntimeState, Target};
|
use super::{Caches, GlobalRuntimeState, Target};
|
||||||
use crate::ast::{ASTFlags, Expr, OpAssignment};
|
use crate::ast::{ASTFlags, Expr, OpAssignment};
|
||||||
use crate::types::dynamic::Union;
|
use crate::types::dynamic::Union;
|
||||||
use crate::{Dynamic, Engine, FnArgsVec, Module, Position, RhaiResult, RhaiResultOf, Scope, ERR};
|
use crate::types::RestoreOnDrop;
|
||||||
|
use crate::{
|
||||||
|
Dynamic, Engine, FnArgsVec, Position, RhaiResult, RhaiResultOf, Scope, SharedModule, ERR,
|
||||||
|
};
|
||||||
use std::hash::Hash;
|
use std::hash::Hash;
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
@ -40,17 +43,16 @@ impl Engine {
|
|||||||
&self,
|
&self,
|
||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
caches: &mut Caches,
|
caches: &mut Caches,
|
||||||
lib: &[&Module],
|
lib: &[SharedModule],
|
||||||
this_ptr: &mut Option<&mut Dynamic>,
|
this_ptr: &mut Dynamic,
|
||||||
target: &mut Target,
|
target: &mut Target,
|
||||||
root: (&str, Position),
|
root: (&str, Position),
|
||||||
_parent: &Expr,
|
_parent: &Expr,
|
||||||
|
parent_options: ASTFlags,
|
||||||
rhs: &Expr,
|
rhs: &Expr,
|
||||||
_parent_options: ASTFlags,
|
|
||||||
idx_values: &mut FnArgsVec<Dynamic>,
|
idx_values: &mut FnArgsVec<Dynamic>,
|
||||||
chain_type: ChainType,
|
chain_type: ChainType,
|
||||||
level: usize,
|
new_val: &mut Option<(Dynamic, &OpAssignment)>,
|
||||||
new_val: Option<(Dynamic, OpAssignment)>,
|
|
||||||
) -> RhaiResultOf<(Dynamic, bool)> {
|
) -> RhaiResultOf<(Dynamic, bool)> {
|
||||||
let is_ref_mut = target.is_ref();
|
let is_ref_mut = target.is_ref();
|
||||||
|
|
||||||
@ -61,7 +63,7 @@ impl Engine {
|
|||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
ChainType::Indexing => {
|
ChainType::Indexing => {
|
||||||
// Check for existence with the null conditional operator
|
// Check for existence with the null conditional operator
|
||||||
if _parent_options.contains(ASTFlags::NEGATED) && target.is::<()>() {
|
if parent_options.contains(ASTFlags::NEGATED) && target.is::<()>() {
|
||||||
return Ok((Dynamic::UNIT, false));
|
return Ok((Dynamic::UNIT, false));
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -70,26 +72,26 @@ impl Engine {
|
|||||||
match rhs {
|
match rhs {
|
||||||
// xxx[idx].expr... | xxx[idx][expr]...
|
// xxx[idx].expr... | xxx[idx][expr]...
|
||||||
Expr::Dot(x, options, x_pos) | Expr::Index(x, options, x_pos)
|
Expr::Dot(x, options, x_pos) | Expr::Index(x, options, x_pos)
|
||||||
if !_parent_options.contains(ASTFlags::BREAK) =>
|
if !parent_options.contains(ASTFlags::BREAK) =>
|
||||||
{
|
{
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
self.run_debugger(scope, global, lib, this_ptr, _parent, level)?;
|
self.run_debugger(global, caches, lib, scope, this_ptr, _parent)?;
|
||||||
|
|
||||||
let idx_val = idx_values.pop().unwrap();
|
let idx_val = &mut idx_values.pop().unwrap();
|
||||||
let mut idx_val_for_setter = idx_val.clone();
|
let mut idx_val_for_setter = idx_val.clone();
|
||||||
let idx_pos = x.lhs.start_position();
|
let idx_pos = x.lhs.start_position();
|
||||||
let rhs_chain = rhs.into();
|
let rhs_chain = rhs.into();
|
||||||
|
|
||||||
let (try_setter, result) = {
|
let (try_setter, result) = {
|
||||||
let mut obj = self.get_indexed_mut(
|
let mut obj = self.get_indexed_mut(
|
||||||
global, caches, lib, target, idx_val, idx_pos, false, true, level,
|
global, caches, lib, target, idx_val, idx_pos, false, true,
|
||||||
)?;
|
)?;
|
||||||
let is_obj_temp_val = obj.is_temp_value();
|
let is_obj_temp_val = obj.is_temp_value();
|
||||||
let obj_ptr = &mut obj;
|
let obj_ptr = &mut obj;
|
||||||
|
|
||||||
match self.eval_dot_index_chain_helper(
|
match self.eval_dot_index_chain_helper(
|
||||||
global, caches, lib, this_ptr, obj_ptr, root, rhs, &x.rhs,
|
global, caches, lib, this_ptr, obj_ptr, root, rhs, *options,
|
||||||
*options, idx_values, rhs_chain, level, new_val,
|
&x.rhs, idx_values, rhs_chain, new_val,
|
||||||
) {
|
) {
|
||||||
Ok((result, true)) if is_obj_temp_val => {
|
Ok((result, true)) if is_obj_temp_val => {
|
||||||
(Some(obj.take_or_clone()), (result, true))
|
(Some(obj.take_or_clone()), (result, true))
|
||||||
@ -104,7 +106,7 @@ impl Engine {
|
|||||||
let idx = &mut idx_val_for_setter;
|
let idx = &mut idx_val_for_setter;
|
||||||
let new_val = &mut new_val;
|
let new_val = &mut new_val;
|
||||||
self.call_indexer_set(
|
self.call_indexer_set(
|
||||||
global, caches, lib, target, idx, new_val, is_ref_mut, level,
|
global, caches, lib, target, idx, new_val, is_ref_mut,
|
||||||
)
|
)
|
||||||
.or_else(|e| match *e {
|
.or_else(|e| match *e {
|
||||||
ERR::ErrorIndexingType(..) => Ok((Dynamic::UNIT, false)),
|
ERR::ErrorIndexingType(..) => Ok((Dynamic::UNIT, false)),
|
||||||
@ -117,21 +119,20 @@ impl Engine {
|
|||||||
// xxx[rhs] op= new_val
|
// xxx[rhs] op= new_val
|
||||||
_ if new_val.is_some() => {
|
_ if new_val.is_some() => {
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
self.run_debugger(scope, global, lib, this_ptr, _parent, level)?;
|
self.run_debugger(global, caches, lib, scope, this_ptr, _parent)?;
|
||||||
|
|
||||||
let (new_val, op_info) = new_val.expect("`Some`");
|
let (new_val, op_info) = new_val.take().expect("`Some`");
|
||||||
let idx_val = idx_values.pop().unwrap();
|
let idx_val = &mut idx_values.pop().unwrap();
|
||||||
let mut idx_val2 = idx_val.clone();
|
let idx = &mut idx_val.clone();
|
||||||
|
|
||||||
let try_setter = match self.get_indexed_mut(
|
let try_setter = match self
|
||||||
global, caches, lib, target, idx_val, pos, true, false, level,
|
.get_indexed_mut(global, caches, lib, target, idx, pos, true, false)
|
||||||
) {
|
{
|
||||||
// Indexed value is not a temp value - update directly
|
// Indexed value is not a temp value - update directly
|
||||||
Ok(ref mut obj_ptr) => {
|
Ok(ref mut obj_ptr) => {
|
||||||
self.eval_op_assignment(
|
self.eval_op_assignment(
|
||||||
global, caches, lib, op_info, obj_ptr, root, new_val, level,
|
global, caches, lib, op_info, obj_ptr, root, new_val,
|
||||||
)?;
|
)?;
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
self.check_data_size(obj_ptr, op_info.pos)?;
|
self.check_data_size(obj_ptr, op_info.pos)?;
|
||||||
None
|
None
|
||||||
}
|
}
|
||||||
@ -143,32 +144,30 @@ impl Engine {
|
|||||||
};
|
};
|
||||||
|
|
||||||
if let Some(mut new_val) = try_setter {
|
if let Some(mut new_val) = try_setter {
|
||||||
let idx = &mut idx_val2;
|
|
||||||
|
|
||||||
// Is this an op-assignment?
|
// Is this an op-assignment?
|
||||||
if op_info.is_op_assignment() {
|
if op_info.is_op_assignment() {
|
||||||
let idx = &mut idx.clone();
|
let idx = &mut idx_val.clone();
|
||||||
|
|
||||||
// Call the index getter to get the current value
|
// Call the index getter to get the current value
|
||||||
if let Ok(val) =
|
if let Ok(val) =
|
||||||
self.call_indexer_get(global, caches, lib, target, idx, level)
|
self.call_indexer_get(global, caches, lib, target, idx)
|
||||||
{
|
{
|
||||||
let mut val = val.into();
|
let mut val = val.into();
|
||||||
// Run the op-assignment
|
// Run the op-assignment
|
||||||
self.eval_op_assignment(
|
self.eval_op_assignment(
|
||||||
global, caches, lib, op_info, &mut val, root, new_val,
|
global, caches, lib, op_info, &mut val, root, new_val,
|
||||||
level,
|
|
||||||
)?;
|
)?;
|
||||||
// Replace new value
|
// Replace new value
|
||||||
new_val = val.take_or_clone();
|
new_val = val.take_or_clone();
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
self.check_data_size(&new_val, op_info.pos)?;
|
self.check_data_size(&new_val, op_info.pos)?;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// Try to call index setter
|
// Try to call index setter
|
||||||
let new_val = &mut new_val;
|
let new_val = &mut new_val;
|
||||||
|
|
||||||
self.call_indexer_set(
|
self.call_indexer_set(
|
||||||
global, caches, lib, target, idx, new_val, is_ref_mut, level,
|
global, caches, lib, target, idx_val, new_val, is_ref_mut,
|
||||||
)?;
|
)?;
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -177,13 +176,11 @@ impl Engine {
|
|||||||
// xxx[rhs]
|
// xxx[rhs]
|
||||||
_ => {
|
_ => {
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
self.run_debugger(scope, global, lib, this_ptr, _parent, level)?;
|
self.run_debugger(global, caches, lib, scope, this_ptr, _parent)?;
|
||||||
|
|
||||||
let idx_val = idx_values.pop().unwrap();
|
let idx_val = &mut idx_values.pop().unwrap();
|
||||||
|
|
||||||
self.get_indexed_mut(
|
self.get_indexed_mut(global, caches, lib, target, idx_val, pos, false, true)
|
||||||
global, caches, lib, target, idx_val, pos, false, true, level,
|
|
||||||
)
|
|
||||||
.map(|v| (v.take_or_clone(), false))
|
.map(|v| (v.take_or_clone(), false))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -192,7 +189,7 @@ impl Engine {
|
|||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
ChainType::Dotting => {
|
ChainType::Dotting => {
|
||||||
// Check for existence with the Elvis operator
|
// Check for existence with the Elvis operator
|
||||||
if _parent_options.contains(ASTFlags::NEGATED) && target.is::<()>() {
|
if parent_options.contains(ASTFlags::NEGATED) && target.is::<()>() {
|
||||||
return Ok((Dynamic::UNIT, false));
|
return Ok((Dynamic::UNIT, false));
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -200,28 +197,28 @@ impl Engine {
|
|||||||
// xxx.fn_name(arg_expr_list)
|
// xxx.fn_name(arg_expr_list)
|
||||||
Expr::MethodCall(x, pos) if !x.is_qualified() && new_val.is_none() => {
|
Expr::MethodCall(x, pos) if !x.is_qualified() && new_val.is_none() => {
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
let reset_debugger =
|
let reset = self
|
||||||
self.run_debugger_with_reset(scope, global, lib, this_ptr, rhs, level)?;
|
.run_debugger_with_reset(global, caches, lib, scope, this_ptr, rhs)?;
|
||||||
|
#[cfg(feature = "debugging")]
|
||||||
|
let global = &mut *RestoreOnDrop::lock(global, move |g| {
|
||||||
|
g.debugger.reset_status(reset)
|
||||||
|
});
|
||||||
|
|
||||||
let crate::ast::FnCallExpr {
|
let crate::ast::FnCallExpr {
|
||||||
name, hashes, args, ..
|
name, hashes, args, ..
|
||||||
} = &**x;
|
} = &**x;
|
||||||
|
|
||||||
|
// Truncate the index values upon exit
|
||||||
let offset = idx_values.len() - args.len();
|
let offset = idx_values.len() - args.len();
|
||||||
|
let idx_values =
|
||||||
|
&mut *RestoreOnDrop::lock(idx_values, move |v| v.truncate(offset));
|
||||||
|
|
||||||
let call_args = &mut idx_values[offset..];
|
let call_args = &mut idx_values[offset..];
|
||||||
let pos1 = args.get(0).map_or(Position::NONE, Expr::position);
|
let pos1 = args.get(0).map_or(Position::NONE, Expr::position);
|
||||||
|
|
||||||
let result = self.make_method_call(
|
self.make_method_call(
|
||||||
global, caches, lib, name, *hashes, target, call_args, pos1, *pos,
|
global, caches, lib, name, *hashes, target, call_args, pos1, *pos,
|
||||||
level,
|
)
|
||||||
);
|
|
||||||
|
|
||||||
idx_values.truncate(offset);
|
|
||||||
|
|
||||||
#[cfg(feature = "debugging")]
|
|
||||||
global.debugger.reset_status(reset_debugger);
|
|
||||||
|
|
||||||
result
|
|
||||||
}
|
}
|
||||||
// xxx.fn_name(...) = ???
|
// xxx.fn_name(...) = ???
|
||||||
Expr::MethodCall(..) if new_val.is_some() => {
|
Expr::MethodCall(..) if new_val.is_some() => {
|
||||||
@ -234,54 +231,53 @@ impl Engine {
|
|||||||
// {xxx:map}.id op= ???
|
// {xxx:map}.id op= ???
|
||||||
Expr::Property(x, pos) if target.is::<crate::Map>() && new_val.is_some() => {
|
Expr::Property(x, pos) if target.is::<crate::Map>() && new_val.is_some() => {
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
self.run_debugger(scope, global, lib, this_ptr, rhs, level)?;
|
self.run_debugger(global, caches, lib, scope, this_ptr, rhs)?;
|
||||||
|
|
||||||
let index = x.2.clone().into();
|
let index = &mut x.2.clone().into();
|
||||||
let (new_val, op_info) = new_val.expect("`Some`");
|
let (new_val, op_info) = new_val.take().expect("`Some`");
|
||||||
{
|
{
|
||||||
let val_target = &mut self.get_indexed_mut(
|
let val_target = &mut self.get_indexed_mut(
|
||||||
global, caches, lib, target, index, *pos, true, false, level,
|
global, caches, lib, target, index, *pos, true, false,
|
||||||
)?;
|
)?;
|
||||||
self.eval_op_assignment(
|
self.eval_op_assignment(
|
||||||
global, caches, lib, op_info, val_target, root, new_val, level,
|
global, caches, lib, op_info, val_target, root, new_val,
|
||||||
)?;
|
)?;
|
||||||
}
|
}
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
self.check_data_size(target.source(), op_info.pos)?;
|
self.check_data_size(target.source(), op_info.pos)?;
|
||||||
Ok((Dynamic::UNIT, true))
|
Ok((Dynamic::UNIT, true))
|
||||||
}
|
}
|
||||||
// {xxx:map}.id
|
// {xxx:map}.id
|
||||||
Expr::Property(x, pos) if target.is::<crate::Map>() => {
|
Expr::Property(x, pos) if target.is::<crate::Map>() => {
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
self.run_debugger(scope, global, lib, this_ptr, rhs, level)?;
|
self.run_debugger(global, caches, lib, scope, this_ptr, rhs)?;
|
||||||
|
|
||||||
let index = x.2.clone().into();
|
let index = &mut x.2.clone().into();
|
||||||
let val = self.get_indexed_mut(
|
let val = self.get_indexed_mut(
|
||||||
global, caches, lib, target, index, *pos, false, false, level,
|
global, caches, lib, target, index, *pos, false, false,
|
||||||
)?;
|
)?;
|
||||||
Ok((val.take_or_clone(), false))
|
Ok((val.take_or_clone(), false))
|
||||||
}
|
}
|
||||||
// xxx.id op= ???
|
// xxx.id op= ???
|
||||||
Expr::Property(x, pos) if new_val.is_some() => {
|
Expr::Property(x, pos) if new_val.is_some() => {
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
self.run_debugger(scope, global, lib, this_ptr, rhs, level)?;
|
self.run_debugger(global, caches, lib, scope, this_ptr, rhs)?;
|
||||||
|
|
||||||
let ((getter, hash_get), (setter, hash_set), name) = &**x;
|
let ((getter, hash_get), (setter, hash_set), name) = &**x;
|
||||||
let (mut new_val, op_info) = new_val.expect("`Some`");
|
let (mut new_val, op_info) = new_val.take().expect("`Some`");
|
||||||
|
|
||||||
if op_info.is_op_assignment() {
|
if op_info.is_op_assignment() {
|
||||||
let args = &mut [target.as_mut()];
|
let args = &mut [target.as_mut()];
|
||||||
let (mut orig_val, ..) = self
|
let (mut orig_val, ..) = self
|
||||||
.call_native_fn(
|
.exec_native_fn_call(
|
||||||
global, caches, lib, getter, *hash_get, args, is_ref_mut,
|
global, caches, lib, getter, None, *hash_get, args, is_ref_mut,
|
||||||
false, *pos, level,
|
*pos,
|
||||||
)
|
)
|
||||||
.or_else(|err| match *err {
|
.or_else(|err| match *err {
|
||||||
// Try an indexer if property does not exist
|
// Try an indexer if property does not exist
|
||||||
ERR::ErrorDotExpr(..) => {
|
ERR::ErrorDotExpr(..) => {
|
||||||
let mut prop = name.into();
|
let mut prop = name.into();
|
||||||
self.call_indexer_get(
|
self.call_indexer_get(
|
||||||
global, caches, lib, target, &mut prop, level,
|
global, caches, lib, target, &mut prop,
|
||||||
)
|
)
|
||||||
.map(|r| (r, false))
|
.map(|r| (r, false))
|
||||||
.map_err(|e| {
|
.map_err(|e| {
|
||||||
@ -298,7 +294,7 @@ impl Engine {
|
|||||||
let orig_val = &mut (&mut orig_val).into();
|
let orig_val = &mut (&mut orig_val).into();
|
||||||
|
|
||||||
self.eval_op_assignment(
|
self.eval_op_assignment(
|
||||||
global, caches, lib, op_info, orig_val, root, new_val, level,
|
global, caches, lib, op_info, orig_val, root, new_val,
|
||||||
)?;
|
)?;
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -306,9 +302,8 @@ impl Engine {
|
|||||||
}
|
}
|
||||||
|
|
||||||
let args = &mut [target.as_mut(), &mut new_val];
|
let args = &mut [target.as_mut(), &mut new_val];
|
||||||
self.call_native_fn(
|
self.exec_native_fn_call(
|
||||||
global, caches, lib, setter, *hash_set, args, is_ref_mut, false, *pos,
|
global, caches, lib, setter, None, *hash_set, args, is_ref_mut, *pos,
|
||||||
level,
|
|
||||||
)
|
)
|
||||||
.or_else(|err| match *err {
|
.or_else(|err| match *err {
|
||||||
// Try an indexer if property does not exist
|
// Try an indexer if property does not exist
|
||||||
@ -316,7 +311,7 @@ impl Engine {
|
|||||||
let idx = &mut name.into();
|
let idx = &mut name.into();
|
||||||
let new_val = &mut new_val;
|
let new_val = &mut new_val;
|
||||||
self.call_indexer_set(
|
self.call_indexer_set(
|
||||||
global, caches, lib, target, idx, new_val, is_ref_mut, level,
|
global, caches, lib, target, idx, new_val, is_ref_mut,
|
||||||
)
|
)
|
||||||
.map_err(|e| match *e {
|
.map_err(|e| match *e {
|
||||||
ERR::ErrorIndexingType(..) => err,
|
ERR::ErrorIndexingType(..) => err,
|
||||||
@ -329,22 +324,19 @@ impl Engine {
|
|||||||
// xxx.id
|
// xxx.id
|
||||||
Expr::Property(x, pos) => {
|
Expr::Property(x, pos) => {
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
self.run_debugger(scope, global, lib, this_ptr, rhs, level)?;
|
self.run_debugger(global, caches, lib, scope, this_ptr, rhs)?;
|
||||||
|
|
||||||
let ((getter, hash_get), _, name) = &**x;
|
let ((getter, hash_get), _, name) = &**x;
|
||||||
let args = &mut [target.as_mut()];
|
let args = &mut [target.as_mut()];
|
||||||
self.call_native_fn(
|
self.exec_native_fn_call(
|
||||||
global, caches, lib, getter, *hash_get, args, is_ref_mut, false, *pos,
|
global, caches, lib, getter, None, *hash_get, args, is_ref_mut, *pos,
|
||||||
level,
|
|
||||||
)
|
)
|
||||||
.map_or_else(
|
.map_or_else(
|
||||||
|err| match *err {
|
|err| match *err {
|
||||||
// Try an indexer if property does not exist
|
// Try an indexer if property does not exist
|
||||||
ERR::ErrorDotExpr(..) => {
|
ERR::ErrorDotExpr(..) => {
|
||||||
let mut prop = name.into();
|
let mut prop = name.into();
|
||||||
self.call_indexer_get(
|
self.call_indexer_get(global, caches, lib, target, &mut prop)
|
||||||
global, caches, lib, target, &mut prop, level,
|
|
||||||
)
|
|
||||||
.map(|r| (r, false))
|
.map(|r| (r, false))
|
||||||
.map_err(|e| match *e {
|
.map_err(|e| match *e {
|
||||||
ERR::ErrorIndexingType(..) => err,
|
ERR::ErrorIndexingType(..) => err,
|
||||||
@ -366,39 +358,43 @@ impl Engine {
|
|||||||
let val_target = &mut match x.lhs {
|
let val_target = &mut match x.lhs {
|
||||||
Expr::Property(ref p, pos) => {
|
Expr::Property(ref p, pos) => {
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
self.run_debugger(scope, global, lib, this_ptr, _node, level)?;
|
self.run_debugger(global, caches, lib, scope, this_ptr, _node)?;
|
||||||
|
|
||||||
let index = p.2.clone().into();
|
let index = &mut p.2.clone().into();
|
||||||
self.get_indexed_mut(
|
self.get_indexed_mut(
|
||||||
global, caches, lib, target, index, pos, false, true, level,
|
global, caches, lib, target, index, pos, false, true,
|
||||||
)?
|
)?
|
||||||
}
|
}
|
||||||
// {xxx:map}.fn_name(arg_expr_list)[expr] | {xxx:map}.fn_name(arg_expr_list).expr
|
// {xxx:map}.fn_name(arg_expr_list)[expr] | {xxx:map}.fn_name(arg_expr_list).expr
|
||||||
Expr::MethodCall(ref x, pos) if !x.is_qualified() => {
|
Expr::MethodCall(ref x, pos) if !x.is_qualified() => {
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
let reset_debugger = self.run_debugger_with_reset(
|
let reset = self.run_debugger_with_reset(
|
||||||
scope, global, lib, this_ptr, _node, level,
|
global, caches, lib, scope, this_ptr, _node,
|
||||||
)?;
|
)?;
|
||||||
|
#[cfg(feature = "debugging")]
|
||||||
|
let global = &mut *RestoreOnDrop::lock(global, move |g| {
|
||||||
|
g.debugger.reset_status(reset)
|
||||||
|
});
|
||||||
|
|
||||||
let crate::ast::FnCallExpr {
|
let crate::ast::FnCallExpr {
|
||||||
name, hashes, args, ..
|
name, hashes, args, ..
|
||||||
} = &**x;
|
} = &**x;
|
||||||
|
|
||||||
|
// Truncate the index values upon exit
|
||||||
let offset = idx_values.len() - args.len();
|
let offset = idx_values.len() - args.len();
|
||||||
|
let idx_values = &mut *RestoreOnDrop::lock(idx_values, move |v| {
|
||||||
|
v.truncate(offset)
|
||||||
|
});
|
||||||
|
|
||||||
let call_args = &mut idx_values[offset..];
|
let call_args = &mut idx_values[offset..];
|
||||||
let pos1 = args.get(0).map_or(Position::NONE, Expr::position);
|
let pos1 = args.get(0).map_or(Position::NONE, Expr::position);
|
||||||
|
|
||||||
let result = self.make_method_call(
|
self.make_method_call(
|
||||||
global, caches, lib, name, *hashes, target, call_args, pos1,
|
global, caches, lib, name, *hashes, target, call_args, pos1,
|
||||||
pos, level,
|
pos,
|
||||||
);
|
)?
|
||||||
|
.0
|
||||||
idx_values.truncate(offset);
|
.into()
|
||||||
|
|
||||||
#[cfg(feature = "debugging")]
|
|
||||||
global.debugger.reset_status(reset_debugger);
|
|
||||||
|
|
||||||
result?.0.into()
|
|
||||||
}
|
}
|
||||||
// {xxx:map}.module::fn_name(...) - syntax error
|
// {xxx:map}.module::fn_name(...) - syntax error
|
||||||
Expr::MethodCall(..) => unreachable!(
|
Expr::MethodCall(..) => unreachable!(
|
||||||
@ -410,8 +406,8 @@ impl Engine {
|
|||||||
let rhs_chain = rhs.into();
|
let rhs_chain = rhs.into();
|
||||||
|
|
||||||
self.eval_dot_index_chain_helper(
|
self.eval_dot_index_chain_helper(
|
||||||
global, caches, lib, this_ptr, val_target, root, rhs, &x.rhs, *options,
|
global, caches, lib, this_ptr, val_target, root, rhs, *options, &x.rhs,
|
||||||
idx_values, rhs_chain, level, new_val,
|
idx_values, rhs_chain, new_val,
|
||||||
)
|
)
|
||||||
.map_err(|err| err.fill_position(*x_pos))
|
.map_err(|err| err.fill_position(*x_pos))
|
||||||
}
|
}
|
||||||
@ -423,7 +419,7 @@ impl Engine {
|
|||||||
// xxx.prop[expr] | xxx.prop.expr
|
// xxx.prop[expr] | xxx.prop.expr
|
||||||
Expr::Property(ref p, pos) => {
|
Expr::Property(ref p, pos) => {
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
self.run_debugger(scope, global, lib, this_ptr, _node, level)?;
|
self.run_debugger(global, caches, lib, scope, this_ptr, _node)?;
|
||||||
|
|
||||||
let ((getter, hash_get), (setter, hash_set), name) = &**p;
|
let ((getter, hash_get), (setter, hash_set), name) = &**p;
|
||||||
let rhs_chain = rhs.into();
|
let rhs_chain = rhs.into();
|
||||||
@ -432,16 +428,16 @@ impl Engine {
|
|||||||
|
|
||||||
// Assume getters are always pure
|
// Assume getters are always pure
|
||||||
let (mut val, ..) = self
|
let (mut val, ..) = self
|
||||||
.call_native_fn(
|
.exec_native_fn_call(
|
||||||
global, caches, lib, getter, *hash_get, args, is_ref_mut,
|
global, caches, lib, getter, None, *hash_get, args,
|
||||||
false, pos, level,
|
is_ref_mut, pos,
|
||||||
)
|
)
|
||||||
.or_else(|err| match *err {
|
.or_else(|err| match *err {
|
||||||
// Try an indexer if property does not exist
|
// Try an indexer if property does not exist
|
||||||
ERR::ErrorDotExpr(..) => {
|
ERR::ErrorDotExpr(..) => {
|
||||||
let mut prop = name.into();
|
let mut prop = name.into();
|
||||||
self.call_indexer_get(
|
self.call_indexer_get(
|
||||||
global, caches, lib, target, &mut prop, level,
|
global, caches, lib, target, &mut prop,
|
||||||
)
|
)
|
||||||
.map(|r| (r, false))
|
.map(|r| (r, false))
|
||||||
.map_err(
|
.map_err(
|
||||||
@ -458,8 +454,8 @@ impl Engine {
|
|||||||
|
|
||||||
let (result, may_be_changed) = self
|
let (result, may_be_changed) = self
|
||||||
.eval_dot_index_chain_helper(
|
.eval_dot_index_chain_helper(
|
||||||
global, caches, lib, this_ptr, val, root, rhs, &x.rhs,
|
global, caches, lib, this_ptr, val, root, rhs, *options,
|
||||||
*options, idx_values, rhs_chain, level, new_val,
|
&x.rhs, idx_values, rhs_chain, new_val,
|
||||||
)
|
)
|
||||||
.map_err(|err| err.fill_position(*x_pos))?;
|
.map_err(|err| err.fill_position(*x_pos))?;
|
||||||
|
|
||||||
@ -468,9 +464,9 @@ impl Engine {
|
|||||||
// Re-use args because the first &mut parameter will not be consumed
|
// Re-use args because the first &mut parameter will not be consumed
|
||||||
let mut arg_values = [target.as_mut(), val.as_mut()];
|
let mut arg_values = [target.as_mut(), val.as_mut()];
|
||||||
let args = &mut arg_values;
|
let args = &mut arg_values;
|
||||||
self.call_native_fn(
|
self.exec_native_fn_call(
|
||||||
global, caches, lib, setter, *hash_set, args, is_ref_mut,
|
global, caches, lib, setter, None, *hash_set, args,
|
||||||
false, pos, level,
|
is_ref_mut, pos,
|
||||||
)
|
)
|
||||||
.or_else(
|
.or_else(
|
||||||
|err| match *err {
|
|err| match *err {
|
||||||
@ -480,7 +476,7 @@ impl Engine {
|
|||||||
let new_val = val;
|
let new_val = val;
|
||||||
self.call_indexer_set(
|
self.call_indexer_set(
|
||||||
global, caches, lib, target, idx, new_val,
|
global, caches, lib, target, idx, new_val,
|
||||||
is_ref_mut, level,
|
is_ref_mut,
|
||||||
)
|
)
|
||||||
.or_else(|e| match *e {
|
.or_else(|e| match *e {
|
||||||
// If there is no setter, no need to feed it
|
// If there is no setter, no need to feed it
|
||||||
@ -500,36 +496,43 @@ impl Engine {
|
|||||||
}
|
}
|
||||||
// xxx.fn_name(arg_expr_list)[expr] | xxx.fn_name(arg_expr_list).expr
|
// xxx.fn_name(arg_expr_list)[expr] | xxx.fn_name(arg_expr_list).expr
|
||||||
Expr::MethodCall(ref f, pos) if !f.is_qualified() => {
|
Expr::MethodCall(ref f, pos) if !f.is_qualified() => {
|
||||||
|
let val = {
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
let reset_debugger = self.run_debugger_with_reset(
|
let reset = self.run_debugger_with_reset(
|
||||||
scope, global, lib, this_ptr, _node, level,
|
global, caches, lib, scope, this_ptr, _node,
|
||||||
)?;
|
)?;
|
||||||
|
#[cfg(feature = "debugging")]
|
||||||
|
let global = &mut *RestoreOnDrop::lock(global, move |g| {
|
||||||
|
g.debugger.reset_status(reset)
|
||||||
|
});
|
||||||
|
|
||||||
let crate::ast::FnCallExpr {
|
let crate::ast::FnCallExpr {
|
||||||
name, hashes, args, ..
|
name, hashes, args, ..
|
||||||
} = &**f;
|
} = &**f;
|
||||||
let rhs_chain = rhs.into();
|
|
||||||
|
|
||||||
|
// Truncate the index values upon exit
|
||||||
let offset = idx_values.len() - args.len();
|
let offset = idx_values.len() - args.len();
|
||||||
|
let idx_values =
|
||||||
|
&mut *RestoreOnDrop::lock(idx_values, move |v| {
|
||||||
|
v.truncate(offset)
|
||||||
|
});
|
||||||
|
|
||||||
let call_args = &mut idx_values[offset..];
|
let call_args = &mut idx_values[offset..];
|
||||||
let pos1 = args.get(0).map_or(Position::NONE, Expr::position);
|
let pos1 = args.get(0).map_or(Position::NONE, Expr::position);
|
||||||
|
|
||||||
let result = self.make_method_call(
|
self.make_method_call(
|
||||||
global, caches, lib, name, *hashes, target, call_args, pos1,
|
global, caches, lib, name, *hashes, target, call_args,
|
||||||
pos, level,
|
pos1, pos,
|
||||||
);
|
)?
|
||||||
|
.0
|
||||||
|
};
|
||||||
|
|
||||||
idx_values.truncate(offset);
|
|
||||||
|
|
||||||
#[cfg(feature = "debugging")]
|
|
||||||
global.debugger.reset_status(reset_debugger);
|
|
||||||
|
|
||||||
let (val, _) = &mut result?;
|
|
||||||
let val = &mut val.into();
|
let val = &mut val.into();
|
||||||
|
let rhs_chain = rhs.into();
|
||||||
|
|
||||||
self.eval_dot_index_chain_helper(
|
self.eval_dot_index_chain_helper(
|
||||||
global, caches, lib, this_ptr, val, root, rhs, &x.rhs,
|
global, caches, lib, this_ptr, val, root, rhs, *options,
|
||||||
*options, idx_values, rhs_chain, level, new_val,
|
&x.rhs, idx_values, rhs_chain, new_val,
|
||||||
)
|
)
|
||||||
.map_err(|err| err.fill_position(pos))
|
.map_err(|err| err.fill_position(pos))
|
||||||
}
|
}
|
||||||
@ -551,14 +554,13 @@ impl Engine {
|
|||||||
/// Evaluate a dot/index chain.
|
/// Evaluate a dot/index chain.
|
||||||
pub(crate) fn eval_dot_index_chain(
|
pub(crate) fn eval_dot_index_chain(
|
||||||
&self,
|
&self,
|
||||||
scope: &mut Scope,
|
|
||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
caches: &mut Caches,
|
caches: &mut Caches,
|
||||||
lib: &[&Module],
|
lib: &[SharedModule],
|
||||||
this_ptr: &mut Option<&mut Dynamic>,
|
scope: &mut Scope,
|
||||||
|
this_ptr: &mut Dynamic,
|
||||||
expr: &Expr,
|
expr: &Expr,
|
||||||
level: usize,
|
new_val: &mut Option<(Dynamic, &OpAssignment)>,
|
||||||
new_val: Option<(Dynamic, OpAssignment)>,
|
|
||||||
) -> RhaiResult {
|
) -> RhaiResult {
|
||||||
let chain_type = ChainType::from(expr);
|
let chain_type = ChainType::from(expr);
|
||||||
let (crate::ast::BinaryExpr { lhs, rhs }, options, op_pos) = match expr {
|
let (crate::ast::BinaryExpr { lhs, rhs }, options, op_pos) = match expr {
|
||||||
@ -595,8 +597,7 @@ impl Engine {
|
|||||||
// All other patterns - evaluate the arguments chain
|
// All other patterns - evaluate the arguments chain
|
||||||
_ => {
|
_ => {
|
||||||
self.eval_dot_index_chain_arguments(
|
self.eval_dot_index_chain_arguments(
|
||||||
scope, global, caches, lib, this_ptr, rhs, options, chain_type, idx_values, 0,
|
global, caches, lib, scope, this_ptr, rhs, options, chain_type, idx_values,
|
||||||
level,
|
|
||||||
)?;
|
)?;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -605,20 +606,19 @@ impl Engine {
|
|||||||
// id.??? or id[???]
|
// id.??? or id[???]
|
||||||
Expr::Variable(x, .., var_pos) => {
|
Expr::Variable(x, .., var_pos) => {
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
self.run_debugger(scope, global, lib, this_ptr, lhs, level)?;
|
self.run_debugger(global, caches, lib, scope, this_ptr, lhs)?;
|
||||||
|
self.track_operation(global, *var_pos)?;
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
self.inc_operations(&mut global.num_operations, *var_pos)?;
|
|
||||||
|
|
||||||
let (mut target, ..) =
|
let (mut target, ..) =
|
||||||
self.search_namespace(scope, global, lib, this_ptr, lhs, level)?;
|
self.search_namespace(global, caches, lib, scope, this_ptr, lhs)?;
|
||||||
|
|
||||||
let obj_ptr = &mut target;
|
let obj_ptr = &mut target;
|
||||||
let root = (x.3.as_str(), *var_pos);
|
let root = (x.3.as_str(), *var_pos);
|
||||||
|
let mut this = Dynamic::NULL;
|
||||||
|
|
||||||
self.eval_dot_index_chain_helper(
|
self.eval_dot_index_chain_helper(
|
||||||
global, caches, lib, &mut None, obj_ptr, root, expr, rhs, options, idx_values,
|
global, caches, lib, &mut this, obj_ptr, root, expr, options, rhs, idx_values,
|
||||||
chain_type, level, new_val,
|
chain_type, new_val,
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
// {expr}.??? = ??? or {expr}[???] = ???
|
// {expr}.??? = ??? or {expr}[???] = ???
|
||||||
@ -626,14 +626,14 @@ impl Engine {
|
|||||||
// {expr}.??? or {expr}[???]
|
// {expr}.??? or {expr}[???]
|
||||||
expr => {
|
expr => {
|
||||||
let value = self
|
let value = self
|
||||||
.eval_expr(scope, global, caches, lib, this_ptr, expr, level)?
|
.eval_expr(global, caches, lib, scope, this_ptr, expr)?
|
||||||
.flatten();
|
.flatten();
|
||||||
let obj_ptr = &mut value.into();
|
let obj_ptr = &mut value.into();
|
||||||
let root = ("", expr.start_position());
|
let root = ("", expr.start_position());
|
||||||
|
|
||||||
self.eval_dot_index_chain_helper(
|
self.eval_dot_index_chain_helper(
|
||||||
global, caches, lib, this_ptr, obj_ptr, root, expr, rhs, options, idx_values,
|
global, caches, lib, this_ptr, obj_ptr, root, expr, options, rhs, idx_values,
|
||||||
chain_type, level, new_val,
|
chain_type, new_val,
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -644,41 +644,38 @@ impl Engine {
|
|||||||
/// Evaluate a chain of indexes and store the results in a [`FnArgsVec`].
|
/// Evaluate a chain of indexes and store the results in a [`FnArgsVec`].
|
||||||
fn eval_dot_index_chain_arguments(
|
fn eval_dot_index_chain_arguments(
|
||||||
&self,
|
&self,
|
||||||
scope: &mut Scope,
|
|
||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
caches: &mut Caches,
|
caches: &mut Caches,
|
||||||
lib: &[&Module],
|
lib: &[SharedModule],
|
||||||
this_ptr: &mut Option<&mut Dynamic>,
|
scope: &mut Scope,
|
||||||
|
this_ptr: &mut Dynamic,
|
||||||
expr: &Expr,
|
expr: &Expr,
|
||||||
parent_options: ASTFlags,
|
parent_options: ASTFlags,
|
||||||
_parent_chain_type: ChainType,
|
parent_chain_type: ChainType,
|
||||||
idx_values: &mut FnArgsVec<Dynamic>,
|
idx_values: &mut FnArgsVec<Dynamic>,
|
||||||
size: usize,
|
|
||||||
level: usize,
|
|
||||||
) -> RhaiResultOf<()> {
|
) -> RhaiResultOf<()> {
|
||||||
#[cfg(not(feature = "unchecked"))]
|
self.track_operation(global, expr.position())?;
|
||||||
self.inc_operations(&mut global.num_operations, expr.position())?;
|
|
||||||
|
|
||||||
match expr {
|
match expr {
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
Expr::MethodCall(x, ..)
|
Expr::MethodCall(x, ..)
|
||||||
if _parent_chain_type == ChainType::Dotting && !x.is_qualified() =>
|
if parent_chain_type == ChainType::Dotting && !x.is_qualified() =>
|
||||||
{
|
{
|
||||||
for arg_expr in &x.args {
|
for arg_expr in &x.args {
|
||||||
idx_values.push(
|
idx_values.push(
|
||||||
self.get_arg_value(scope, global, caches, lib, this_ptr, arg_expr, level)?
|
self.get_arg_value(global, caches, lib, scope, this_ptr, arg_expr)?
|
||||||
.0
|
.0
|
||||||
.flatten(),
|
.flatten(),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
Expr::MethodCall(..) if _parent_chain_type == ChainType::Dotting => {
|
Expr::MethodCall(..) if parent_chain_type == ChainType::Dotting => {
|
||||||
unreachable!("function call in dot chain should not be namespace-qualified")
|
unreachable!("function call in dot chain should not be namespace-qualified")
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
Expr::Property(..) if _parent_chain_type == ChainType::Dotting => (),
|
Expr::Property(..) if parent_chain_type == ChainType::Dotting => (),
|
||||||
Expr::Property(..) => unreachable!("unexpected Expr::Property for indexing"),
|
Expr::Property(..) => unreachable!("unexpected Expr::Property for indexing"),
|
||||||
|
|
||||||
Expr::Index(x, options, ..) | Expr::Dot(x, options, ..)
|
Expr::Index(x, options, ..) | Expr::Dot(x, options, ..)
|
||||||
@ -691,35 +688,33 @@ impl Engine {
|
|||||||
// Evaluate in left-to-right order
|
// Evaluate in left-to-right order
|
||||||
match lhs {
|
match lhs {
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
Expr::Property(..) if _parent_chain_type == ChainType::Dotting => (),
|
Expr::Property(..) if parent_chain_type == ChainType::Dotting => (),
|
||||||
Expr::Property(..) => unreachable!("unexpected Expr::Property for indexing"),
|
Expr::Property(..) => unreachable!("unexpected Expr::Property for indexing"),
|
||||||
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
Expr::MethodCall(x, ..)
|
Expr::MethodCall(x, ..)
|
||||||
if _parent_chain_type == ChainType::Dotting && !x.is_qualified() =>
|
if parent_chain_type == ChainType::Dotting && !x.is_qualified() =>
|
||||||
{
|
{
|
||||||
for arg_expr in &x.args {
|
for arg_expr in &x.args {
|
||||||
_arg_values.push(
|
_arg_values.push(
|
||||||
self.get_arg_value(
|
self.get_arg_value(global, caches, lib, scope, this_ptr, arg_expr)?
|
||||||
scope, global, caches, lib, this_ptr, arg_expr, level,
|
|
||||||
)?
|
|
||||||
.0
|
.0
|
||||||
.flatten(),
|
.flatten(),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
Expr::MethodCall(..) if _parent_chain_type == ChainType::Dotting => {
|
Expr::MethodCall(..) if parent_chain_type == ChainType::Dotting => {
|
||||||
unreachable!("function call in dot chain should not be namespace-qualified")
|
unreachable!("function call in dot chain should not be namespace-qualified")
|
||||||
}
|
}
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
expr if _parent_chain_type == ChainType::Dotting => {
|
expr if parent_chain_type == ChainType::Dotting => {
|
||||||
unreachable!("invalid dot expression: {:?}", expr);
|
unreachable!("invalid dot expression: {:?}", expr);
|
||||||
}
|
}
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
_ if _parent_chain_type == ChainType::Indexing => {
|
_ if parent_chain_type == ChainType::Indexing => {
|
||||||
_arg_values.push(
|
_arg_values.push(
|
||||||
self.eval_expr(scope, global, caches, lib, this_ptr, lhs, level)?
|
self.eval_expr(global, caches, lib, scope, this_ptr, lhs)?
|
||||||
.flatten(),
|
.flatten(),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
@ -730,8 +725,7 @@ impl Engine {
|
|||||||
let chain_type = expr.into();
|
let chain_type = expr.into();
|
||||||
|
|
||||||
self.eval_dot_index_chain_arguments(
|
self.eval_dot_index_chain_arguments(
|
||||||
scope, global, caches, lib, this_ptr, rhs, *options, chain_type, idx_values,
|
global, caches, lib, scope, this_ptr, rhs, *options, chain_type, idx_values,
|
||||||
size, level,
|
|
||||||
)?;
|
)?;
|
||||||
|
|
||||||
if !_arg_values.is_empty() {
|
if !_arg_values.is_empty() {
|
||||||
@ -740,12 +734,12 @@ impl Engine {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
_ if _parent_chain_type == ChainType::Dotting => {
|
_ if parent_chain_type == ChainType::Dotting => {
|
||||||
unreachable!("invalid dot expression: {:?}", expr);
|
unreachable!("invalid dot expression: {:?}", expr);
|
||||||
}
|
}
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
_ if _parent_chain_type == ChainType::Indexing => idx_values.push(
|
_ if parent_chain_type == ChainType::Indexing => idx_values.push(
|
||||||
self.eval_expr(scope, global, caches, lib, this_ptr, expr, level)?
|
self.eval_expr(global, caches, lib, scope, this_ptr, expr)?
|
||||||
.flatten(),
|
.flatten(),
|
||||||
),
|
),
|
||||||
_ => unreachable!("unknown chained expression: {:?}", expr),
|
_ => unreachable!("unknown chained expression: {:?}", expr),
|
||||||
@ -760,20 +754,19 @@ impl Engine {
|
|||||||
&self,
|
&self,
|
||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
caches: &mut Caches,
|
caches: &mut Caches,
|
||||||
lib: &[&Module],
|
lib: &[SharedModule],
|
||||||
target: &mut Dynamic,
|
target: &mut Dynamic,
|
||||||
idx: &mut Dynamic,
|
idx: &mut Dynamic,
|
||||||
level: usize,
|
|
||||||
) -> RhaiResultOf<Dynamic> {
|
) -> RhaiResultOf<Dynamic> {
|
||||||
let args = &mut [target, idx];
|
let args = &mut [target, idx];
|
||||||
let hash = global.hash_idx_get();
|
let hash = global.hash_idx_get();
|
||||||
let fn_name = crate::engine::FN_IDX_GET;
|
let fn_name = crate::engine::FN_IDX_GET;
|
||||||
let pos = Position::NONE;
|
let pos = Position::NONE;
|
||||||
let level = level + 1;
|
|
||||||
|
|
||||||
self.call_native_fn(
|
global.level += 1;
|
||||||
global, caches, lib, fn_name, hash, args, true, false, pos, level,
|
let global = &mut *RestoreOnDrop::lock(global, move |g| g.level -= 1);
|
||||||
)
|
|
||||||
|
self.exec_native_fn_call(global, caches, lib, fn_name, None, hash, args, true, pos)
|
||||||
.map(|(r, ..)| r)
|
.map(|(r, ..)| r)
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -783,21 +776,22 @@ impl Engine {
|
|||||||
&self,
|
&self,
|
||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
caches: &mut Caches,
|
caches: &mut Caches,
|
||||||
lib: &[&Module],
|
lib: &[SharedModule],
|
||||||
target: &mut Dynamic,
|
target: &mut Dynamic,
|
||||||
idx: &mut Dynamic,
|
idx: &mut Dynamic,
|
||||||
new_val: &mut Dynamic,
|
new_val: &mut Dynamic,
|
||||||
is_ref_mut: bool,
|
is_ref_mut: bool,
|
||||||
level: usize,
|
|
||||||
) -> RhaiResultOf<(Dynamic, bool)> {
|
) -> RhaiResultOf<(Dynamic, bool)> {
|
||||||
let hash = global.hash_idx_set();
|
let hash = global.hash_idx_set();
|
||||||
let args = &mut [target, idx, new_val];
|
let args = &mut [target, idx, new_val];
|
||||||
let fn_name = crate::engine::FN_IDX_SET;
|
let fn_name = crate::engine::FN_IDX_SET;
|
||||||
let pos = Position::NONE;
|
let pos = Position::NONE;
|
||||||
let level = level + 1;
|
|
||||||
|
|
||||||
self.call_native_fn(
|
global.level += 1;
|
||||||
global, caches, lib, fn_name, hash, args, is_ref_mut, false, pos, level,
|
let global = &mut *RestoreOnDrop::lock(global, move |g| g.level -= 1);
|
||||||
|
|
||||||
|
self.exec_native_fn_call(
|
||||||
|
global, caches, lib, fn_name, None, hash, args, is_ref_mut, pos,
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -807,16 +801,14 @@ impl Engine {
|
|||||||
&self,
|
&self,
|
||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
caches: &mut Caches,
|
caches: &mut Caches,
|
||||||
lib: &[&Module],
|
lib: &[SharedModule],
|
||||||
target: &'t mut Dynamic,
|
target: &'t mut Dynamic,
|
||||||
mut idx: Dynamic,
|
idx: &mut Dynamic,
|
||||||
idx_pos: Position,
|
idx_pos: Position,
|
||||||
_add_if_not_found: bool,
|
_add_if_not_found: bool,
|
||||||
use_indexers: bool,
|
use_indexers: bool,
|
||||||
level: usize,
|
|
||||||
) -> RhaiResultOf<Target<'t>> {
|
) -> RhaiResultOf<Target<'t>> {
|
||||||
#[cfg(not(feature = "unchecked"))]
|
self.track_operation(global, Position::NONE)?;
|
||||||
self.inc_operations(&mut global.num_operations, Position::NONE)?;
|
|
||||||
|
|
||||||
match target {
|
match target {
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
@ -1018,7 +1010,7 @@ impl Engine {
|
|||||||
}
|
}
|
||||||
|
|
||||||
_ if use_indexers => self
|
_ if use_indexers => self
|
||||||
.call_indexer_get(global, caches, lib, target, &mut idx, level)
|
.call_indexer_get(global, caches, lib, target, idx)
|
||||||
.map(Into::into),
|
.map(Into::into),
|
||||||
|
|
||||||
_ => Err(ERR::ErrorIndexingType(
|
_ => Err(ERR::ErrorIndexingType(
|
||||||
|
@ -1,9 +1,9 @@
|
|||||||
//! Data size checks during evaluation.
|
//! Data size checks during evaluation.
|
||||||
#![cfg(not(feature = "unchecked"))]
|
#![cfg(not(feature = "unchecked"))]
|
||||||
|
|
||||||
|
use super::GlobalRuntimeState;
|
||||||
use crate::types::dynamic::Union;
|
use crate::types::dynamic::Union;
|
||||||
use crate::{Dynamic, Engine, Position, RhaiResultOf, ERR};
|
use crate::{Dynamic, Engine, Position, RhaiResult, RhaiResultOf, ERR};
|
||||||
use std::num::NonZeroUsize;
|
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
|
|
||||||
@ -15,46 +15,45 @@ impl Engine {
|
|||||||
/// # Panics
|
/// # Panics
|
||||||
///
|
///
|
||||||
/// Panics if any interior data is shared (should never happen).
|
/// Panics if any interior data is shared (should never happen).
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
pub(crate) fn calc_data_sizes(value: &Dynamic, _top: bool) -> (usize, usize, usize) {
|
pub(crate) fn calc_data_sizes(value: &Dynamic, _top: bool) -> (usize, usize, usize) {
|
||||||
match value.0 {
|
match value.0 {
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
Union::Array(ref arr, ..) => {
|
Union::Array(ref arr, ..) => {
|
||||||
arr.iter()
|
arr.iter()
|
||||||
.fold((0, 0, 0), |(arrays, maps, strings), value| match value.0 {
|
.fold((0, 0, 0), |(ax, mx, sx), value| match value.0 {
|
||||||
Union::Array(..) => {
|
Union::Array(..) => {
|
||||||
let (a, m, s) = Self::calc_data_sizes(value, false);
|
let (a, m, s) = Self::calc_data_sizes(value, false);
|
||||||
(arrays + a + 1, maps + m, strings + s)
|
(ax + a + 1, mx + m, sx + s)
|
||||||
}
|
}
|
||||||
Union::Blob(ref a, ..) => (arrays + 1 + a.len(), maps, strings),
|
Union::Blob(ref a, ..) => (ax + 1 + a.len(), mx, sx),
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
Union::Map(..) => {
|
Union::Map(..) => {
|
||||||
let (a, m, s) = Self::calc_data_sizes(value, false);
|
let (a, m, s) = Self::calc_data_sizes(value, false);
|
||||||
(arrays + a + 1, maps + m, strings + s)
|
(ax + a + 1, mx + m, sx + s)
|
||||||
}
|
}
|
||||||
Union::Str(ref s, ..) => (arrays + 1, maps, strings + s.len()),
|
Union::Str(ref s, ..) => (ax + 1, mx, sx + s.len()),
|
||||||
_ => (arrays + 1, maps, strings),
|
_ => (ax + 1, mx, sx),
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
Union::Blob(ref arr, ..) => (arr.len(), 0, 0),
|
Union::Blob(ref blob, ..) => (blob.len(), 0, 0),
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
Union::Map(ref map, ..) => {
|
Union::Map(ref map, ..) => {
|
||||||
map.values()
|
map.values()
|
||||||
.fold((0, 0, 0), |(arrays, maps, strings), value| match value.0 {
|
.fold((0, 0, 0), |(ax, mx, sx), value| match value.0 {
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
Union::Array(..) => {
|
Union::Array(..) => {
|
||||||
let (a, m, s) = Self::calc_data_sizes(value, false);
|
let (a, m, s) = Self::calc_data_sizes(value, false);
|
||||||
(arrays + a, maps + m + 1, strings + s)
|
(ax + a, mx + m + 1, sx + s)
|
||||||
}
|
}
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
Union::Blob(ref a, ..) => (arrays + a.len(), maps, strings),
|
Union::Blob(ref a, ..) => (ax + a.len(), mx, sx),
|
||||||
Union::Map(..) => {
|
Union::Map(..) => {
|
||||||
let (a, m, s) = Self::calc_data_sizes(value, false);
|
let (a, m, s) = Self::calc_data_sizes(value, false);
|
||||||
(arrays + a, maps + m + 1, strings + s)
|
(ax + a, mx + m + 1, sx + s)
|
||||||
}
|
}
|
||||||
Union::Str(ref s, ..) => (arrays, maps + 1, strings + s.len()),
|
Union::Str(ref s, ..) => (ax, mx + 1, sx + s.len()),
|
||||||
_ => (arrays, maps + 1, strings),
|
_ => (ax, mx + 1, sx),
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
Union::Str(ref s, ..) => (0, 0, s.len()),
|
Union::Str(ref s, ..) => (0, 0, s.len()),
|
||||||
@ -70,65 +69,48 @@ impl Engine {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Is there a data size limit set?
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
pub(crate) const fn has_data_size_limit(&self) -> bool {
|
|
||||||
let mut _limited = self.limits.max_string_size.is_some();
|
|
||||||
|
|
||||||
#[cfg(not(feature = "no_index"))]
|
|
||||||
{
|
|
||||||
_limited = _limited || self.limits.max_array_size.is_some();
|
|
||||||
}
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
|
||||||
{
|
|
||||||
_limited = _limited || self.limits.max_map_size.is_some();
|
|
||||||
}
|
|
||||||
|
|
||||||
_limited
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Raise an error if any data size exceeds limit.
|
/// Raise an error if any data size exceeds limit.
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
pub(crate) fn raise_err_if_over_data_size_limit(
|
pub(crate) fn raise_err_if_over_data_size_limit(
|
||||||
&self,
|
&self,
|
||||||
sizes: (usize, usize, usize),
|
(_arr, _map, s): (usize, usize, usize),
|
||||||
pos: Position,
|
|
||||||
) -> RhaiResultOf<()> {
|
) -> RhaiResultOf<()> {
|
||||||
let (_arr, _map, s) = sizes;
|
if self
|
||||||
|
|
||||||
if s > self
|
|
||||||
.limits
|
.limits
|
||||||
.max_string_size
|
.max_string_size
|
||||||
.map_or(usize::MAX, NonZeroUsize::get)
|
.map_or(false, |max| s > max.get())
|
||||||
{
|
{
|
||||||
return Err(ERR::ErrorDataTooLarge("Length of string".to_string(), pos).into());
|
return Err(
|
||||||
|
ERR::ErrorDataTooLarge("Length of string".to_string(), Position::NONE).into(),
|
||||||
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
if _arr
|
if self
|
||||||
> self
|
|
||||||
.limits
|
.limits
|
||||||
.max_array_size
|
.max_array_size
|
||||||
.map_or(usize::MAX, NonZeroUsize::get)
|
.map_or(false, |max| _arr > max.get())
|
||||||
{
|
{
|
||||||
return Err(ERR::ErrorDataTooLarge("Size of array".to_string(), pos).into());
|
return Err(
|
||||||
|
ERR::ErrorDataTooLarge("Size of array/BLOB".to_string(), Position::NONE).into(),
|
||||||
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
if _map
|
if self
|
||||||
> self
|
|
||||||
.limits
|
.limits
|
||||||
.max_map_size
|
.max_map_size
|
||||||
.map_or(usize::MAX, NonZeroUsize::get)
|
.map_or(false, |max| _map > max.get())
|
||||||
{
|
{
|
||||||
return Err(ERR::ErrorDataTooLarge("Size of object map".to_string(), pos).into());
|
return Err(
|
||||||
|
ERR::ErrorDataTooLarge("Size of object map".to_string(), Position::NONE).into(),
|
||||||
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Check whether the size of a [`Dynamic`] is within limits.
|
/// Check whether the size of a [`Dynamic`] is within limits.
|
||||||
#[cfg(not(feature = "unchecked"))]
|
#[inline]
|
||||||
pub(crate) fn check_data_size(&self, value: &Dynamic, pos: Position) -> RhaiResultOf<()> {
|
pub(crate) fn check_data_size(&self, value: &Dynamic, pos: Position) -> RhaiResultOf<()> {
|
||||||
// If no data size limits, just return
|
// If no data size limits, just return
|
||||||
if !self.has_data_size_limit() {
|
if !self.has_data_size_limit() {
|
||||||
@ -137,35 +119,37 @@ impl Engine {
|
|||||||
|
|
||||||
let sizes = Self::calc_data_sizes(value, true);
|
let sizes = Self::calc_data_sizes(value, true);
|
||||||
|
|
||||||
self.raise_err_if_over_data_size_limit(sizes, pos)
|
self.raise_err_if_over_data_size_limit(sizes)
|
||||||
|
.map_err(|err| err.fill_position(pos))
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Raise an error if the size of a [`Dynamic`] is out of limits (if any).
|
/// Raise an error if the size of a [`Dynamic`] is out of limits (if any).
|
||||||
///
|
///
|
||||||
/// Not available under `unchecked`.
|
/// Not available under `unchecked`.
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn ensure_data_size_within_limits(&self, value: &Dynamic) -> RhaiResultOf<()> {
|
pub fn ensure_data_size_within_limits(&self, value: &Dynamic) -> RhaiResultOf<()> {
|
||||||
self.check_data_size(value, Position::NONE)
|
self.check_data_size(value, Position::NONE)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Check if the number of operations stay within limit.
|
/// Check if the number of operations stay within limit.
|
||||||
#[cfg(not(feature = "unchecked"))]
|
pub(crate) fn track_operation(
|
||||||
pub(crate) fn inc_operations(
|
|
||||||
&self,
|
&self,
|
||||||
num_operations: &mut u64,
|
global: &mut GlobalRuntimeState,
|
||||||
pos: Position,
|
pos: Position,
|
||||||
) -> RhaiResultOf<()> {
|
) -> RhaiResultOf<()> {
|
||||||
*num_operations += 1;
|
global.num_operations += 1;
|
||||||
|
|
||||||
// Guard against too many operations
|
// Guard against too many operations
|
||||||
if self.max_operations() > 0 && *num_operations > self.max_operations() {
|
let max = self.max_operations();
|
||||||
|
let num_operations = global.num_operations;
|
||||||
|
|
||||||
|
if max > 0 && num_operations > max {
|
||||||
return Err(ERR::ErrorTooManyOperations(pos).into());
|
return Err(ERR::ErrorTooManyOperations(pos).into());
|
||||||
}
|
}
|
||||||
|
|
||||||
// Report progress - only in steps
|
// Report progress - only in steps
|
||||||
if let Some(ref progress) = self.progress {
|
if let Some(ref progress) = self.progress {
|
||||||
if let Some(token) = progress(*num_operations) {
|
if let Some(token) = progress(num_operations) {
|
||||||
// Terminate script if progress returns a termination token
|
// Terminate script if progress returns a termination token
|
||||||
return Err(ERR::ErrorTerminated(token, pos).into());
|
return Err(ERR::ErrorTerminated(token, pos).into());
|
||||||
}
|
}
|
||||||
@ -173,4 +157,14 @@ impl Engine {
|
|||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// Check a result to ensure that it is valid.
|
||||||
|
#[inline]
|
||||||
|
pub(crate) fn check_return_value(&self, result: RhaiResult, pos: Position) -> RhaiResult {
|
||||||
|
if let Ok(ref r) = result {
|
||||||
|
self.check_data_size(r, pos)?;
|
||||||
|
}
|
||||||
|
|
||||||
|
result
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
@ -1,9 +1,11 @@
|
|||||||
//! Module defining the debugging interface.
|
//! Module defining the debugging interface.
|
||||||
#![cfg(feature = "debugging")]
|
#![cfg(feature = "debugging")]
|
||||||
|
|
||||||
use super::{EvalContext, GlobalRuntimeState};
|
use super::{Caches, EvalContext, GlobalRuntimeState};
|
||||||
use crate::ast::{ASTNode, Expr, Stmt};
|
use crate::ast::{ASTNode, Expr, Stmt};
|
||||||
use crate::{Dynamic, Engine, EvalAltResult, Identifier, Module, Position, RhaiResultOf, Scope};
|
use crate::{
|
||||||
|
Dynamic, Engine, EvalAltResult, ImmutableString, Position, RhaiResultOf, Scope, SharedModule,
|
||||||
|
};
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
use std::{fmt, iter::repeat, mem};
|
use std::{fmt, iter::repeat, mem};
|
||||||
@ -48,6 +50,7 @@ pub enum DebuggerCommand {
|
|||||||
|
|
||||||
impl Default for DebuggerCommand {
|
impl Default for DebuggerCommand {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
Self::Continue
|
Self::Continue
|
||||||
}
|
}
|
||||||
@ -99,12 +102,10 @@ pub enum BreakPoint {
|
|||||||
/// Break at a particular position under a particular source.
|
/// Break at a particular position under a particular source.
|
||||||
///
|
///
|
||||||
/// Not available under `no_position`.
|
/// Not available under `no_position`.
|
||||||
///
|
|
||||||
/// Source is empty if not available.
|
|
||||||
#[cfg(not(feature = "no_position"))]
|
#[cfg(not(feature = "no_position"))]
|
||||||
AtPosition {
|
AtPosition {
|
||||||
/// Source (empty if not available) of the break-point.
|
/// Source (empty if not available) of the break-point.
|
||||||
source: Identifier,
|
source: Option<ImmutableString>,
|
||||||
/// [Position] of the break-point.
|
/// [Position] of the break-point.
|
||||||
pos: Position,
|
pos: Position,
|
||||||
/// Is the break-point enabled?
|
/// Is the break-point enabled?
|
||||||
@ -113,14 +114,14 @@ pub enum BreakPoint {
|
|||||||
/// Break at a particular function call.
|
/// Break at a particular function call.
|
||||||
AtFunctionName {
|
AtFunctionName {
|
||||||
/// Function name.
|
/// Function name.
|
||||||
name: Identifier,
|
name: ImmutableString,
|
||||||
/// Is the break-point enabled?
|
/// Is the break-point enabled?
|
||||||
enabled: bool,
|
enabled: bool,
|
||||||
},
|
},
|
||||||
/// Break at a particular function call with a particular number of arguments.
|
/// Break at a particular function call with a particular number of arguments.
|
||||||
AtFunctionCall {
|
AtFunctionCall {
|
||||||
/// Function name.
|
/// Function name.
|
||||||
name: Identifier,
|
name: ImmutableString,
|
||||||
/// Number of arguments.
|
/// Number of arguments.
|
||||||
args: usize,
|
args: usize,
|
||||||
/// Is the break-point enabled?
|
/// Is the break-point enabled?
|
||||||
@ -132,7 +133,7 @@ pub enum BreakPoint {
|
|||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
AtProperty {
|
AtProperty {
|
||||||
/// Property name.
|
/// Property name.
|
||||||
name: Identifier,
|
name: ImmutableString,
|
||||||
/// Is the break-point enabled?
|
/// Is the break-point enabled?
|
||||||
enabled: bool,
|
enabled: bool,
|
||||||
},
|
},
|
||||||
@ -147,35 +148,30 @@ impl fmt::Display for BreakPoint {
|
|||||||
pos,
|
pos,
|
||||||
enabled,
|
enabled,
|
||||||
} => {
|
} => {
|
||||||
if source.is_empty() {
|
if let Some(ref source) = source {
|
||||||
write!(f, "@ {:?}", pos)?;
|
write!(f, "{source} ")?;
|
||||||
} else {
|
|
||||||
write!(f, "{} @ {:?}", source, pos)?;
|
|
||||||
}
|
}
|
||||||
|
write!(f, "@ {pos:?}")?;
|
||||||
if !*enabled {
|
if !*enabled {
|
||||||
f.write_str(" (disabled)")?;
|
f.write_str(" (disabled)")?;
|
||||||
}
|
}
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
Self::AtFunctionName {
|
Self::AtFunctionName { name, enabled } => {
|
||||||
name: fn_name,
|
write!(f, "{name} (...)")?;
|
||||||
enabled,
|
|
||||||
} => {
|
|
||||||
write!(f, "{} (...)", fn_name)?;
|
|
||||||
if !*enabled {
|
if !*enabled {
|
||||||
f.write_str(" (disabled)")?;
|
f.write_str(" (disabled)")?;
|
||||||
}
|
}
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
Self::AtFunctionCall {
|
Self::AtFunctionCall {
|
||||||
name: fn_name,
|
name,
|
||||||
args,
|
args,
|
||||||
enabled,
|
enabled,
|
||||||
} => {
|
} => {
|
||||||
write!(
|
write!(
|
||||||
f,
|
f,
|
||||||
"{} ({})",
|
"{name} ({})",
|
||||||
fn_name,
|
|
||||||
repeat("_").take(*args).collect::<Vec<_>>().join(", ")
|
repeat("_").take(*args).collect::<Vec<_>>().join(", ")
|
||||||
)?;
|
)?;
|
||||||
if !*enabled {
|
if !*enabled {
|
||||||
@ -184,11 +180,8 @@ impl fmt::Display for BreakPoint {
|
|||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
Self::AtProperty {
|
Self::AtProperty { name, enabled } => {
|
||||||
name: prop,
|
write!(f, ".{name}")?;
|
||||||
enabled,
|
|
||||||
} => {
|
|
||||||
write!(f, ".{}", prop)?;
|
|
||||||
if !*enabled {
|
if !*enabled {
|
||||||
f.write_str(" (disabled)")?;
|
f.write_str(" (disabled)")?;
|
||||||
}
|
}
|
||||||
@ -230,11 +223,11 @@ impl BreakPoint {
|
|||||||
#[derive(Debug, Clone, Hash)]
|
#[derive(Debug, Clone, Hash)]
|
||||||
pub struct CallStackFrame {
|
pub struct CallStackFrame {
|
||||||
/// Function name.
|
/// Function name.
|
||||||
pub fn_name: Identifier,
|
pub fn_name: ImmutableString,
|
||||||
/// Copies of function call arguments, if any.
|
/// Copies of function call arguments, if any.
|
||||||
pub args: crate::StaticVec<Dynamic>,
|
pub args: crate::StaticVec<Dynamic>,
|
||||||
/// Source of the function, empty if none.
|
/// Source of the function.
|
||||||
pub source: Identifier,
|
pub source: Option<ImmutableString>,
|
||||||
/// [Position][`Position`] of the function call.
|
/// [Position][`Position`] of the function call.
|
||||||
pub pos: Position,
|
pub pos: Position,
|
||||||
}
|
}
|
||||||
@ -250,11 +243,10 @@ impl fmt::Display for CallStackFrame {
|
|||||||
fp.finish()?;
|
fp.finish()?;
|
||||||
|
|
||||||
if !self.pos.is_none() {
|
if !self.pos.is_none() {
|
||||||
if self.source.is_empty() {
|
if let Some(ref source) = self.source {
|
||||||
write!(f, " @ {:?}", self.pos)?;
|
write!(f, ": {source}")?;
|
||||||
} else {
|
|
||||||
write!(f, ": {} @ {:?}", self.source, self.pos)?;
|
|
||||||
}
|
}
|
||||||
|
write!(f, " @ {:?}", self.pos)?;
|
||||||
}
|
}
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
@ -301,15 +293,15 @@ impl Debugger {
|
|||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub(crate) fn push_call_stack_frame(
|
pub(crate) fn push_call_stack_frame(
|
||||||
&mut self,
|
&mut self,
|
||||||
fn_name: impl Into<Identifier>,
|
fn_name: ImmutableString,
|
||||||
args: crate::StaticVec<Dynamic>,
|
args: crate::StaticVec<Dynamic>,
|
||||||
source: impl Into<Identifier>,
|
source: Option<ImmutableString>,
|
||||||
pos: Position,
|
pos: Position,
|
||||||
) {
|
) {
|
||||||
self.call_stack.push(CallStackFrame {
|
self.call_stack.push(CallStackFrame {
|
||||||
fn_name: fn_name.into(),
|
fn_name: fn_name.into(),
|
||||||
args,
|
args,
|
||||||
source: source.into(),
|
source,
|
||||||
pos,
|
pos,
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
@ -336,7 +328,7 @@ impl Debugger {
|
|||||||
}
|
}
|
||||||
/// Returns the first break-point triggered by a particular [`AST` Node][ASTNode].
|
/// Returns the first break-point triggered by a particular [`AST` Node][ASTNode].
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn is_break_point(&self, src: &str, node: ASTNode) -> Option<usize> {
|
pub fn is_break_point(&self, src: Option<&str>, node: ASTNode) -> Option<usize> {
|
||||||
let _src = src;
|
let _src = src;
|
||||||
|
|
||||||
self.break_points()
|
self.break_points()
|
||||||
@ -348,11 +340,12 @@ impl Debugger {
|
|||||||
BreakPoint::AtPosition { pos, .. } if pos.is_none() => false,
|
BreakPoint::AtPosition { pos, .. } if pos.is_none() => false,
|
||||||
#[cfg(not(feature = "no_position"))]
|
#[cfg(not(feature = "no_position"))]
|
||||||
BreakPoint::AtPosition { source, pos, .. } if pos.is_beginning_of_line() => {
|
BreakPoint::AtPosition { source, pos, .. } if pos.is_beginning_of_line() => {
|
||||||
node.position().line().unwrap_or(0) == pos.line().unwrap() && _src == source
|
node.position().line().unwrap_or(0) == pos.line().unwrap()
|
||||||
|
&& _src == source.as_ref().map(|s| s.as_str())
|
||||||
}
|
}
|
||||||
#[cfg(not(feature = "no_position"))]
|
#[cfg(not(feature = "no_position"))]
|
||||||
BreakPoint::AtPosition { source, pos, .. } => {
|
BreakPoint::AtPosition { source, pos, .. } => {
|
||||||
node.position() == *pos && _src == source
|
node.position() == *pos && _src == source.as_ref().map(|s| s.as_str())
|
||||||
}
|
}
|
||||||
BreakPoint::AtFunctionName { name, .. } => match node {
|
BreakPoint::AtFunctionName { name, .. } => match node {
|
||||||
ASTNode::Expr(Expr::FnCall(x, ..)) | ASTNode::Stmt(Stmt::FnCall(x, ..)) => {
|
ASTNode::Expr(Expr::FnCall(x, ..)) | ASTNode::Stmt(Stmt::FnCall(x, ..)) => {
|
||||||
@ -418,16 +411,16 @@ impl Engine {
|
|||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub(crate) fn run_debugger<'a>(
|
pub(crate) fn run_debugger<'a>(
|
||||||
&self,
|
&self,
|
||||||
scope: &mut Scope,
|
|
||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
lib: &[&Module],
|
caches: &mut Caches,
|
||||||
this_ptr: &mut Option<&mut Dynamic>,
|
lib: &[SharedModule],
|
||||||
|
scope: &mut Scope,
|
||||||
|
this_ptr: &mut Dynamic,
|
||||||
node: impl Into<ASTNode<'a>>,
|
node: impl Into<ASTNode<'a>>,
|
||||||
level: usize,
|
|
||||||
) -> RhaiResultOf<()> {
|
) -> RhaiResultOf<()> {
|
||||||
if self.debugger.is_some() {
|
if self.debugger.is_some() {
|
||||||
if let Some(cmd) =
|
if let Some(cmd) =
|
||||||
self.run_debugger_with_reset_raw(scope, global, lib, this_ptr, node, level)?
|
self.run_debugger_with_reset_raw(global, caches, lib, scope, this_ptr, node)?
|
||||||
{
|
{
|
||||||
global.debugger.status = cmd;
|
global.debugger.status = cmd;
|
||||||
}
|
}
|
||||||
@ -437,41 +430,41 @@ impl Engine {
|
|||||||
}
|
}
|
||||||
/// Run the debugger callback if there is a debugging interface registered.
|
/// Run the debugger callback if there is a debugging interface registered.
|
||||||
///
|
///
|
||||||
/// Returns `Some` if the debugger needs to be reactivated at the end of the block, statement or
|
/// Returns [`Some`] if the debugger needs to be reactivated at the end of the block, statement or
|
||||||
/// function call.
|
/// function call.
|
||||||
///
|
///
|
||||||
/// It is up to the [`Engine`] to reactivate the debugger.
|
/// It is up to the [`Engine`] to reactivate the debugger.
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub(crate) fn run_debugger_with_reset<'a>(
|
pub(crate) fn run_debugger_with_reset<'a>(
|
||||||
&self,
|
&self,
|
||||||
scope: &mut Scope,
|
|
||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
lib: &[&Module],
|
caches: &mut Caches,
|
||||||
this_ptr: &mut Option<&mut Dynamic>,
|
lib: &[SharedModule],
|
||||||
|
scope: &mut Scope,
|
||||||
|
this_ptr: &mut Dynamic,
|
||||||
node: impl Into<ASTNode<'a>>,
|
node: impl Into<ASTNode<'a>>,
|
||||||
level: usize,
|
|
||||||
) -> RhaiResultOf<Option<DebuggerStatus>> {
|
) -> RhaiResultOf<Option<DebuggerStatus>> {
|
||||||
if self.debugger.is_some() {
|
if self.debugger.is_some() {
|
||||||
self.run_debugger_with_reset_raw(scope, global, lib, this_ptr, node, level)
|
self.run_debugger_with_reset_raw(global, caches, lib, scope, this_ptr, node)
|
||||||
} else {
|
} else {
|
||||||
Ok(None)
|
Ok(None)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
/// Run the debugger callback.
|
/// Run the debugger callback.
|
||||||
///
|
///
|
||||||
/// Returns `Some` if the debugger needs to be reactivated at the end of the block, statement or
|
/// Returns [`Some`] if the debugger needs to be reactivated at the end of the block, statement or
|
||||||
/// function call.
|
/// function call.
|
||||||
///
|
///
|
||||||
/// It is up to the [`Engine`] to reactivate the debugger.
|
/// It is up to the [`Engine`] to reactivate the debugger.
|
||||||
#[inline]
|
#[inline]
|
||||||
pub(crate) fn run_debugger_with_reset_raw<'a>(
|
pub(crate) fn run_debugger_with_reset_raw<'a>(
|
||||||
&self,
|
&self,
|
||||||
scope: &mut Scope,
|
|
||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
lib: &[&Module],
|
caches: &mut Caches,
|
||||||
this_ptr: &mut Option<&mut Dynamic>,
|
lib: &[SharedModule],
|
||||||
|
scope: &mut Scope,
|
||||||
|
this_ptr: &mut Dynamic,
|
||||||
node: impl Into<ASTNode<'a>>,
|
node: impl Into<ASTNode<'a>>,
|
||||||
level: usize,
|
|
||||||
) -> RhaiResultOf<Option<DebuggerStatus>> {
|
) -> RhaiResultOf<Option<DebuggerStatus>> {
|
||||||
let node = node.into();
|
let node = node.into();
|
||||||
|
|
||||||
@ -495,45 +488,37 @@ impl Engine {
|
|||||||
|
|
||||||
let event = match event {
|
let event = match event {
|
||||||
Some(e) => e,
|
Some(e) => e,
|
||||||
None => {
|
None => match global.debugger.is_break_point(global.source(), node) {
|
||||||
if let Some(bp) = global.debugger.is_break_point(&global.source, node) {
|
Some(bp) => DebuggerEvent::BreakPoint(bp),
|
||||||
DebuggerEvent::BreakPoint(bp)
|
None => return Ok(None),
|
||||||
} else {
|
},
|
||||||
return Ok(None);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
};
|
};
|
||||||
|
|
||||||
self.run_debugger_raw(scope, global, lib, this_ptr, node, event, level)
|
self.run_debugger_raw(global, caches, lib, scope, this_ptr, node, event)
|
||||||
}
|
}
|
||||||
/// Run the debugger callback unconditionally.
|
/// Run the debugger callback unconditionally.
|
||||||
///
|
///
|
||||||
/// Returns `Some` if the debugger needs to be reactivated at the end of the block, statement or
|
/// Returns [`Some`] if the debugger needs to be reactivated at the end of the block, statement or
|
||||||
/// function call.
|
/// function call.
|
||||||
///
|
///
|
||||||
/// It is up to the [`Engine`] to reactivate the debugger.
|
/// It is up to the [`Engine`] to reactivate the debugger.
|
||||||
#[inline]
|
#[inline]
|
||||||
pub(crate) fn run_debugger_raw<'a>(
|
pub(crate) fn run_debugger_raw<'a>(
|
||||||
&self,
|
&self,
|
||||||
scope: &mut Scope,
|
|
||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
lib: &[&Module],
|
caches: &mut Caches,
|
||||||
this_ptr: &mut Option<&mut Dynamic>,
|
lib: &[SharedModule],
|
||||||
|
scope: &mut Scope,
|
||||||
|
this_ptr: &mut Dynamic,
|
||||||
node: ASTNode<'a>,
|
node: ASTNode<'a>,
|
||||||
event: DebuggerEvent,
|
event: DebuggerEvent,
|
||||||
level: usize,
|
|
||||||
) -> Result<Option<DebuggerStatus>, Box<crate::EvalAltResult>> {
|
) -> Result<Option<DebuggerStatus>, Box<crate::EvalAltResult>> {
|
||||||
let source = global.source.clone();
|
let src = global.source_raw().cloned();
|
||||||
let source = if source.is_empty() {
|
let src = src.as_ref().map(|s| s.as_str());
|
||||||
None
|
let context = crate::EvalContext::new(self, global, caches, lib, scope, this_ptr);
|
||||||
} else {
|
|
||||||
Some(source.as_str())
|
|
||||||
};
|
|
||||||
|
|
||||||
let context = crate::EvalContext::new(self, scope, global, None, lib, this_ptr, level);
|
|
||||||
|
|
||||||
if let Some((.., ref on_debugger)) = self.debugger {
|
if let Some((.., ref on_debugger)) = self.debugger {
|
||||||
let command = on_debugger(context, event, node, source, node.position())?;
|
let command = on_debugger(context, event, node, src, node.position())?;
|
||||||
|
|
||||||
match command {
|
match command {
|
||||||
DebuggerCommand::Continue => {
|
DebuggerCommand::Continue => {
|
||||||
@ -556,12 +541,12 @@ impl Engine {
|
|||||||
// Bump a level if it is a function call
|
// Bump a level if it is a function call
|
||||||
let level = match node {
|
let level = match node {
|
||||||
ASTNode::Expr(Expr::FnCall(..)) | ASTNode::Stmt(Stmt::FnCall(..)) => {
|
ASTNode::Expr(Expr::FnCall(..)) | ASTNode::Stmt(Stmt::FnCall(..)) => {
|
||||||
level + 1
|
global.level + 1
|
||||||
}
|
}
|
||||||
ASTNode::Stmt(Stmt::Expr(e)) if matches!(**e, Expr::FnCall(..)) => {
|
ASTNode::Stmt(Stmt::Expr(e)) if matches!(**e, Expr::FnCall(..)) => {
|
||||||
level + 1
|
global.level + 1
|
||||||
}
|
}
|
||||||
_ => level,
|
_ => global.level,
|
||||||
};
|
};
|
||||||
global.debugger.status = DebuggerStatus::FunctionExit(level);
|
global.debugger.status = DebuggerStatus::FunctionExit(level);
|
||||||
Ok(None)
|
Ok(None)
|
||||||
|
@ -1,42 +1,39 @@
|
|||||||
//! Evaluation context.
|
//! Evaluation context.
|
||||||
|
|
||||||
use super::{Caches, GlobalRuntimeState};
|
use super::{Caches, GlobalRuntimeState};
|
||||||
use crate::{Dynamic, Engine, Module, Scope};
|
use crate::{Dynamic, Engine, Module, Scope, SharedModule};
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
|
|
||||||
/// Context of a script evaluation process.
|
/// Context of a script evaluation process.
|
||||||
#[derive(Debug)]
|
#[derive(Debug)]
|
||||||
#[allow(dead_code)]
|
#[allow(dead_code)]
|
||||||
pub struct EvalContext<'a, 's, 'ps, 'g, 'pg, 'c, 'pc, 't, 'pt> {
|
pub struct EvalContext<'a, 's, 'ps, 'g, 'c, 't> {
|
||||||
/// The current [`Engine`].
|
/// The current [`Engine`].
|
||||||
engine: &'a Engine,
|
engine: &'a Engine,
|
||||||
/// The current [`Scope`].
|
/// The current [`Scope`].
|
||||||
scope: &'s mut Scope<'ps>,
|
scope: &'s mut Scope<'ps>,
|
||||||
/// The current [`GlobalRuntimeState`].
|
/// The current [`GlobalRuntimeState`].
|
||||||
global: &'g mut GlobalRuntimeState<'pg>,
|
global: &'g mut GlobalRuntimeState,
|
||||||
/// The current [caches][Caches], if available.
|
/// The current [caches][Caches], if available.
|
||||||
caches: Option<&'c mut Caches<'pc>>,
|
caches: &'c mut Caches,
|
||||||
/// The current stack of imported [modules][Module].
|
/// The current stack of imported [modules][Module].
|
||||||
lib: &'a [&'a Module],
|
lib: &'a [SharedModule],
|
||||||
/// The current bound `this` pointer, if any.
|
/// The current bound `this` pointer, if any.
|
||||||
this_ptr: &'t mut Option<&'pt mut Dynamic>,
|
this_ptr: &'t mut Dynamic,
|
||||||
/// The current nesting level of function calls.
|
|
||||||
level: usize,
|
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<'a, 's, 'ps, 'g, 'pg, 'c, 'pc, 't, 'pt> EvalContext<'a, 's, 'ps, 'g, 'pg, 'c, 'pc, 't, 'pt> {
|
impl<'a, 's, 'ps, 'g, 'c, 't> EvalContext<'a, 's, 'ps, 'g, 'c, 't> {
|
||||||
/// Create a new [`EvalContext`].
|
/// Create a new [`EvalContext`].
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn new(
|
pub fn new(
|
||||||
engine: &'a Engine,
|
engine: &'a Engine,
|
||||||
|
global: &'g mut GlobalRuntimeState,
|
||||||
|
caches: &'c mut Caches,
|
||||||
|
lib: &'a [SharedModule],
|
||||||
scope: &'s mut Scope<'ps>,
|
scope: &'s mut Scope<'ps>,
|
||||||
global: &'g mut GlobalRuntimeState<'pg>,
|
this_ptr: &'t mut Dynamic,
|
||||||
caches: Option<&'c mut Caches<'pc>>,
|
|
||||||
lib: &'a [&'a Module],
|
|
||||||
this_ptr: &'t mut Option<&'pt mut Dynamic>,
|
|
||||||
level: usize,
|
|
||||||
) -> Self {
|
) -> Self {
|
||||||
Self {
|
Self {
|
||||||
engine,
|
engine,
|
||||||
@ -45,7 +42,6 @@ impl<'a, 's, 'ps, 'g, 'pg, 'c, 'pc, 't, 'pt> EvalContext<'a, 's, 'ps, 'g, 'pg, '
|
|||||||
caches,
|
caches,
|
||||||
lib,
|
lib,
|
||||||
this_ptr,
|
this_ptr,
|
||||||
level,
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
/// The current [`Engine`].
|
/// The current [`Engine`].
|
||||||
@ -58,11 +54,7 @@ impl<'a, 's, 'ps, 'g, 'pg, 'c, 'pc, 't, 'pt> EvalContext<'a, 's, 'ps, 'g, 'pg, '
|
|||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn source(&self) -> Option<&str> {
|
pub fn source(&self) -> Option<&str> {
|
||||||
if self.global.source.is_empty() {
|
self.global.source()
|
||||||
None
|
|
||||||
} else {
|
|
||||||
Some(self.global.source.as_str())
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
/// The current [`Scope`].
|
/// The current [`Scope`].
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
@ -108,39 +100,47 @@ impl<'a, 's, 'ps, 'g, 'pg, 'c, 'pc, 't, 'pt> EvalContext<'a, 's, 'ps, 'g, 'pg, '
|
|||||||
#[cfg(feature = "internals")]
|
#[cfg(feature = "internals")]
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn global_runtime_state_mut(&mut self) -> &mut &'g mut GlobalRuntimeState<'pg> {
|
pub fn global_runtime_state_mut(&mut self) -> &mut GlobalRuntimeState {
|
||||||
&mut self.global
|
self.global
|
||||||
}
|
}
|
||||||
/// Get an iterator over the namespaces containing definition of all script-defined functions.
|
/// Get an iterator over the namespaces containing definition of all script-defined functions.
|
||||||
#[inline]
|
#[inline]
|
||||||
pub fn iter_namespaces(&self) -> impl Iterator<Item = &Module> {
|
pub fn iter_namespaces(&self) -> impl Iterator<Item = &Module> {
|
||||||
self.lib.iter().copied()
|
self.lib.iter().map(|m| m.as_ref())
|
||||||
}
|
}
|
||||||
/// _(internals)_ The current set of namespaces containing definitions of all script-defined functions.
|
/// _(internals)_ The current set of namespaces containing definitions of all script-defined functions.
|
||||||
/// Exported under the `internals` feature only.
|
/// Exported under the `internals` feature only.
|
||||||
#[cfg(feature = "internals")]
|
#[cfg(feature = "internals")]
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn namespaces(&self) -> &[&Module] {
|
pub const fn namespaces(&self) -> &[SharedModule] {
|
||||||
self.lib
|
self.lib
|
||||||
}
|
}
|
||||||
/// The current bound `this` pointer, if any.
|
/// The current bound `this` pointer, if any.
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn this_ptr(&self) -> Option<&Dynamic> {
|
pub fn this_ptr(&self) -> Option<&Dynamic> {
|
||||||
self.this_ptr.as_ref().map(|v| &**v)
|
if self.this_ptr.is_null() {
|
||||||
|
None
|
||||||
|
} else {
|
||||||
|
Some(self.this_ptr)
|
||||||
|
}
|
||||||
}
|
}
|
||||||
/// Mutable reference to the current bound `this` pointer, if any.
|
/// Mutable reference to the current bound `this` pointer, if any.
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn this_ptr_mut(&mut self) -> &mut Option<&'pt mut Dynamic> {
|
pub fn this_ptr_mut(&mut self) -> Option<&mut Dynamic> {
|
||||||
self.this_ptr
|
if self.this_ptr.is_null() {
|
||||||
|
None
|
||||||
|
} else {
|
||||||
|
Some(self.this_ptr)
|
||||||
|
}
|
||||||
}
|
}
|
||||||
/// The current nesting level of function calls.
|
/// The current nesting level of function calls.
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn call_level(&self) -> usize {
|
pub const fn call_level(&self) -> usize {
|
||||||
self.level
|
self.global.level
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Evaluate an [expression tree][crate::Expression] within this [evaluation context][`EvalContext`].
|
/// Evaluate an [expression tree][crate::Expression] within this [evaluation context][`EvalContext`].
|
||||||
@ -177,32 +177,23 @@ impl<'a, 's, 'ps, 'g, 'pg, 'c, 'pc, 't, 'pt> EvalContext<'a, 's, 'ps, 'g, 'pg, '
|
|||||||
) -> crate::RhaiResult {
|
) -> crate::RhaiResult {
|
||||||
let expr: &crate::ast::Expr = expr;
|
let expr: &crate::ast::Expr = expr;
|
||||||
|
|
||||||
let mut new_caches = Caches::new();
|
|
||||||
|
|
||||||
let caches = match self.caches.as_mut() {
|
|
||||||
Some(c) => c,
|
|
||||||
None => &mut new_caches,
|
|
||||||
};
|
|
||||||
|
|
||||||
match expr {
|
match expr {
|
||||||
crate::ast::Expr::Stmt(statements) => self.engine.eval_stmt_block(
|
crate::ast::Expr::Stmt(statements) => self.engine.eval_stmt_block(
|
||||||
self.scope,
|
|
||||||
self.global,
|
self.global,
|
||||||
caches,
|
self.caches,
|
||||||
self.lib,
|
self.lib,
|
||||||
|
self.scope,
|
||||||
self.this_ptr,
|
self.this_ptr,
|
||||||
statements,
|
statements,
|
||||||
rewind_scope,
|
rewind_scope,
|
||||||
self.level,
|
|
||||||
),
|
),
|
||||||
_ => self.engine.eval_expr(
|
_ => self.engine.eval_expr(
|
||||||
self.scope,
|
|
||||||
self.global,
|
self.global,
|
||||||
caches,
|
self.caches,
|
||||||
self.lib,
|
self.lib,
|
||||||
|
self.scope,
|
||||||
self.this_ptr,
|
self.this_ptr,
|
||||||
expr,
|
expr,
|
||||||
self.level,
|
|
||||||
),
|
),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
448
src/eval/expr.rs
448
src/eval/expr.rs
@ -1,19 +1,10 @@
|
|||||||
//! Module defining functions for evaluating an expression.
|
//! Module defining functions for evaluating an expression.
|
||||||
|
|
||||||
use super::{Caches, EvalContext, GlobalRuntimeState, Target};
|
use super::{Caches, EvalContext, GlobalRuntimeState, Target};
|
||||||
use crate::ast::{Expr, FnCallExpr, OpAssignment};
|
use crate::ast::{Expr, OpAssignment};
|
||||||
use crate::engine::{KEYWORD_THIS, OP_CONCAT};
|
use crate::engine::{KEYWORD_THIS, OP_CONCAT};
|
||||||
use crate::eval::FnResolutionCacheEntry;
|
|
||||||
use crate::func::{
|
|
||||||
calc_fn_params_hash, combine_hashes, gen_fn_call_signature, get_builtin_binary_op_fn,
|
|
||||||
CallableFunction,
|
|
||||||
};
|
|
||||||
use crate::types::dynamic::AccessMode;
|
use crate::types::dynamic::AccessMode;
|
||||||
use crate::{Dynamic, Engine, Module, Position, RhaiResult, RhaiResultOf, Scope, ERR};
|
use crate::{Dynamic, Engine, Position, RhaiResult, RhaiResultOf, Scope, SharedModule, ERR};
|
||||||
#[cfg(feature = "no_std")]
|
|
||||||
use hashbrown::hash_map::Entry;
|
|
||||||
#[cfg(not(feature = "no_std"))]
|
|
||||||
use std::collections::hash_map::Entry;
|
|
||||||
use std::num::NonZeroUsize;
|
use std::num::NonZeroUsize;
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
@ -27,18 +18,18 @@ impl Engine {
|
|||||||
&self,
|
&self,
|
||||||
global: &GlobalRuntimeState,
|
global: &GlobalRuntimeState,
|
||||||
namespace: &crate::ast::Namespace,
|
namespace: &crate::ast::Namespace,
|
||||||
) -> Option<crate::Shared<Module>> {
|
) -> Option<SharedModule> {
|
||||||
assert!(!namespace.is_empty());
|
assert!(!namespace.is_empty());
|
||||||
|
|
||||||
let root = namespace.root();
|
let root = namespace.root();
|
||||||
|
|
||||||
// Qualified - check if the root module is directly indexed
|
|
||||||
let index = if global.always_search_scope {
|
let index = if global.always_search_scope {
|
||||||
None
|
None
|
||||||
} else {
|
} else {
|
||||||
namespace.index()
|
namespace.index()
|
||||||
};
|
};
|
||||||
|
|
||||||
|
// Qualified - check if the root module is directly indexed
|
||||||
if let Some(index) = index {
|
if let Some(index) = index {
|
||||||
let offset = global.num_imports() - index.get();
|
let offset = global.num_imports() - index.get();
|
||||||
|
|
||||||
@ -58,25 +49,26 @@ impl Engine {
|
|||||||
/// depending on whether the variable name is namespace-qualified.
|
/// depending on whether the variable name is namespace-qualified.
|
||||||
pub(crate) fn search_namespace<'s>(
|
pub(crate) fn search_namespace<'s>(
|
||||||
&self,
|
&self,
|
||||||
scope: &'s mut Scope,
|
|
||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
lib: &[&Module],
|
caches: &mut Caches,
|
||||||
this_ptr: &'s mut Option<&mut Dynamic>,
|
lib: &[SharedModule],
|
||||||
|
|
||||||
|
scope: &'s mut Scope,
|
||||||
|
this_ptr: &'s mut Dynamic,
|
||||||
expr: &Expr,
|
expr: &Expr,
|
||||||
level: usize,
|
|
||||||
) -> RhaiResultOf<(Target<'s>, Position)> {
|
) -> RhaiResultOf<(Target<'s>, Position)> {
|
||||||
match expr {
|
match expr {
|
||||||
Expr::Variable(_, Some(_), _) => {
|
Expr::Variable(_, Some(_), _) => {
|
||||||
self.search_scope_only(scope, global, lib, this_ptr, expr, level)
|
self.search_scope_only(global, caches, lib, scope, this_ptr, expr)
|
||||||
}
|
}
|
||||||
Expr::Variable(v, None, _var_pos) => match &**v {
|
Expr::Variable(v, None, _var_pos) => match &**v {
|
||||||
// Normal variable access
|
// Normal variable access
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
(_, ns, ..) if ns.is_empty() => {
|
(_, ns, ..) if ns.is_empty() => {
|
||||||
self.search_scope_only(scope, global, lib, this_ptr, expr, level)
|
self.search_scope_only(global, caches, lib, scope, this_ptr, expr)
|
||||||
}
|
}
|
||||||
#[cfg(feature = "no_module")]
|
#[cfg(feature = "no_module")]
|
||||||
(_, (), ..) => self.search_scope_only(scope, global, lib, this_ptr, expr, level),
|
(_, (), ..) => self.search_scope_only(global, caches, lib, scope, this_ptr, expr),
|
||||||
|
|
||||||
// Qualified variable access
|
// Qualified variable access
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
@ -141,22 +133,24 @@ impl Engine {
|
|||||||
/// Panics if `expr` is not [`Expr::Variable`].
|
/// Panics if `expr` is not [`Expr::Variable`].
|
||||||
pub(crate) fn search_scope_only<'s>(
|
pub(crate) fn search_scope_only<'s>(
|
||||||
&self,
|
&self,
|
||||||
scope: &'s mut Scope,
|
|
||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
lib: &[&Module],
|
caches: &mut Caches,
|
||||||
this_ptr: &'s mut Option<&mut Dynamic>,
|
lib: &[SharedModule],
|
||||||
|
|
||||||
|
scope: &'s mut Scope,
|
||||||
|
this_ptr: &'s mut Dynamic,
|
||||||
expr: &Expr,
|
expr: &Expr,
|
||||||
level: usize,
|
|
||||||
) -> RhaiResultOf<(Target<'s>, Position)> {
|
) -> RhaiResultOf<(Target<'s>, Position)> {
|
||||||
// Make sure that the pointer indirection is taken only when absolutely necessary.
|
// Make sure that the pointer indirection is taken only when absolutely necessary.
|
||||||
|
|
||||||
let (index, var_pos) = match expr {
|
let (index, var_pos) = match expr {
|
||||||
// Check if the variable is `this`
|
// Check if the variable is `this`
|
||||||
Expr::Variable(v, None, pos) if v.0.is_none() && v.3 == KEYWORD_THIS => {
|
Expr::Variable(v, None, pos) if v.0.is_none() && v.3 == KEYWORD_THIS => {
|
||||||
return this_ptr.as_mut().map_or_else(
|
return if this_ptr.is_null() {
|
||||||
|| Err(ERR::ErrorUnboundThis(*pos).into()),
|
Err(ERR::ErrorUnboundThis(*pos).into())
|
||||||
|val| Ok(((*val).into(), *pos)),
|
} else {
|
||||||
)
|
Ok((this_ptr.into(), *pos))
|
||||||
|
};
|
||||||
}
|
}
|
||||||
_ if global.always_search_scope => (0, expr.start_position()),
|
_ if global.always_search_scope => (0, expr.start_position()),
|
||||||
Expr::Variable(.., Some(i), pos) => (i.get() as usize, *pos),
|
Expr::Variable(.., Some(i), pos) => (i.get() as usize, *pos),
|
||||||
@ -165,7 +159,7 @@ impl Engine {
|
|||||||
Expr::Variable(v, None, pos)
|
Expr::Variable(v, None, pos)
|
||||||
if lib
|
if lib
|
||||||
.iter()
|
.iter()
|
||||||
.flat_map(|&m| m.iter_script_fn())
|
.flat_map(|m| m.iter_script_fn())
|
||||||
.any(|(_, _, f, ..)| f == v.3.as_str()) =>
|
.any(|(_, _, f, ..)| f == v.3.as_str()) =>
|
||||||
{
|
{
|
||||||
let val: Dynamic =
|
let val: Dynamic =
|
||||||
@ -178,7 +172,7 @@ impl Engine {
|
|||||||
|
|
||||||
// Check the variable resolver, if any
|
// Check the variable resolver, if any
|
||||||
if let Some(ref resolve_var) = self.resolve_var {
|
if let Some(ref resolve_var) = self.resolve_var {
|
||||||
let context = EvalContext::new(self, scope, global, None, lib, this_ptr, level);
|
let context = EvalContext::new(self, global, caches, lib, scope, this_ptr);
|
||||||
let var_name = expr.get_variable_name(true).expect("`Expr::Variable`");
|
let var_name = expr.get_variable_name(true).expect("`Expr::Variable`");
|
||||||
match resolve_var(var_name, index, context) {
|
match resolve_var(var_name, index, context) {
|
||||||
Ok(Some(mut result)) => {
|
Ok(Some(mut result)) => {
|
||||||
@ -196,8 +190,8 @@ impl Engine {
|
|||||||
// Find the variable in the scope
|
// Find the variable in the scope
|
||||||
let var_name = expr.get_variable_name(true).expect("`Expr::Variable`");
|
let var_name = expr.get_variable_name(true).expect("`Expr::Variable`");
|
||||||
|
|
||||||
match scope.get_index(var_name) {
|
match scope.search(var_name) {
|
||||||
Some((index, _)) => index,
|
Some(index) => index,
|
||||||
None => {
|
None => {
|
||||||
return match self.global_modules.iter().find_map(|m| m.get_var(var_name)) {
|
return match self.global_modules.iter().find_map(|m| m.get_var(var_name)) {
|
||||||
Some(val) => Ok((val.into(), var_pos)),
|
Some(val) => Ok((val.into(), var_pos)),
|
||||||
@ -214,136 +208,6 @@ impl Engine {
|
|||||||
Ok((val.into(), var_pos))
|
Ok((val.into(), var_pos))
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Evaluate a function call expression.
|
|
||||||
pub(crate) fn eval_fn_call_expr(
|
|
||||||
&self,
|
|
||||||
scope: &mut Scope,
|
|
||||||
global: &mut GlobalRuntimeState,
|
|
||||||
caches: &mut Caches,
|
|
||||||
lib: &[&Module],
|
|
||||||
this_ptr: &mut Option<&mut Dynamic>,
|
|
||||||
expr: &FnCallExpr,
|
|
||||||
pos: Position,
|
|
||||||
level: usize,
|
|
||||||
) -> RhaiResult {
|
|
||||||
let FnCallExpr {
|
|
||||||
name, hashes, args, ..
|
|
||||||
} = expr;
|
|
||||||
|
|
||||||
// Short-circuit native binary operator call if under Fast Operators mode
|
|
||||||
if expr.is_native_operator && self.fast_operators() && (args.len() == 1 || args.len() == 2)
|
|
||||||
{
|
|
||||||
let mut lhs = self
|
|
||||||
.get_arg_value(scope, global, caches, lib, this_ptr, &args[0], level)?
|
|
||||||
.0
|
|
||||||
.flatten();
|
|
||||||
|
|
||||||
let mut rhs = if args.len() == 2 {
|
|
||||||
self.get_arg_value(scope, global, caches, lib, this_ptr, &args[1], level)?
|
|
||||||
.0
|
|
||||||
.flatten()
|
|
||||||
} else {
|
|
||||||
Dynamic::UNIT
|
|
||||||
};
|
|
||||||
|
|
||||||
let mut operands = [&mut lhs, &mut rhs];
|
|
||||||
let operands = if args.len() == 2 {
|
|
||||||
&mut operands[..]
|
|
||||||
} else {
|
|
||||||
&mut operands[0..1]
|
|
||||||
};
|
|
||||||
|
|
||||||
let hash = calc_fn_params_hash(operands.iter().map(|a| a.type_id()));
|
|
||||||
let hash = combine_hashes(hashes.native, hash);
|
|
||||||
|
|
||||||
let cache = caches.fn_resolution_cache_mut();
|
|
||||||
let local_entry: CallableFunction;
|
|
||||||
|
|
||||||
let func = match cache.map.entry(hash) {
|
|
||||||
Entry::Vacant(entry) => {
|
|
||||||
let func = if args.len() == 2 {
|
|
||||||
get_builtin_binary_op_fn(name, operands[0], operands[1])
|
|
||||||
} else {
|
|
||||||
None
|
|
||||||
};
|
|
||||||
|
|
||||||
if let Some(f) = func {
|
|
||||||
if cache.filter.is_absent_and_set(hash) {
|
|
||||||
// Do not cache "one-hit wonders"
|
|
||||||
local_entry = CallableFunction::from_fn_builtin(f);
|
|
||||||
&local_entry
|
|
||||||
} else {
|
|
||||||
// Cache repeated calls
|
|
||||||
&entry
|
|
||||||
.insert(Some(FnResolutionCacheEntry {
|
|
||||||
func: CallableFunction::from_fn_builtin(f),
|
|
||||||
source: None,
|
|
||||||
}))
|
|
||||||
.as_ref()
|
|
||||||
.unwrap()
|
|
||||||
.func
|
|
||||||
}
|
|
||||||
} else {
|
|
||||||
let result = self.exec_fn_call(
|
|
||||||
None, global, caches, lib, name, *hashes, operands, false, false, pos,
|
|
||||||
level,
|
|
||||||
);
|
|
||||||
return result.map(|(v, ..)| v);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
Entry::Occupied(entry) => {
|
|
||||||
if let Some(entry) = entry.into_mut() {
|
|
||||||
&entry.func
|
|
||||||
} else {
|
|
||||||
let sig = gen_fn_call_signature(self, name, operands);
|
|
||||||
return Err(ERR::ErrorFunctionNotFound(sig, pos).into());
|
|
||||||
}
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
let context = (self, name, None, &*global, lib, pos, level).into();
|
|
||||||
let result = if func.is_plugin_fn() {
|
|
||||||
func.get_plugin_fn().unwrap().call(context, operands)
|
|
||||||
} else {
|
|
||||||
func.get_native_fn().unwrap()(context, operands)
|
|
||||||
};
|
|
||||||
return self.check_return_value(result, pos);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[cfg(not(feature = "no_module"))]
|
|
||||||
if !expr.namespace.is_empty() {
|
|
||||||
// Qualified function call
|
|
||||||
let hash = hashes.native;
|
|
||||||
let namespace = &expr.namespace;
|
|
||||||
|
|
||||||
return self.make_qualified_function_call(
|
|
||||||
scope, global, caches, lib, this_ptr, namespace, name, args, hash, pos, level,
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
// Normal function call
|
|
||||||
let (first_arg, args) = args.split_first().map_or_else(
|
|
||||||
|| (None, args.as_ref()),
|
|
||||||
|(first, rest)| (Some(first), rest),
|
|
||||||
);
|
|
||||||
|
|
||||||
self.make_function_call(
|
|
||||||
scope,
|
|
||||||
global,
|
|
||||||
caches,
|
|
||||||
lib,
|
|
||||||
this_ptr,
|
|
||||||
name,
|
|
||||||
first_arg,
|
|
||||||
args,
|
|
||||||
*hashes,
|
|
||||||
expr.capture_parent_scope,
|
|
||||||
expr.is_native_operator,
|
|
||||||
pos,
|
|
||||||
level,
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Evaluate an expression.
|
/// Evaluate an expression.
|
||||||
//
|
//
|
||||||
// # Implementation Notes
|
// # Implementation Notes
|
||||||
@ -354,34 +218,30 @@ impl Engine {
|
|||||||
// Errors that are not recoverable, such as system errors or safety errors, can use `?`.
|
// Errors that are not recoverable, such as system errors or safety errors, can use `?`.
|
||||||
pub(crate) fn eval_expr(
|
pub(crate) fn eval_expr(
|
||||||
&self,
|
&self,
|
||||||
scope: &mut Scope,
|
|
||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
caches: &mut Caches,
|
caches: &mut Caches,
|
||||||
lib: &[&Module],
|
lib: &[SharedModule],
|
||||||
this_ptr: &mut Option<&mut Dynamic>,
|
|
||||||
|
scope: &mut Scope,
|
||||||
|
this_ptr: &mut Dynamic,
|
||||||
expr: &Expr,
|
expr: &Expr,
|
||||||
level: usize,
|
|
||||||
) -> RhaiResult {
|
) -> RhaiResult {
|
||||||
// Coded this way for better branch prediction.
|
// Coded this way for better branch prediction.
|
||||||
// Popular branches are lifted out of the `match` statement into their own branches.
|
// Popular branches are lifted out of the `match` statement into their own branches.
|
||||||
|
|
||||||
// Function calls should account for a relatively larger portion of expressions because
|
// Function calls should account for a relatively larger portion of expressions because
|
||||||
// binary operators are also function calls.
|
// binary operators are also function calls.
|
||||||
if let Expr::FnCall(x, ..) = expr {
|
if let Expr::FnCall(x, pos) = expr {
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
let reset_debugger =
|
let reset = self.run_debugger_with_reset(global, caches, lib, scope, this_ptr, expr)?;
|
||||||
self.run_debugger_with_reset(scope, global, lib, this_ptr, expr, level)?;
|
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
self.inc_operations(&mut global.num_operations, expr.position())?;
|
|
||||||
|
|
||||||
let result =
|
|
||||||
self.eval_fn_call_expr(scope, global, caches, lib, this_ptr, x, x.pos, level);
|
|
||||||
|
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
global.debugger.reset_status(reset_debugger);
|
let global = &mut *crate::types::RestoreOnDrop::lock(global, move |g| {
|
||||||
|
g.debugger.reset_status(reset)
|
||||||
|
});
|
||||||
|
|
||||||
return result;
|
self.track_operation(global, expr.position())?;
|
||||||
|
|
||||||
|
return self.eval_fn_call_expr(global, caches, lib, scope, this_ptr, x, *pos);
|
||||||
}
|
}
|
||||||
|
|
||||||
// Then variable access.
|
// Then variable access.
|
||||||
@ -389,30 +249,32 @@ impl Engine {
|
|||||||
// will cost more than the mis-predicted `match` branch.
|
// will cost more than the mis-predicted `match` branch.
|
||||||
if let Expr::Variable(x, index, var_pos) = expr {
|
if let Expr::Variable(x, index, var_pos) = expr {
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
self.run_debugger(scope, global, lib, this_ptr, expr, level)?;
|
self.run_debugger(global, caches, lib, scope, this_ptr, expr)?;
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
self.track_operation(global, expr.position())?;
|
||||||
self.inc_operations(&mut global.num_operations, expr.position())?;
|
|
||||||
|
|
||||||
return if index.is_none() && x.0.is_none() && x.3 == KEYWORD_THIS {
|
return if index.is_none() && x.0.is_none() && x.3 == KEYWORD_THIS {
|
||||||
this_ptr
|
if this_ptr.is_null() {
|
||||||
.as_deref()
|
ERR::ErrorUnboundThis(*var_pos).into()
|
||||||
.cloned()
|
|
||||||
.ok_or_else(|| ERR::ErrorUnboundThis(*var_pos).into())
|
|
||||||
} else {
|
} else {
|
||||||
self.search_namespace(scope, global, lib, this_ptr, expr, level)
|
Ok(this_ptr.clone())
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
self.search_namespace(global, caches, lib, scope, this_ptr, expr)
|
||||||
.map(|(val, ..)| val.take_or_clone())
|
.map(|(val, ..)| val.take_or_clone())
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
let reset_debugger =
|
let reset = self.run_debugger_with_reset(global, caches, lib, scope, this_ptr, expr)?;
|
||||||
self.run_debugger_with_reset(scope, global, lib, this_ptr, expr, level)?;
|
#[cfg(feature = "debugging")]
|
||||||
|
let global = &mut *crate::types::RestoreOnDrop::lock(global, move |g| {
|
||||||
|
g.debugger.reset_status(reset)
|
||||||
|
});
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
self.track_operation(global, expr.position())?;
|
||||||
self.inc_operations(&mut global.num_operations, expr.position())?;
|
|
||||||
|
|
||||||
let result = match expr {
|
match expr {
|
||||||
// Constants
|
// Constants
|
||||||
Expr::DynamicConstant(x, ..) => Ok(x.as_ref().clone()),
|
Expr::DynamicConstant(x, ..) => Ok(x.as_ref().clone()),
|
||||||
Expr::IntegerConstant(x, ..) => Ok((*x).into()),
|
Expr::IntegerConstant(x, ..) => Ok((*x).into()),
|
||||||
@ -427,163 +289,115 @@ impl Engine {
|
|||||||
Expr::InterpolatedString(x, _) => {
|
Expr::InterpolatedString(x, _) => {
|
||||||
let mut concat = self.get_interned_string("").into();
|
let mut concat = self.get_interned_string("").into();
|
||||||
let target = &mut concat;
|
let target = &mut concat;
|
||||||
let mut result = Ok(Dynamic::UNIT);
|
|
||||||
|
|
||||||
let mut op_info = OpAssignment::new_op_assignment(OP_CONCAT, Position::NONE);
|
let mut op_info = OpAssignment::new_op_assignment(OP_CONCAT, Position::NONE);
|
||||||
let root = ("", Position::NONE);
|
let root = ("", Position::NONE);
|
||||||
|
|
||||||
for expr in &**x {
|
let result = x
|
||||||
let item =
|
.iter()
|
||||||
match self.eval_expr(scope, global, caches, lib, this_ptr, expr, level) {
|
.try_for_each(|expr| {
|
||||||
Ok(r) => r,
|
let item = self.eval_expr(global, caches, lib, scope, this_ptr, expr)?;
|
||||||
err => {
|
|
||||||
result = err;
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
op_info.pos = expr.start_position();
|
op_info.pos = expr.start_position();
|
||||||
|
|
||||||
if let Err(err) = self
|
self.eval_op_assignment(global, caches, lib, &op_info, target, root, item)
|
||||||
.eval_op_assignment(global, caches, lib, op_info, target, root, item, level)
|
})
|
||||||
{
|
.map(|_| concat.take_or_clone());
|
||||||
result = Err(err);
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
self.check_return_value(
|
self.check_return_value(result, expr.start_position())
|
||||||
result.map(|_| concat.take_or_clone()),
|
|
||||||
expr.start_position(),
|
|
||||||
)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
Expr::Array(x, ..) => {
|
Expr::Array(x, ..) => {
|
||||||
let mut array = crate::Array::with_capacity(x.len());
|
|
||||||
let mut result = Ok(Dynamic::UNIT);
|
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
#[cfg(not(feature = "unchecked"))]
|
||||||
let mut sizes = (0, 0, 0);
|
let mut total_data_sizes = (0, 0, 0);
|
||||||
|
|
||||||
for item_expr in &**x {
|
x.iter()
|
||||||
let value = match self
|
.try_fold(
|
||||||
.eval_expr(scope, global, caches, lib, this_ptr, item_expr, level)
|
crate::Array::with_capacity(x.len()),
|
||||||
{
|
|mut array, item_expr| {
|
||||||
Ok(r) => r.flatten(),
|
let value = self
|
||||||
err => {
|
.eval_expr(global, caches, lib, scope, this_ptr, item_expr)?
|
||||||
result = err;
|
.flatten();
|
||||||
break;
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
let val_sizes = Self::calc_data_sizes(&value, true);
|
|
||||||
|
|
||||||
array.push(value);
|
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
#[cfg(not(feature = "unchecked"))]
|
||||||
if self.has_data_size_limit() {
|
if self.has_data_size_limit() {
|
||||||
sizes = (
|
let val_sizes = Self::calc_data_sizes(&value, true);
|
||||||
sizes.0 + val_sizes.0,
|
|
||||||
sizes.1 + val_sizes.1,
|
total_data_sizes = (
|
||||||
sizes.2 + val_sizes.2,
|
total_data_sizes.0 + val_sizes.0,
|
||||||
|
total_data_sizes.1 + val_sizes.1,
|
||||||
|
total_data_sizes.2 + val_sizes.2,
|
||||||
);
|
);
|
||||||
self.raise_err_if_over_data_size_limit(sizes, item_expr.position())?;
|
self.raise_err_if_over_data_size_limit(total_data_sizes)
|
||||||
}
|
.map_err(|err| err.fill_position(item_expr.position()))?;
|
||||||
}
|
}
|
||||||
|
|
||||||
result.map(|_| array.into())
|
array.push(value);
|
||||||
|
|
||||||
|
Ok(array)
|
||||||
|
},
|
||||||
|
)
|
||||||
|
.map(Into::into)
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
Expr::Map(x, ..) => {
|
Expr::Map(x, ..) => {
|
||||||
let mut map = x.1.clone();
|
|
||||||
let mut result = Ok(Dynamic::UNIT);
|
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
#[cfg(not(feature = "unchecked"))]
|
||||||
let mut sizes = (0, 0, 0);
|
let mut total_data_sizes = (0, 0, 0);
|
||||||
|
|
||||||
for (key, value_expr) in &x.0 {
|
x.0.iter()
|
||||||
let value = match self
|
.try_fold(x.1.clone(), |mut map, (key, value_expr)| {
|
||||||
.eval_expr(scope, global, caches, lib, this_ptr, value_expr, level)
|
let value = self
|
||||||
{
|
.eval_expr(global, caches, lib, scope, this_ptr, value_expr)?
|
||||||
Ok(r) => r.flatten(),
|
.flatten();
|
||||||
err => {
|
|
||||||
result = err;
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
let delta = Self::calc_data_sizes(&value, true);
|
|
||||||
|
|
||||||
*map.get_mut(key.as_str()).unwrap() = value;
|
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
#[cfg(not(feature = "unchecked"))]
|
||||||
if self.has_data_size_limit() {
|
if self.has_data_size_limit() {
|
||||||
sizes = (sizes.0 + delta.0, sizes.1 + delta.1, sizes.2 + delta.2);
|
let delta = Self::calc_data_sizes(&value, true);
|
||||||
self.raise_err_if_over_data_size_limit(sizes, value_expr.position())?;
|
total_data_sizes = (
|
||||||
}
|
total_data_sizes.0 + delta.0,
|
||||||
|
total_data_sizes.1 + delta.1,
|
||||||
|
total_data_sizes.2 + delta.2,
|
||||||
|
);
|
||||||
|
self.raise_err_if_over_data_size_limit(total_data_sizes)
|
||||||
|
.map_err(|err| err.fill_position(value_expr.position()))?;
|
||||||
}
|
}
|
||||||
|
|
||||||
result.map(|_| map.into())
|
*map.get_mut(key.as_str()).unwrap() = value;
|
||||||
}
|
|
||||||
|
|
||||||
Expr::And(x, ..) => {
|
Ok(map)
|
||||||
let lhs = self
|
|
||||||
.eval_expr(scope, global, caches, lib, this_ptr, &x.lhs, level)
|
|
||||||
.and_then(|v| {
|
|
||||||
v.as_bool().map_err(|typ| {
|
|
||||||
self.make_type_mismatch_err::<bool>(typ, x.lhs.position())
|
|
||||||
})
|
|
||||||
});
|
|
||||||
|
|
||||||
if let Ok(true) = lhs {
|
|
||||||
self.eval_expr(scope, global, caches, lib, this_ptr, &x.rhs, level)
|
|
||||||
.and_then(|v| {
|
|
||||||
v.as_bool()
|
|
||||||
.map_err(|typ| {
|
|
||||||
self.make_type_mismatch_err::<bool>(typ, x.rhs.position())
|
|
||||||
})
|
})
|
||||||
.map(Into::into)
|
.map(Into::into)
|
||||||
})
|
|
||||||
} else {
|
|
||||||
lhs.map(Into::into)
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
Expr::Or(x, ..) => {
|
Expr::And(x, ..) => Ok((self
|
||||||
let lhs = self
|
.eval_expr(global, caches, lib, scope, this_ptr, &x.lhs)?
|
||||||
.eval_expr(scope, global, caches, lib, this_ptr, &x.lhs, level)
|
.as_bool()
|
||||||
.and_then(|v| {
|
.map_err(|typ| self.make_type_mismatch_err::<bool>(typ, x.lhs.position()))?
|
||||||
v.as_bool().map_err(|typ| {
|
&& self
|
||||||
self.make_type_mismatch_err::<bool>(typ, x.lhs.position())
|
.eval_expr(global, caches, lib, scope, this_ptr, &x.rhs)?
|
||||||
})
|
.as_bool()
|
||||||
});
|
.map_err(|typ| self.make_type_mismatch_err::<bool>(typ, x.rhs.position()))?)
|
||||||
|
.into()),
|
||||||
|
|
||||||
if let Ok(false) = lhs {
|
Expr::Or(x, ..) => Ok((self
|
||||||
self.eval_expr(scope, global, caches, lib, this_ptr, &x.rhs, level)
|
.eval_expr(global, caches, lib, scope, this_ptr, &x.lhs)?
|
||||||
.and_then(|v| {
|
.as_bool()
|
||||||
v.as_bool()
|
.map_err(|typ| self.make_type_mismatch_err::<bool>(typ, x.lhs.position()))?
|
||||||
.map_err(|typ| {
|
|| self
|
||||||
self.make_type_mismatch_err::<bool>(typ, x.rhs.position())
|
.eval_expr(global, caches, lib, scope, this_ptr, &x.rhs)?
|
||||||
})
|
.as_bool()
|
||||||
.map(Into::into)
|
.map_err(|typ| self.make_type_mismatch_err::<bool>(typ, x.rhs.position()))?)
|
||||||
})
|
.into()),
|
||||||
} else {
|
|
||||||
lhs.map(Into::into)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
Expr::Coalesce(x, ..) => {
|
Expr::Coalesce(x, ..) => {
|
||||||
let lhs = self.eval_expr(scope, global, caches, lib, this_ptr, &x.lhs, level);
|
let value = self.eval_expr(global, caches, lib, scope, this_ptr, &x.lhs)?;
|
||||||
|
|
||||||
match lhs {
|
if value.is::<()>() {
|
||||||
Ok(value) if value.is::<()>() => {
|
self.eval_expr(global, caches, lib, scope, this_ptr, &x.rhs)
|
||||||
self.eval_expr(scope, global, caches, lib, this_ptr, &x.rhs, level)
|
} else {
|
||||||
}
|
Ok(value)
|
||||||
Ok(_) | Err(_) => lhs,
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -601,8 +415,7 @@ impl Engine {
|
|||||||
*pos,
|
*pos,
|
||||||
))
|
))
|
||||||
})?;
|
})?;
|
||||||
let mut context =
|
let mut context = EvalContext::new(self, global, caches, lib, scope, this_ptr);
|
||||||
EvalContext::new(self, scope, global, Some(caches), lib, this_ptr, level);
|
|
||||||
|
|
||||||
let result = (custom_def.func)(&mut context, &expressions, &custom.state);
|
let result = (custom_def.func)(&mut context, &expressions, &custom.state);
|
||||||
|
|
||||||
@ -610,26 +423,19 @@ impl Engine {
|
|||||||
}
|
}
|
||||||
|
|
||||||
Expr::Stmt(x) if x.is_empty() => Ok(Dynamic::UNIT),
|
Expr::Stmt(x) if x.is_empty() => Ok(Dynamic::UNIT),
|
||||||
Expr::Stmt(x) => {
|
Expr::Stmt(x) => self.eval_stmt_block(global, caches, lib, scope, this_ptr, x, true),
|
||||||
self.eval_stmt_block(scope, global, caches, lib, this_ptr, x, true, level)
|
|
||||||
}
|
|
||||||
|
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
Expr::Index(..) => {
|
Expr::Index(..) => {
|
||||||
self.eval_dot_index_chain(scope, global, caches, lib, this_ptr, expr, level, None)
|
self.eval_dot_index_chain(global, caches, lib, scope, this_ptr, expr, &mut None)
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
Expr::Dot(..) => {
|
Expr::Dot(..) => {
|
||||||
self.eval_dot_index_chain(scope, global, caches, lib, this_ptr, expr, level, None)
|
self.eval_dot_index_chain(global, caches, lib, scope, this_ptr, expr, &mut None)
|
||||||
}
|
}
|
||||||
|
|
||||||
_ => unreachable!("expression cannot be evaluated: {:?}", expr),
|
_ => unreachable!("expression cannot be evaluated: {:?}", expr),
|
||||||
};
|
}
|
||||||
|
|
||||||
#[cfg(feature = "debugging")]
|
|
||||||
global.debugger.reset_status(reset_debugger);
|
|
||||||
|
|
||||||
result
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -1,15 +1,15 @@
|
|||||||
//! Global runtime state.
|
//! Global runtime state.
|
||||||
|
|
||||||
use crate::{Dynamic, Engine, Identifier};
|
use crate::{Dynamic, Engine, ImmutableString};
|
||||||
|
use std::fmt;
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
use std::{fmt, marker::PhantomData};
|
|
||||||
|
|
||||||
/// Collection of globally-defined constants.
|
/// Collection of globally-defined constants.
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
pub type GlobalConstants =
|
pub type GlobalConstants =
|
||||||
crate::Shared<crate::Locked<std::collections::BTreeMap<crate::ImmutableString, Dynamic>>>;
|
crate::Shared<crate::Locked<std::collections::BTreeMap<ImmutableString, Dynamic>>>;
|
||||||
|
|
||||||
/// _(internals)_ Global runtime states.
|
/// _(internals)_ Global runtime states.
|
||||||
/// Exported under the `internals` feature only.
|
/// Exported under the `internals` feature only.
|
||||||
@ -22,21 +22,24 @@ pub type GlobalConstants =
|
|||||||
// Most usage will be looking up a particular key from the list and then getting the module that
|
// Most usage will be looking up a particular key from the list and then getting the module that
|
||||||
// corresponds to that key.
|
// corresponds to that key.
|
||||||
#[derive(Clone)]
|
#[derive(Clone)]
|
||||||
pub struct GlobalRuntimeState<'a> {
|
pub struct GlobalRuntimeState {
|
||||||
/// Stack of module names.
|
/// Names of imported [modules][crate::Module].
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
keys: crate::StaticVec<crate::ImmutableString>,
|
imports: crate::StaticVec<ImmutableString>,
|
||||||
/// Stack of imported [modules][crate::Module].
|
/// Stack of imported [modules][crate::Module].
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
modules: crate::StaticVec<crate::Shared<crate::Module>>,
|
modules: crate::StaticVec<crate::SharedModule>,
|
||||||
/// Source of the current context.
|
/// Source of the current context.
|
||||||
///
|
///
|
||||||
/// No source if the string is empty.
|
/// No source if the string is empty.
|
||||||
pub source: Identifier,
|
pub source: Option<ImmutableString>,
|
||||||
/// Number of operations performed.
|
/// Number of operations performed.
|
||||||
pub num_operations: u64,
|
pub num_operations: u64,
|
||||||
/// Number of modules loaded.
|
/// Number of modules loaded.
|
||||||
|
#[cfg(not(feature = "no_module"))]
|
||||||
pub num_modules_loaded: usize,
|
pub num_modules_loaded: usize,
|
||||||
|
/// The current nesting level of function calls.
|
||||||
|
pub level: usize,
|
||||||
/// Level of the current scope.
|
/// Level of the current scope.
|
||||||
///
|
///
|
||||||
/// The global (root) level is zero, a new block (or function call) is one level higher, and so on.
|
/// The global (root) level is zero, a new block (or function call) is one level higher, and so on.
|
||||||
@ -69,24 +72,24 @@ pub struct GlobalRuntimeState<'a> {
|
|||||||
/// Debugging interface.
|
/// Debugging interface.
|
||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
pub debugger: super::Debugger,
|
pub debugger: super::Debugger,
|
||||||
/// Take care of the lifetime parameter.
|
|
||||||
dummy: PhantomData<&'a ()>,
|
|
||||||
}
|
}
|
||||||
|
|
||||||
impl GlobalRuntimeState<'_> {
|
impl GlobalRuntimeState {
|
||||||
/// Create a new [`GlobalRuntimeState`] based on an [`Engine`].
|
/// Create a new [`GlobalRuntimeState`] based on an [`Engine`].
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn new(engine: &Engine) -> Self {
|
pub fn new(engine: &Engine) -> Self {
|
||||||
Self {
|
Self {
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
keys: crate::StaticVec::new_const(),
|
imports: crate::StaticVec::new_const(),
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
modules: crate::StaticVec::new_const(),
|
modules: crate::StaticVec::new_const(),
|
||||||
source: Identifier::new_const(),
|
source: None,
|
||||||
num_operations: 0,
|
num_operations: 0,
|
||||||
|
#[cfg(not(feature = "no_module"))]
|
||||||
num_modules_loaded: 0,
|
num_modules_loaded: 0,
|
||||||
scope_level: 0,
|
scope_level: 0,
|
||||||
|
level: 0,
|
||||||
always_search_scope: false,
|
always_search_scope: false,
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
embedded_module_resolver: None,
|
embedded_module_resolver: None,
|
||||||
@ -105,14 +108,11 @@ impl GlobalRuntimeState<'_> {
|
|||||||
} else {
|
} else {
|
||||||
crate::eval::DebuggerStatus::CONTINUE
|
crate::eval::DebuggerStatus::CONTINUE
|
||||||
},
|
},
|
||||||
if let Some((ref init, ..)) = engine.debugger {
|
match engine.debugger {
|
||||||
init(engine)
|
Some((ref init, ..)) => init(engine),
|
||||||
} else {
|
None => Dynamic::UNIT,
|
||||||
Dynamic::UNIT
|
|
||||||
},
|
},
|
||||||
),
|
),
|
||||||
|
|
||||||
dummy: PhantomData::default(),
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
/// Get the length of the stack of globally-imported [modules][crate::Module].
|
/// Get the length of the stack of globally-imported [modules][crate::Module].
|
||||||
@ -122,7 +122,7 @@ impl GlobalRuntimeState<'_> {
|
|||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn num_imports(&self) -> usize {
|
pub fn num_imports(&self) -> usize {
|
||||||
self.keys.len()
|
self.modules.len()
|
||||||
}
|
}
|
||||||
/// Get the globally-imported [module][crate::Module] at a particular index.
|
/// Get the globally-imported [module][crate::Module] at a particular index.
|
||||||
///
|
///
|
||||||
@ -130,7 +130,7 @@ impl GlobalRuntimeState<'_> {
|
|||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn get_shared_import(&self, index: usize) -> Option<crate::Shared<crate::Module>> {
|
pub fn get_shared_import(&self, index: usize) -> Option<crate::SharedModule> {
|
||||||
self.modules.get(index).cloned()
|
self.modules.get(index).cloned()
|
||||||
}
|
}
|
||||||
/// Get a mutable reference to the globally-imported [module][crate::Module] at a
|
/// Get a mutable reference to the globally-imported [module][crate::Module] at a
|
||||||
@ -144,7 +144,7 @@ impl GlobalRuntimeState<'_> {
|
|||||||
pub(crate) fn get_shared_import_mut(
|
pub(crate) fn get_shared_import_mut(
|
||||||
&mut self,
|
&mut self,
|
||||||
index: usize,
|
index: usize,
|
||||||
) -> Option<&mut crate::Shared<crate::Module>> {
|
) -> Option<&mut crate::SharedModule> {
|
||||||
self.modules.get_mut(index)
|
self.modules.get_mut(index)
|
||||||
}
|
}
|
||||||
/// Get the index of a globally-imported [module][crate::Module] by name.
|
/// Get the index of a globally-imported [module][crate::Module] by name.
|
||||||
@ -154,13 +154,11 @@ impl GlobalRuntimeState<'_> {
|
|||||||
#[inline]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn find_import(&self, name: &str) -> Option<usize> {
|
pub fn find_import(&self, name: &str) -> Option<usize> {
|
||||||
let len = self.keys.len();
|
self.imports
|
||||||
|
|
||||||
self.keys
|
|
||||||
.iter()
|
.iter()
|
||||||
.rev()
|
.rev()
|
||||||
.position(|key| key.as_str() == name)
|
.position(|key| key.as_str() == name)
|
||||||
.map(|i| len - 1 - i)
|
.map(|i| self.imports.len() - 1 - i)
|
||||||
}
|
}
|
||||||
/// Push an imported [module][crate::Module] onto the stack.
|
/// Push an imported [module][crate::Module] onto the stack.
|
||||||
///
|
///
|
||||||
@ -169,10 +167,10 @@ impl GlobalRuntimeState<'_> {
|
|||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn push_import(
|
pub fn push_import(
|
||||||
&mut self,
|
&mut self,
|
||||||
name: impl Into<crate::ImmutableString>,
|
name: impl Into<ImmutableString>,
|
||||||
module: impl Into<crate::Shared<crate::Module>>,
|
module: impl Into<crate::SharedModule>,
|
||||||
) {
|
) {
|
||||||
self.keys.push(name.into());
|
self.imports.push(name.into());
|
||||||
self.modules.push(module.into());
|
self.modules.push(module.into());
|
||||||
}
|
}
|
||||||
/// Truncate the stack of globally-imported [modules][crate::Module] to a particular length.
|
/// Truncate the stack of globally-imported [modules][crate::Module] to a particular length.
|
||||||
@ -181,43 +179,51 @@ impl GlobalRuntimeState<'_> {
|
|||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn truncate_imports(&mut self, size: usize) {
|
pub fn truncate_imports(&mut self, size: usize) {
|
||||||
self.keys.truncate(size);
|
self.imports.truncate(size);
|
||||||
self.modules.truncate(size);
|
self.modules.truncate(size);
|
||||||
}
|
}
|
||||||
/// Get an iterator to the stack of globally-imported [modules][crate::Module] in reverse order.
|
/// Get an iterator to the stack of globally-imported [modules][crate::Module] in reverse order.
|
||||||
///
|
///
|
||||||
/// Not available under `no_module`.
|
/// Not available under `no_module`.
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
#[allow(dead_code)]
|
|
||||||
#[inline]
|
#[inline]
|
||||||
pub fn iter_imports(&self) -> impl Iterator<Item = (&str, &crate::Module)> {
|
pub fn iter_imports(&self) -> impl Iterator<Item = (&str, &crate::Module)> {
|
||||||
self.keys
|
self.imports
|
||||||
.iter()
|
.iter()
|
||||||
|
.zip(self.modules.iter())
|
||||||
.rev()
|
.rev()
|
||||||
.zip(self.modules.iter().rev())
|
|
||||||
.map(|(name, module)| (name.as_str(), &**module))
|
.map(|(name, module)| (name.as_str(), &**module))
|
||||||
}
|
}
|
||||||
/// Get an iterator to the stack of globally-imported [modules][crate::Module] in reverse order.
|
/// Get an iterator to the stack of globally-imported [modules][crate::Module] in reverse order.
|
||||||
///
|
///
|
||||||
/// Not available under `no_module`.
|
/// Not available under `no_module`.
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
#[allow(dead_code)]
|
|
||||||
#[inline]
|
#[inline]
|
||||||
pub(crate) fn iter_imports_raw(
|
pub(crate) fn iter_imports_raw(
|
||||||
&self,
|
&self,
|
||||||
) -> impl Iterator<Item = (&crate::ImmutableString, &crate::Shared<crate::Module>)> {
|
) -> impl Iterator<Item = (&ImmutableString, &crate::SharedModule)> {
|
||||||
self.keys.iter().rev().zip(self.modules.iter().rev())
|
self.imports.iter().zip(self.modules.iter()).rev()
|
||||||
}
|
}
|
||||||
/// Get an iterator to the stack of globally-imported [modules][crate::Module] in forward order.
|
/// Get an iterator to the stack of globally-imported [modules][crate::Module] in forward order.
|
||||||
///
|
///
|
||||||
/// Not available under `no_module`.
|
/// Not available under `no_module`.
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
#[allow(dead_code)]
|
|
||||||
#[inline]
|
#[inline]
|
||||||
pub fn scan_imports_raw(
|
pub fn scan_imports_raw(
|
||||||
&self,
|
&self,
|
||||||
) -> impl Iterator<Item = (&crate::ImmutableString, &crate::Shared<crate::Module>)> {
|
) -> impl Iterator<Item = (&ImmutableString, &crate::SharedModule)> {
|
||||||
self.keys.iter().zip(self.modules.iter())
|
self.imports.iter().zip(self.modules.iter())
|
||||||
|
}
|
||||||
|
/// Can the particular function with [`Dynamic`] parameter(s) exist in the stack of
|
||||||
|
/// globally-imported [modules][crate::Module]?
|
||||||
|
///
|
||||||
|
/// Not available under `no_module`.
|
||||||
|
#[cfg(not(feature = "no_module"))]
|
||||||
|
#[inline(always)]
|
||||||
|
pub(crate) fn may_contain_dynamic_fn(&self, hash_script: u64) -> bool {
|
||||||
|
self.modules
|
||||||
|
.iter()
|
||||||
|
.any(|m| m.may_contain_dynamic_fn(hash_script))
|
||||||
}
|
}
|
||||||
/// Does the specified function hash key exist in the stack of globally-imported
|
/// Does the specified function hash key exist in the stack of globally-imported
|
||||||
/// [modules][crate::Module]?
|
/// [modules][crate::Module]?
|
||||||
@ -240,11 +246,11 @@ impl GlobalRuntimeState<'_> {
|
|||||||
pub fn get_qualified_fn(
|
pub fn get_qualified_fn(
|
||||||
&self,
|
&self,
|
||||||
hash: u64,
|
hash: u64,
|
||||||
) -> Option<(&crate::func::CallableFunction, Option<&str>)> {
|
) -> Option<(&crate::func::CallableFunction, Option<&ImmutableString>)> {
|
||||||
self.modules
|
self.modules
|
||||||
.iter()
|
.iter()
|
||||||
.rev()
|
.rev()
|
||||||
.find_map(|m| m.get_qualified_fn(hash).map(|f| (f, m.id())))
|
.find_map(|m| m.get_qualified_fn(hash).map(|f| (f, m.id_raw())))
|
||||||
}
|
}
|
||||||
/// Does the specified [`TypeId`][std::any::TypeId] iterator exist in the stack of
|
/// Does the specified [`TypeId`][std::any::TypeId] iterator exist in the stack of
|
||||||
/// globally-imported [modules][crate::Module]?
|
/// globally-imported [modules][crate::Module]?
|
||||||
@ -271,14 +277,17 @@ impl GlobalRuntimeState<'_> {
|
|||||||
.find_map(|m| m.get_qualified_iter(id))
|
.find_map(|m| m.get_qualified_iter(id))
|
||||||
}
|
}
|
||||||
/// Get the current source.
|
/// Get the current source.
|
||||||
#[inline]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn source(&self) -> Option<&str> {
|
pub fn source(&self) -> Option<&str> {
|
||||||
if self.source.is_empty() {
|
self.source.as_ref().map(|s| s.as_str())
|
||||||
None
|
|
||||||
} else {
|
|
||||||
Some(self.source.as_str())
|
|
||||||
}
|
}
|
||||||
|
/// Get the current source.
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
#[allow(dead_code)]
|
||||||
|
pub(crate) const fn source_raw(&self) -> Option<&ImmutableString> {
|
||||||
|
self.source.as_ref()
|
||||||
}
|
}
|
||||||
/// Get the pre-calculated index getter hash.
|
/// Get the pre-calculated index getter hash.
|
||||||
#[cfg(any(not(feature = "no_index"), not(feature = "no_object")))]
|
#[cfg(any(not(feature = "no_index"), not(feature = "no_object")))]
|
||||||
@ -309,67 +318,64 @@ impl GlobalRuntimeState<'_> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
impl IntoIterator for GlobalRuntimeState<'_> {
|
impl IntoIterator for GlobalRuntimeState {
|
||||||
type Item = (crate::ImmutableString, crate::Shared<crate::Module>);
|
type Item = (ImmutableString, crate::SharedModule);
|
||||||
type IntoIter = std::iter::Zip<
|
type IntoIter = std::iter::Rev<
|
||||||
std::iter::Rev<smallvec::IntoIter<[crate::ImmutableString; 3]>>,
|
std::iter::Zip<
|
||||||
std::iter::Rev<smallvec::IntoIter<[crate::Shared<crate::Module>; 3]>>,
|
smallvec::IntoIter<[ImmutableString; crate::STATIC_VEC_INLINE_SIZE]>,
|
||||||
|
smallvec::IntoIter<[crate::SharedModule; crate::STATIC_VEC_INLINE_SIZE]>,
|
||||||
|
>,
|
||||||
>;
|
>;
|
||||||
|
|
||||||
#[inline]
|
|
||||||
fn into_iter(self) -> Self::IntoIter {
|
fn into_iter(self) -> Self::IntoIter {
|
||||||
self.keys
|
self.imports.into_iter().zip(self.modules.into_iter()).rev()
|
||||||
.into_iter()
|
|
||||||
.rev()
|
|
||||||
.zip(self.modules.into_iter().rev())
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
impl<'a> IntoIterator for &'a GlobalRuntimeState<'_> {
|
impl<'a> IntoIterator for &'a GlobalRuntimeState {
|
||||||
type Item = (&'a crate::ImmutableString, &'a crate::Shared<crate::Module>);
|
type Item = (&'a ImmutableString, &'a crate::SharedModule);
|
||||||
type IntoIter = std::iter::Zip<
|
type IntoIter = std::iter::Rev<
|
||||||
std::iter::Rev<std::slice::Iter<'a, crate::ImmutableString>>,
|
std::iter::Zip<
|
||||||
std::iter::Rev<std::slice::Iter<'a, crate::Shared<crate::Module>>>,
|
std::slice::Iter<'a, ImmutableString>,
|
||||||
|
std::slice::Iter<'a, crate::SharedModule>,
|
||||||
|
>,
|
||||||
>;
|
>;
|
||||||
|
|
||||||
#[inline]
|
|
||||||
fn into_iter(self) -> Self::IntoIter {
|
fn into_iter(self) -> Self::IntoIter {
|
||||||
let x = self.keys.iter().rev().zip(self.modules.iter().rev());
|
self.imports.iter().zip(self.modules.iter()).rev()
|
||||||
x
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
impl<K: Into<crate::ImmutableString>, M: Into<crate::Shared<crate::Module>>> Extend<(K, M)>
|
impl<K: Into<ImmutableString>, M: Into<crate::SharedModule>> Extend<(K, M)> for GlobalRuntimeState {
|
||||||
for GlobalRuntimeState<'_>
|
|
||||||
{
|
|
||||||
#[inline]
|
#[inline]
|
||||||
fn extend<T: IntoIterator<Item = (K, M)>>(&mut self, iter: T) {
|
fn extend<T: IntoIterator<Item = (K, M)>>(&mut self, iter: T) {
|
||||||
for (k, m) in iter {
|
for (k, m) in iter {
|
||||||
self.keys.push(k.into());
|
self.imports.push(k.into());
|
||||||
self.modules.push(m.into());
|
self.modules.push(m.into());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl fmt::Debug for GlobalRuntimeState<'_> {
|
impl fmt::Debug for GlobalRuntimeState {
|
||||||
#[inline]
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
let mut f = f.debug_struct("GlobalRuntimeState");
|
let mut f = f.debug_struct("GlobalRuntimeState");
|
||||||
|
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
f.field("imports", &self.keys.iter().zip(self.modules.iter()));
|
f.field("imports", &self.scan_imports_raw().collect::<Vec<_>>());
|
||||||
|
|
||||||
f.field("source", &self.source)
|
f.field("source", &self.source)
|
||||||
.field("num_operations", &self.num_operations)
|
.field("num_operations", &self.num_operations);
|
||||||
.field("num_modules_loaded", &self.num_modules_loaded);
|
|
||||||
|
|
||||||
#[cfg(any(not(feature = "no_index"), not(feature = "no_object")))]
|
#[cfg(any(not(feature = "no_index"), not(feature = "no_object")))]
|
||||||
f.field("fn_hash_indexing", &self.fn_hash_indexing);
|
f.field("fn_hash_indexing", &self.fn_hash_indexing);
|
||||||
|
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
f.field("embedded_module_resolver", &self.embedded_module_resolver);
|
f.field("num_modules_loaded", &self.num_modules_loaded)
|
||||||
|
.field("embedded_module_resolver", &self.embedded_module_resolver);
|
||||||
|
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
|
@ -22,3 +22,36 @@ pub use eval_context::EvalContext;
|
|||||||
pub use global_state::GlobalConstants;
|
pub use global_state::GlobalConstants;
|
||||||
pub use global_state::GlobalRuntimeState;
|
pub use global_state::GlobalRuntimeState;
|
||||||
pub use target::{calc_index, calc_offset_len, Target};
|
pub use target::{calc_index, calc_offset_len, Target};
|
||||||
|
|
||||||
|
#[cfg(feature = "unchecked")]
|
||||||
|
mod unchecked {
|
||||||
|
use crate::{eval::GlobalRuntimeState, Dynamic, Engine, Position, RhaiResult, RhaiResultOf};
|
||||||
|
|
||||||
|
impl Engine {
|
||||||
|
/// Check if the number of operations stay within limit.
|
||||||
|
#[inline(always)]
|
||||||
|
pub(crate) const fn track_operation(
|
||||||
|
&self,
|
||||||
|
_: &GlobalRuntimeState,
|
||||||
|
_: Position,
|
||||||
|
) -> RhaiResultOf<()> {
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Check whether the size of a [`Dynamic`] is within limits.
|
||||||
|
#[inline(always)]
|
||||||
|
pub(crate) const fn check_data_size(&self, _: &Dynamic, _: Position) -> RhaiResultOf<()> {
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Check a result to ensure that it is valid.
|
||||||
|
#[inline(always)]
|
||||||
|
pub(crate) const fn check_return_value(
|
||||||
|
&self,
|
||||||
|
result: RhaiResult,
|
||||||
|
_: Position,
|
||||||
|
) -> RhaiResult {
|
||||||
|
result
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
748
src/eval/stmt.rs
748
src/eval/stmt.rs
File diff suppressed because it is too large
Load Diff
@ -2,9 +2,12 @@
|
|||||||
|
|
||||||
use crate::types::dynamic::Variant;
|
use crate::types::dynamic::Variant;
|
||||||
use crate::{Dynamic, Position, RhaiResultOf};
|
use crate::{Dynamic, Position, RhaiResultOf};
|
||||||
use std::ops::{Deref, DerefMut};
|
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
|
use std::{
|
||||||
|
borrow::Borrow,
|
||||||
|
ops::{Deref, DerefMut},
|
||||||
|
};
|
||||||
|
|
||||||
// Calculate an offset+len pair given an actual length of the underlying array.
|
// Calculate an offset+len pair given an actual length of the underlying array.
|
||||||
//
|
//
|
||||||
@ -416,11 +419,20 @@ impl Deref for Target<'_> {
|
|||||||
|
|
||||||
impl AsRef<Dynamic> for Target<'_> {
|
impl AsRef<Dynamic> for Target<'_> {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn as_ref(&self) -> &Dynamic {
|
fn as_ref(&self) -> &Dynamic {
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl Borrow<Dynamic> for Target<'_> {
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
fn borrow(&self) -> &Dynamic {
|
||||||
|
self
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
impl DerefMut for Target<'_> {
|
impl DerefMut for Target<'_> {
|
||||||
#[inline]
|
#[inline]
|
||||||
fn deref_mut(&mut self) -> &mut Dynamic {
|
fn deref_mut(&mut self) -> &mut Dynamic {
|
||||||
@ -440,6 +452,7 @@ impl DerefMut for Target<'_> {
|
|||||||
|
|
||||||
impl AsMut<Dynamic> for Target<'_> {
|
impl AsMut<Dynamic> for Target<'_> {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn as_mut(&mut self) -> &mut Dynamic {
|
fn as_mut(&mut self) -> &mut Dynamic {
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
@ -2,8 +2,10 @@
|
|||||||
|
|
||||||
use super::call::FnCallArgs;
|
use super::call::FnCallArgs;
|
||||||
use super::native::FnBuiltin;
|
use super::native::FnBuiltin;
|
||||||
use crate::engine::OP_CONTAINS;
|
use crate::tokenizer::{Token, Token::*};
|
||||||
use crate::{Dynamic, ExclusiveRange, ImmutableString, InclusiveRange, INT};
|
use crate::{
|
||||||
|
Dynamic, ExclusiveRange, ImmutableString, InclusiveRange, NativeCallContext, RhaiResult, INT,
|
||||||
|
};
|
||||||
use std::any::TypeId;
|
use std::any::TypeId;
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
@ -63,11 +65,24 @@ fn is_numeric(type_id: TypeId) -> bool {
|
|||||||
false
|
false
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// A function that returns `true`.
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
fn const_true_fn(_: NativeCallContext, _: &mut [&mut Dynamic]) -> RhaiResult {
|
||||||
|
Ok(Dynamic::TRUE)
|
||||||
|
}
|
||||||
|
/// A function that returns `false`.
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
fn const_false_fn(_: NativeCallContext, _: &mut [&mut Dynamic]) -> RhaiResult {
|
||||||
|
Ok(Dynamic::FALSE)
|
||||||
|
}
|
||||||
|
|
||||||
/// Build in common binary operator implementations to avoid the cost of calling a registered function.
|
/// Build in common binary operator implementations to avoid the cost of calling a registered function.
|
||||||
///
|
///
|
||||||
/// The return function will be registered as a _method_, so the first parameter cannot be consumed.
|
/// The return function will be registered as a _method_, so the first parameter cannot be consumed.
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn get_builtin_binary_op_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<FnBuiltin> {
|
pub fn get_builtin_binary_op_fn(op: &Token, x: &Dynamic, y: &Dynamic) -> Option<FnBuiltin> {
|
||||||
let type1 = x.type_id();
|
let type1 = x.type_id();
|
||||||
let type2 = y.type_id();
|
let type2 = y.type_id();
|
||||||
|
|
||||||
@ -131,46 +146,46 @@ pub fn get_builtin_binary_op_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<Fn
|
|||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
#[cfg(not(feature = "unchecked"))]
|
||||||
match op {
|
match op {
|
||||||
"+" => return Some(impl_op!(INT => add(as_int, as_int))),
|
Plus => return Some(impl_op!(INT => add(as_int, as_int))),
|
||||||
"-" => return Some(impl_op!(INT => subtract(as_int, as_int))),
|
Minus => return Some(impl_op!(INT => subtract(as_int, as_int))),
|
||||||
"*" => return Some(impl_op!(INT => multiply(as_int, as_int))),
|
Multiply => return Some(impl_op!(INT => multiply(as_int, as_int))),
|
||||||
"/" => return Some(impl_op!(INT => divide(as_int, as_int))),
|
Divide => return Some(impl_op!(INT => divide(as_int, as_int))),
|
||||||
"%" => return Some(impl_op!(INT => modulo(as_int, as_int))),
|
Modulo => return Some(impl_op!(INT => modulo(as_int, as_int))),
|
||||||
"**" => return Some(impl_op!(INT => power(as_int, as_int))),
|
PowerOf => return Some(impl_op!(INT => power(as_int, as_int))),
|
||||||
">>" => return Some(impl_op!(INT => shift_right(as_int, as_int))),
|
RightShift => return Some(impl_op!(INT => shift_right(as_int, as_int))),
|
||||||
"<<" => return Some(impl_op!(INT => shift_left(as_int, as_int))),
|
LeftShift => return Some(impl_op!(INT => shift_left(as_int, as_int))),
|
||||||
_ => (),
|
_ => (),
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(feature = "unchecked")]
|
#[cfg(feature = "unchecked")]
|
||||||
match op {
|
match op {
|
||||||
"+" => return Some(impl_op!(INT => as_int + as_int)),
|
Plus => return Some(impl_op!(INT => as_int + as_int)),
|
||||||
"-" => return Some(impl_op!(INT => as_int - as_int)),
|
Minus => return Some(impl_op!(INT => as_int - as_int)),
|
||||||
"*" => return Some(impl_op!(INT => as_int * as_int)),
|
Multiply => return Some(impl_op!(INT => as_int * as_int)),
|
||||||
"/" => return Some(impl_op!(INT => as_int / as_int)),
|
Divide => return Some(impl_op!(INT => as_int / as_int)),
|
||||||
"%" => return Some(impl_op!(INT => as_int % as_int)),
|
Modulo => return Some(impl_op!(INT => as_int % as_int)),
|
||||||
"**" => return Some(impl_op!(INT => as_int.pow(as_int as u32))),
|
PowerOf => return Some(impl_op!(INT => as_int.pow(as_int as u32))),
|
||||||
">>" => return Some(impl_op!(INT => as_int >> as_int)),
|
RightShift => return Some(impl_op!(INT => as_int >> as_int)),
|
||||||
"<<" => return Some(impl_op!(INT => as_int << as_int)),
|
LeftShift => return Some(impl_op!(INT => as_int << as_int)),
|
||||||
_ => (),
|
_ => (),
|
||||||
}
|
}
|
||||||
|
|
||||||
return match op {
|
return match op {
|
||||||
"==" => Some(impl_op!(INT => as_int == as_int)),
|
EqualsTo => Some(impl_op!(INT => as_int == as_int)),
|
||||||
"!=" => Some(impl_op!(INT => as_int != as_int)),
|
NotEqualsTo => Some(impl_op!(INT => as_int != as_int)),
|
||||||
">" => Some(impl_op!(INT => as_int > as_int)),
|
GreaterThan => Some(impl_op!(INT => as_int > as_int)),
|
||||||
">=" => Some(impl_op!(INT => as_int >= as_int)),
|
GreaterThanEqualsTo => Some(impl_op!(INT => as_int >= as_int)),
|
||||||
"<" => Some(impl_op!(INT => as_int < as_int)),
|
LessThan => Some(impl_op!(INT => as_int < as_int)),
|
||||||
"<=" => Some(impl_op!(INT => as_int <= as_int)),
|
LessThanEqualsTo => Some(impl_op!(INT => as_int <= as_int)),
|
||||||
"&" => Some(impl_op!(INT => as_int & as_int)),
|
Ampersand => Some(impl_op!(INT => as_int & as_int)),
|
||||||
"|" => Some(impl_op!(INT => as_int | as_int)),
|
Pipe => Some(impl_op!(INT => as_int | as_int)),
|
||||||
"^" => Some(impl_op!(INT => as_int ^ as_int)),
|
XOr => Some(impl_op!(INT => as_int ^ as_int)),
|
||||||
".." => Some(|_, args| {
|
ExclusiveRange => Some(|_, args| {
|
||||||
let x = args[0].as_int().expect(BUILTIN);
|
let x = args[0].as_int().expect(BUILTIN);
|
||||||
let y = args[1].as_int().expect(BUILTIN);
|
let y = args[1].as_int().expect(BUILTIN);
|
||||||
Ok((x..y).into())
|
Ok((x..y).into())
|
||||||
}),
|
}),
|
||||||
"..=" => Some(|_, args| {
|
InclusiveRange => Some(|_, args| {
|
||||||
let x = args[0].as_int().expect(BUILTIN);
|
let x = args[0].as_int().expect(BUILTIN);
|
||||||
let y = args[1].as_int().expect(BUILTIN);
|
let y = args[1].as_int().expect(BUILTIN);
|
||||||
Ok((x..=y).into())
|
Ok((x..=y).into())
|
||||||
@ -181,47 +196,65 @@ pub fn get_builtin_binary_op_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<Fn
|
|||||||
|
|
||||||
if type1 == TypeId::of::<bool>() {
|
if type1 == TypeId::of::<bool>() {
|
||||||
return match op {
|
return match op {
|
||||||
"==" => Some(impl_op!(bool => as_bool == as_bool)),
|
EqualsTo => Some(impl_op!(bool => as_bool == as_bool)),
|
||||||
"!=" => Some(impl_op!(bool => as_bool != as_bool)),
|
NotEqualsTo => Some(impl_op!(bool => as_bool != as_bool)),
|
||||||
">" => Some(impl_op!(bool => as_bool > as_bool)),
|
GreaterThan => Some(impl_op!(bool => as_bool > as_bool)),
|
||||||
">=" => Some(impl_op!(bool => as_bool >= as_bool)),
|
GreaterThanEqualsTo => Some(impl_op!(bool => as_bool >= as_bool)),
|
||||||
"<" => Some(impl_op!(bool => as_bool < as_bool)),
|
LessThan => Some(impl_op!(bool => as_bool < as_bool)),
|
||||||
"<=" => Some(impl_op!(bool => as_bool <= as_bool)),
|
LessThanEqualsTo => Some(impl_op!(bool => as_bool <= as_bool)),
|
||||||
"&" => Some(impl_op!(bool => as_bool & as_bool)),
|
Ampersand => Some(impl_op!(bool => as_bool & as_bool)),
|
||||||
"|" => Some(impl_op!(bool => as_bool | as_bool)),
|
Pipe => Some(impl_op!(bool => as_bool | as_bool)),
|
||||||
"^" => Some(impl_op!(bool => as_bool ^ as_bool)),
|
XOr => Some(impl_op!(bool => as_bool ^ as_bool)),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
if type1 == TypeId::of::<ImmutableString>() {
|
if type1 == TypeId::of::<ImmutableString>() {
|
||||||
return match op {
|
return match op {
|
||||||
"+" => Some(impl_op!(ImmutableString + ImmutableString)),
|
Plus => Some(|_ctx, args| {
|
||||||
"-" => Some(impl_op!(ImmutableString - ImmutableString)),
|
let s1 = &*args[0].read_lock::<ImmutableString>().expect(BUILTIN);
|
||||||
"==" => Some(impl_op!(ImmutableString == ImmutableString)),
|
let s2 = &*args[1].read_lock::<ImmutableString>().expect(BUILTIN);
|
||||||
"!=" => Some(impl_op!(ImmutableString != ImmutableString)),
|
|
||||||
">" => Some(impl_op!(ImmutableString > ImmutableString)),
|
#[cfg(not(feature = "unchecked"))]
|
||||||
">=" => Some(impl_op!(ImmutableString >= ImmutableString)),
|
if !s1.is_empty() && !s2.is_empty() {
|
||||||
"<" => Some(impl_op!(ImmutableString < ImmutableString)),
|
let total_len = s1.len() + s2.len();
|
||||||
"<=" => Some(impl_op!(ImmutableString <= ImmutableString)),
|
_ctx.engine()
|
||||||
OP_CONTAINS => Some(impl_op!(ImmutableString.contains(ImmutableString.as_str()))),
|
.raise_err_if_over_data_size_limit((0, 0, total_len))?;
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok((s1 + s2).into())
|
||||||
|
}),
|
||||||
|
Minus => Some(impl_op!(ImmutableString - ImmutableString)),
|
||||||
|
EqualsTo => Some(impl_op!(ImmutableString == ImmutableString)),
|
||||||
|
NotEqualsTo => Some(impl_op!(ImmutableString != ImmutableString)),
|
||||||
|
GreaterThan => Some(impl_op!(ImmutableString > ImmutableString)),
|
||||||
|
GreaterThanEqualsTo => Some(impl_op!(ImmutableString >= ImmutableString)),
|
||||||
|
LessThan => Some(impl_op!(ImmutableString < ImmutableString)),
|
||||||
|
LessThanEqualsTo => Some(impl_op!(ImmutableString <= ImmutableString)),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
if type1 == TypeId::of::<char>() {
|
if type1 == TypeId::of::<char>() {
|
||||||
return match op {
|
return match op {
|
||||||
"+" => Some(|_, args| {
|
Plus => Some(|_ctx, args| {
|
||||||
let x = args[0].as_char().expect(BUILTIN);
|
let x = args[0].as_char().expect(BUILTIN);
|
||||||
let y = args[1].as_char().expect(BUILTIN);
|
let y = args[1].as_char().expect(BUILTIN);
|
||||||
Ok(format!("{x}{y}").into())
|
|
||||||
|
let result = format!("{x}{y}");
|
||||||
|
|
||||||
|
#[cfg(not(feature = "unchecked"))]
|
||||||
|
_ctx.engine()
|
||||||
|
.raise_err_if_over_data_size_limit((0, 0, result.len()))?;
|
||||||
|
|
||||||
|
Ok(result.into())
|
||||||
}),
|
}),
|
||||||
"==" => Some(impl_op!(char => as_char == as_char)),
|
EqualsTo => Some(impl_op!(char => as_char == as_char)),
|
||||||
"!=" => Some(impl_op!(char => as_char != as_char)),
|
NotEqualsTo => Some(impl_op!(char => as_char != as_char)),
|
||||||
">" => Some(impl_op!(char => as_char > as_char)),
|
GreaterThan => Some(impl_op!(char => as_char > as_char)),
|
||||||
">=" => Some(impl_op!(char => as_char >= as_char)),
|
GreaterThanEqualsTo => Some(impl_op!(char => as_char >= as_char)),
|
||||||
"<" => Some(impl_op!(char => as_char < as_char)),
|
LessThan => Some(impl_op!(char => as_char < as_char)),
|
||||||
"<=" => Some(impl_op!(char => as_char <= as_char)),
|
LessThanEqualsTo => Some(impl_op!(char => as_char <= as_char)),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
@ -231,7 +264,7 @@ pub fn get_builtin_binary_op_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<Fn
|
|||||||
use crate::Blob;
|
use crate::Blob;
|
||||||
|
|
||||||
return match op {
|
return match op {
|
||||||
"+" => Some(|_, args| {
|
Plus => Some(|_ctx, args| {
|
||||||
let blob1 = &*args[0].read_lock::<Blob>().expect(BUILTIN);
|
let blob1 = &*args[0].read_lock::<Blob>().expect(BUILTIN);
|
||||||
let blob2 = &*args[1].read_lock::<Blob>().expect(BUILTIN);
|
let blob2 = &*args[1].read_lock::<Blob>().expect(BUILTIN);
|
||||||
|
|
||||||
@ -240,21 +273,30 @@ pub fn get_builtin_binary_op_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<Fn
|
|||||||
} else if blob1.is_empty() {
|
} else if blob1.is_empty() {
|
||||||
blob2.clone()
|
blob2.clone()
|
||||||
} else {
|
} else {
|
||||||
|
#[cfg(not(feature = "unchecked"))]
|
||||||
|
_ctx.engine().raise_err_if_over_data_size_limit((
|
||||||
|
blob1.len() + blob2.len(),
|
||||||
|
0,
|
||||||
|
0,
|
||||||
|
))?;
|
||||||
|
|
||||||
let mut blob = blob1.clone();
|
let mut blob = blob1.clone();
|
||||||
blob.extend(blob2);
|
blob.extend(blob2);
|
||||||
blob
|
blob
|
||||||
}))
|
}))
|
||||||
}),
|
}),
|
||||||
"==" => Some(impl_op!(Blob == Blob)),
|
EqualsTo => Some(impl_op!(Blob == Blob)),
|
||||||
"!=" => Some(impl_op!(Blob != Blob)),
|
NotEqualsTo => Some(impl_op!(Blob != Blob)),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
if type1 == TypeId::of::<()>() {
|
if type1 == TypeId::of::<()>() {
|
||||||
return match op {
|
return match op {
|
||||||
"==" => Some(|_, _| Ok(Dynamic::TRUE)),
|
EqualsTo => Some(const_true_fn),
|
||||||
"!=" | ">" | ">=" | "<" | "<=" => Some(|_, _| Ok(Dynamic::FALSE)),
|
NotEqualsTo | GreaterThan | GreaterThanEqualsTo | LessThan | LessThanEqualsTo => {
|
||||||
|
Some(const_false_fn)
|
||||||
|
}
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
@ -265,18 +307,18 @@ pub fn get_builtin_binary_op_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<Fn
|
|||||||
($x:ty, $xx:ident, $y:ty, $yy:ident) => {
|
($x:ty, $xx:ident, $y:ty, $yy:ident) => {
|
||||||
if (type1, type2) == (TypeId::of::<$x>(), TypeId::of::<$y>()) {
|
if (type1, type2) == (TypeId::of::<$x>(), TypeId::of::<$y>()) {
|
||||||
return match op {
|
return match op {
|
||||||
"+" => Some(impl_op!(FLOAT => $xx + $yy)),
|
Plus => Some(impl_op!(FLOAT => $xx + $yy)),
|
||||||
"-" => Some(impl_op!(FLOAT => $xx - $yy)),
|
Minus => Some(impl_op!(FLOAT => $xx - $yy)),
|
||||||
"*" => Some(impl_op!(FLOAT => $xx * $yy)),
|
Multiply => Some(impl_op!(FLOAT => $xx * $yy)),
|
||||||
"/" => Some(impl_op!(FLOAT => $xx / $yy)),
|
Divide => Some(impl_op!(FLOAT => $xx / $yy)),
|
||||||
"%" => Some(impl_op!(FLOAT => $xx % $yy)),
|
Modulo => Some(impl_op!(FLOAT => $xx % $yy)),
|
||||||
"**" => Some(impl_op!(FLOAT => $xx.powf($yy as FLOAT))),
|
PowerOf => Some(impl_op!(FLOAT => $xx.powf($yy as FLOAT))),
|
||||||
"==" => Some(impl_op!(FLOAT => $xx == $yy)),
|
EqualsTo => Some(impl_op!(FLOAT => $xx == $yy)),
|
||||||
"!=" => Some(impl_op!(FLOAT => $xx != $yy)),
|
NotEqualsTo => Some(impl_op!(FLOAT => $xx != $yy)),
|
||||||
">" => Some(impl_op!(FLOAT => $xx > $yy)),
|
GreaterThan => Some(impl_op!(FLOAT => $xx > $yy)),
|
||||||
">=" => Some(impl_op!(FLOAT => $xx >= $yy)),
|
GreaterThanEqualsTo => Some(impl_op!(FLOAT => $xx >= $yy)),
|
||||||
"<" => Some(impl_op!(FLOAT => $xx < $yy)),
|
LessThan => Some(impl_op!(FLOAT => $xx < $yy)),
|
||||||
"<=" => Some(impl_op!(FLOAT => $xx <= $yy)),
|
LessThanEqualsTo => Some(impl_op!(FLOAT => $xx <= $yy)),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
@ -295,16 +337,16 @@ pub fn get_builtin_binary_op_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<Fn
|
|||||||
($x:ty, $xx:ident, $y:ty, $yy:ident) => {
|
($x:ty, $xx:ident, $y:ty, $yy:ident) => {
|
||||||
if (type1, type2) == (TypeId::of::<$x>(), TypeId::of::<$y>()) {
|
if (type1, type2) == (TypeId::of::<$x>(), TypeId::of::<$y>()) {
|
||||||
#[cfg(not(feature = "unchecked"))]
|
#[cfg(not(feature = "unchecked"))]
|
||||||
use crate::packages::arithmetic::decimal_functions::*;
|
use crate::packages::arithmetic::decimal_functions::builtin::*;
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
#[cfg(not(feature = "unchecked"))]
|
||||||
match op {
|
match op {
|
||||||
"+" => return Some(impl_op!(from Decimal => add($xx, $yy))),
|
Plus => return Some(impl_op!(from Decimal => add($xx, $yy))),
|
||||||
"-" => return Some(impl_op!(from Decimal => subtract($xx, $yy))),
|
Minus => return Some(impl_op!(from Decimal => subtract($xx, $yy))),
|
||||||
"*" => return Some(impl_op!(from Decimal => multiply($xx, $yy))),
|
Multiply => return Some(impl_op!(from Decimal => multiply($xx, $yy))),
|
||||||
"/" => return Some(impl_op!(from Decimal => divide($xx, $yy))),
|
Divide => return Some(impl_op!(from Decimal => divide($xx, $yy))),
|
||||||
"%" => return Some(impl_op!(from Decimal => modulo($xx, $yy))),
|
Modulo => return Some(impl_op!(from Decimal => modulo($xx, $yy))),
|
||||||
"**" => return Some(impl_op!(from Decimal => power($xx, $yy))),
|
PowerOf => return Some(impl_op!(from Decimal => power($xx, $yy))),
|
||||||
_ => ()
|
_ => ()
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -313,22 +355,22 @@ pub fn get_builtin_binary_op_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<Fn
|
|||||||
|
|
||||||
#[cfg(feature = "unchecked")]
|
#[cfg(feature = "unchecked")]
|
||||||
match op {
|
match op {
|
||||||
"+" => return Some(impl_op!(from Decimal => $xx + $yy)),
|
Plus => return Some(impl_op!(from Decimal => $xx + $yy)),
|
||||||
"-" => return Some(impl_op!(from Decimal => $xx - $yy)),
|
Minus => return Some(impl_op!(from Decimal => $xx - $yy)),
|
||||||
"*" => return Some(impl_op!(from Decimal => $xx * $yy)),
|
Multiply => return Some(impl_op!(from Decimal => $xx * $yy)),
|
||||||
"/" => return Some(impl_op!(from Decimal => $xx / $yy)),
|
Divide => return Some(impl_op!(from Decimal => $xx / $yy)),
|
||||||
"%" => return Some(impl_op!(from Decimal => $xx % $yy)),
|
Modulo => return Some(impl_op!(from Decimal => $xx % $yy)),
|
||||||
"**" => return Some(impl_op!(from Decimal => $xx.powd($yy))),
|
PowerOf => return Some(impl_op!(from Decimal => $xx.powd($yy))),
|
||||||
_ => ()
|
_ => ()
|
||||||
}
|
}
|
||||||
|
|
||||||
return match op {
|
return match op {
|
||||||
"==" => Some(impl_op!(from Decimal => $xx == $yy)),
|
EqualsTo => Some(impl_op!(from Decimal => $xx == $yy)),
|
||||||
"!=" => Some(impl_op!(from Decimal => $xx != $yy)),
|
NotEqualsTo => Some(impl_op!(from Decimal => $xx != $yy)),
|
||||||
">" => Some(impl_op!(from Decimal => $xx > $yy)),
|
GreaterThan => Some(impl_op!(from Decimal => $xx > $yy)),
|
||||||
">=" => Some(impl_op!(from Decimal => $xx >= $yy)),
|
GreaterThanEqualsTo => Some(impl_op!(from Decimal => $xx >= $yy)),
|
||||||
"<" => Some(impl_op!(from Decimal => $xx < $yy)),
|
LessThan => Some(impl_op!(from Decimal => $xx < $yy)),
|
||||||
"<=" => Some(impl_op!(from Decimal => $xx <= $yy)),
|
LessThanEqualsTo => Some(impl_op!(from Decimal => $xx <= $yy)),
|
||||||
_ => None
|
_ => None
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
@ -354,17 +396,23 @@ pub fn get_builtin_binary_op_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<Fn
|
|||||||
}
|
}
|
||||||
|
|
||||||
return match op {
|
return match op {
|
||||||
"+" => Some(|_, args| {
|
Plus => Some(|_ctx, args| {
|
||||||
let x = args[0].as_char().expect(BUILTIN);
|
let x = args[0].as_char().expect(BUILTIN);
|
||||||
let y = &*args[1].read_lock::<ImmutableString>().expect(BUILTIN);
|
let y = &*args[1].read_lock::<ImmutableString>().expect(BUILTIN);
|
||||||
Ok(format!("{x}{y}").into())
|
let result = format!("{x}{y}");
|
||||||
|
|
||||||
|
#[cfg(not(feature = "unchecked"))]
|
||||||
|
_ctx.engine()
|
||||||
|
.raise_err_if_over_data_size_limit((0, 0, result.len()))?;
|
||||||
|
|
||||||
|
Ok(result.into())
|
||||||
}),
|
}),
|
||||||
"==" => Some(impl_op!(get_s1s2(==))),
|
EqualsTo => Some(impl_op!(get_s1s2(==))),
|
||||||
"!=" => Some(impl_op!(get_s1s2(!=))),
|
NotEqualsTo => Some(impl_op!(get_s1s2(!=))),
|
||||||
">" => Some(impl_op!(get_s1s2(>))),
|
GreaterThan => Some(impl_op!(get_s1s2(>))),
|
||||||
">=" => Some(impl_op!(get_s1s2(>=))),
|
GreaterThanEqualsTo => Some(impl_op!(get_s1s2(>=))),
|
||||||
"<" => Some(impl_op!(get_s1s2(<))),
|
LessThan => Some(impl_op!(get_s1s2(<))),
|
||||||
"<=" => Some(impl_op!(get_s1s2(<=))),
|
LessThanEqualsTo => Some(impl_op!(get_s1s2(<=))),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
@ -380,45 +428,50 @@ pub fn get_builtin_binary_op_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<Fn
|
|||||||
}
|
}
|
||||||
|
|
||||||
return match op {
|
return match op {
|
||||||
"+" => Some(|_, args| {
|
Plus => Some(|_ctx, args| {
|
||||||
let x = &*args[0].read_lock::<ImmutableString>().expect(BUILTIN);
|
let x = &*args[0].read_lock::<ImmutableString>().expect(BUILTIN);
|
||||||
let y = args[1].as_char().expect(BUILTIN);
|
let y = args[1].as_char().expect(BUILTIN);
|
||||||
Ok((x + y).into())
|
let result = x + y;
|
||||||
|
|
||||||
|
#[cfg(not(feature = "unchecked"))]
|
||||||
|
_ctx.engine()
|
||||||
|
.raise_err_if_over_data_size_limit((0, 0, result.len()))?;
|
||||||
|
|
||||||
|
Ok(result.into())
|
||||||
}),
|
}),
|
||||||
"-" => Some(|_, args| {
|
Minus => Some(|_, args| {
|
||||||
let x = &*args[0].read_lock::<ImmutableString>().expect(BUILTIN);
|
let x = &*args[0].read_lock::<ImmutableString>().expect(BUILTIN);
|
||||||
let y = args[1].as_char().expect(BUILTIN);
|
let y = args[1].as_char().expect(BUILTIN);
|
||||||
Ok((x - y).into())
|
Ok((x - y).into())
|
||||||
}),
|
}),
|
||||||
"==" => Some(impl_op!(get_s1s2(==))),
|
EqualsTo => Some(impl_op!(get_s1s2(==))),
|
||||||
"!=" => Some(impl_op!(get_s1s2(!=))),
|
NotEqualsTo => Some(impl_op!(get_s1s2(!=))),
|
||||||
">" => Some(impl_op!(get_s1s2(>))),
|
GreaterThan => Some(impl_op!(get_s1s2(>))),
|
||||||
">=" => Some(impl_op!(get_s1s2(>=))),
|
GreaterThanEqualsTo => Some(impl_op!(get_s1s2(>=))),
|
||||||
"<" => Some(impl_op!(get_s1s2(<))),
|
LessThan => Some(impl_op!(get_s1s2(<))),
|
||||||
"<=" => Some(impl_op!(get_s1s2(<=))),
|
LessThanEqualsTo => Some(impl_op!(get_s1s2(<=))),
|
||||||
OP_CONTAINS => Some(|_, args| {
|
|
||||||
let s = &*args[0].read_lock::<ImmutableString>().expect(BUILTIN);
|
|
||||||
let c = args[1].as_char().expect(BUILTIN);
|
|
||||||
Ok(s.contains(c).into())
|
|
||||||
}),
|
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
// () op string
|
// () op string
|
||||||
if (type1, type2) == (TypeId::of::<()>(), TypeId::of::<ImmutableString>()) {
|
if (type1, type2) == (TypeId::of::<()>(), TypeId::of::<ImmutableString>()) {
|
||||||
return match op {
|
return match op {
|
||||||
"+" => Some(|_, args| Ok(args[1].clone())),
|
Plus => Some(|_, args| Ok(args[1].clone())),
|
||||||
"==" | ">" | ">=" | "<" | "<=" => Some(|_, _| Ok(Dynamic::FALSE)),
|
EqualsTo | GreaterThan | GreaterThanEqualsTo | LessThan | LessThanEqualsTo => {
|
||||||
"!=" => Some(|_, _| Ok(Dynamic::TRUE)),
|
Some(const_false_fn)
|
||||||
|
}
|
||||||
|
NotEqualsTo => Some(const_true_fn),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
// string op ()
|
// string op ()
|
||||||
if (type1, type2) == (TypeId::of::<ImmutableString>(), TypeId::of::<()>()) {
|
if (type1, type2) == (TypeId::of::<ImmutableString>(), TypeId::of::<()>()) {
|
||||||
return match op {
|
return match op {
|
||||||
"+" => Some(|_, args| Ok(args[0].clone())),
|
Plus => Some(|_, args| Ok(args[0].clone())),
|
||||||
"==" | ">" | ">=" | "<" | "<=" => Some(|_, _| Ok(Dynamic::FALSE)),
|
EqualsTo | GreaterThan | GreaterThanEqualsTo | LessThan | LessThanEqualsTo => {
|
||||||
"!=" => Some(|_, _| Ok(Dynamic::TRUE)),
|
Some(const_false_fn)
|
||||||
|
}
|
||||||
|
NotEqualsTo => Some(const_true_fn),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
@ -428,22 +481,20 @@ pub fn get_builtin_binary_op_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<Fn
|
|||||||
if type1 == TypeId::of::<crate::Blob>() {
|
if type1 == TypeId::of::<crate::Blob>() {
|
||||||
use crate::Blob;
|
use crate::Blob;
|
||||||
|
|
||||||
if type2 == TypeId::of::<INT>() {
|
|
||||||
return match op {
|
|
||||||
OP_CONTAINS => Some(|_, args| {
|
|
||||||
let blob = &*args[0].read_lock::<Blob>().expect(BUILTIN);
|
|
||||||
let x = (args[1].as_int().expect("`INT`") & 0x0000_00ff) as u8;
|
|
||||||
Ok((!blob.is_empty() && blob.contains(&x)).into())
|
|
||||||
}),
|
|
||||||
_ => None,
|
|
||||||
};
|
|
||||||
}
|
|
||||||
if type2 == TypeId::of::<char>() {
|
if type2 == TypeId::of::<char>() {
|
||||||
return match op {
|
return match op {
|
||||||
"+" => Some(|_, args| {
|
Plus => Some(|_ctx, args| {
|
||||||
let mut buf = [0_u8; 4];
|
|
||||||
let mut blob = args[0].read_lock::<Blob>().expect(BUILTIN).clone();
|
let mut blob = args[0].read_lock::<Blob>().expect(BUILTIN).clone();
|
||||||
let x = args[1].as_char().expect("`char`").encode_utf8(&mut buf);
|
let mut buf = [0_u8; 4];
|
||||||
|
let x = args[1].as_char().expect(BUILTIN).encode_utf8(&mut buf);
|
||||||
|
|
||||||
|
#[cfg(not(feature = "unchecked"))]
|
||||||
|
_ctx.engine().raise_err_if_over_data_size_limit((
|
||||||
|
blob.len() + x.len(),
|
||||||
|
0,
|
||||||
|
0,
|
||||||
|
))?;
|
||||||
|
|
||||||
blob.extend(x.as_bytes());
|
blob.extend(x.as_bytes());
|
||||||
Ok(Dynamic::from_blob(blob))
|
Ok(Dynamic::from_blob(blob))
|
||||||
}),
|
}),
|
||||||
@ -452,17 +503,6 @@ pub fn get_builtin_binary_op_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<Fn
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// map op string
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
|
||||||
if (type1, type2) == (TypeId::of::<crate::Map>(), TypeId::of::<ImmutableString>()) {
|
|
||||||
use crate::Map;
|
|
||||||
|
|
||||||
return match op {
|
|
||||||
OP_CONTAINS => Some(impl_op!(Map.contains_key(ImmutableString.as_str()))),
|
|
||||||
_ => None,
|
|
||||||
};
|
|
||||||
}
|
|
||||||
|
|
||||||
// Non-compatible ranges
|
// Non-compatible ranges
|
||||||
if (type1, type2)
|
if (type1, type2)
|
||||||
== (
|
== (
|
||||||
@ -476,48 +516,28 @@ pub fn get_builtin_binary_op_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<Fn
|
|||||||
)
|
)
|
||||||
{
|
{
|
||||||
return match op {
|
return match op {
|
||||||
"!=" => Some(|_, _| Ok(Dynamic::TRUE)),
|
NotEqualsTo => Some(const_true_fn),
|
||||||
"==" => Some(|_, _| Ok(Dynamic::FALSE)),
|
Equals => Some(const_false_fn),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
// Handle ranges here because ranges are implemented as custom type
|
// Handle ranges here because ranges are implemented as custom type
|
||||||
if type1 == TypeId::of::<ExclusiveRange>() {
|
if type1 == TypeId::of::<ExclusiveRange>() {
|
||||||
if type2 == TypeId::of::<INT>() {
|
|
||||||
return match op {
|
|
||||||
OP_CONTAINS => Some(|_, args| {
|
|
||||||
let range = &*args[0].read_lock::<ExclusiveRange>().expect(BUILTIN);
|
|
||||||
let x = args[1].as_int().expect("`INT`");
|
|
||||||
Ok(range.contains(&x).into())
|
|
||||||
}),
|
|
||||||
_ => None,
|
|
||||||
};
|
|
||||||
}
|
|
||||||
if type1 == type2 {
|
if type1 == type2 {
|
||||||
return match op {
|
return match op {
|
||||||
"==" => Some(impl_op!(ExclusiveRange == ExclusiveRange)),
|
EqualsTo => Some(impl_op!(ExclusiveRange == ExclusiveRange)),
|
||||||
"!=" => Some(impl_op!(ExclusiveRange != ExclusiveRange)),
|
NotEqualsTo => Some(impl_op!(ExclusiveRange != ExclusiveRange)),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
if type1 == TypeId::of::<InclusiveRange>() {
|
if type1 == TypeId::of::<InclusiveRange>() {
|
||||||
if type2 == TypeId::of::<INT>() {
|
|
||||||
return match op {
|
|
||||||
OP_CONTAINS => Some(|_, args| {
|
|
||||||
let range = &*args[0].read_lock::<InclusiveRange>().expect(BUILTIN);
|
|
||||||
let x = args[1].as_int().expect("`INT`");
|
|
||||||
Ok(range.contains(&x).into())
|
|
||||||
}),
|
|
||||||
_ => None,
|
|
||||||
};
|
|
||||||
}
|
|
||||||
if type1 == type2 {
|
if type1 == type2 {
|
||||||
return match op {
|
return match op {
|
||||||
"==" => Some(impl_op!(InclusiveRange == InclusiveRange)),
|
EqualsTo => Some(impl_op!(InclusiveRange == InclusiveRange)),
|
||||||
"!=" => Some(impl_op!(InclusiveRange != InclusiveRange)),
|
NotEqualsTo => Some(impl_op!(InclusiveRange != InclusiveRange)),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
@ -531,8 +551,10 @@ pub fn get_builtin_binary_op_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<Fn
|
|||||||
} else if type1 != type2 {
|
} else if type1 != type2 {
|
||||||
// If the types are not the same, default to not compare
|
// If the types are not the same, default to not compare
|
||||||
match op {
|
match op {
|
||||||
"!=" => Some(|_, _| Ok(Dynamic::TRUE)),
|
NotEqualsTo => Some(const_true_fn),
|
||||||
"==" | ">" | ">=" | "<" | "<=" => Some(|_, _| Ok(Dynamic::FALSE)),
|
EqualsTo | GreaterThan | GreaterThanEqualsTo | LessThan | LessThanEqualsTo => {
|
||||||
|
Some(const_false_fn)
|
||||||
|
}
|
||||||
_ => None,
|
_ => None,
|
||||||
}
|
}
|
||||||
} else {
|
} else {
|
||||||
@ -544,8 +566,10 @@ pub fn get_builtin_binary_op_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<Fn
|
|||||||
// Default comparison operators for different types
|
// Default comparison operators for different types
|
||||||
if type2 != type1 {
|
if type2 != type1 {
|
||||||
return match op {
|
return match op {
|
||||||
"!=" => Some(|_, _| Ok(Dynamic::TRUE)),
|
NotEqualsTo => Some(const_true_fn),
|
||||||
"==" | ">" | ">=" | "<" | "<=" => Some(|_, _| Ok(Dynamic::FALSE)),
|
EqualsTo | GreaterThan | GreaterThanEqualsTo | LessThan | LessThanEqualsTo => {
|
||||||
|
Some(const_false_fn)
|
||||||
|
}
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
@ -558,7 +582,7 @@ pub fn get_builtin_binary_op_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<Fn
|
|||||||
///
|
///
|
||||||
/// The return function is registered as a _method_, so the first parameter cannot be consumed.
|
/// The return function is registered as a _method_, so the first parameter cannot be consumed.
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn get_builtin_op_assignment_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Option<FnBuiltin> {
|
pub fn get_builtin_op_assignment_fn(op: &Token, x: &Dynamic, y: &Dynamic) -> Option<FnBuiltin> {
|
||||||
let type1 = x.type_id();
|
let type1 = x.type_id();
|
||||||
let type2 = y.type_id();
|
let type2 = y.type_id();
|
||||||
|
|
||||||
@ -610,49 +634,49 @@ pub fn get_builtin_op_assignment_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Optio
|
|||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
#[cfg(not(feature = "unchecked"))]
|
||||||
match op {
|
match op {
|
||||||
"+=" => return Some(impl_op!(INT => add(as_int, as_int))),
|
PlusAssign => return Some(impl_op!(INT => add(as_int, as_int))),
|
||||||
"-=" => return Some(impl_op!(INT => subtract(as_int, as_int))),
|
MinusAssign => return Some(impl_op!(INT => subtract(as_int, as_int))),
|
||||||
"*=" => return Some(impl_op!(INT => multiply(as_int, as_int))),
|
MultiplyAssign => return Some(impl_op!(INT => multiply(as_int, as_int))),
|
||||||
"/=" => return Some(impl_op!(INT => divide(as_int, as_int))),
|
DivideAssign => return Some(impl_op!(INT => divide(as_int, as_int))),
|
||||||
"%=" => return Some(impl_op!(INT => modulo(as_int, as_int))),
|
ModuloAssign => return Some(impl_op!(INT => modulo(as_int, as_int))),
|
||||||
"**=" => return Some(impl_op!(INT => power(as_int, as_int))),
|
PowerOfAssign => return Some(impl_op!(INT => power(as_int, as_int))),
|
||||||
">>=" => return Some(impl_op!(INT => shift_right(as_int, as_int))),
|
RightShiftAssign => return Some(impl_op!(INT => shift_right(as_int, as_int))),
|
||||||
"<<=" => return Some(impl_op!(INT => shift_left(as_int, as_int))),
|
LeftShiftAssign => return Some(impl_op!(INT => shift_left(as_int, as_int))),
|
||||||
_ => (),
|
_ => (),
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(feature = "unchecked")]
|
#[cfg(feature = "unchecked")]
|
||||||
match op {
|
match op {
|
||||||
"+=" => return Some(impl_op!(INT += as_int)),
|
PlusAssign => return Some(impl_op!(INT += as_int)),
|
||||||
"-=" => return Some(impl_op!(INT -= as_int)),
|
MinusAssign => return Some(impl_op!(INT -= as_int)),
|
||||||
"*=" => return Some(impl_op!(INT *= as_int)),
|
MultiplyAssign => return Some(impl_op!(INT *= as_int)),
|
||||||
"/=" => return Some(impl_op!(INT /= as_int)),
|
DivideAssign => return Some(impl_op!(INT /= as_int)),
|
||||||
"%=" => return Some(impl_op!(INT %= as_int)),
|
ModuloAssign => return Some(impl_op!(INT %= as_int)),
|
||||||
"**=" => return Some(impl_op!(INT => as_int.pow(as_int as u32))),
|
PowerOfAssign => return Some(impl_op!(INT => as_int.pow(as_int as u32))),
|
||||||
">>=" => return Some(impl_op!(INT >>= as_int)),
|
RightShiftAssign => return Some(impl_op!(INT >>= as_int)),
|
||||||
"<<=" => return Some(impl_op!(INT <<= as_int)),
|
LeftShiftAssign => return Some(impl_op!(INT <<= as_int)),
|
||||||
_ => (),
|
_ => (),
|
||||||
}
|
}
|
||||||
|
|
||||||
return match op {
|
return match op {
|
||||||
"&=" => Some(impl_op!(INT &= as_int)),
|
AndAssign => Some(impl_op!(INT &= as_int)),
|
||||||
"|=" => Some(impl_op!(INT |= as_int)),
|
OrAssign => Some(impl_op!(INT |= as_int)),
|
||||||
"^=" => Some(impl_op!(INT ^= as_int)),
|
XOrAssign => Some(impl_op!(INT ^= as_int)),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
if type1 == TypeId::of::<bool>() {
|
if type1 == TypeId::of::<bool>() {
|
||||||
return match op {
|
return match op {
|
||||||
"&=" => Some(impl_op!(bool = x && as_bool)),
|
AndAssign => Some(impl_op!(bool = x && as_bool)),
|
||||||
"|=" => Some(impl_op!(bool = x || as_bool)),
|
OrAssign => Some(impl_op!(bool = x || as_bool)),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
if type1 == TypeId::of::<char>() {
|
if type1 == TypeId::of::<char>() {
|
||||||
return match op {
|
return match op {
|
||||||
"+=" => Some(|_, args| {
|
PlusAssign => Some(|_, args| {
|
||||||
let y = args[1].as_char().expect(BUILTIN);
|
let y = args[1].as_char().expect(BUILTIN);
|
||||||
let x = &mut *args[0].write_lock::<Dynamic>().expect(BUILTIN);
|
let x = &mut *args[0].write_lock::<Dynamic>().expect(BUILTIN);
|
||||||
Ok((*x = format!("{x}{y}").into()).into())
|
Ok((*x = format!("{x}{y}").into()).into())
|
||||||
@ -663,13 +687,21 @@ pub fn get_builtin_op_assignment_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Optio
|
|||||||
|
|
||||||
if type1 == TypeId::of::<ImmutableString>() {
|
if type1 == TypeId::of::<ImmutableString>() {
|
||||||
return match op {
|
return match op {
|
||||||
"+=" => Some(|_, args| {
|
PlusAssign => Some(|_ctx, args| {
|
||||||
let (first, second) = args.split_first_mut().expect(BUILTIN);
|
let (first, second) = args.split_first_mut().expect(BUILTIN);
|
||||||
let x = &mut *first.write_lock::<ImmutableString>().expect(BUILTIN);
|
let x = &mut *first.write_lock::<ImmutableString>().expect(BUILTIN);
|
||||||
let y = std::mem::take(second[0]).cast::<ImmutableString>();
|
let y = std::mem::take(second[0]).cast::<ImmutableString>();
|
||||||
|
|
||||||
|
#[cfg(not(feature = "unchecked"))]
|
||||||
|
if !x.is_empty() && !y.is_empty() {
|
||||||
|
let total_len = x.len() + y.len();
|
||||||
|
_ctx.engine()
|
||||||
|
.raise_err_if_over_data_size_limit((0, 0, total_len))?;
|
||||||
|
}
|
||||||
|
|
||||||
Ok((*x += y).into())
|
Ok((*x += y).into())
|
||||||
}),
|
}),
|
||||||
"-=" => Some(|_, args| {
|
MinusAssign => Some(|_, args| {
|
||||||
let (first, second) = args.split_first_mut().expect(BUILTIN);
|
let (first, second) = args.split_first_mut().expect(BUILTIN);
|
||||||
let x = &mut *first.write_lock::<ImmutableString>().expect(BUILTIN);
|
let x = &mut *first.write_lock::<ImmutableString>().expect(BUILTIN);
|
||||||
let y = std::mem::take(second[0]).cast::<ImmutableString>();
|
let y = std::mem::take(second[0]).cast::<ImmutableString>();
|
||||||
@ -679,15 +711,55 @@ pub fn get_builtin_op_assignment_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Optio
|
|||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[cfg(not(feature = "no_index"))]
|
||||||
|
if type1 == TypeId::of::<crate::Array>() {
|
||||||
|
use crate::packages::array_basic::array_functions::*;
|
||||||
|
use crate::Array;
|
||||||
|
|
||||||
|
return match op {
|
||||||
|
PlusAssign => Some(|_ctx, args| {
|
||||||
|
let x = std::mem::take(args[1]).cast::<Array>();
|
||||||
|
|
||||||
|
if x.is_empty() {
|
||||||
|
return Ok(Dynamic::UNIT);
|
||||||
|
}
|
||||||
|
|
||||||
|
let _array_is_empty = args[0].read_lock::<Array>().expect(BUILTIN).is_empty();
|
||||||
|
|
||||||
|
#[cfg(not(feature = "unchecked"))]
|
||||||
|
if !_array_is_empty {
|
||||||
|
_ctx.engine().check_data_size(
|
||||||
|
&*args[0].read_lock().expect(BUILTIN),
|
||||||
|
crate::Position::NONE,
|
||||||
|
)?;
|
||||||
|
}
|
||||||
|
|
||||||
|
let array = &mut *args[0].write_lock::<Array>().expect(BUILTIN);
|
||||||
|
|
||||||
|
Ok(append(array, x).into())
|
||||||
|
}),
|
||||||
|
_ => None,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
if type1 == TypeId::of::<crate::Blob>() {
|
if type1 == TypeId::of::<crate::Blob>() {
|
||||||
|
use crate::packages::blob_basic::blob_functions::*;
|
||||||
use crate::Blob;
|
use crate::Blob;
|
||||||
|
|
||||||
return match op {
|
return match op {
|
||||||
"+=" => Some(|_, args| {
|
PlusAssign => Some(|_ctx, args| {
|
||||||
let blob2 = std::mem::take(args[1]).cast::<Blob>();
|
let blob2 = std::mem::take(args[1]).cast::<Blob>();
|
||||||
let blob1 = &mut *args[0].write_lock::<Blob>().expect(BUILTIN);
|
let blob1 = &mut *args[0].write_lock::<Blob>().expect(BUILTIN);
|
||||||
Ok(crate::packages::blob_basic::blob_functions::append(blob1, blob2).into())
|
|
||||||
|
#[cfg(not(feature = "unchecked"))]
|
||||||
|
_ctx.engine().raise_err_if_over_data_size_limit((
|
||||||
|
blob1.len() + blob2.len(),
|
||||||
|
0,
|
||||||
|
0,
|
||||||
|
))?;
|
||||||
|
|
||||||
|
Ok(append(blob1, blob2).into())
|
||||||
}),
|
}),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
@ -699,12 +771,12 @@ pub fn get_builtin_op_assignment_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Optio
|
|||||||
($x:ident, $xx:ident, $y:ty, $yy:ident) => {
|
($x:ident, $xx:ident, $y:ty, $yy:ident) => {
|
||||||
if (type1, type2) == (TypeId::of::<$x>(), TypeId::of::<$y>()) {
|
if (type1, type2) == (TypeId::of::<$x>(), TypeId::of::<$y>()) {
|
||||||
return match op {
|
return match op {
|
||||||
"+=" => Some(impl_op!($x += $yy)),
|
PlusAssign => Some(impl_op!($x += $yy)),
|
||||||
"-=" => Some(impl_op!($x -= $yy)),
|
MinusAssign => Some(impl_op!($x -= $yy)),
|
||||||
"*=" => Some(impl_op!($x *= $yy)),
|
MultiplyAssign => Some(impl_op!($x *= $yy)),
|
||||||
"/=" => Some(impl_op!($x /= $yy)),
|
DivideAssign => Some(impl_op!($x /= $yy)),
|
||||||
"%=" => Some(impl_op!($x %= $yy)),
|
ModuloAssign => Some(impl_op!($x %= $yy)),
|
||||||
"**=" => Some(impl_op!($x => $xx.powf($yy as $x))),
|
PowerOfAssign => Some(impl_op!($x => $xx.powf($yy as $x))),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
@ -722,16 +794,16 @@ pub fn get_builtin_op_assignment_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Optio
|
|||||||
($x:ident, $xx:ident, $y:ty, $yy:ident) => {
|
($x:ident, $xx:ident, $y:ty, $yy:ident) => {
|
||||||
if (type1, type2) == (TypeId::of::<$x>(), TypeId::of::<$y>()) {
|
if (type1, type2) == (TypeId::of::<$x>(), TypeId::of::<$y>()) {
|
||||||
#[cfg(not(feature = "unchecked"))]
|
#[cfg(not(feature = "unchecked"))]
|
||||||
use crate::packages::arithmetic::decimal_functions::*;
|
use crate::packages::arithmetic::decimal_functions::builtin::*;
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
#[cfg(not(feature = "unchecked"))]
|
||||||
return match op {
|
return match op {
|
||||||
"+=" => Some(impl_op!(from $x => add($xx, $yy))),
|
PlusAssign => Some(impl_op!(from $x => add($xx, $yy))),
|
||||||
"-=" => Some(impl_op!(from $x => subtract($xx, $yy))),
|
MinusAssign => Some(impl_op!(from $x => subtract($xx, $yy))),
|
||||||
"*=" => Some(impl_op!(from $x => multiply($xx, $yy))),
|
MultiplyAssign => Some(impl_op!(from $x => multiply($xx, $yy))),
|
||||||
"/=" => Some(impl_op!(from $x => divide($xx, $yy))),
|
DivideAssign => Some(impl_op!(from $x => divide($xx, $yy))),
|
||||||
"%=" => Some(impl_op!(from $x => modulo($xx, $yy))),
|
ModuloAssign => Some(impl_op!(from $x => modulo($xx, $yy))),
|
||||||
"**=" => Some(impl_op!(from $x => power($xx, $yy))),
|
PowerOfAssign => Some(impl_op!(from $x => power($xx, $yy))),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
|
|
||||||
@ -740,12 +812,12 @@ pub fn get_builtin_op_assignment_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Optio
|
|||||||
|
|
||||||
#[cfg(feature = "unchecked")]
|
#[cfg(feature = "unchecked")]
|
||||||
return match op {
|
return match op {
|
||||||
"+=" => Some(impl_op!(from $x += $yy)),
|
PlusAssign => Some(impl_op!(from $x += $yy)),
|
||||||
"-=" => Some(impl_op!(from $x -= $yy)),
|
MinusAssign => Some(impl_op!(from $x -= $yy)),
|
||||||
"*=" => Some(impl_op!(from $x *= $yy)),
|
MultiplyAssign => Some(impl_op!(from $x *= $yy)),
|
||||||
"/=" => Some(impl_op!(from $x /= $yy)),
|
DivideAssign => Some(impl_op!(from $x /= $yy)),
|
||||||
"%=" => Some(impl_op!(from $x %= $yy)),
|
ModuloAssign => Some(impl_op!(from $x %= $yy)),
|
||||||
"**=" => Some(impl_op!(from $x => $xx.powd($yy))),
|
PowerOfAssign => Some(impl_op!(from $x => $xx.powd($yy))),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
@ -761,25 +833,45 @@ pub fn get_builtin_op_assignment_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Optio
|
|||||||
// string op= char
|
// string op= char
|
||||||
if (type1, type2) == (TypeId::of::<ImmutableString>(), TypeId::of::<char>()) {
|
if (type1, type2) == (TypeId::of::<ImmutableString>(), TypeId::of::<char>()) {
|
||||||
return match op {
|
return match op {
|
||||||
"+=" => Some(impl_op!(ImmutableString += as_char as char)),
|
PlusAssign => Some(|_ctx, args| {
|
||||||
"-=" => Some(impl_op!(ImmutableString -= as_char as char)),
|
let mut buf = [0_u8; 4];
|
||||||
|
let ch = &*args[1].as_char().expect(BUILTIN).encode_utf8(&mut buf);
|
||||||
|
let mut x = args[0].write_lock::<ImmutableString>().expect(BUILTIN);
|
||||||
|
|
||||||
|
#[cfg(not(feature = "unchecked"))]
|
||||||
|
_ctx.engine()
|
||||||
|
.raise_err_if_over_data_size_limit((0, 0, x.len() + ch.len()))?;
|
||||||
|
|
||||||
|
Ok((*x += ch).into())
|
||||||
|
}),
|
||||||
|
MinusAssign => Some(impl_op!(ImmutableString -= as_char as char)),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
// char op= string
|
// char op= string
|
||||||
if (type1, type2) == (TypeId::of::<char>(), TypeId::of::<ImmutableString>()) {
|
if (type1, type2) == (TypeId::of::<char>(), TypeId::of::<ImmutableString>()) {
|
||||||
return match op {
|
return match op {
|
||||||
"+=" => Some(|_, args| {
|
PlusAssign => Some(|_ctx, args| {
|
||||||
let mut ch = args[0].as_char().expect(BUILTIN).to_string();
|
let ch = {
|
||||||
ch.push_str(
|
let s = &*args[1].read_lock::<ImmutableString>().expect(BUILTIN);
|
||||||
args[1]
|
|
||||||
.read_lock::<ImmutableString>()
|
|
||||||
.expect(BUILTIN)
|
|
||||||
.as_str(),
|
|
||||||
);
|
|
||||||
|
|
||||||
let mut x = args[0].write_lock::<Dynamic>().expect(BUILTIN);
|
if s.is_empty() {
|
||||||
Ok((*x = ch.into()).into())
|
return Ok(Dynamic::UNIT);
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut ch = args[0].as_char().expect(BUILTIN).to_string();
|
||||||
|
|
||||||
|
#[cfg(not(feature = "unchecked"))]
|
||||||
|
_ctx.engine()
|
||||||
|
.raise_err_if_over_data_size_limit((0, 0, ch.len() + s.len()))?;
|
||||||
|
|
||||||
|
ch.push_str(s);
|
||||||
|
ch
|
||||||
|
};
|
||||||
|
|
||||||
|
*args[0].write_lock::<Dynamic>().expect(BUILTIN) = ch.into();
|
||||||
|
|
||||||
|
Ok(Dynamic::UNIT)
|
||||||
}),
|
}),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
@ -791,21 +883,21 @@ pub fn get_builtin_op_assignment_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Optio
|
|||||||
use crate::packages::array_basic::array_functions::*;
|
use crate::packages::array_basic::array_functions::*;
|
||||||
use crate::Array;
|
use crate::Array;
|
||||||
|
|
||||||
if type2 == TypeId::of::<crate::Array>() {
|
|
||||||
return match op {
|
return match op {
|
||||||
"+=" => Some(|_, args| {
|
PlusAssign => Some(|_ctx, args| {
|
||||||
let array2 = std::mem::take(args[1]).cast::<Array>();
|
{
|
||||||
let array1 = &mut *args[0].write_lock::<Array>().expect(BUILTIN);
|
|
||||||
Ok(append(array1, array2).into())
|
|
||||||
}),
|
|
||||||
_ => None,
|
|
||||||
};
|
|
||||||
}
|
|
||||||
return match op {
|
|
||||||
"+=" => Some(|_, args| {
|
|
||||||
let x = std::mem::take(args[1]);
|
let x = std::mem::take(args[1]);
|
||||||
let array = &mut *args[0].write_lock::<Array>().expect(BUILTIN);
|
let array = &mut *args[0].write_lock::<Array>().expect(BUILTIN);
|
||||||
Ok(push(array, x).into())
|
push(array, x);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(not(feature = "unchecked"))]
|
||||||
|
_ctx.engine().check_data_size(
|
||||||
|
&*args[0].read_lock().expect(BUILTIN),
|
||||||
|
crate::Position::NONE,
|
||||||
|
)?;
|
||||||
|
|
||||||
|
Ok(Dynamic::UNIT)
|
||||||
}),
|
}),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
@ -817,11 +909,18 @@ pub fn get_builtin_op_assignment_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Optio
|
|||||||
|
|
||||||
// blob op= int
|
// blob op= int
|
||||||
if (type1, type2) == (TypeId::of::<Blob>(), TypeId::of::<INT>()) {
|
if (type1, type2) == (TypeId::of::<Blob>(), TypeId::of::<INT>()) {
|
||||||
|
use crate::packages::blob_basic::blob_functions::*;
|
||||||
|
|
||||||
return match op {
|
return match op {
|
||||||
"+=" => Some(|_, args| {
|
PlusAssign => Some(|_ctx, args| {
|
||||||
let x = args[1].as_int().expect("`INT`");
|
let x = args[1].as_int().expect(BUILTIN);
|
||||||
let blob = &mut *args[0].write_lock::<Blob>().expect(BUILTIN);
|
let blob = &mut *args[0].write_lock::<Blob>().expect(BUILTIN);
|
||||||
Ok(crate::packages::blob_basic::blob_functions::push(blob, x).into())
|
|
||||||
|
#[cfg(not(feature = "unchecked"))]
|
||||||
|
_ctx.engine()
|
||||||
|
.raise_err_if_over_data_size_limit((blob.len() + 1, 0, 0))?;
|
||||||
|
|
||||||
|
Ok(push(blob, x).into())
|
||||||
}),
|
}),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
@ -829,11 +928,18 @@ pub fn get_builtin_op_assignment_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Optio
|
|||||||
|
|
||||||
// blob op= char
|
// blob op= char
|
||||||
if (type1, type2) == (TypeId::of::<Blob>(), TypeId::of::<char>()) {
|
if (type1, type2) == (TypeId::of::<Blob>(), TypeId::of::<char>()) {
|
||||||
|
use crate::packages::blob_basic::blob_functions::*;
|
||||||
|
|
||||||
return match op {
|
return match op {
|
||||||
"+=" => Some(|_, args| {
|
PlusAssign => Some(|_ctx, args| {
|
||||||
let x = args[1].as_char().expect("`char`");
|
let x = args[1].as_char().expect(BUILTIN);
|
||||||
let blob = &mut *args[0].write_lock::<Blob>().expect(BUILTIN);
|
let blob = &mut *args[0].write_lock::<Blob>().expect(BUILTIN);
|
||||||
Ok(crate::packages::blob_basic::blob_functions::append_char(blob, x).into())
|
|
||||||
|
#[cfg(not(feature = "unchecked"))]
|
||||||
|
_ctx.engine()
|
||||||
|
.raise_err_if_over_data_size_limit((blob.len() + 1, 0, 0))?;
|
||||||
|
|
||||||
|
Ok(append_char(blob, x).into())
|
||||||
}),
|
}),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
@ -841,11 +947,26 @@ pub fn get_builtin_op_assignment_fn(op: &str, x: &Dynamic, y: &Dynamic) -> Optio
|
|||||||
|
|
||||||
// blob op= string
|
// blob op= string
|
||||||
if (type1, type2) == (TypeId::of::<Blob>(), TypeId::of::<ImmutableString>()) {
|
if (type1, type2) == (TypeId::of::<Blob>(), TypeId::of::<ImmutableString>()) {
|
||||||
|
use crate::packages::blob_basic::blob_functions::*;
|
||||||
|
|
||||||
return match op {
|
return match op {
|
||||||
"+=" => Some(|_, args| {
|
PlusAssign => Some(|_ctx, args| {
|
||||||
let s = std::mem::take(args[1]).cast::<ImmutableString>();
|
let s = std::mem::take(args[1]).cast::<ImmutableString>();
|
||||||
|
|
||||||
|
if s.is_empty() {
|
||||||
|
return Ok(Dynamic::UNIT);
|
||||||
|
}
|
||||||
|
|
||||||
let blob = &mut *args[0].write_lock::<Blob>().expect(BUILTIN);
|
let blob = &mut *args[0].write_lock::<Blob>().expect(BUILTIN);
|
||||||
Ok(crate::packages::blob_basic::blob_functions::append_str(blob, &s).into())
|
|
||||||
|
#[cfg(not(feature = "unchecked"))]
|
||||||
|
_ctx.engine().raise_err_if_over_data_size_limit((
|
||||||
|
blob.len() + s.len(),
|
||||||
|
0,
|
||||||
|
0,
|
||||||
|
))?;
|
||||||
|
|
||||||
|
Ok(append_str(blob, &s).into())
|
||||||
}),
|
}),
|
||||||
_ => None,
|
_ => None,
|
||||||
};
|
};
|
||||||
|
668
src/func/call.rs
668
src/func/call.rs
File diff suppressed because it is too large
Load Diff
@ -27,12 +27,14 @@ pub enum CallableFunction {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl fmt::Debug for CallableFunction {
|
impl fmt::Debug for CallableFunction {
|
||||||
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
match self {
|
match self {
|
||||||
Self::Pure(..) => write!(f, "NativePureFunction"),
|
Self::Pure(..) => f.write_str("NativePureFunction"),
|
||||||
Self::Method(..) => write!(f, "NativeMethod"),
|
Self::Method(..) => f.write_str("NativeMethod"),
|
||||||
Self::Iterator(..) => write!(f, "NativeIterator"),
|
Self::Iterator(..) => f.write_str("NativeIterator"),
|
||||||
Self::Plugin(..) => write!(f, "PluginFunction"),
|
Self::Plugin(..) => f.write_str("PluginFunction"),
|
||||||
|
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
Self::Script(fn_def) => fmt::Debug::fmt(fn_def, f),
|
Self::Script(fn_def) => fmt::Debug::fmt(fn_def, f),
|
||||||
@ -43,10 +45,10 @@ impl fmt::Debug for CallableFunction {
|
|||||||
impl fmt::Display for CallableFunction {
|
impl fmt::Display for CallableFunction {
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
match self {
|
match self {
|
||||||
Self::Pure(..) => write!(f, "NativePureFunction"),
|
Self::Pure(..) => f.write_str("NativePureFunction"),
|
||||||
Self::Method(..) => write!(f, "NativeMethod"),
|
Self::Method(..) => f.write_str("NativeMethod"),
|
||||||
Self::Iterator(..) => write!(f, "NativeIterator"),
|
Self::Iterator(..) => f.write_str("NativeIterator"),
|
||||||
Self::Plugin(..) => write!(f, "PluginFunction"),
|
Self::Plugin(..) => f.write_str("PluginFunction"),
|
||||||
|
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
Self::Script(s) => fmt::Display::fmt(s, f),
|
Self::Script(s) => fmt::Display::fmt(s, f),
|
||||||
@ -197,7 +199,7 @@ impl CallableFunction {
|
|||||||
Self::Script(..) => None,
|
Self::Script(..) => None,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
/// Create a new [`CallableFunction::Method`] from `FnBuiltin`.
|
/// Create a new [`CallableFunction::Method`] from a built-in function.
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn from_fn_builtin(func: FnBuiltin) -> Self {
|
pub fn from_fn_builtin(func: FnBuiltin) -> Self {
|
||||||
|
@ -46,6 +46,7 @@ pub trait Func<ARGS, RET> {
|
|||||||
/// func(123, "hello")? == false; // call the anonymous function
|
/// func(123, "hello")? == false; // call the anonymous function
|
||||||
/// # Ok(())
|
/// # Ok(())
|
||||||
/// # }
|
/// # }
|
||||||
|
#[must_use]
|
||||||
fn create_from_ast(self, ast: AST, entry_point: &str) -> Self::Output;
|
fn create_from_ast(self, ast: AST, entry_point: &str) -> Self::Output;
|
||||||
|
|
||||||
/// Create a Rust closure from a script.
|
/// Create a Rust closure from a script.
|
||||||
@ -79,6 +80,7 @@ pub trait Func<ARGS, RET> {
|
|||||||
/// # Ok(())
|
/// # Ok(())
|
||||||
/// # }
|
/// # }
|
||||||
/// ```
|
/// ```
|
||||||
|
#[must_use]
|
||||||
fn create_from_script(self, script: &str, entry_point: &str) -> ParseResult<Self::Output>;
|
fn create_from_script(self, script: &str, entry_point: &str) -> ParseResult<Self::Output>;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -1,5 +1,6 @@
|
|||||||
//! Module containing utilities to hash functions and function calls.
|
//! Module containing utilities to hash functions and function calls.
|
||||||
|
|
||||||
|
use crate::config;
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
use std::{
|
use std::{
|
||||||
@ -40,6 +41,7 @@ pub struct StraightHasher(u64);
|
|||||||
|
|
||||||
impl Hasher for StraightHasher {
|
impl Hasher for StraightHasher {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn finish(&self) -> u64 {
|
fn finish(&self) -> u64 {
|
||||||
self.0
|
self.0
|
||||||
}
|
}
|
||||||
@ -65,6 +67,7 @@ impl BuildHasher for StraightHasherBuilder {
|
|||||||
type Hasher = StraightHasher;
|
type Hasher = StraightHasher;
|
||||||
|
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn build_hasher(&self) -> Self::Hasher {
|
fn build_hasher(&self) -> Self::Hasher {
|
||||||
StraightHasher(ALT_ZERO_HASH)
|
StraightHasher(ALT_ZERO_HASH)
|
||||||
}
|
}
|
||||||
@ -74,7 +77,12 @@ impl BuildHasher for StraightHasherBuilder {
|
|||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn get_hasher() -> ahash::AHasher {
|
pub fn get_hasher() -> ahash::AHasher {
|
||||||
ahash::AHasher::default()
|
match config::hashing::get_ahash_seed() {
|
||||||
|
Some([seed1, seed2, seed3, seed4]) if seed1 | seed2 | seed3 | seed4 != 0 => {
|
||||||
|
ahash::RandomState::with_seeds(*seed1, *seed2, *seed3, *seed4).build_hasher()
|
||||||
|
}
|
||||||
|
_ => ahash::AHasher::default(),
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Calculate a non-zero [`u64`] hash key from a namespace-qualified variable name.
|
/// Calculate a non-zero [`u64`] hash key from a namespace-qualified variable name.
|
||||||
@ -148,7 +156,7 @@ pub fn calc_fn_hash<'a>(
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Calculate a non-zero [`u64`] hash key from a list of parameter types.
|
/// Calculate a non-zero [`u64`] hash key from a base [`u64`] hash key and a list of parameter types.
|
||||||
///
|
///
|
||||||
/// Parameter types are passed in via [`TypeId`] values from an iterator.
|
/// Parameter types are passed in via [`TypeId`] values from an iterator.
|
||||||
///
|
///
|
||||||
@ -157,10 +165,12 @@ pub fn calc_fn_hash<'a>(
|
|||||||
/// If the hash happens to be zero, it is mapped to `DEFAULT_HASH`.
|
/// If the hash happens to be zero, it is mapped to `DEFAULT_HASH`.
|
||||||
#[inline]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn calc_fn_params_hash(
|
pub fn calc_fn_hash_full(
|
||||||
|
base: u64,
|
||||||
params: impl IntoIterator<Item = TypeId, IntoIter = impl ExactSizeIterator<Item = TypeId>>,
|
params: impl IntoIterator<Item = TypeId, IntoIter = impl ExactSizeIterator<Item = TypeId>>,
|
||||||
) -> u64 {
|
) -> u64 {
|
||||||
let s = &mut get_hasher();
|
let s = &mut get_hasher();
|
||||||
|
base.hash(s);
|
||||||
let iter = params.into_iter();
|
let iter = params.into_iter();
|
||||||
let len = iter.len();
|
let len = iter.len();
|
||||||
iter.for_each(|t| {
|
iter.for_each(|t| {
|
||||||
@ -173,17 +183,3 @@ pub fn calc_fn_params_hash(
|
|||||||
r => r,
|
r => r,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Combine two [`u64`] hashes by taking the XOR of them.
|
|
||||||
///
|
|
||||||
/// # Zeros
|
|
||||||
///
|
|
||||||
/// If the hash happens to be zero, it is mapped to `DEFAULT_HASH`.
|
|
||||||
#[inline(always)]
|
|
||||||
#[must_use]
|
|
||||||
pub const fn combine_hashes(a: u64, b: u64) -> u64 {
|
|
||||||
match a ^ b {
|
|
||||||
0 => ALT_ZERO_HASH,
|
|
||||||
r => r,
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
@ -13,15 +13,17 @@ pub mod script;
|
|||||||
|
|
||||||
pub use args::FuncArgs;
|
pub use args::FuncArgs;
|
||||||
pub use builtin::{get_builtin_binary_op_fn, get_builtin_op_assignment_fn};
|
pub use builtin::{get_builtin_binary_op_fn, get_builtin_op_assignment_fn};
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_closure"))]
|
||||||
pub use call::gen_qualified_fn_call_signature;
|
pub use call::ensure_no_data_race;
|
||||||
pub use call::{gen_fn_call_signature, FnCallArgs};
|
#[cfg(not(feature = "no_function"))]
|
||||||
|
pub use call::is_anonymous_fn;
|
||||||
|
pub use call::FnCallArgs;
|
||||||
pub use callable_function::CallableFunction;
|
pub use callable_function::CallableFunction;
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
pub use func::Func;
|
pub use func::Func;
|
||||||
pub use hashing::{
|
pub use hashing::{calc_fn_hash, calc_fn_hash_full, calc_var_hash, get_hasher, StraightHashMap};
|
||||||
calc_fn_hash, calc_fn_params_hash, calc_var_hash, combine_hashes, get_hasher, StraightHashMap,
|
#[cfg(feature = "internals")]
|
||||||
};
|
pub use native::NativeCallContextStore;
|
||||||
pub use native::{
|
pub use native::{
|
||||||
locked_read, locked_write, shared_get_mut, shared_make_mut, shared_take, shared_take_or_clone,
|
locked_read, locked_write, shared_get_mut, shared_make_mut, shared_take, shared_take_or_clone,
|
||||||
shared_try_take, FnAny, FnPlugin, IteratorFn, Locked, NativeCallContext, SendSync, Shared,
|
shared_try_take, FnAny, FnPlugin, IteratorFn, Locked, NativeCallContext, SendSync, Shared,
|
||||||
|
@ -4,11 +4,11 @@ use super::call::FnCallArgs;
|
|||||||
use crate::ast::FnCallHashes;
|
use crate::ast::FnCallHashes;
|
||||||
use crate::eval::{Caches, GlobalRuntimeState};
|
use crate::eval::{Caches, GlobalRuntimeState};
|
||||||
use crate::plugin::PluginFunction;
|
use crate::plugin::PluginFunction;
|
||||||
use crate::tokenizer::{Token, TokenizeState};
|
use crate::tokenizer::{is_valid_function_name, Token, TokenizeState};
|
||||||
use crate::types::dynamic::Variant;
|
use crate::types::dynamic::Variant;
|
||||||
use crate::{
|
use crate::{
|
||||||
calc_fn_hash, Dynamic, Engine, EvalContext, FuncArgs, Module, Position, RhaiResult,
|
calc_fn_hash, Dynamic, Engine, EvalContext, FuncArgs, Module, Position, RhaiResult,
|
||||||
RhaiResultOf, StaticVec, VarDefInfo, ERR,
|
RhaiResultOf, SharedModule, StaticVec, VarDefInfo, ERR,
|
||||||
};
|
};
|
||||||
use std::any::type_name;
|
use std::any::type_name;
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
@ -72,91 +72,73 @@ pub struct NativeCallContext<'a> {
|
|||||||
/// Function source, if any.
|
/// Function source, if any.
|
||||||
source: Option<&'a str>,
|
source: Option<&'a str>,
|
||||||
/// The current [`GlobalRuntimeState`], if any.
|
/// The current [`GlobalRuntimeState`], if any.
|
||||||
global: Option<&'a GlobalRuntimeState<'a>>,
|
global: &'a GlobalRuntimeState,
|
||||||
/// The current stack of loaded [modules][Module].
|
/// The current stack of loaded [modules][Module].
|
||||||
lib: &'a [&'a Module],
|
lib: &'a [SharedModule],
|
||||||
/// [Position] of the function call.
|
/// [Position] of the function call.
|
||||||
pos: Position,
|
pos: Position,
|
||||||
/// The current nesting level of function calls.
|
|
||||||
level: usize,
|
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<'a, M: AsRef<[&'a Module]> + ?Sized, S: AsRef<str> + 'a + ?Sized>
|
/// _(internals)_ Context of a native Rust function call.
|
||||||
|
/// Exported under the `internals` feature only.
|
||||||
|
#[cfg(feature = "internals")]
|
||||||
|
#[derive(Debug, Clone)]
|
||||||
|
pub struct NativeCallContextStore {
|
||||||
|
/// Name of function called.
|
||||||
|
pub fn_name: String,
|
||||||
|
/// Function source, if any.
|
||||||
|
pub source: Option<String>,
|
||||||
|
/// The current [`GlobalRuntimeState`], if any.
|
||||||
|
pub global: GlobalRuntimeState,
|
||||||
|
/// The current stack of loaded [modules][Module].
|
||||||
|
pub lib: StaticVec<SharedModule>,
|
||||||
|
/// [Position] of the function call.
|
||||||
|
pub pos: Position,
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "internals")]
|
||||||
|
impl NativeCallContextStore {
|
||||||
|
/// Create a [`NativeCallContext`] from a [`NativeCallContextClone`].
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
pub fn create_context<'a>(&'a self, engine: &'a Engine) -> NativeCallContext<'a> {
|
||||||
|
NativeCallContext::from_stored_data(engine, self)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<'a>
|
||||||
From<(
|
From<(
|
||||||
&'a Engine,
|
&'a Engine,
|
||||||
&'a S,
|
&'a str,
|
||||||
Option<&'a S>,
|
Option<&'a str>,
|
||||||
&'a GlobalRuntimeState<'a>,
|
&'a GlobalRuntimeState,
|
||||||
&'a M,
|
&'a [SharedModule],
|
||||||
Position,
|
Position,
|
||||||
usize,
|
|
||||||
)> for NativeCallContext<'a>
|
)> for NativeCallContext<'a>
|
||||||
{
|
{
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn from(
|
fn from(
|
||||||
value: (
|
value: (
|
||||||
&'a Engine,
|
&'a Engine,
|
||||||
&'a S,
|
&'a str,
|
||||||
Option<&'a S>,
|
Option<&'a str>,
|
||||||
&'a GlobalRuntimeState,
|
&'a GlobalRuntimeState,
|
||||||
&'a M,
|
&'a [SharedModule],
|
||||||
Position,
|
Position,
|
||||||
usize,
|
|
||||||
),
|
),
|
||||||
) -> Self {
|
) -> Self {
|
||||||
Self {
|
Self {
|
||||||
engine: value.0,
|
engine: value.0,
|
||||||
fn_name: value.1.as_ref(),
|
fn_name: value.1,
|
||||||
source: value.2.map(<_>::as_ref),
|
source: value.2,
|
||||||
global: Some(value.3),
|
global: value.3,
|
||||||
lib: value.4.as_ref(),
|
lib: value.4,
|
||||||
pos: value.5,
|
pos: value.5,
|
||||||
level: value.6,
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<'a, M: AsRef<[&'a Module]> + ?Sized, S: AsRef<str> + 'a + ?Sized>
|
|
||||||
From<(&'a Engine, &'a S, &'a M)> for NativeCallContext<'a>
|
|
||||||
{
|
|
||||||
#[inline(always)]
|
|
||||||
fn from(value: (&'a Engine, &'a S, &'a M)) -> Self {
|
|
||||||
Self {
|
|
||||||
engine: value.0,
|
|
||||||
fn_name: value.1.as_ref(),
|
|
||||||
source: None,
|
|
||||||
global: None,
|
|
||||||
lib: value.2.as_ref(),
|
|
||||||
pos: Position::NONE,
|
|
||||||
level: 0,
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<'a> NativeCallContext<'a> {
|
impl<'a> NativeCallContext<'a> {
|
||||||
/// _(internals)_ Create a new [`NativeCallContext`].
|
|
||||||
/// Exported under the `metadata` feature only.
|
|
||||||
#[deprecated(
|
|
||||||
since = "1.3.0",
|
|
||||||
note = "`NativeCallContext::new` will be moved under `internals`. Use `FnPtr::call` to call a function pointer directly."
|
|
||||||
)]
|
|
||||||
#[inline(always)]
|
|
||||||
#[must_use]
|
|
||||||
pub fn new(
|
|
||||||
engine: &'a Engine,
|
|
||||||
fn_name: &'a (impl AsRef<str> + 'a + ?Sized),
|
|
||||||
lib: &'a [&Module],
|
|
||||||
) -> Self {
|
|
||||||
Self {
|
|
||||||
engine,
|
|
||||||
fn_name: fn_name.as_ref(),
|
|
||||||
source: None,
|
|
||||||
global: None,
|
|
||||||
lib,
|
|
||||||
pos: Position::NONE,
|
|
||||||
level: 0,
|
|
||||||
}
|
|
||||||
}
|
|
||||||
/// _(internals)_ Create a new [`NativeCallContext`].
|
/// _(internals)_ Create a new [`NativeCallContext`].
|
||||||
/// Exported under the `internals` feature only.
|
/// Exported under the `internals` feature only.
|
||||||
///
|
///
|
||||||
@ -167,23 +149,52 @@ impl<'a> NativeCallContext<'a> {
|
|||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn new_with_all_fields(
|
pub fn new_with_all_fields(
|
||||||
engine: &'a Engine,
|
engine: &'a Engine,
|
||||||
fn_name: &'a (impl AsRef<str> + 'a + ?Sized),
|
fn_name: &'a str,
|
||||||
source: Option<&'a (impl AsRef<str> + 'a + ?Sized)>,
|
source: Option<&'a str>,
|
||||||
global: &'a GlobalRuntimeState,
|
global: &'a GlobalRuntimeState,
|
||||||
lib: &'a [&Module],
|
lib: &'a [SharedModule],
|
||||||
pos: Position,
|
pos: Position,
|
||||||
level: usize,
|
|
||||||
) -> Self {
|
) -> Self {
|
||||||
Self {
|
Self {
|
||||||
engine,
|
engine,
|
||||||
fn_name: fn_name.as_ref(),
|
fn_name,
|
||||||
source: source.map(<_>::as_ref),
|
source,
|
||||||
global: Some(global),
|
global,
|
||||||
lib,
|
lib,
|
||||||
pos,
|
pos,
|
||||||
level,
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// _(internals)_ Create a [`NativeCallContext`] from a [`NativeCallContextClone`].
|
||||||
|
/// Exported under the `internals` feature only.
|
||||||
|
#[cfg(feature = "internals")]
|
||||||
|
#[inline]
|
||||||
|
#[must_use]
|
||||||
|
pub fn from_stored_data(engine: &'a Engine, context: &'a NativeCallContextStore) -> Self {
|
||||||
|
Self {
|
||||||
|
engine,
|
||||||
|
fn_name: &context.fn_name,
|
||||||
|
source: context.source.as_ref().map(String::as_str),
|
||||||
|
global: &context.global,
|
||||||
|
lib: &context.lib,
|
||||||
|
pos: context.pos,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
/// _(internals)_ Store this [`NativeCallContext`] into a [`NativeCallContextClone`].
|
||||||
|
/// Exported under the `internals` feature only.
|
||||||
|
#[cfg(feature = "internals")]
|
||||||
|
#[inline]
|
||||||
|
#[must_use]
|
||||||
|
pub fn store_data(&self) -> NativeCallContextStore {
|
||||||
|
NativeCallContextStore {
|
||||||
|
fn_name: self.fn_name.to_string(),
|
||||||
|
source: self.source.map(|s| s.to_string()),
|
||||||
|
global: self.global.clone(),
|
||||||
|
lib: self.lib.iter().cloned().collect(),
|
||||||
|
pos: self.pos,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/// The current [`Engine`].
|
/// The current [`Engine`].
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
@ -206,7 +217,7 @@ impl<'a> NativeCallContext<'a> {
|
|||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn call_level(&self) -> usize {
|
pub const fn call_level(&self) -> usize {
|
||||||
self.level
|
self.global.level
|
||||||
}
|
}
|
||||||
/// The current source.
|
/// The current source.
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
@ -218,7 +229,7 @@ impl<'a> NativeCallContext<'a> {
|
|||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn tag(&self) -> Option<&Dynamic> {
|
pub fn tag(&self) -> Option<&Dynamic> {
|
||||||
self.global.as_ref().map(|g| &g.tag)
|
Some(&self.global.tag)
|
||||||
}
|
}
|
||||||
/// Get an iterator over the current set of modules imported via `import` statements
|
/// Get an iterator over the current set of modules imported via `import` statements
|
||||||
/// in reverse order.
|
/// in reverse order.
|
||||||
@ -227,7 +238,7 @@ impl<'a> NativeCallContext<'a> {
|
|||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
#[inline]
|
#[inline]
|
||||||
pub fn iter_imports(&self) -> impl Iterator<Item = (&str, &Module)> {
|
pub fn iter_imports(&self) -> impl Iterator<Item = (&str, &Module)> {
|
||||||
self.global.iter().flat_map(|&g| g.iter_imports())
|
self.global.iter_imports()
|
||||||
}
|
}
|
||||||
/// Get an iterator over the current set of modules imported via `import` statements in reverse order.
|
/// Get an iterator over the current set of modules imported via `import` statements in reverse order.
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
@ -235,8 +246,8 @@ impl<'a> NativeCallContext<'a> {
|
|||||||
#[inline]
|
#[inline]
|
||||||
pub(crate) fn iter_imports_raw(
|
pub(crate) fn iter_imports_raw(
|
||||||
&self,
|
&self,
|
||||||
) -> impl Iterator<Item = (&crate::ImmutableString, &Shared<Module>)> {
|
) -> impl Iterator<Item = (&crate::ImmutableString, &SharedModule)> {
|
||||||
self.global.iter().flat_map(|&g| g.iter_imports_raw())
|
self.global.iter_imports_raw()
|
||||||
}
|
}
|
||||||
/// _(internals)_ The current [`GlobalRuntimeState`], if any.
|
/// _(internals)_ The current [`GlobalRuntimeState`], if any.
|
||||||
/// Exported under the `internals` feature only.
|
/// Exported under the `internals` feature only.
|
||||||
@ -245,21 +256,21 @@ impl<'a> NativeCallContext<'a> {
|
|||||||
#[cfg(feature = "internals")]
|
#[cfg(feature = "internals")]
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn global_runtime_state(&self) -> Option<&GlobalRuntimeState> {
|
pub const fn global_runtime_state(&self) -> &GlobalRuntimeState {
|
||||||
self.global
|
self.global
|
||||||
}
|
}
|
||||||
/// Get an iterator over the namespaces containing definitions of all script-defined functions
|
/// Get an iterator over the namespaces containing definitions of all script-defined functions
|
||||||
/// in reverse order (i.e. parent namespaces are iterated after child namespaces).
|
/// in reverse order (i.e. parent namespaces are iterated after child namespaces).
|
||||||
#[inline]
|
#[inline]
|
||||||
pub fn iter_namespaces(&self) -> impl Iterator<Item = &Module> {
|
pub fn iter_namespaces(&self) -> impl Iterator<Item = &Module> {
|
||||||
self.lib.iter().copied()
|
self.lib.iter().map(|m| m.as_ref())
|
||||||
}
|
}
|
||||||
/// _(internals)_ The current stack of namespaces containing definitions of all script-defined functions.
|
/// _(internals)_ The current stack of namespaces containing definitions of all script-defined functions.
|
||||||
/// Exported under the `internals` feature only.
|
/// Exported under the `internals` feature only.
|
||||||
#[cfg(feature = "internals")]
|
#[cfg(feature = "internals")]
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn namespaces(&self) -> &[&Module] {
|
pub const fn namespaces(&self) -> &[SharedModule] {
|
||||||
self.lib
|
self.lib
|
||||||
}
|
}
|
||||||
/// Call a function inside the call context with the provided arguments.
|
/// Call a function inside the call context with the provided arguments.
|
||||||
@ -274,7 +285,7 @@ impl<'a> NativeCallContext<'a> {
|
|||||||
|
|
||||||
let mut args: StaticVec<_> = arg_values.iter_mut().collect();
|
let mut args: StaticVec<_> = arg_values.iter_mut().collect();
|
||||||
|
|
||||||
let result = self.call_fn_raw(fn_name, false, false, &mut args)?;
|
let result = self._call_fn_raw(fn_name, false, false, false, &mut args)?;
|
||||||
|
|
||||||
let typ = self.engine().map_type_name(result.type_name());
|
let typ = self.engine().map_type_name(result.type_name());
|
||||||
|
|
||||||
@ -283,7 +294,32 @@ impl<'a> NativeCallContext<'a> {
|
|||||||
ERR::ErrorMismatchOutputType(t, typ.into(), Position::NONE).into()
|
ERR::ErrorMismatchOutputType(t, typ.into(), Position::NONE).into()
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
/// Call a function inside the call context.
|
/// Call a registered native Rust function inside the call context with the provided arguments.
|
||||||
|
///
|
||||||
|
/// This is often useful because Rust functions typically only want to cross-call other
|
||||||
|
/// registered Rust functions and not have to worry about scripted functions hijacking the
|
||||||
|
/// process unknowingly (or deliberately).
|
||||||
|
#[inline]
|
||||||
|
pub fn call_native_fn<T: Variant + Clone>(
|
||||||
|
&self,
|
||||||
|
fn_name: impl AsRef<str>,
|
||||||
|
args: impl FuncArgs,
|
||||||
|
) -> RhaiResultOf<T> {
|
||||||
|
let mut arg_values = StaticVec::new_const();
|
||||||
|
args.parse(&mut arg_values);
|
||||||
|
|
||||||
|
let mut args: StaticVec<_> = arg_values.iter_mut().collect();
|
||||||
|
|
||||||
|
let result = self._call_fn_raw(fn_name, true, false, false, &mut args)?;
|
||||||
|
|
||||||
|
let typ = self.engine().map_type_name(result.type_name());
|
||||||
|
|
||||||
|
result.try_cast().ok_or_else(|| {
|
||||||
|
let t = self.engine().map_type_name(type_name::<T>()).into();
|
||||||
|
ERR::ErrorMismatchOutputType(t, typ.into(), Position::NONE).into()
|
||||||
|
})
|
||||||
|
}
|
||||||
|
/// Call a function (native Rust or scripted) inside the call context.
|
||||||
///
|
///
|
||||||
/// If `is_method_call` is [`true`], the first argument is assumed to be the `this` pointer for
|
/// If `is_method_call` is [`true`], the first argument is assumed to be the `this` pointer for
|
||||||
/// a script-defined function (or the object of a method call).
|
/// a script-defined function (or the object of a method call).
|
||||||
@ -302,6 +338,7 @@ impl<'a> NativeCallContext<'a> {
|
|||||||
///
|
///
|
||||||
/// If `is_ref_mut` is [`true`], the first argument is assumed to be passed by reference and is
|
/// If `is_ref_mut` is [`true`], the first argument is assumed to be passed by reference and is
|
||||||
/// not consumed.
|
/// not consumed.
|
||||||
|
#[inline(always)]
|
||||||
pub fn call_fn_raw(
|
pub fn call_fn_raw(
|
||||||
&self,
|
&self,
|
||||||
fn_name: impl AsRef<str>,
|
fn_name: impl AsRef<str>,
|
||||||
@ -309,15 +346,81 @@ impl<'a> NativeCallContext<'a> {
|
|||||||
is_method_call: bool,
|
is_method_call: bool,
|
||||||
args: &mut [&mut Dynamic],
|
args: &mut [&mut Dynamic],
|
||||||
) -> RhaiResult {
|
) -> RhaiResult {
|
||||||
let mut global = self
|
let name = fn_name.as_ref();
|
||||||
.global
|
let native_only = !is_valid_function_name(name);
|
||||||
.cloned()
|
#[cfg(not(feature = "no_function"))]
|
||||||
.unwrap_or_else(|| GlobalRuntimeState::new(self.engine()));
|
let native_only = native_only && !crate::parser::is_anonymous_fn(name);
|
||||||
let mut caches = Caches::new();
|
|
||||||
|
self._call_fn_raw(fn_name, native_only, is_ref_mut, is_method_call, args)
|
||||||
|
}
|
||||||
|
/// Call a registered native Rust function inside the call context.
|
||||||
|
///
|
||||||
|
/// This is often useful because Rust functions typically only want to cross-call other
|
||||||
|
/// registered Rust functions and not have to worry about scripted functions hijacking the
|
||||||
|
/// process unknowingly (or deliberately).
|
||||||
|
///
|
||||||
|
/// # WARNING - Low Level API
|
||||||
|
///
|
||||||
|
/// This function is very low level.
|
||||||
|
///
|
||||||
|
/// # Arguments
|
||||||
|
///
|
||||||
|
/// All arguments may be _consumed_, meaning that they may be replaced by `()`. This is to avoid
|
||||||
|
/// unnecessarily cloning the arguments.
|
||||||
|
///
|
||||||
|
/// **DO NOT** reuse the arguments after this call. If they are needed afterwards, clone them
|
||||||
|
/// _before_ calling this function.
|
||||||
|
///
|
||||||
|
/// If `is_ref_mut` is [`true`], the first argument is assumed to be passed by reference and is
|
||||||
|
/// not consumed.
|
||||||
|
#[inline(always)]
|
||||||
|
pub fn call_native_fn_raw(
|
||||||
|
&self,
|
||||||
|
fn_name: impl AsRef<str>,
|
||||||
|
is_ref_mut: bool,
|
||||||
|
args: &mut [&mut Dynamic],
|
||||||
|
) -> RhaiResult {
|
||||||
|
self._call_fn_raw(fn_name, true, is_ref_mut, false, args)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Call a function (native Rust or scripted) inside the call context.
|
||||||
|
fn _call_fn_raw(
|
||||||
|
&self,
|
||||||
|
fn_name: impl AsRef<str>,
|
||||||
|
native_only: bool,
|
||||||
|
is_ref_mut: bool,
|
||||||
|
is_method_call: bool,
|
||||||
|
args: &mut [&mut Dynamic],
|
||||||
|
) -> RhaiResult {
|
||||||
|
let mut global = &mut self.global.clone();
|
||||||
|
let caches = &mut Caches::new();
|
||||||
|
|
||||||
let fn_name = fn_name.as_ref();
|
let fn_name = fn_name.as_ref();
|
||||||
|
let op_token = Token::lookup_symbol_from_syntax(fn_name);
|
||||||
|
let op_token = op_token.as_ref();
|
||||||
let args_len = args.len();
|
let args_len = args.len();
|
||||||
|
|
||||||
|
global.level += 1;
|
||||||
|
|
||||||
|
if native_only {
|
||||||
|
return self
|
||||||
|
.engine()
|
||||||
|
.exec_native_fn_call(
|
||||||
|
global,
|
||||||
|
caches,
|
||||||
|
self.lib,
|
||||||
|
fn_name,
|
||||||
|
op_token,
|
||||||
|
calc_fn_hash(None, fn_name, args_len),
|
||||||
|
args,
|
||||||
|
is_ref_mut,
|
||||||
|
Position::NONE,
|
||||||
|
)
|
||||||
|
.map(|(r, ..)| r);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Native or script
|
||||||
|
|
||||||
let hash = if is_method_call {
|
let hash = if is_method_call {
|
||||||
FnCallHashes::from_all(
|
FnCallHashes::from_all(
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
@ -330,17 +433,17 @@ impl<'a> NativeCallContext<'a> {
|
|||||||
|
|
||||||
self.engine()
|
self.engine()
|
||||||
.exec_fn_call(
|
.exec_fn_call(
|
||||||
None,
|
global,
|
||||||
&mut global,
|
caches,
|
||||||
&mut caches,
|
|
||||||
self.lib,
|
self.lib,
|
||||||
|
None,
|
||||||
fn_name,
|
fn_name,
|
||||||
|
op_token,
|
||||||
hash,
|
hash,
|
||||||
args,
|
args,
|
||||||
is_ref_mut,
|
is_ref_mut,
|
||||||
is_method_call,
|
is_method_call,
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
self.level + 1,
|
|
||||||
)
|
)
|
||||||
.map(|(r, ..)| r)
|
.map(|(r, ..)| r)
|
||||||
}
|
}
|
||||||
|
@ -29,4 +29,14 @@ pub trait PluginFunction {
|
|||||||
/// Is this plugin function a method?
|
/// Is this plugin function a method?
|
||||||
#[must_use]
|
#[must_use]
|
||||||
fn is_method_call(&self) -> bool;
|
fn is_method_call(&self) -> bool;
|
||||||
|
|
||||||
|
/// Is this plugin function pure?
|
||||||
|
///
|
||||||
|
/// This defaults to `true` such that any old implementation that has constant-checking code
|
||||||
|
/// inside the function itself will continue to work.
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
fn is_pure(&self) -> bool {
|
||||||
|
true
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
@ -86,35 +86,39 @@ pub trait RegisterNativeFunction<ARGS, RET, RESULT> {
|
|||||||
/// _(metadata)_ Get the type name of this function's return value.
|
/// _(metadata)_ Get the type name of this function's return value.
|
||||||
/// Exported under the `metadata` feature only.
|
/// Exported under the `metadata` feature only.
|
||||||
#[cfg(feature = "metadata")]
|
#[cfg(feature = "metadata")]
|
||||||
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
fn return_type_name() -> &'static str;
|
fn return_type_name() -> &'static str {
|
||||||
|
std::any::type_name::<RET>()
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
const EXPECT_ARGS: &str = "arguments";
|
const EXPECT_ARGS: &str = "arguments";
|
||||||
|
|
||||||
macro_rules! check_constant {
|
macro_rules! check_constant {
|
||||||
($ctx:ident, $args:ident) => {
|
($abi:ident, $ctx:ident, $args:ident) => {
|
||||||
#[cfg(any(not(feature = "no_object"), not(feature = "no_index")))]
|
#[cfg(any(not(feature = "no_object"), not(feature = "no_index")))]
|
||||||
{
|
if stringify!($abi) == "Method" && !$args.is_empty() {
|
||||||
let args_len = $args.len();
|
let deny = match $args.len() {
|
||||||
|
|
||||||
if args_len > 0 && $args[0].is_read_only() {
|
|
||||||
let deny = match $ctx.fn_name() {
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
|
||||||
f if args_len == 2 && f.starts_with(crate::engine::FN_SET) => true,
|
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
crate::engine::FN_IDX_SET if args_len == 3 => true,
|
3 if $ctx.fn_name() == crate::engine::FN_IDX_SET && $args[0].is_read_only() => true,
|
||||||
|
#[cfg(not(feature = "no_object"))]
|
||||||
|
2 if $ctx.fn_name().starts_with(crate::engine::FN_SET)
|
||||||
|
&& $args[0].is_read_only() =>
|
||||||
|
{
|
||||||
|
true
|
||||||
|
}
|
||||||
_ => false,
|
_ => false,
|
||||||
};
|
};
|
||||||
|
|
||||||
if deny {
|
if deny {
|
||||||
return Err(crate::ERR::ErrorAssignmentToConstant(
|
return Err(crate::ERR::ErrorNonPureMethodCallOnConstant(
|
||||||
String::new(),
|
$ctx.fn_name().to_string(),
|
||||||
crate::Position::NONE,
|
crate::Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -138,11 +142,10 @@ macro_rules! def_register {
|
|||||||
#[inline(always)] fn param_types() -> Box<[TypeId]> { vec![$(TypeId::of::<$par>()),*].into_boxed_slice() }
|
#[inline(always)] fn param_types() -> Box<[TypeId]> { vec![$(TypeId::of::<$par>()),*].into_boxed_slice() }
|
||||||
#[cfg(feature = "metadata")] #[inline(always)] fn param_names() -> Box<[&'static str]> { vec![$(std::any::type_name::<$param>()),*].into_boxed_slice() }
|
#[cfg(feature = "metadata")] #[inline(always)] fn param_names() -> Box<[&'static str]> { vec![$(std::any::type_name::<$param>()),*].into_boxed_slice() }
|
||||||
#[cfg(feature = "metadata")] #[inline(always)] fn return_type() -> TypeId { TypeId::of::<RET>() }
|
#[cfg(feature = "metadata")] #[inline(always)] fn return_type() -> TypeId { TypeId::of::<RET>() }
|
||||||
#[cfg(feature = "metadata")] #[inline(always)] fn return_type_name() -> &'static str { std::any::type_name::<RET>() }
|
|
||||||
#[inline(always)] fn into_callable_function(self) -> CallableFunction {
|
#[inline(always)] fn into_callable_function(self) -> CallableFunction {
|
||||||
CallableFunction::$abi(Shared::new(move |_ctx: NativeCallContext, args: &mut FnCallArgs| {
|
CallableFunction::$abi(Shared::new(move |_ctx: NativeCallContext, args: &mut FnCallArgs| {
|
||||||
// The arguments are assumed to be of the correct number and types!
|
// The arguments are assumed to be of the correct number and types!
|
||||||
check_constant!(_ctx, args);
|
check_constant!($abi, _ctx, args);
|
||||||
|
|
||||||
let mut _drain = args.iter_mut();
|
let mut _drain = args.iter_mut();
|
||||||
$($let $par = ($clone)(_drain.next().expect(EXPECT_ARGS)); )*
|
$($let $par = ($clone)(_drain.next().expect(EXPECT_ARGS)); )*
|
||||||
@ -164,11 +167,10 @@ macro_rules! def_register {
|
|||||||
#[inline(always)] fn param_types() -> Box<[TypeId]> { vec![$(TypeId::of::<$par>()),*].into_boxed_slice() }
|
#[inline(always)] fn param_types() -> Box<[TypeId]> { vec![$(TypeId::of::<$par>()),*].into_boxed_slice() }
|
||||||
#[cfg(feature = "metadata")] #[inline(always)] fn param_names() -> Box<[&'static str]> { vec![$(std::any::type_name::<$param>()),*].into_boxed_slice() }
|
#[cfg(feature = "metadata")] #[inline(always)] fn param_names() -> Box<[&'static str]> { vec![$(std::any::type_name::<$param>()),*].into_boxed_slice() }
|
||||||
#[cfg(feature = "metadata")] #[inline(always)] fn return_type() -> TypeId { TypeId::of::<RET>() }
|
#[cfg(feature = "metadata")] #[inline(always)] fn return_type() -> TypeId { TypeId::of::<RET>() }
|
||||||
#[cfg(feature = "metadata")] #[inline(always)] fn return_type_name() -> &'static str { std::any::type_name::<RET>() }
|
|
||||||
#[inline(always)] fn into_callable_function(self) -> CallableFunction {
|
#[inline(always)] fn into_callable_function(self) -> CallableFunction {
|
||||||
CallableFunction::$abi(Shared::new(move |ctx: NativeCallContext, args: &mut FnCallArgs| {
|
CallableFunction::$abi(Shared::new(move |ctx: NativeCallContext, args: &mut FnCallArgs| {
|
||||||
// The arguments are assumed to be of the correct number and types!
|
// The arguments are assumed to be of the correct number and types!
|
||||||
check_constant!(ctx, args);
|
check_constant!($abi, ctx, args);
|
||||||
|
|
||||||
let mut _drain = args.iter_mut();
|
let mut _drain = args.iter_mut();
|
||||||
$($let $par = ($clone)(_drain.next().expect(EXPECT_ARGS)); )*
|
$($let $par = ($clone)(_drain.next().expect(EXPECT_ARGS)); )*
|
||||||
@ -194,7 +196,7 @@ macro_rules! def_register {
|
|||||||
#[inline(always)] fn into_callable_function(self) -> CallableFunction {
|
#[inline(always)] fn into_callable_function(self) -> CallableFunction {
|
||||||
CallableFunction::$abi(Shared::new(move |_ctx: NativeCallContext, args: &mut FnCallArgs| {
|
CallableFunction::$abi(Shared::new(move |_ctx: NativeCallContext, args: &mut FnCallArgs| {
|
||||||
// The arguments are assumed to be of the correct number and types!
|
// The arguments are assumed to be of the correct number and types!
|
||||||
check_constant!(_ctx, args);
|
check_constant!($abi, _ctx, args);
|
||||||
|
|
||||||
let mut _drain = args.iter_mut();
|
let mut _drain = args.iter_mut();
|
||||||
$($let $par = ($clone)(_drain.next().expect(EXPECT_ARGS)); )*
|
$($let $par = ($clone)(_drain.next().expect(EXPECT_ARGS)); )*
|
||||||
@ -217,7 +219,7 @@ macro_rules! def_register {
|
|||||||
#[inline(always)] fn into_callable_function(self) -> CallableFunction {
|
#[inline(always)] fn into_callable_function(self) -> CallableFunction {
|
||||||
CallableFunction::$abi(Shared::new(move |ctx: NativeCallContext, args: &mut FnCallArgs| {
|
CallableFunction::$abi(Shared::new(move |ctx: NativeCallContext, args: &mut FnCallArgs| {
|
||||||
// The arguments are assumed to be of the correct number and types!
|
// The arguments are assumed to be of the correct number and types!
|
||||||
check_constant!(ctx, args);
|
check_constant!($abi, ctx, args);
|
||||||
|
|
||||||
let mut _drain = args.iter_mut();
|
let mut _drain = args.iter_mut();
|
||||||
$($let $par = ($clone)(_drain.next().expect(EXPECT_ARGS)); )*
|
$($let $par = ($clone)(_drain.next().expect(EXPECT_ARGS)); )*
|
||||||
|
@ -4,7 +4,7 @@
|
|||||||
use super::call::FnCallArgs;
|
use super::call::FnCallArgs;
|
||||||
use crate::ast::ScriptFnDef;
|
use crate::ast::ScriptFnDef;
|
||||||
use crate::eval::{Caches, GlobalRuntimeState};
|
use crate::eval::{Caches, GlobalRuntimeState};
|
||||||
use crate::{Dynamic, Engine, Module, Position, RhaiError, RhaiResult, Scope, ERR};
|
use crate::{Dynamic, Engine, Position, RhaiError, RhaiResult, Scope, SharedModule, ERR};
|
||||||
use std::mem;
|
use std::mem;
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
@ -24,16 +24,15 @@ impl Engine {
|
|||||||
/// **DO NOT** reuse the argument values unless for the first `&mut` argument - all others are silently replaced by `()`!
|
/// **DO NOT** reuse the argument values unless for the first `&mut` argument - all others are silently replaced by `()`!
|
||||||
pub(crate) fn call_script_fn(
|
pub(crate) fn call_script_fn(
|
||||||
&self,
|
&self,
|
||||||
scope: &mut Scope,
|
|
||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
caches: &mut Caches,
|
caches: &mut Caches,
|
||||||
lib: &[&Module],
|
lib: &[SharedModule],
|
||||||
this_ptr: &mut Option<&mut Dynamic>,
|
scope: &mut Scope,
|
||||||
|
this_ptr: &mut Dynamic,
|
||||||
fn_def: &ScriptFnDef,
|
fn_def: &ScriptFnDef,
|
||||||
args: &mut FnCallArgs,
|
args: &mut FnCallArgs,
|
||||||
rewind_scope: bool,
|
rewind_scope: bool,
|
||||||
pos: Position,
|
pos: Position,
|
||||||
level: usize,
|
|
||||||
) -> RhaiResult {
|
) -> RhaiResult {
|
||||||
#[cold]
|
#[cold]
|
||||||
#[inline(never)]
|
#[inline(never)]
|
||||||
@ -54,7 +53,7 @@ impl Engine {
|
|||||||
|
|
||||||
Err(ERR::ErrorInFunctionCall(
|
Err(ERR::ErrorInFunctionCall(
|
||||||
name,
|
name,
|
||||||
source.unwrap_or_else(|| global.source.to_string()),
|
source.unwrap_or_else(|| global.source().unwrap_or("").to_string()),
|
||||||
err,
|
err,
|
||||||
pos,
|
pos,
|
||||||
)
|
)
|
||||||
@ -63,12 +62,10 @@ impl Engine {
|
|||||||
|
|
||||||
assert!(fn_def.params.len() == args.len());
|
assert!(fn_def.params.len() == args.len());
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
self.track_operation(global, pos)?;
|
||||||
self.inc_operations(&mut global.num_operations, pos)?;
|
|
||||||
|
|
||||||
// Check for stack overflow
|
// Check for stack overflow
|
||||||
#[cfg(not(feature = "unchecked"))]
|
if global.level > self.max_call_levels() {
|
||||||
if level > self.max_call_levels() {
|
|
||||||
return Err(ERR::ErrorStackOverflow(pos).into());
|
return Err(ERR::ErrorStackOverflow(pos).into());
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -129,8 +126,8 @@ impl Engine {
|
|||||||
lib
|
lib
|
||||||
} else {
|
} else {
|
||||||
caches.push_fn_resolution_cache();
|
caches.push_fn_resolution_cache();
|
||||||
lib_merged.push(&**fn_lib);
|
lib_merged.push(fn_lib.clone());
|
||||||
lib_merged.extend(lib.iter().copied());
|
lib_merged.extend(lib.iter().cloned());
|
||||||
&lib_merged
|
&lib_merged
|
||||||
},
|
},
|
||||||
Some(mem::replace(&mut global.constants, constants.clone())),
|
Some(mem::replace(&mut global.constants, constants.clone())),
|
||||||
@ -142,20 +139,19 @@ impl Engine {
|
|||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
{
|
{
|
||||||
let node = crate::ast::Stmt::Noop(fn_def.body.position());
|
let node = crate::ast::Stmt::Noop(fn_def.body.position());
|
||||||
self.run_debugger(scope, global, lib, this_ptr, &node, level)?;
|
self.run_debugger(global, caches, lib, scope, this_ptr, &node)?;
|
||||||
}
|
}
|
||||||
|
|
||||||
// Evaluate the function
|
// Evaluate the function
|
||||||
let mut _result = self
|
let mut _result = self
|
||||||
.eval_stmt_block(
|
.eval_stmt_block(
|
||||||
scope,
|
|
||||||
global,
|
global,
|
||||||
caches,
|
caches,
|
||||||
lib,
|
lib,
|
||||||
|
scope,
|
||||||
this_ptr,
|
this_ptr,
|
||||||
&fn_def.body,
|
&fn_def.body,
|
||||||
rewind_scope,
|
rewind_scope,
|
||||||
level,
|
|
||||||
)
|
)
|
||||||
.or_else(|err| match *err {
|
.or_else(|err| match *err {
|
||||||
// Convert return statement to return value
|
// Convert return statement to return value
|
||||||
@ -181,7 +177,7 @@ impl Engine {
|
|||||||
#[cfg(feature = "debugging")]
|
#[cfg(feature = "debugging")]
|
||||||
{
|
{
|
||||||
let trigger = match global.debugger.status {
|
let trigger = match global.debugger.status {
|
||||||
crate::eval::DebuggerStatus::FunctionExit(n) => n >= level,
|
crate::eval::DebuggerStatus::FunctionExit(n) => n >= global.level,
|
||||||
crate::eval::DebuggerStatus::Next(.., true) => true,
|
crate::eval::DebuggerStatus::Next(.., true) => true,
|
||||||
_ => false,
|
_ => false,
|
||||||
};
|
};
|
||||||
@ -192,7 +188,7 @@ impl Engine {
|
|||||||
Ok(ref r) => crate::eval::DebuggerEvent::FunctionExitWithValue(r),
|
Ok(ref r) => crate::eval::DebuggerEvent::FunctionExitWithValue(r),
|
||||||
Err(ref err) => crate::eval::DebuggerEvent::FunctionExitWithError(err),
|
Err(ref err) => crate::eval::DebuggerEvent::FunctionExitWithError(err),
|
||||||
};
|
};
|
||||||
match self.run_debugger_raw(scope, global, lib, this_ptr, node, event, level) {
|
match self.run_debugger_raw(global, caches, lib, scope, this_ptr, node, event) {
|
||||||
Ok(_) => (),
|
Ok(_) => (),
|
||||||
Err(err) => _result = Err(err),
|
Err(err) => _result = Err(err),
|
||||||
}
|
}
|
||||||
@ -228,9 +224,9 @@ impl Engine {
|
|||||||
#[must_use]
|
#[must_use]
|
||||||
pub(crate) fn has_script_fn(
|
pub(crate) fn has_script_fn(
|
||||||
&self,
|
&self,
|
||||||
_global: Option<&GlobalRuntimeState>,
|
_global: &GlobalRuntimeState,
|
||||||
caches: &mut Caches,
|
caches: &mut Caches,
|
||||||
lib: &[&Module],
|
lib: &[SharedModule],
|
||||||
hash_script: u64,
|
hash_script: u64,
|
||||||
) -> bool {
|
) -> bool {
|
||||||
let cache = caches.fn_resolution_cache_mut();
|
let cache = caches.fn_resolution_cache_mut();
|
||||||
@ -247,17 +243,14 @@ impl Engine {
|
|||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
let result = result ||
|
let result = result ||
|
||||||
// Then check imported modules
|
// Then check imported modules
|
||||||
_global.map_or(false, |m| m.contains_qualified_fn(hash_script))
|
_global.contains_qualified_fn(hash_script)
|
||||||
// Then check sub-modules
|
// Then check sub-modules
|
||||||
|| self.global_sub_modules.values().any(|m| m.contains_qualified_fn(hash_script));
|
|| self.global_sub_modules.values().any(|m| m.contains_qualified_fn(hash_script));
|
||||||
|
|
||||||
if !result {
|
if !result && !cache.filter.is_absent_and_set(hash_script) {
|
||||||
if cache.filter.is_absent(hash_script) {
|
// Do not cache "one-hit wonders"
|
||||||
cache.filter.mark(hash_script);
|
|
||||||
} else {
|
|
||||||
cache.map.insert(hash_script, None);
|
cache.map.insert(hash_script, None);
|
||||||
}
|
}
|
||||||
}
|
|
||||||
|
|
||||||
result
|
result
|
||||||
}
|
}
|
||||||
|
25
src/lib.rs
25
src/lib.rs
@ -83,6 +83,7 @@ use std::prelude::v1::*;
|
|||||||
// Internal modules
|
// Internal modules
|
||||||
mod api;
|
mod api;
|
||||||
mod ast;
|
mod ast;
|
||||||
|
pub mod config;
|
||||||
mod engine;
|
mod engine;
|
||||||
mod eval;
|
mod eval;
|
||||||
mod func;
|
mod func;
|
||||||
@ -206,7 +207,7 @@ pub use eval::EvalContext;
|
|||||||
pub use func::{NativeCallContext, RegisterNativeFunction};
|
pub use func::{NativeCallContext, RegisterNativeFunction};
|
||||||
pub use module::{FnNamespace, Module};
|
pub use module::{FnNamespace, Module};
|
||||||
pub use tokenizer::Position;
|
pub use tokenizer::Position;
|
||||||
#[cfg(not(feature = "no_std"))]
|
#[cfg(not(feature = "no_time"))]
|
||||||
pub use types::Instant;
|
pub use types::Instant;
|
||||||
pub use types::{
|
pub use types::{
|
||||||
Dynamic, EvalAltResult, FnPtr, ImmutableString, LexError, ParseError, ParseErrorType, Scope,
|
Dynamic, EvalAltResult, FnPtr, ImmutableString, LexError, ParseError, ParseErrorType, Scope,
|
||||||
@ -227,7 +228,7 @@ pub mod debugger {
|
|||||||
/// An identifier in Rhai. [`SmartString`](https://crates.io/crates/smartstring) is used because most
|
/// An identifier in Rhai. [`SmartString`](https://crates.io/crates/smartstring) is used because most
|
||||||
/// identifiers are ASCII and short, fewer than 23 characters, so they can be stored inline.
|
/// identifiers are ASCII and short, fewer than 23 characters, so they can be stored inline.
|
||||||
#[cfg(not(feature = "internals"))]
|
#[cfg(not(feature = "internals"))]
|
||||||
pub(crate) type Identifier = SmartString;
|
type Identifier = SmartString;
|
||||||
|
|
||||||
/// An identifier in Rhai. [`SmartString`](https://crates.io/crates/smartstring) is used because most
|
/// An identifier in Rhai. [`SmartString`](https://crates.io/crates/smartstring) is used because most
|
||||||
/// identifiers are ASCII and short, fewer than 23 characters, so they can be stored inline.
|
/// identifiers are ASCII and short, fewer than 23 characters, so they can be stored inline.
|
||||||
@ -240,7 +241,10 @@ pub use func::Shared;
|
|||||||
/// Alias to [`RefCell`][std::cell::RefCell] or [`RwLock`][std::sync::RwLock] depending on the `sync` feature flag.
|
/// Alias to [`RefCell`][std::cell::RefCell] or [`RwLock`][std::sync::RwLock] depending on the `sync` feature flag.
|
||||||
pub use func::Locked;
|
pub use func::Locked;
|
||||||
|
|
||||||
pub(crate) use func::{calc_fn_hash, calc_fn_params_hash, calc_var_hash, combine_hashes};
|
use func::{calc_fn_hash, calc_fn_hash_full, calc_var_hash};
|
||||||
|
|
||||||
|
/// A shared [`Module`].
|
||||||
|
type SharedModule = Shared<Module>;
|
||||||
|
|
||||||
pub use rhai_codegen::*;
|
pub use rhai_codegen::*;
|
||||||
|
|
||||||
@ -343,6 +347,9 @@ pub use eval::{Caches, FnResolutionCache, FnResolutionCacheEntry, GlobalRuntimeS
|
|||||||
#[cfg(feature = "metadata")]
|
#[cfg(feature = "metadata")]
|
||||||
pub use api::definitions::Definitions;
|
pub use api::definitions::Definitions;
|
||||||
|
|
||||||
|
/// Number of items to keep inline for [`StaticVec`].
|
||||||
|
const STATIC_VEC_INLINE_SIZE: usize = 3;
|
||||||
|
|
||||||
/// Alias to [`smallvec::SmallVec<[T; 3]>`](https://crates.io/crates/smallvec), which is a
|
/// Alias to [`smallvec::SmallVec<[T; 3]>`](https://crates.io/crates/smallvec), which is a
|
||||||
/// specialized [`Vec`] backed by a small, inline, fixed-size array when there are ≤ 3 items stored.
|
/// specialized [`Vec`] backed by a small, inline, fixed-size array when there are ≤ 3 items stored.
|
||||||
///
|
///
|
||||||
@ -375,7 +382,7 @@ pub use api::definitions::Definitions;
|
|||||||
/// most scripts load fewer than 4 external modules; most module paths contain fewer than 4 levels
|
/// most scripts load fewer than 4 external modules; most module paths contain fewer than 4 levels
|
||||||
/// (e.g. `std::collections::map::HashMap` is 4 levels and it is just about as long as they get).
|
/// (e.g. `std::collections::map::HashMap` is 4 levels and it is just about as long as they get).
|
||||||
#[cfg(not(feature = "internals"))]
|
#[cfg(not(feature = "internals"))]
|
||||||
type StaticVec<T> = smallvec::SmallVec<[T; 3]>;
|
type StaticVec<T> = smallvec::SmallVec<[T; STATIC_VEC_INLINE_SIZE]>;
|
||||||
|
|
||||||
/// _(internals)_ Alias to [`smallvec::SmallVec<[T; 3]>`](https://crates.io/crates/smallvec),
|
/// _(internals)_ Alias to [`smallvec::SmallVec<[T; 3]>`](https://crates.io/crates/smallvec),
|
||||||
/// which is a [`Vec`] backed by a small, inline, fixed-size array when there are ≤ 3 items stored.
|
/// which is a [`Vec`] backed by a small, inline, fixed-size array when there are ≤ 3 items stored.
|
||||||
@ -410,7 +417,11 @@ type StaticVec<T> = smallvec::SmallVec<[T; 3]>;
|
|||||||
/// most scripts load fewer than 4 external modules; most module paths contain fewer than 4 levels
|
/// most scripts load fewer than 4 external modules; most module paths contain fewer than 4 levels
|
||||||
/// (e.g. `std::collections::map::HashMap` is 4 levels and it is just about as long as they get).
|
/// (e.g. `std::collections::map::HashMap` is 4 levels and it is just about as long as they get).
|
||||||
#[cfg(feature = "internals")]
|
#[cfg(feature = "internals")]
|
||||||
pub type StaticVec<T> = smallvec::SmallVec<[T; 3]>;
|
pub type StaticVec<T> = smallvec::SmallVec<[T; STATIC_VEC_INLINE_SIZE]>;
|
||||||
|
|
||||||
|
/// Number of items to keep inline for [`FnArgsVec`].
|
||||||
|
#[cfg(not(feature = "no_closure"))]
|
||||||
|
const FN_ARGS_VEC_INLINE_SIZE: usize = 5;
|
||||||
|
|
||||||
/// Inline arguments storage for function calls.
|
/// Inline arguments storage for function calls.
|
||||||
///
|
///
|
||||||
@ -425,14 +436,14 @@ pub type StaticVec<T> = smallvec::SmallVec<[T; 3]>;
|
|||||||
///
|
///
|
||||||
/// Under `no_closure`, this type aliases to [`StaticVec`][crate::StaticVec] instead.
|
/// Under `no_closure`, this type aliases to [`StaticVec`][crate::StaticVec] instead.
|
||||||
#[cfg(not(feature = "no_closure"))]
|
#[cfg(not(feature = "no_closure"))]
|
||||||
type FnArgsVec<T> = smallvec::SmallVec<[T; 5]>;
|
type FnArgsVec<T> = smallvec::SmallVec<[T; FN_ARGS_VEC_INLINE_SIZE]>;
|
||||||
|
|
||||||
/// Inline arguments storage for function calls.
|
/// Inline arguments storage for function calls.
|
||||||
/// This type aliases to [`StaticVec`][crate::StaticVec].
|
/// This type aliases to [`StaticVec`][crate::StaticVec].
|
||||||
#[cfg(feature = "no_closure")]
|
#[cfg(feature = "no_closure")]
|
||||||
type FnArgsVec<T> = crate::StaticVec<T>;
|
type FnArgsVec<T> = crate::StaticVec<T>;
|
||||||
|
|
||||||
pub(crate) type SmartString = smartstring::SmartString<smartstring::LazyCompact>;
|
type SmartString = smartstring::SmartString<smartstring::LazyCompact>;
|
||||||
|
|
||||||
// Compiler guards against mutually-exclusive feature flags
|
// Compiler guards against mutually-exclusive feature flags
|
||||||
|
|
||||||
|
@ -9,8 +9,8 @@ use crate::func::{
|
|||||||
};
|
};
|
||||||
use crate::types::{dynamic::Variant, BloomFilterU64, CustomTypesCollection};
|
use crate::types::{dynamic::Variant, BloomFilterU64, CustomTypesCollection};
|
||||||
use crate::{
|
use crate::{
|
||||||
calc_fn_hash, calc_fn_params_hash, combine_hashes, Dynamic, Identifier, ImmutableString,
|
calc_fn_hash, calc_fn_hash_full, Dynamic, Identifier, ImmutableString, NativeCallContext,
|
||||||
NativeCallContext, RhaiResultOf, Shared, SmartString, StaticVec,
|
RhaiResultOf, Shared, SharedModule, SmartString, StaticVec,
|
||||||
};
|
};
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
@ -72,7 +72,7 @@ pub struct FuncInfo {
|
|||||||
/// Function access mode.
|
/// Function access mode.
|
||||||
pub access: FnAccess,
|
pub access: FnAccess,
|
||||||
/// Function name.
|
/// Function name.
|
||||||
pub name: Identifier,
|
pub name: ImmutableString,
|
||||||
/// Number of parameters.
|
/// Number of parameters.
|
||||||
pub num_params: usize,
|
pub num_params: usize,
|
||||||
/// Parameter types (if applicable).
|
/// Parameter types (if applicable).
|
||||||
@ -150,9 +150,10 @@ pub fn calc_native_fn_hash<'a>(
|
|||||||
fn_name: &str,
|
fn_name: &str,
|
||||||
params: &[TypeId],
|
params: &[TypeId],
|
||||||
) -> u64 {
|
) -> u64 {
|
||||||
let hash_script = calc_fn_hash(modules, fn_name, params.len());
|
calc_fn_hash_full(
|
||||||
let hash_params = calc_fn_params_hash(params.iter().copied());
|
calc_fn_hash(modules, fn_name, params.len()),
|
||||||
combine_hashes(hash_script, hash_params)
|
params.iter().copied(),
|
||||||
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// A module which may contain variables, sub-modules, external Rust functions,
|
/// A module which may contain variables, sub-modules, external Rust functions,
|
||||||
@ -160,8 +161,7 @@ pub fn calc_native_fn_hash<'a>(
|
|||||||
#[derive(Clone)]
|
#[derive(Clone)]
|
||||||
pub struct Module {
|
pub struct Module {
|
||||||
/// ID identifying the module.
|
/// ID identifying the module.
|
||||||
/// No ID if string is empty.
|
id: Option<ImmutableString>,
|
||||||
id: Identifier,
|
|
||||||
/// Module documentation.
|
/// Module documentation.
|
||||||
#[cfg(feature = "metadata")]
|
#[cfg(feature = "metadata")]
|
||||||
doc: crate::SmartString,
|
doc: crate::SmartString,
|
||||||
@ -172,7 +172,7 @@ pub struct Module {
|
|||||||
/// Custom types.
|
/// Custom types.
|
||||||
custom_types: Option<CustomTypesCollection>,
|
custom_types: Option<CustomTypesCollection>,
|
||||||
/// Sub-modules.
|
/// Sub-modules.
|
||||||
modules: Option<BTreeMap<Identifier, Shared<Module>>>,
|
modules: Option<BTreeMap<Identifier, SharedModule>>,
|
||||||
/// [`Module`] variables.
|
/// [`Module`] variables.
|
||||||
variables: Option<BTreeMap<Identifier, Dynamic>>,
|
variables: Option<BTreeMap<Identifier, Dynamic>>,
|
||||||
/// Flattened collection of all [`Module`] variables, including those in sub-modules.
|
/// Flattened collection of all [`Module`] variables, including those in sub-modules.
|
||||||
@ -196,12 +196,15 @@ pub struct Module {
|
|||||||
|
|
||||||
impl Default for Module {
|
impl Default for Module {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
Self::new()
|
Self::new()
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl fmt::Debug for Module {
|
impl fmt::Debug for Module {
|
||||||
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
let mut d = f.debug_struct("Module");
|
let mut d = f.debug_struct("Module");
|
||||||
|
|
||||||
@ -289,7 +292,7 @@ impl Module {
|
|||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn with_capacity(capacity: usize) -> Self {
|
pub fn with_capacity(capacity: usize) -> Self {
|
||||||
Self {
|
Self {
|
||||||
id: Identifier::new_const(),
|
id: None,
|
||||||
#[cfg(feature = "metadata")]
|
#[cfg(feature = "metadata")]
|
||||||
doc: crate::SmartString::new_const(),
|
doc: crate::SmartString::new_const(),
|
||||||
internal: false,
|
internal: false,
|
||||||
@ -321,18 +324,14 @@ impl Module {
|
|||||||
#[inline]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn id(&self) -> Option<&str> {
|
pub fn id(&self) -> Option<&str> {
|
||||||
if self.id_raw().is_empty() {
|
self.id.as_ref().map(|s| s.as_str())
|
||||||
None
|
|
||||||
} else {
|
|
||||||
Some(self.id_raw())
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Get the ID of the [`Module`] as an [`Identifier`], if any.
|
/// Get the ID of the [`Module`] as an [`Identifier`], if any.
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub(crate) const fn id_raw(&self) -> &Identifier {
|
pub(crate) const fn id_raw(&self) -> Option<&ImmutableString> {
|
||||||
&self.id
|
self.id.as_ref()
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Set the ID of the [`Module`].
|
/// Set the ID of the [`Module`].
|
||||||
@ -348,8 +347,15 @@ impl Module {
|
|||||||
/// assert_eq!(module.id(), Some("hello"));
|
/// assert_eq!(module.id(), Some("hello"));
|
||||||
/// ```
|
/// ```
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn set_id(&mut self, id: impl Into<Identifier>) -> &mut Self {
|
pub fn set_id(&mut self, id: impl Into<ImmutableString>) -> &mut Self {
|
||||||
self.id = id.into();
|
let id = id.into();
|
||||||
|
|
||||||
|
if id.is_empty() {
|
||||||
|
self.id = None;
|
||||||
|
} else {
|
||||||
|
self.id = Some(id);
|
||||||
|
}
|
||||||
|
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -367,7 +373,7 @@ impl Module {
|
|||||||
/// ```
|
/// ```
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn clear_id(&mut self) -> &mut Self {
|
pub fn clear_id(&mut self) -> &mut Self {
|
||||||
self.id.clear();
|
self.id = None;
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -431,7 +437,7 @@ impl Module {
|
|||||||
/// Clear the [`Module`].
|
/// Clear the [`Module`].
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn clear(&mut self) {
|
pub fn clear(&mut self) {
|
||||||
self.id.clear();
|
self.id = None;
|
||||||
#[cfg(feature = "metadata")]
|
#[cfg(feature = "metadata")]
|
||||||
self.doc.clear();
|
self.doc.clear();
|
||||||
self.internal = false;
|
self.internal = false;
|
||||||
@ -491,12 +497,12 @@ impl Module {
|
|||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn set_custom_type_raw(
|
pub fn set_custom_type_raw(
|
||||||
&mut self,
|
&mut self,
|
||||||
type_name: impl Into<Identifier>,
|
type_path: impl Into<Identifier>,
|
||||||
name: impl Into<Identifier>,
|
name: impl Into<Identifier>,
|
||||||
) -> &mut Self {
|
) -> &mut Self {
|
||||||
self.custom_types
|
self.custom_types
|
||||||
.get_or_insert_with(CustomTypesCollection::new)
|
.get_or_insert_with(CustomTypesCollection::new)
|
||||||
.add(type_name, name);
|
.add(type_path, name);
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
/// Get the display name of a registered custom type.
|
/// Get the display name of a registered custom type.
|
||||||
@ -748,7 +754,7 @@ impl Module {
|
|||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
#[inline]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub(crate) fn get_sub_modules_mut(&mut self) -> &mut BTreeMap<Identifier, Shared<Module>> {
|
pub(crate) fn get_sub_modules_mut(&mut self) -> &mut BTreeMap<Identifier, SharedModule> {
|
||||||
// We must assume that the user has changed the sub-modules
|
// We must assume that the user has changed the sub-modules
|
||||||
// (otherwise why take a mutable reference?)
|
// (otherwise why take a mutable reference?)
|
||||||
self.all_functions = None;
|
self.all_functions = None;
|
||||||
@ -816,7 +822,7 @@ impl Module {
|
|||||||
pub fn set_sub_module(
|
pub fn set_sub_module(
|
||||||
&mut self,
|
&mut self,
|
||||||
name: impl Into<Identifier>,
|
name: impl Into<Identifier>,
|
||||||
sub_module: impl Into<Shared<Module>>,
|
sub_module: impl Into<SharedModule>,
|
||||||
) -> &mut Self {
|
) -> &mut Self {
|
||||||
self.modules
|
self.modules
|
||||||
.get_or_insert_with(|| Default::default())
|
.get_or_insert_with(|| Default::default())
|
||||||
@ -1022,8 +1028,7 @@ impl Module {
|
|||||||
|
|
||||||
let name = name.as_ref();
|
let name = name.as_ref();
|
||||||
let hash_script = calc_fn_hash(None, name, param_types.len());
|
let hash_script = calc_fn_hash(None, name, param_types.len());
|
||||||
let hash_params = calc_fn_params_hash(param_types.iter().copied());
|
let hash_fn = calc_fn_hash_full(hash_script, param_types.iter().copied());
|
||||||
let hash_fn = combine_hashes(hash_script, hash_params);
|
|
||||||
|
|
||||||
if is_dynamic {
|
if is_dynamic {
|
||||||
self.dynamic_functions_filter.mark(hash_script);
|
self.dynamic_functions_filter.mark(hash_script);
|
||||||
@ -1739,10 +1744,9 @@ impl Module {
|
|||||||
}
|
}
|
||||||
|
|
||||||
if let Some(ref variables) = other.variables {
|
if let Some(ref variables) = other.variables {
|
||||||
if let Some(ref mut m) = self.variables {
|
match self.variables {
|
||||||
m.extend(variables.iter().map(|(k, v)| (k.clone(), v.clone())));
|
Some(ref mut m) => m.extend(variables.iter().map(|(k, v)| (k.clone(), v.clone()))),
|
||||||
} else {
|
None => self.variables = other.variables.clone(),
|
||||||
self.variables = other.variables.clone();
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -1764,10 +1768,9 @@ impl Module {
|
|||||||
self.dynamic_functions_filter += &other.dynamic_functions_filter;
|
self.dynamic_functions_filter += &other.dynamic_functions_filter;
|
||||||
|
|
||||||
if let Some(ref type_iterators) = other.type_iterators {
|
if let Some(ref type_iterators) = other.type_iterators {
|
||||||
if let Some(ref mut t) = self.type_iterators {
|
match self.type_iterators {
|
||||||
t.extend(type_iterators.iter().map(|(&k, v)| (k, v.clone())));
|
Some(ref mut t) => t.extend(type_iterators.iter().map(|(&k, v)| (k, v.clone()))),
|
||||||
} else {
|
None => self.type_iterators = other.type_iterators.clone(),
|
||||||
self.type_iterators = other.type_iterators.clone();
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
self.all_functions = None;
|
self.all_functions = None;
|
||||||
@ -1827,7 +1830,7 @@ impl Module {
|
|||||||
|
|
||||||
/// Get an iterator to the sub-modules in the [`Module`].
|
/// Get an iterator to the sub-modules in the [`Module`].
|
||||||
#[inline]
|
#[inline]
|
||||||
pub fn iter_sub_modules(&self) -> impl Iterator<Item = (&str, &Shared<Module>)> {
|
pub fn iter_sub_modules(&self) -> impl Iterator<Item = (&str, &SharedModule)> {
|
||||||
self.modules
|
self.modules
|
||||||
.iter()
|
.iter()
|
||||||
.flat_map(|m| m.iter().map(|(k, m)| (k.as_str(), m)))
|
.flat_map(|m| m.iter().map(|(k, m)| (k.as_str(), m)))
|
||||||
@ -1981,7 +1984,9 @@ impl Module {
|
|||||||
let orig_constants = std::mem::take(&mut global.constants);
|
let orig_constants = std::mem::take(&mut global.constants);
|
||||||
|
|
||||||
// Run the script
|
// Run the script
|
||||||
let result = engine.eval_ast_with_scope_raw(&mut scope, global, ast, 0);
|
let caches = &mut crate::eval::Caches::new();
|
||||||
|
|
||||||
|
let result = engine.eval_ast_with_scope_raw(global, caches, &mut scope, ast);
|
||||||
|
|
||||||
// Create new module
|
// Create new module
|
||||||
let mut module = Module::new();
|
let mut module = Module::new();
|
||||||
@ -2077,7 +2082,7 @@ impl Module {
|
|||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
module.set_id(ast.source_raw().clone());
|
module.id = ast.source_raw().cloned();
|
||||||
|
|
||||||
#[cfg(feature = "metadata")]
|
#[cfg(feature = "metadata")]
|
||||||
module.set_doc(ast.doc());
|
module.set_doc(ast.doc());
|
||||||
|
@ -1,7 +1,10 @@
|
|||||||
use crate::{Engine, Module, ModuleResolver, Position, RhaiResultOf, Shared, ERR};
|
use crate::{
|
||||||
|
Engine, ModuleResolver, Position, RhaiResultOf, SharedModule, StaticVec, ERR,
|
||||||
|
STATIC_VEC_INLINE_SIZE,
|
||||||
|
};
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
use std::{ops::AddAssign, slice::Iter, vec::IntoIter};
|
use std::{ops::AddAssign, slice::Iter};
|
||||||
|
|
||||||
/// [Module] resolution service that holds a collection of module resolvers,
|
/// [Module] resolution service that holds a collection of module resolvers,
|
||||||
/// to be searched in sequential order.
|
/// to be searched in sequential order.
|
||||||
@ -21,7 +24,7 @@ use std::{ops::AddAssign, slice::Iter, vec::IntoIter};
|
|||||||
/// engine.set_module_resolver(collection);
|
/// engine.set_module_resolver(collection);
|
||||||
/// ```
|
/// ```
|
||||||
#[derive(Default)]
|
#[derive(Default)]
|
||||||
pub struct ModuleResolversCollection(Vec<Box<dyn ModuleResolver>>);
|
pub struct ModuleResolversCollection(StaticVec<Box<dyn ModuleResolver>>);
|
||||||
|
|
||||||
impl ModuleResolversCollection {
|
impl ModuleResolversCollection {
|
||||||
/// Create a new [`ModuleResolversCollection`].
|
/// Create a new [`ModuleResolversCollection`].
|
||||||
@ -42,8 +45,8 @@ impl ModuleResolversCollection {
|
|||||||
/// ```
|
/// ```
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn new() -> Self {
|
pub const fn new() -> Self {
|
||||||
Self(Vec::new())
|
Self(StaticVec::new_const())
|
||||||
}
|
}
|
||||||
/// Append a [module resolver][ModuleResolver] to the end.
|
/// Append a [module resolver][ModuleResolver] to the end.
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
@ -109,9 +112,10 @@ impl ModuleResolversCollection {
|
|||||||
|
|
||||||
impl IntoIterator for ModuleResolversCollection {
|
impl IntoIterator for ModuleResolversCollection {
|
||||||
type Item = Box<dyn ModuleResolver>;
|
type Item = Box<dyn ModuleResolver>;
|
||||||
type IntoIter = IntoIter<Box<dyn ModuleResolver>>;
|
type IntoIter = smallvec::IntoIter<[Box<dyn ModuleResolver>; STATIC_VEC_INLINE_SIZE]>;
|
||||||
|
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn into_iter(self) -> Self::IntoIter {
|
fn into_iter(self) -> Self::IntoIter {
|
||||||
self.0.into_iter()
|
self.0.into_iter()
|
||||||
}
|
}
|
||||||
@ -134,7 +138,7 @@ impl ModuleResolver for ModuleResolversCollection {
|
|||||||
source_path: Option<&str>,
|
source_path: Option<&str>,
|
||||||
path: &str,
|
path: &str,
|
||||||
pos: Position,
|
pos: Position,
|
||||||
) -> RhaiResultOf<Shared<Module>> {
|
) -> RhaiResultOf<SharedModule> {
|
||||||
for resolver in &self.0 {
|
for resolver in &self.0 {
|
||||||
match resolver.resolve(engine, source_path, path, pos) {
|
match resolver.resolve(engine, source_path, path, pos) {
|
||||||
Ok(module) => return Ok(module),
|
Ok(module) => return Ok(module),
|
||||||
|
@ -1,4 +1,4 @@
|
|||||||
use crate::{Engine, Module, ModuleResolver, Position, RhaiResultOf, Shared, ERR};
|
use crate::{Engine, ModuleResolver, Position, RhaiResultOf, SharedModule, ERR};
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
|
|
||||||
@ -45,7 +45,7 @@ impl ModuleResolver for DummyModuleResolver {
|
|||||||
_: Option<&str>,
|
_: Option<&str>,
|
||||||
path: &str,
|
path: &str,
|
||||||
pos: Position,
|
pos: Position,
|
||||||
) -> RhaiResultOf<Shared<Module>> {
|
) -> RhaiResultOf<SharedModule> {
|
||||||
Err(ERR::ErrorModuleNotFound(path.into(), pos).into())
|
Err(ERR::ErrorModuleNotFound(path.into(), pos).into())
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -4,7 +4,8 @@
|
|||||||
use crate::eval::GlobalRuntimeState;
|
use crate::eval::GlobalRuntimeState;
|
||||||
use crate::func::{locked_read, locked_write};
|
use crate::func::{locked_read, locked_write};
|
||||||
use crate::{
|
use crate::{
|
||||||
Engine, Identifier, Locked, Module, ModuleResolver, Position, RhaiResultOf, Scope, Shared, ERR,
|
Engine, Identifier, Locked, Module, ModuleResolver, Position, RhaiResultOf, Scope, Shared,
|
||||||
|
SharedModule, ERR,
|
||||||
};
|
};
|
||||||
|
|
||||||
use std::{
|
use std::{
|
||||||
@ -51,11 +52,12 @@ pub struct FileModuleResolver {
|
|||||||
extension: Identifier,
|
extension: Identifier,
|
||||||
cache_enabled: bool,
|
cache_enabled: bool,
|
||||||
scope: Scope<'static>,
|
scope: Scope<'static>,
|
||||||
cache: Locked<BTreeMap<PathBuf, Shared<Module>>>,
|
cache: Locked<BTreeMap<PathBuf, SharedModule>>,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Default for FileModuleResolver {
|
impl Default for FileModuleResolver {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
Self::new()
|
Self::new()
|
||||||
}
|
}
|
||||||
@ -194,8 +196,8 @@ impl FileModuleResolver {
|
|||||||
/// Get a reference to the file module resolver's [scope][Scope].
|
/// Get a reference to the file module resolver's [scope][Scope].
|
||||||
///
|
///
|
||||||
/// The [scope][Scope] is used for compiling module scripts.
|
/// The [scope][Scope] is used for compiling module scripts.
|
||||||
#[must_use]
|
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
pub const fn scope(&self) -> &Scope {
|
pub const fn scope(&self) -> &Scope {
|
||||||
&self.scope
|
&self.scope
|
||||||
}
|
}
|
||||||
@ -211,8 +213,8 @@ impl FileModuleResolver {
|
|||||||
/// Get a mutable reference to the file module resolver's [scope][Scope].
|
/// Get a mutable reference to the file module resolver's [scope][Scope].
|
||||||
///
|
///
|
||||||
/// The [scope][Scope] is used for compiling module scripts.
|
/// The [scope][Scope] is used for compiling module scripts.
|
||||||
#[must_use]
|
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
pub fn scope_mut(&mut self) -> &mut Scope<'static> {
|
pub fn scope_mut(&mut self) -> &mut Scope<'static> {
|
||||||
&mut self.scope
|
&mut self.scope
|
||||||
}
|
}
|
||||||
@ -257,7 +259,7 @@ impl FileModuleResolver {
|
|||||||
/// The next time this path is resolved, the script file will be loaded once again.
|
/// The next time this path is resolved, the script file will be loaded once again.
|
||||||
#[inline]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn clear_cache_for_path(&mut self, path: impl AsRef<Path>) -> Option<Shared<Module>> {
|
pub fn clear_cache_for_path(&mut self, path: impl AsRef<Path>) -> Option<SharedModule> {
|
||||||
locked_write(&self.cache)
|
locked_write(&self.cache)
|
||||||
.remove_entry(path.as_ref())
|
.remove_entry(path.as_ref())
|
||||||
.map(|(.., v)| v)
|
.map(|(.., v)| v)
|
||||||
@ -292,7 +294,7 @@ impl FileModuleResolver {
|
|||||||
source: Option<&str>,
|
source: Option<&str>,
|
||||||
path: &str,
|
path: &str,
|
||||||
pos: Position,
|
pos: Position,
|
||||||
) -> Result<Shared<Module>, Box<crate::EvalAltResult>> {
|
) -> Result<SharedModule, Box<crate::EvalAltResult>> {
|
||||||
// Load relative paths from source if there is no base path specified
|
// Load relative paths from source if there is no base path specified
|
||||||
let source_path = global
|
let source_path = global
|
||||||
.as_ref()
|
.as_ref()
|
||||||
@ -321,10 +323,9 @@ impl FileModuleResolver {
|
|||||||
|
|
||||||
let scope = Scope::new();
|
let scope = Scope::new();
|
||||||
|
|
||||||
let m: Shared<_> = if let Some(global) = global {
|
let m: Shared<_> = match global {
|
||||||
Module::eval_ast_as_new_raw(engine, scope, global, &ast)
|
Some(global) => Module::eval_ast_as_new_raw(engine, scope, global, &ast),
|
||||||
} else {
|
None => Module::eval_ast_as_new(scope, &ast, engine),
|
||||||
Module::eval_ast_as_new(scope, &ast, engine)
|
|
||||||
}
|
}
|
||||||
.map_err(|err| Box::new(ERR::ErrorInModule(path.to_string(), err, pos)))?
|
.map_err(|err| Box::new(ERR::ErrorInModule(path.to_string(), err, pos)))?
|
||||||
.into();
|
.into();
|
||||||
@ -344,7 +345,7 @@ impl ModuleResolver for FileModuleResolver {
|
|||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
path: &str,
|
path: &str,
|
||||||
pos: Position,
|
pos: Position,
|
||||||
) -> RhaiResultOf<Shared<Module>> {
|
) -> RhaiResultOf<SharedModule> {
|
||||||
self.impl_resolve(engine, Some(global), None, path, pos)
|
self.impl_resolve(engine, Some(global), None, path, pos)
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -355,7 +356,7 @@ impl ModuleResolver for FileModuleResolver {
|
|||||||
source: Option<&str>,
|
source: Option<&str>,
|
||||||
path: &str,
|
path: &str,
|
||||||
pos: Position,
|
pos: Position,
|
||||||
) -> RhaiResultOf<Shared<Module>> {
|
) -> RhaiResultOf<SharedModule> {
|
||||||
self.impl_resolve(engine, None, source, path, pos)
|
self.impl_resolve(engine, None, source, path, pos)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -1,6 +1,6 @@
|
|||||||
use crate::eval::GlobalRuntimeState;
|
use crate::eval::GlobalRuntimeState;
|
||||||
use crate::func::SendSync;
|
use crate::func::SendSync;
|
||||||
use crate::{Engine, Module, Position, RhaiResultOf, Shared, AST};
|
use crate::{Engine, Position, RhaiResultOf, SharedModule, AST};
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
|
|
||||||
@ -25,7 +25,7 @@ pub trait ModuleResolver: SendSync {
|
|||||||
source: Option<&str>,
|
source: Option<&str>,
|
||||||
path: &str,
|
path: &str,
|
||||||
pos: Position,
|
pos: Position,
|
||||||
) -> RhaiResultOf<Shared<Module>>;
|
) -> RhaiResultOf<SharedModule>;
|
||||||
|
|
||||||
/// Resolve a module based on a path string, given a [`GlobalRuntimeState`].
|
/// Resolve a module based on a path string, given a [`GlobalRuntimeState`].
|
||||||
///
|
///
|
||||||
@ -38,7 +38,7 @@ pub trait ModuleResolver: SendSync {
|
|||||||
global: &mut GlobalRuntimeState,
|
global: &mut GlobalRuntimeState,
|
||||||
path: &str,
|
path: &str,
|
||||||
pos: Position,
|
pos: Position,
|
||||||
) -> RhaiResultOf<Shared<Module>> {
|
) -> RhaiResultOf<SharedModule> {
|
||||||
self.resolve(engine, global.source(), path, pos)
|
self.resolve(engine, global.source(), path, pos)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -1,5 +1,6 @@
|
|||||||
use crate::{
|
use crate::{
|
||||||
Engine, Identifier, Module, ModuleResolver, Position, RhaiResultOf, Shared, SmartString, ERR,
|
Engine, Identifier, Module, ModuleResolver, Position, RhaiResultOf, SharedModule, SmartString,
|
||||||
|
ERR,
|
||||||
};
|
};
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
@ -27,7 +28,7 @@ use std::{
|
|||||||
/// engine.set_module_resolver(resolver);
|
/// engine.set_module_resolver(resolver);
|
||||||
/// ```
|
/// ```
|
||||||
#[derive(Debug, Clone, Default)]
|
#[derive(Debug, Clone, Default)]
|
||||||
pub struct StaticModuleResolver(BTreeMap<Identifier, Shared<Module>>);
|
pub struct StaticModuleResolver(BTreeMap<Identifier, SharedModule>);
|
||||||
|
|
||||||
impl StaticModuleResolver {
|
impl StaticModuleResolver {
|
||||||
/// Create a new [`StaticModuleResolver`].
|
/// Create a new [`StaticModuleResolver`].
|
||||||
@ -65,7 +66,7 @@ impl StaticModuleResolver {
|
|||||||
}
|
}
|
||||||
/// Remove a [module][Module] given its path.
|
/// Remove a [module][Module] given its path.
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn remove(&mut self, path: &str) -> Option<Shared<Module>> {
|
pub fn remove(&mut self, path: &str) -> Option<SharedModule> {
|
||||||
self.0.remove(path)
|
self.0.remove(path)
|
||||||
}
|
}
|
||||||
/// Does the path exist?
|
/// Does the path exist?
|
||||||
@ -80,12 +81,12 @@ impl StaticModuleResolver {
|
|||||||
}
|
}
|
||||||
/// Get an iterator of all the [modules][Module].
|
/// Get an iterator of all the [modules][Module].
|
||||||
#[inline]
|
#[inline]
|
||||||
pub fn iter(&self) -> impl Iterator<Item = (&str, &Shared<Module>)> {
|
pub fn iter(&self) -> impl Iterator<Item = (&str, &SharedModule)> {
|
||||||
self.0.iter().map(|(k, v)| (k.as_str(), v))
|
self.0.iter().map(|(k, v)| (k.as_str(), v))
|
||||||
}
|
}
|
||||||
/// Get a mutable iterator of all the [modules][Module].
|
/// Get a mutable iterator of all the [modules][Module].
|
||||||
#[inline]
|
#[inline]
|
||||||
pub fn iter_mut(&mut self) -> impl Iterator<Item = (&str, &mut Shared<Module>)> {
|
pub fn iter_mut(&mut self) -> impl Iterator<Item = (&str, &mut SharedModule)> {
|
||||||
self.0.iter_mut().map(|(k, v)| (k.as_str(), v))
|
self.0.iter_mut().map(|(k, v)| (k.as_str(), v))
|
||||||
}
|
}
|
||||||
/// Get an iterator of all the [module][Module] paths.
|
/// Get an iterator of all the [module][Module] paths.
|
||||||
@ -95,7 +96,7 @@ impl StaticModuleResolver {
|
|||||||
}
|
}
|
||||||
/// Get an iterator of all the [modules][Module].
|
/// Get an iterator of all the [modules][Module].
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn values(&self) -> impl Iterator<Item = &Shared<Module>> {
|
pub fn values(&self) -> impl Iterator<Item = &SharedModule> {
|
||||||
self.0.values()
|
self.0.values()
|
||||||
}
|
}
|
||||||
/// Remove all [modules][Module].
|
/// Remove all [modules][Module].
|
||||||
@ -130,18 +131,19 @@ impl StaticModuleResolver {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl IntoIterator for StaticModuleResolver {
|
impl IntoIterator for StaticModuleResolver {
|
||||||
type Item = (Identifier, Shared<Module>);
|
type Item = (Identifier, SharedModule);
|
||||||
type IntoIter = IntoIter<SmartString, Shared<Module>>;
|
type IntoIter = IntoIter<SmartString, SharedModule>;
|
||||||
|
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn into_iter(self) -> Self::IntoIter {
|
fn into_iter(self) -> Self::IntoIter {
|
||||||
self.0.into_iter()
|
self.0.into_iter()
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<'a> IntoIterator for &'a StaticModuleResolver {
|
impl<'a> IntoIterator for &'a StaticModuleResolver {
|
||||||
type Item = (&'a Identifier, &'a Shared<Module>);
|
type Item = (&'a Identifier, &'a SharedModule);
|
||||||
type IntoIter = Iter<'a, SmartString, Shared<Module>>;
|
type IntoIter = Iter<'a, SmartString, SharedModule>;
|
||||||
|
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn into_iter(self) -> Self::IntoIter {
|
fn into_iter(self) -> Self::IntoIter {
|
||||||
@ -157,7 +159,7 @@ impl ModuleResolver for StaticModuleResolver {
|
|||||||
_: Option<&str>,
|
_: Option<&str>,
|
||||||
path: &str,
|
path: &str,
|
||||||
pos: Position,
|
pos: Position,
|
||||||
) -> RhaiResultOf<Shared<Module>> {
|
) -> RhaiResultOf<SharedModule> {
|
||||||
self.0
|
self.0
|
||||||
.get(path)
|
.get(path)
|
||||||
.cloned()
|
.cloned()
|
||||||
|
214
src/optimizer.rs
214
src/optimizer.rs
@ -8,11 +8,11 @@ use crate::engine::{KEYWORD_DEBUG, KEYWORD_EVAL, KEYWORD_FN_PTR, KEYWORD_PRINT,
|
|||||||
use crate::eval::{Caches, GlobalRuntimeState};
|
use crate::eval::{Caches, GlobalRuntimeState};
|
||||||
use crate::func::builtin::get_builtin_binary_op_fn;
|
use crate::func::builtin::get_builtin_binary_op_fn;
|
||||||
use crate::func::hashing::get_hasher;
|
use crate::func::hashing::get_hasher;
|
||||||
use crate::tokenizer::{Span, Token};
|
use crate::tokenizer::Token;
|
||||||
use crate::types::dynamic::AccessMode;
|
use crate::types::dynamic::AccessMode;
|
||||||
use crate::{
|
use crate::{
|
||||||
calc_fn_hash, calc_fn_params_hash, combine_hashes, Dynamic, Engine, FnPtr, Identifier,
|
calc_fn_hash, calc_fn_hash_full, Dynamic, Engine, FnPtr, Identifier, ImmutableString, Position,
|
||||||
ImmutableString, Position, Scope, StaticVec, AST, INT,
|
Scope, StaticVec, AST, INT,
|
||||||
};
|
};
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
@ -38,6 +38,7 @@ pub enum OptimizationLevel {
|
|||||||
|
|
||||||
impl Default for OptimizationLevel {
|
impl Default for OptimizationLevel {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
Self::Simple
|
Self::Simple
|
||||||
}
|
}
|
||||||
@ -49,18 +50,18 @@ struct OptimizerState<'a> {
|
|||||||
/// Has the [`AST`] been changed during this pass?
|
/// Has the [`AST`] been changed during this pass?
|
||||||
changed: bool,
|
changed: bool,
|
||||||
/// Collection of constants to use for eager function evaluations.
|
/// Collection of constants to use for eager function evaluations.
|
||||||
variables: StaticVec<(Identifier, AccessMode, Option<Dynamic>)>,
|
variables: StaticVec<(Identifier, AccessMode, Dynamic)>,
|
||||||
/// Activate constants propagation?
|
/// Activate constants propagation?
|
||||||
propagate_constants: bool,
|
propagate_constants: bool,
|
||||||
/// An [`Engine`] instance for eager function evaluation.
|
/// An [`Engine`] instance for eager function evaluation.
|
||||||
engine: &'a Engine,
|
engine: &'a Engine,
|
||||||
/// The global runtime state.
|
/// The global runtime state.
|
||||||
global: GlobalRuntimeState<'a>,
|
global: GlobalRuntimeState,
|
||||||
/// Function resolution caches.
|
/// Function resolution caches.
|
||||||
caches: Caches<'a>,
|
caches: Caches,
|
||||||
/// [Module][crate::Module] containing script-defined functions.
|
/// [Module][crate::Module] containing script-defined functions.
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
lib: &'a [&'a crate::Module],
|
lib: &'a [crate::SharedModule],
|
||||||
/// Optimization level.
|
/// Optimization level.
|
||||||
optimization_level: OptimizationLevel,
|
optimization_level: OptimizationLevel,
|
||||||
}
|
}
|
||||||
@ -70,7 +71,7 @@ impl<'a> OptimizerState<'a> {
|
|||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn new(
|
pub fn new(
|
||||||
engine: &'a Engine,
|
engine: &'a Engine,
|
||||||
#[cfg(not(feature = "no_function"))] lib: &'a [&'a crate::Module],
|
#[cfg(not(feature = "no_function"))] lib: &'a [crate::SharedModule],
|
||||||
optimization_level: OptimizationLevel,
|
optimization_level: OptimizationLevel,
|
||||||
) -> Self {
|
) -> Self {
|
||||||
Self {
|
Self {
|
||||||
@ -107,12 +108,7 @@ impl<'a> OptimizerState<'a> {
|
|||||||
}
|
}
|
||||||
/// Add a new variable to the list.
|
/// Add a new variable to the list.
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
pub fn push_var(
|
pub fn push_var(&mut self, name: impl Into<Identifier>, access: AccessMode, value: Dynamic) {
|
||||||
&mut self,
|
|
||||||
name: impl Into<Identifier>,
|
|
||||||
access: AccessMode,
|
|
||||||
value: Option<Dynamic>,
|
|
||||||
) {
|
|
||||||
self.variables.push((name.into(), access, value));
|
self.variables.push((name.into(), access, value));
|
||||||
}
|
}
|
||||||
/// Look up a constant from the list.
|
/// Look up a constant from the list.
|
||||||
@ -126,7 +122,8 @@ impl<'a> OptimizerState<'a> {
|
|||||||
if n == name {
|
if n == name {
|
||||||
return match access {
|
return match access {
|
||||||
AccessMode::ReadWrite => None,
|
AccessMode::ReadWrite => None,
|
||||||
AccessMode::ReadOnly => value.as_ref(),
|
AccessMode::ReadOnly if value.is_null() => None,
|
||||||
|
AccessMode::ReadOnly => Some(value),
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -138,28 +135,27 @@ impl<'a> OptimizerState<'a> {
|
|||||||
pub fn call_fn_with_constant_arguments(
|
pub fn call_fn_with_constant_arguments(
|
||||||
&mut self,
|
&mut self,
|
||||||
fn_name: &str,
|
fn_name: &str,
|
||||||
|
op_token: Option<&Token>,
|
||||||
arg_values: &mut [Dynamic],
|
arg_values: &mut [Dynamic],
|
||||||
) -> Option<Dynamic> {
|
) -> Dynamic {
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
let lib = self.lib;
|
let lib = self.lib;
|
||||||
#[cfg(feature = "no_function")]
|
#[cfg(feature = "no_function")]
|
||||||
let lib = &[];
|
let lib = &[];
|
||||||
|
|
||||||
self.engine
|
self.engine
|
||||||
.call_native_fn(
|
.exec_native_fn_call(
|
||||||
&mut self.global,
|
&mut self.global,
|
||||||
&mut self.caches,
|
&mut self.caches,
|
||||||
lib,
|
lib,
|
||||||
fn_name,
|
fn_name,
|
||||||
|
op_token,
|
||||||
calc_fn_hash(None, fn_name, arg_values.len()),
|
calc_fn_hash(None, fn_name, arg_values.len()),
|
||||||
&mut arg_values.iter_mut().collect::<StaticVec<_>>(),
|
&mut arg_values.iter_mut().collect::<StaticVec<_>>(),
|
||||||
false,
|
false,
|
||||||
false,
|
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
0,
|
|
||||||
)
|
)
|
||||||
.ok()
|
.map_or(Dynamic::NULL, |(v, ..)| v)
|
||||||
.map(|(v, ..)| v)
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -169,26 +165,30 @@ fn has_native_fn_override(
|
|||||||
hash_script: u64,
|
hash_script: u64,
|
||||||
arg_types: impl AsRef<[TypeId]>,
|
arg_types: impl AsRef<[TypeId]>,
|
||||||
) -> bool {
|
) -> bool {
|
||||||
let hash_params = calc_fn_params_hash(arg_types.as_ref().iter().copied());
|
let hash = calc_fn_hash_full(hash_script, arg_types.as_ref().iter().copied());
|
||||||
let hash = combine_hashes(hash_script, hash_params);
|
|
||||||
|
|
||||||
// First check the global namespace and packages, but skip modules that are standard because
|
// First check the global namespace and packages, but skip modules that are standard because
|
||||||
// they should never conflict with system functions.
|
// they should never conflict with system functions.
|
||||||
let result = engine
|
if engine
|
||||||
.global_modules
|
.global_modules
|
||||||
.iter()
|
.iter()
|
||||||
.filter(|m| !m.standard)
|
.filter(|m| !m.standard)
|
||||||
.any(|m| m.contains_fn(hash));
|
.any(|m| m.contains_fn(hash))
|
||||||
|
{
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_module"))]
|
|
||||||
// Then check sub-modules
|
// Then check sub-modules
|
||||||
let result = result
|
#[cfg(not(feature = "no_module"))]
|
||||||
|| engine
|
if engine
|
||||||
.global_sub_modules
|
.global_sub_modules
|
||||||
.values()
|
.values()
|
||||||
.any(|m| m.contains_qualified_fn(hash));
|
.any(|m| m.contains_qualified_fn(hash))
|
||||||
|
{
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
result
|
false
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Optimize a block of [statements][Stmt].
|
/// Optimize a block of [statements][Stmt].
|
||||||
@ -254,7 +254,7 @@ fn optimize_stmt_block(
|
|||||||
});
|
});
|
||||||
|
|
||||||
// Optimize each statement in the block
|
// Optimize each statement in the block
|
||||||
for stmt in statements.iter_mut() {
|
for stmt in &mut statements {
|
||||||
match stmt {
|
match stmt {
|
||||||
Stmt::Var(x, options, ..) => {
|
Stmt::Var(x, options, ..) => {
|
||||||
if options.contains(ASTFlags::CONSTANT) {
|
if options.contains(ASTFlags::CONSTANT) {
|
||||||
@ -265,13 +265,13 @@ fn optimize_stmt_block(
|
|||||||
state.push_var(
|
state.push_var(
|
||||||
x.0.as_str(),
|
x.0.as_str(),
|
||||||
AccessMode::ReadOnly,
|
AccessMode::ReadOnly,
|
||||||
x.1.get_literal_value(),
|
x.1.get_literal_value().unwrap_or(Dynamic::NULL),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
} else {
|
} else {
|
||||||
// Add variables into the state
|
// Add variables into the state
|
||||||
optimize_expr(&mut x.1, state, false);
|
optimize_expr(&mut x.1, state, false);
|
||||||
state.push_var(x.0.as_str(), AccessMode::ReadWrite, None);
|
state.push_var(x.0.as_str(), AccessMode::ReadWrite, Dynamic::NULL);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
// Optimize the statement
|
// Optimize the statement
|
||||||
@ -432,15 +432,15 @@ fn optimize_stmt(stmt: &mut Stmt, state: &mut OptimizerState, preserve_result: b
|
|||||||
if !x.0.is_op_assignment()
|
if !x.0.is_op_assignment()
|
||||||
&& x.1.lhs.is_variable_access(true)
|
&& x.1.lhs.is_variable_access(true)
|
||||||
&& matches!(&x.1.rhs, Expr::FnCall(x2, ..)
|
&& matches!(&x.1.rhs, Expr::FnCall(x2, ..)
|
||||||
if Token::lookup_from_syntax(&x2.name).map_or(false, |t| t.has_op_assignment())
|
if Token::lookup_symbol_from_syntax(&x2.name).map_or(false, |t| t.has_op_assignment())
|
||||||
&& x2.args.len() == 2
|
&& x2.args.len() == 2
|
||||||
&& x2.args[0].get_variable_name(true) == x.1.lhs.get_variable_name(true)
|
&& x2.args[0].get_variable_name(true) == x.1.lhs.get_variable_name(true)
|
||||||
) =>
|
) =>
|
||||||
{
|
{
|
||||||
match x.1.rhs {
|
match x.1.rhs {
|
||||||
Expr::FnCall(ref mut x2, ..) => {
|
Expr::FnCall(ref mut x2, pos) => {
|
||||||
state.set_dirty();
|
state.set_dirty();
|
||||||
x.0 = OpAssignment::new_op_assignment_from_base(&x2.name, x2.pos);
|
x.0 = OpAssignment::new_op_assignment_from_base(&x2.name, pos);
|
||||||
x.1.rhs = mem::take(&mut x2.args[1]);
|
x.1.rhs = mem::take(&mut x2.args[1]);
|
||||||
}
|
}
|
||||||
ref expr => unreachable!("Expr::FnCall expected but gets {:?}", expr),
|
ref expr => unreachable!("Expr::FnCall expected but gets {:?}", expr),
|
||||||
@ -550,13 +550,14 @@ fn optimize_stmt(stmt: &mut Stmt, state: &mut OptimizerState, preserve_result: b
|
|||||||
// switch const { case if condition => stmt, _ => def } => if condition { stmt } else { def }
|
// switch const { case if condition => stmt, _ => def } => if condition { stmt } else { def }
|
||||||
optimize_expr(&mut b.condition, state, false);
|
optimize_expr(&mut b.condition, state, false);
|
||||||
|
|
||||||
let else_stmt = if let Some(index) = def_case {
|
let else_stmt = match def_case {
|
||||||
|
Some(index) => {
|
||||||
let mut def_stmt =
|
let mut def_stmt =
|
||||||
Stmt::Expr(mem::take(&mut expressions[*index].expr).into());
|
Stmt::Expr(mem::take(&mut expressions[*index].expr).into());
|
||||||
optimize_stmt(&mut def_stmt, state, true);
|
optimize_stmt(&mut def_stmt, state, true);
|
||||||
def_stmt.into()
|
def_stmt.into()
|
||||||
} else {
|
}
|
||||||
StmtBlock::NONE
|
_ => StmtBlock::NONE,
|
||||||
};
|
};
|
||||||
|
|
||||||
*stmt = Stmt::If(
|
*stmt = Stmt::If(
|
||||||
@ -615,13 +616,14 @@ fn optimize_stmt(stmt: &mut Stmt, state: &mut OptimizerState, preserve_result: b
|
|||||||
// switch const { range if condition => stmt, _ => def } => if condition { stmt } else { def }
|
// switch const { range if condition => stmt, _ => def } => if condition { stmt } else { def }
|
||||||
optimize_expr(&mut condition, state, false);
|
optimize_expr(&mut condition, state, false);
|
||||||
|
|
||||||
let else_stmt = if let Some(index) = def_case {
|
let else_stmt = match def_case {
|
||||||
|
Some(index) => {
|
||||||
let mut def_stmt =
|
let mut def_stmt =
|
||||||
Stmt::Expr(mem::take(&mut expressions[*index].expr).into());
|
Stmt::Expr(mem::take(&mut expressions[*index].expr).into());
|
||||||
optimize_stmt(&mut def_stmt, state, true);
|
optimize_stmt(&mut def_stmt, state, true);
|
||||||
def_stmt.into()
|
def_stmt.into()
|
||||||
} else {
|
}
|
||||||
StmtBlock::NONE
|
_ => StmtBlock::NONE,
|
||||||
};
|
};
|
||||||
|
|
||||||
let if_stmt =
|
let if_stmt =
|
||||||
@ -664,12 +666,13 @@ fn optimize_stmt(stmt: &mut Stmt, state: &mut OptimizerState, preserve_result: b
|
|||||||
// Promote the default case
|
// Promote the default case
|
||||||
state.set_dirty();
|
state.set_dirty();
|
||||||
|
|
||||||
if let Some(index) = def_case {
|
match def_case {
|
||||||
|
Some(index) => {
|
||||||
let mut def_stmt = Stmt::Expr(mem::take(&mut expressions[*index].expr).into());
|
let mut def_stmt = Stmt::Expr(mem::take(&mut expressions[*index].expr).into());
|
||||||
optimize_stmt(&mut def_stmt, state, true);
|
optimize_stmt(&mut def_stmt, state, true);
|
||||||
*stmt = def_stmt;
|
*stmt = def_stmt;
|
||||||
} else {
|
}
|
||||||
*stmt = StmtBlock::empty(*pos).into();
|
_ => *stmt = StmtBlock::empty(*pos).into(),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
// switch
|
// switch
|
||||||
@ -688,7 +691,7 @@ fn optimize_stmt(stmt: &mut Stmt, state: &mut OptimizerState, preserve_result: b
|
|||||||
optimize_expr(match_expr, state, false);
|
optimize_expr(match_expr, state, false);
|
||||||
|
|
||||||
// Optimize blocks
|
// Optimize blocks
|
||||||
for b in expressions.iter_mut() {
|
for b in expressions.as_mut() {
|
||||||
optimize_expr(&mut b.condition, state, false);
|
optimize_expr(&mut b.condition, state, false);
|
||||||
optimize_expr(&mut b.expr, state, false);
|
optimize_expr(&mut b.expr, state, false);
|
||||||
|
|
||||||
@ -776,50 +779,6 @@ fn optimize_stmt(stmt: &mut Stmt, state: &mut OptimizerState, preserve_result: b
|
|||||||
*condition = Expr::Unit(*pos);
|
*condition = Expr::Unit(*pos);
|
||||||
}
|
}
|
||||||
**body = optimize_stmt_block(mem::take(&mut **body), state, false, true, false);
|
**body = optimize_stmt_block(mem::take(&mut **body), state, false, true, false);
|
||||||
|
|
||||||
if body.len() == 1 {
|
|
||||||
match body[0] {
|
|
||||||
// while expr { break; } -> { expr; }
|
|
||||||
Stmt::BreakLoop(options, pos) if options.contains(ASTFlags::BREAK) => {
|
|
||||||
// Only a single break statement - turn into running the guard expression once
|
|
||||||
state.set_dirty();
|
|
||||||
if condition.is_unit() {
|
|
||||||
*stmt = Stmt::Noop(pos);
|
|
||||||
} else {
|
|
||||||
let mut statements = vec![Stmt::Expr(mem::take(condition).into())];
|
|
||||||
if preserve_result {
|
|
||||||
statements.push(Stmt::Noop(pos));
|
|
||||||
}
|
|
||||||
*stmt = (statements, Span::new(pos, Position::NONE)).into();
|
|
||||||
};
|
|
||||||
}
|
|
||||||
_ => (),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
// do { block } until true -> { block }
|
|
||||||
Stmt::Do(x, options, ..)
|
|
||||||
if matches!(x.0, Expr::BoolConstant(true, ..))
|
|
||||||
&& options.contains(ASTFlags::NEGATED) =>
|
|
||||||
{
|
|
||||||
state.set_dirty();
|
|
||||||
*stmt = (
|
|
||||||
optimize_stmt_block(mem::take(&mut *x.1), state, false, true, false),
|
|
||||||
x.1.span(),
|
|
||||||
)
|
|
||||||
.into();
|
|
||||||
}
|
|
||||||
// do { block } while false -> { block }
|
|
||||||
Stmt::Do(x, options, ..)
|
|
||||||
if matches!(x.0, Expr::BoolConstant(false, ..))
|
|
||||||
&& !options.contains(ASTFlags::NEGATED) =>
|
|
||||||
{
|
|
||||||
state.set_dirty();
|
|
||||||
*stmt = (
|
|
||||||
optimize_stmt_block(mem::take(&mut *x.1), state, false, true, false),
|
|
||||||
x.1.span(),
|
|
||||||
)
|
|
||||||
.into();
|
|
||||||
}
|
}
|
||||||
// do { block } while|until expr
|
// do { block } while|until expr
|
||||||
Stmt::Do(x, ..) => {
|
Stmt::Do(x, ..) => {
|
||||||
@ -893,27 +852,23 @@ fn optimize_stmt(stmt: &mut Stmt, state: &mut OptimizerState, preserve_result: b
|
|||||||
Stmt::Expr(expr) => {
|
Stmt::Expr(expr) => {
|
||||||
optimize_expr(expr, state, false);
|
optimize_expr(expr, state, false);
|
||||||
|
|
||||||
match &mut **expr {
|
if matches!(**expr, Expr::FnCall(..) | Expr::Stmt(..)) {
|
||||||
// func(...)
|
|
||||||
Expr::FnCall(x, pos) => {
|
|
||||||
state.set_dirty();
|
state.set_dirty();
|
||||||
*stmt = Stmt::FnCall(mem::take(x), *pos);
|
*stmt = match *mem::take(expr) {
|
||||||
}
|
// func(...);
|
||||||
|
Expr::FnCall(x, pos) => Stmt::FnCall(x, pos),
|
||||||
|
// {};
|
||||||
|
Expr::Stmt(x) if x.is_empty() => Stmt::Noop(x.position()),
|
||||||
// {...};
|
// {...};
|
||||||
Expr::Stmt(x) => {
|
Expr::Stmt(x) => (*x).into(),
|
||||||
if x.is_empty() {
|
_ => unreachable!(),
|
||||||
state.set_dirty();
|
};
|
||||||
*stmt = Stmt::Noop(x.position());
|
|
||||||
} else {
|
|
||||||
state.set_dirty();
|
|
||||||
*stmt = mem::take(&mut **x).into();
|
|
||||||
}
|
|
||||||
}
|
|
||||||
// expr;
|
|
||||||
_ => (),
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// break expr;
|
||||||
|
Stmt::BreakLoop(Some(ref mut expr), ..) => optimize_expr(expr, state, false),
|
||||||
|
|
||||||
// return expr;
|
// return expr;
|
||||||
Stmt::Return(Some(ref mut expr), ..) => optimize_expr(expr, state, false),
|
Stmt::Return(Some(ref mut expr), ..) => optimize_expr(expr, state, false),
|
||||||
|
|
||||||
@ -1137,7 +1092,7 @@ fn optimize_expr(expr: &mut Expr, state: &mut OptimizerState, _chaining: bool) {
|
|||||||
&& state.optimization_level == OptimizationLevel::Simple // simple optimizations
|
&& state.optimization_level == OptimizationLevel::Simple // simple optimizations
|
||||||
&& x.args.len() == 1
|
&& x.args.len() == 1
|
||||||
&& x.name == KEYWORD_FN_PTR
|
&& x.name == KEYWORD_FN_PTR
|
||||||
&& x.args[0].is_constant()
|
&& x.constant_args()
|
||||||
=> {
|
=> {
|
||||||
let fn_name = match x.args[0] {
|
let fn_name = match x.args[0] {
|
||||||
Expr::StringConstant(ref s, ..) => s.clone().into(),
|
Expr::StringConstant(ref s, ..) => s.clone().into(),
|
||||||
@ -1161,8 +1116,7 @@ fn optimize_expr(expr: &mut Expr, state: &mut OptimizerState, _chaining: bool) {
|
|||||||
Expr::FnCall(x, pos)
|
Expr::FnCall(x, pos)
|
||||||
if !x.is_qualified() // Non-qualified
|
if !x.is_qualified() // Non-qualified
|
||||||
&& state.optimization_level == OptimizationLevel::Simple // simple optimizations
|
&& state.optimization_level == OptimizationLevel::Simple // simple optimizations
|
||||||
&& x.args.iter().all(Expr::is_constant) // all arguments are constants
|
&& x.constant_args() // all arguments are constants
|
||||||
//&& !is_valid_identifier(x.chars()) // cannot be scripted
|
|
||||||
=> {
|
=> {
|
||||||
let arg_values = &mut x.args.iter().map(|e| e.get_literal_value().unwrap()).collect::<StaticVec<_>>();
|
let arg_values = &mut x.args.iter().map(|e| e.get_literal_value().unwrap()).collect::<StaticVec<_>>();
|
||||||
let arg_types: StaticVec<_> = arg_values.iter().map(Dynamic::type_id).collect();
|
let arg_types: StaticVec<_> = arg_values.iter().map(Dynamic::type_id).collect();
|
||||||
@ -1181,15 +1135,15 @@ fn optimize_expr(expr: &mut Expr, state: &mut OptimizerState, _chaining: bool) {
|
|||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
// Overloaded operators can override built-in.
|
// Overloaded operators can override built-in.
|
||||||
_ if x.args.len() == 2 && (state.engine.fast_operators() || !has_native_fn_override(state.engine, x.hashes.native, &arg_types)) => {
|
_ if x.args.len() == 2 && x.op_token.is_some() && (state.engine.fast_operators() || !has_native_fn_override(state.engine, x.hashes.native(), &arg_types)) => {
|
||||||
if let Some(result) = get_builtin_binary_op_fn(&x.name, &arg_values[0], &arg_values[1])
|
if let Some(result) = get_builtin_binary_op_fn(x.op_token.as_ref().unwrap(), &arg_values[0], &arg_values[1])
|
||||||
.and_then(|f| {
|
.and_then(|f| {
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
let lib = state.lib;
|
let lib = state.lib;
|
||||||
#[cfg(feature = "no_function")]
|
#[cfg(feature = "no_function")]
|
||||||
let lib = &[];
|
let lib = &[][..];
|
||||||
|
|
||||||
let context = (state.engine, &x.name, lib).into();
|
let context = (state.engine, x.name.as_str(),None, &state.global, lib, *pos).into();
|
||||||
let (first, second) = arg_values.split_first_mut().unwrap();
|
let (first, second) = arg_values.split_first_mut().unwrap();
|
||||||
(f)(context, &mut [ first, &mut second[0] ]).ok()
|
(f)(context, &mut [ first, &mut second[0] ]).ok()
|
||||||
}) {
|
}) {
|
||||||
@ -1204,7 +1158,7 @@ fn optimize_expr(expr: &mut Expr, state: &mut OptimizerState, _chaining: bool) {
|
|||||||
x.args.iter_mut().for_each(|a| optimize_expr(a, state, false));
|
x.args.iter_mut().for_each(|a| optimize_expr(a, state, false));
|
||||||
|
|
||||||
// Move constant arguments
|
// Move constant arguments
|
||||||
for arg in x.args.iter_mut() {
|
for arg in &mut x.args {
|
||||||
match arg {
|
match arg {
|
||||||
Expr::DynamicConstant(..) | Expr::Unit(..)
|
Expr::DynamicConstant(..) | Expr::Unit(..)
|
||||||
| Expr::StringConstant(..) | Expr::CharConstant(..)
|
| Expr::StringConstant(..) | Expr::CharConstant(..)
|
||||||
@ -1225,25 +1179,25 @@ fn optimize_expr(expr: &mut Expr, state: &mut OptimizerState, _chaining: bool) {
|
|||||||
Expr::FnCall(x, pos)
|
Expr::FnCall(x, pos)
|
||||||
if !x.is_qualified() // non-qualified
|
if !x.is_qualified() // non-qualified
|
||||||
&& state.optimization_level == OptimizationLevel::Full // full optimizations
|
&& state.optimization_level == OptimizationLevel::Full // full optimizations
|
||||||
&& x.args.iter().all(Expr::is_constant) // all arguments are constants
|
&& x.constant_args() // all arguments are constants
|
||||||
=> {
|
=> {
|
||||||
// First search for script-defined functions (can override built-in)
|
// First search for script-defined functions (can override built-in)
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
let has_script_fn = state.lib.iter().copied().any(|m| m.get_script_fn(&x.name, x.args.len()).is_some());
|
let has_script_fn = !x.hashes.is_native_only() && state.lib.iter().find_map(|m| m.get_script_fn(&x.name, x.args.len())).is_some();
|
||||||
#[cfg(feature = "no_function")]
|
#[cfg(feature = "no_function")]
|
||||||
let has_script_fn = false;
|
let has_script_fn = false;
|
||||||
|
|
||||||
if !has_script_fn {
|
if !has_script_fn {
|
||||||
let arg_values = &mut x.args.iter().map(|e| e.get_literal_value().unwrap()).collect::<StaticVec<_>>();
|
let arg_values = &mut x.args.iter().map(Expr::get_literal_value).collect::<Option<StaticVec<_>>>().unwrap();
|
||||||
|
|
||||||
let result = match x.name.as_str() {
|
let result = match x.name.as_str() {
|
||||||
KEYWORD_TYPE_OF if arg_values.len() == 1 => Some(state.engine.map_type_name(arg_values[0].type_name()).into()),
|
KEYWORD_TYPE_OF if arg_values.len() == 1 => state.engine.map_type_name(arg_values[0].type_name()).into(),
|
||||||
#[cfg(not(feature = "no_closure"))]
|
#[cfg(not(feature = "no_closure"))]
|
||||||
crate::engine::KEYWORD_IS_SHARED if arg_values.len() == 1 => Some(Dynamic::FALSE),
|
crate::engine::KEYWORD_IS_SHARED if arg_values.len() == 1 => Dynamic::FALSE,
|
||||||
_ => state.call_fn_with_constant_arguments(&x.name, arg_values)
|
_ => state.call_fn_with_constant_arguments(&x.name, x.op_token.as_ref(), arg_values)
|
||||||
};
|
};
|
||||||
|
|
||||||
if let Some(result) = result {
|
if !result.is_null() {
|
||||||
state.set_dirty();
|
state.set_dirty();
|
||||||
*expr = Expr::from_dynamic(result, *pos);
|
*expr = Expr::from_dynamic(result, *pos);
|
||||||
return;
|
return;
|
||||||
@ -1254,7 +1208,7 @@ fn optimize_expr(expr: &mut Expr, state: &mut OptimizerState, _chaining: bool) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// id(args ..) or xxx.id(args ..) -> optimize function call arguments
|
// id(args ..) or xxx.id(args ..) -> optimize function call arguments
|
||||||
Expr::FnCall(x, ..) | Expr::MethodCall(x, ..) => for arg in x.args.iter_mut() {
|
Expr::FnCall(x, ..) | Expr::MethodCall(x, ..) => for arg in &mut x.args {
|
||||||
optimize_expr(arg, state, false);
|
optimize_expr(arg, state, false);
|
||||||
|
|
||||||
// Move constant arguments
|
// Move constant arguments
|
||||||
@ -1303,7 +1257,7 @@ fn optimize_top_level(
|
|||||||
statements: StmtBlockContainer,
|
statements: StmtBlockContainer,
|
||||||
engine: &Engine,
|
engine: &Engine,
|
||||||
scope: &Scope,
|
scope: &Scope,
|
||||||
#[cfg(not(feature = "no_function"))] lib: &[&crate::Module],
|
#[cfg(not(feature = "no_function"))] lib: &[crate::SharedModule],
|
||||||
optimization_level: OptimizationLevel,
|
optimization_level: OptimizationLevel,
|
||||||
) -> StmtBlockContainer {
|
) -> StmtBlockContainer {
|
||||||
let mut statements = statements;
|
let mut statements = statements;
|
||||||
@ -1329,15 +1283,15 @@ fn optimize_top_level(
|
|||||||
.rev()
|
.rev()
|
||||||
.flat_map(|m| m.iter_var())
|
.flat_map(|m| m.iter_var())
|
||||||
{
|
{
|
||||||
state.push_var(name, AccessMode::ReadOnly, Some(value.clone()));
|
state.push_var(name, AccessMode::ReadOnly, value.clone());
|
||||||
}
|
}
|
||||||
|
|
||||||
// Add constants and variables from the scope
|
// Add constants and variables from the scope
|
||||||
for (name, constant, value) in scope.iter() {
|
for (name, constant, value) in scope.iter() {
|
||||||
if constant {
|
if constant {
|
||||||
state.push_var(name, AccessMode::ReadOnly, Some(value));
|
state.push_var(name, AccessMode::ReadOnly, value);
|
||||||
} else {
|
} else {
|
||||||
state.push_var(name, AccessMode::ReadWrite, None);
|
state.push_var(name, AccessMode::ReadWrite, Dynamic::NULL);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -1357,7 +1311,7 @@ pub fn optimize_into_ast(
|
|||||||
let mut statements = statements;
|
let mut statements = statements;
|
||||||
|
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
let lib = {
|
let lib: crate::Shared<_> = {
|
||||||
let mut module = crate::Module::new();
|
let mut module = crate::Module::new();
|
||||||
|
|
||||||
if optimization_level != OptimizationLevel::None {
|
if optimization_level != OptimizationLevel::None {
|
||||||
@ -1378,7 +1332,7 @@ pub fn optimize_into_ast(
|
|||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
let lib2 = &[&lib2];
|
let lib2 = &[lib2.into()];
|
||||||
|
|
||||||
for fn_def in functions {
|
for fn_def in functions {
|
||||||
let mut fn_def = crate::func::shared_take_or_clone(fn_def);
|
let mut fn_def = crate::func::shared_take_or_clone(fn_def);
|
||||||
@ -1396,7 +1350,7 @@ pub fn optimize_into_ast(
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
module
|
module.into()
|
||||||
};
|
};
|
||||||
|
|
||||||
statements.shrink_to_fit();
|
statements.shrink_to_fit();
|
||||||
@ -1409,7 +1363,7 @@ pub fn optimize_into_ast(
|
|||||||
engine,
|
engine,
|
||||||
scope,
|
scope,
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
&[&lib],
|
&[lib.clone()],
|
||||||
optimization_level,
|
optimization_level,
|
||||||
),
|
),
|
||||||
},
|
},
|
||||||
|
@ -488,39 +488,29 @@ mod f64_functions {
|
|||||||
#[cfg(feature = "decimal")]
|
#[cfg(feature = "decimal")]
|
||||||
#[export_module]
|
#[export_module]
|
||||||
pub mod decimal_functions {
|
pub mod decimal_functions {
|
||||||
use num_traits::Pow;
|
use rust_decimal::{prelude::Zero, Decimal};
|
||||||
use rust_decimal::{prelude::Zero, Decimal, MathematicalOps};
|
|
||||||
|
|
||||||
#[rhai_fn(skip, return_raw)]
|
#[cfg(not(feature = "unchecked"))]
|
||||||
|
pub mod builtin {
|
||||||
|
use rust_decimal::MathematicalOps;
|
||||||
|
|
||||||
|
#[rhai_fn(return_raw)]
|
||||||
pub fn add(x: Decimal, y: Decimal) -> RhaiResultOf<Decimal> {
|
pub fn add(x: Decimal, y: Decimal) -> RhaiResultOf<Decimal> {
|
||||||
if cfg!(not(feature = "unchecked")) {
|
|
||||||
x.checked_add(y)
|
x.checked_add(y)
|
||||||
.ok_or_else(|| make_err(format!("Addition overflow: {x} + {y}")))
|
.ok_or_else(|| make_err(format!("Addition overflow: {x} + {y}")))
|
||||||
} else {
|
|
||||||
Ok(x + y)
|
|
||||||
}
|
}
|
||||||
}
|
#[rhai_fn(return_raw)]
|
||||||
#[rhai_fn(skip, return_raw)]
|
|
||||||
pub fn subtract(x: Decimal, y: Decimal) -> RhaiResultOf<Decimal> {
|
pub fn subtract(x: Decimal, y: Decimal) -> RhaiResultOf<Decimal> {
|
||||||
if cfg!(not(feature = "unchecked")) {
|
|
||||||
x.checked_sub(y)
|
x.checked_sub(y)
|
||||||
.ok_or_else(|| make_err(format!("Subtraction overflow: {x} - {y}")))
|
.ok_or_else(|| make_err(format!("Subtraction overflow: {x} - {y}")))
|
||||||
} else {
|
|
||||||
Ok(x - y)
|
|
||||||
}
|
}
|
||||||
}
|
#[rhai_fn(return_raw)]
|
||||||
#[rhai_fn(skip, return_raw)]
|
|
||||||
pub fn multiply(x: Decimal, y: Decimal) -> RhaiResultOf<Decimal> {
|
pub fn multiply(x: Decimal, y: Decimal) -> RhaiResultOf<Decimal> {
|
||||||
if cfg!(not(feature = "unchecked")) {
|
|
||||||
x.checked_mul(y)
|
x.checked_mul(y)
|
||||||
.ok_or_else(|| make_err(format!("Multiplication overflow: {x} * {y}")))
|
.ok_or_else(|| make_err(format!("Multiplication overflow: {x} * {y}")))
|
||||||
} else {
|
|
||||||
Ok(x * y)
|
|
||||||
}
|
}
|
||||||
}
|
#[rhai_fn(return_raw)]
|
||||||
#[rhai_fn(skip, return_raw)]
|
|
||||||
pub fn divide(x: Decimal, y: Decimal) -> RhaiResultOf<Decimal> {
|
pub fn divide(x: Decimal, y: Decimal) -> RhaiResultOf<Decimal> {
|
||||||
if cfg!(not(feature = "unchecked")) {
|
|
||||||
// Detect division by zero
|
// Detect division by zero
|
||||||
if y == Decimal::zero() {
|
if y == Decimal::zero() {
|
||||||
Err(make_err(format!("Division by zero: {x} / {y}")))
|
Err(make_err(format!("Division by zero: {x} / {y}")))
|
||||||
@ -528,26 +518,16 @@ pub mod decimal_functions {
|
|||||||
x.checked_div(y)
|
x.checked_div(y)
|
||||||
.ok_or_else(|| make_err(format!("Division overflow: {x} / {y}")))
|
.ok_or_else(|| make_err(format!("Division overflow: {x} / {y}")))
|
||||||
}
|
}
|
||||||
} else {
|
|
||||||
Ok(x / y)
|
|
||||||
}
|
}
|
||||||
}
|
#[rhai_fn(return_raw)]
|
||||||
#[rhai_fn(skip, return_raw)]
|
|
||||||
pub fn modulo(x: Decimal, y: Decimal) -> RhaiResultOf<Decimal> {
|
pub fn modulo(x: Decimal, y: Decimal) -> RhaiResultOf<Decimal> {
|
||||||
if cfg!(not(feature = "unchecked")) {
|
|
||||||
x.checked_rem(y)
|
x.checked_rem(y)
|
||||||
.ok_or_else(|| make_err(format!("Modulo division by zero or overflow: {x} % {y}")))
|
.ok_or_else(|| make_err(format!("Modulo division by zero or overflow: {x} % {y}")))
|
||||||
} else {
|
|
||||||
Ok(x % y)
|
|
||||||
}
|
}
|
||||||
}
|
#[rhai_fn(return_raw)]
|
||||||
#[rhai_fn(skip, return_raw)]
|
|
||||||
pub fn power(x: Decimal, y: Decimal) -> RhaiResultOf<Decimal> {
|
pub fn power(x: Decimal, y: Decimal) -> RhaiResultOf<Decimal> {
|
||||||
if cfg!(not(feature = "unchecked")) {
|
|
||||||
x.checked_powd(y)
|
x.checked_powd(y)
|
||||||
.ok_or_else(|| make_err(format!("Exponential overflow: {x} ** {y}")))
|
.ok_or_else(|| make_err(format!("Exponential overflow: {x} ** {y}")))
|
||||||
} else {
|
|
||||||
Ok(x.pow(y))
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
#[rhai_fn(name = "-")]
|
#[rhai_fn(name = "-")]
|
||||||
|
@ -236,9 +236,8 @@ pub mod array_functions {
|
|||||||
}
|
}
|
||||||
|
|
||||||
let check_sizes = match item.0 {
|
let check_sizes = match item.0 {
|
||||||
crate::types::dynamic::Union::Array(..) | crate::types::dynamic::Union::Str(..) => {
|
crate::types::dynamic::Union::Str(..) => true,
|
||||||
true
|
crate::types::dynamic::Union::Array(..) => true,
|
||||||
}
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
crate::types::dynamic::Union::Map(..) => true,
|
crate::types::dynamic::Union::Map(..) => true,
|
||||||
_ => false,
|
_ => false,
|
||||||
@ -260,7 +259,7 @@ pub mod array_functions {
|
|||||||
s1 += s2;
|
s1 += s2;
|
||||||
|
|
||||||
_ctx.engine()
|
_ctx.engine()
|
||||||
.raise_err_if_over_data_size_limit((a1, m1, s1), Position::NONE)?;
|
.raise_err_if_over_data_size_limit((a1, m1, s1))?;
|
||||||
|
|
||||||
guard.push(item.clone());
|
guard.push(item.clone());
|
||||||
arr_len += 1;
|
arr_len += 1;
|
||||||
@ -834,9 +833,9 @@ pub mod array_functions {
|
|||||||
return Ok(false);
|
return Ok(false);
|
||||||
}
|
}
|
||||||
|
|
||||||
for item in array.iter_mut() {
|
for item in array {
|
||||||
if ctx
|
if ctx
|
||||||
.call_fn_raw(OP_EQUALS, true, false, &mut [item, &mut value.clone()])
|
.call_native_fn_raw(OP_EQUALS, true, &mut [item, &mut value.clone()])
|
||||||
.or_else(|err| match *err {
|
.or_else(|err| match *err {
|
||||||
ERR::ErrorFunctionNotFound(ref fn_sig, ..) if fn_sig.starts_with(OP_EQUALS) => {
|
ERR::ErrorFunctionNotFound(ref fn_sig, ..) if fn_sig.starts_with(OP_EQUALS) => {
|
||||||
if item.type_id() == value.type_id() {
|
if item.type_id() == value.type_id() {
|
||||||
@ -928,7 +927,7 @@ pub mod array_functions {
|
|||||||
|
|
||||||
for (i, item) in array.iter_mut().enumerate().skip(start) {
|
for (i, item) in array.iter_mut().enumerate().skip(start) {
|
||||||
if ctx
|
if ctx
|
||||||
.call_fn_raw(OP_EQUALS, true, false, &mut [item, &mut value.clone()])
|
.call_native_fn_raw(OP_EQUALS, true, &mut [item, &mut value.clone()])
|
||||||
.or_else(|err| match *err {
|
.or_else(|err| match *err {
|
||||||
ERR::ErrorFunctionNotFound(ref fn_sig, ..) if fn_sig.starts_with(OP_EQUALS) => {
|
ERR::ErrorFunctionNotFound(ref fn_sig, ..) if fn_sig.starts_with(OP_EQUALS) => {
|
||||||
if item.type_id() == value.type_id() {
|
if item.type_id() == value.type_id() {
|
||||||
@ -2314,7 +2313,7 @@ pub mod array_functions {
|
|||||||
|
|
||||||
for (a1, a2) in array1.iter_mut().zip(array2.iter_mut()) {
|
for (a1, a2) in array1.iter_mut().zip(array2.iter_mut()) {
|
||||||
if !ctx
|
if !ctx
|
||||||
.call_fn_raw(OP_EQUALS, true, false, &mut [a1, a2])
|
.call_native_fn_raw(OP_EQUALS, true, &mut [a1, a2])
|
||||||
.or_else(|err| match *err {
|
.or_else(|err| match *err {
|
||||||
ERR::ErrorFunctionNotFound(ref fn_sig, ..) if fn_sig.starts_with(OP_EQUALS) => {
|
ERR::ErrorFunctionNotFound(ref fn_sig, ..) if fn_sig.starts_with(OP_EQUALS) => {
|
||||||
if a1.type_id() == a2.type_id() {
|
if a1.type_id() == a2.type_id() {
|
||||||
|
@ -80,11 +80,8 @@ pub mod blob_functions {
|
|||||||
|
|
||||||
// Check if blob will be over max size limit
|
// Check if blob will be over max size limit
|
||||||
#[cfg(not(feature = "unchecked"))]
|
#[cfg(not(feature = "unchecked"))]
|
||||||
if _ctx.engine().max_array_size() > 0 && len > _ctx.engine().max_array_size() {
|
_ctx.engine()
|
||||||
return Err(
|
.raise_err_if_over_data_size_limit((len, 0, 0))?;
|
||||||
crate::ERR::ErrorDataTooLarge("Size of BLOB".to_string(), Position::NONE).into(),
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
let mut blob = Blob::new();
|
let mut blob = Blob::new();
|
||||||
blob.resize(len, (value & 0x0000_00ff) as u8);
|
blob.resize(len, (value & 0x0000_00ff) as u8);
|
||||||
@ -146,6 +143,21 @@ pub mod blob_functions {
|
|||||||
pub fn is_empty(blob: &mut Blob) -> bool {
|
pub fn is_empty(blob: &mut Blob) -> bool {
|
||||||
blob.len() == 0
|
blob.len() == 0
|
||||||
}
|
}
|
||||||
|
/// Return `true` if the BLOB contains a specified byte value.
|
||||||
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rhai
|
||||||
|
/// let text = "hello, world!";
|
||||||
|
///
|
||||||
|
/// print(text.contains('h')); // prints true
|
||||||
|
///
|
||||||
|
/// print(text.contains('x')); // prints false
|
||||||
|
/// ```
|
||||||
|
#[rhai_fn(name = "contains")]
|
||||||
|
pub fn contains(blob: &mut Blob, value: INT) -> bool {
|
||||||
|
blob.contains(&((value & 0x0000_00ff) as u8))
|
||||||
|
}
|
||||||
/// Get the byte value at the `index` position in the BLOB.
|
/// Get the byte value at the `index` position in the BLOB.
|
||||||
///
|
///
|
||||||
/// * If `index` < 0, position counts from the end of the BLOB (`-1` is the last element).
|
/// * If `index` < 0, position counts from the end of the BLOB (`-1` is the last element).
|
||||||
@ -349,7 +361,6 @@ pub mod blob_functions {
|
|||||||
let _ctx = ctx;
|
let _ctx = ctx;
|
||||||
|
|
||||||
// Check if blob will be over max size limit
|
// Check if blob will be over max size limit
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
if _ctx.engine().max_array_size() > 0 && len > _ctx.engine().max_array_size() {
|
if _ctx.engine().max_array_size() > 0 && len > _ctx.engine().max_array_size() {
|
||||||
return Err(
|
return Err(
|
||||||
crate::ERR::ErrorDataTooLarge("Size of BLOB".to_string(), Position::NONE).into(),
|
crate::ERR::ErrorDataTooLarge("Size of BLOB".to_string(), Position::NONE).into(),
|
||||||
|
@ -33,14 +33,13 @@ mod debugging_functions {
|
|||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
pub fn back_trace(ctx: NativeCallContext) -> Array {
|
pub fn back_trace(ctx: NativeCallContext) -> Array {
|
||||||
if let Some(global) = ctx.global_runtime_state() {
|
ctx.global_runtime_state()
|
||||||
global
|
|
||||||
.debugger
|
.debugger
|
||||||
.call_stack()
|
.call_stack()
|
||||||
.iter()
|
.iter()
|
||||||
.rev()
|
.rev()
|
||||||
.filter(|crate::debugger::CallStackFrame { fn_name, args, .. }| {
|
.filter(|crate::debugger::CallStackFrame { fn_name, args, .. }| {
|
||||||
fn_name != "back_trace" || !args.is_empty()
|
fn_name.as_str() != "back_trace" || !args.is_empty()
|
||||||
})
|
})
|
||||||
.map(
|
.map(
|
||||||
|frame @ crate::debugger::CallStackFrame {
|
|frame @ crate::debugger::CallStackFrame {
|
||||||
@ -57,19 +56,13 @@ mod debugging_functions {
|
|||||||
map.insert("display".into(), display.into());
|
map.insert("display".into(), display.into());
|
||||||
map.insert("fn_name".into(), _fn_name.into());
|
map.insert("fn_name".into(), _fn_name.into());
|
||||||
if !_args.is_empty() {
|
if !_args.is_empty() {
|
||||||
map.insert(
|
map.insert("args".into(), Dynamic::from_array(_args.clone().to_vec()));
|
||||||
"args".into(),
|
|
||||||
Dynamic::from_array(_args.clone().to_vec()),
|
|
||||||
);
|
|
||||||
}
|
}
|
||||||
if !_source.is_empty() {
|
if let Some(source) = _source {
|
||||||
map.insert("source".into(), _source.into());
|
map.insert("source".into(), source.into());
|
||||||
}
|
}
|
||||||
if !_pos.is_none() {
|
if !_pos.is_none() {
|
||||||
map.insert(
|
map.insert("line".into(), (_pos.line().unwrap() as crate::INT).into());
|
||||||
"line".into(),
|
|
||||||
(_pos.line().unwrap() as crate::INT).into(),
|
|
||||||
);
|
|
||||||
map.insert(
|
map.insert(
|
||||||
"position".into(),
|
"position".into(),
|
||||||
(_pos.position().unwrap_or(0) as crate::INT).into(),
|
(_pos.position().unwrap_or(0) as crate::INT).into(),
|
||||||
@ -82,8 +75,5 @@ mod debugging_functions {
|
|||||||
},
|
},
|
||||||
)
|
)
|
||||||
.collect()
|
.collect()
|
||||||
} else {
|
|
||||||
Array::new()
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -27,7 +27,7 @@ mod fn_ptr_functions {
|
|||||||
/// ```
|
/// ```
|
||||||
#[rhai_fn(name = "name", get = "name", pure)]
|
#[rhai_fn(name = "name", get = "name", pure)]
|
||||||
pub fn name(fn_ptr: &mut FnPtr) -> ImmutableString {
|
pub fn name(fn_ptr: &mut FnPtr) -> ImmutableString {
|
||||||
fn_ptr.fn_name_raw().into()
|
fn_ptr.fn_name_raw().clone()
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Return `true` if the function is an anonymous function.
|
/// Return `true` if the function is an anonymous function.
|
||||||
|
@ -47,6 +47,8 @@ pub struct StepRange<T: Debug + Copy + PartialOrd> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl<T: Debug + Copy + PartialOrd> Debug for StepRange<T> {
|
impl<T: Debug + Copy + PartialOrd> Debug for StepRange<T> {
|
||||||
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||||
f.debug_tuple(&format!("StepRange<{}>", type_name::<T>()))
|
f.debug_tuple(&format!("StepRange<{}>", type_name::<T>()))
|
||||||
.field(&self.from)
|
.field(&self.from)
|
||||||
@ -120,7 +122,7 @@ impl<T: Debug + Copy + PartialOrd> FusedIterator for StepRange<T> {}
|
|||||||
|
|
||||||
// Bit-field iterator with step
|
// Bit-field iterator with step
|
||||||
#[derive(Debug, Clone, Hash, Eq, PartialEq)]
|
#[derive(Debug, Clone, Hash, Eq, PartialEq)]
|
||||||
pub struct BitRange(INT, INT, usize);
|
pub struct BitRange(INT, usize);
|
||||||
|
|
||||||
impl BitRange {
|
impl BitRange {
|
||||||
pub fn new(value: INT, from: INT, len: INT) -> RhaiResultOf<Self> {
|
pub fn new(value: INT, from: INT, len: INT) -> RhaiResultOf<Self> {
|
||||||
@ -136,7 +138,7 @@ impl BitRange {
|
|||||||
len as usize
|
len as usize
|
||||||
};
|
};
|
||||||
|
|
||||||
Ok(Self(value, 1 << from, len))
|
Ok(Self(value >> from, len))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -144,19 +146,19 @@ impl Iterator for BitRange {
|
|||||||
type Item = bool;
|
type Item = bool;
|
||||||
|
|
||||||
fn next(&mut self) -> Option<Self::Item> {
|
fn next(&mut self) -> Option<Self::Item> {
|
||||||
if self.2 == 0 {
|
if self.1 == 0 {
|
||||||
None
|
None
|
||||||
} else {
|
} else {
|
||||||
let r = (self.0 & self.1) != 0;
|
let r = (self.0 & 0x0001) != 0;
|
||||||
self.1 <<= 1;
|
self.0 >>= 1;
|
||||||
self.2 -= 1;
|
self.1 -= 1;
|
||||||
Some(r)
|
Some(r)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn size_hint(&self) -> (usize, Option<usize>) {
|
fn size_hint(&self) -> (usize, Option<usize>) {
|
||||||
(self.2, Some(self.2))
|
(self.1, Some(self.1))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -165,7 +167,7 @@ impl FusedIterator for BitRange {}
|
|||||||
impl ExactSizeIterator for BitRange {
|
impl ExactSizeIterator for BitRange {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
fn len(&self) -> usize {
|
fn len(&self) -> usize {
|
||||||
self.2
|
self.1
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -668,6 +670,12 @@ mod range_functions {
|
|||||||
pub fn is_empty_exclusive(range: &mut ExclusiveRange) -> bool {
|
pub fn is_empty_exclusive(range: &mut ExclusiveRange) -> bool {
|
||||||
range.is_empty()
|
range.is_empty()
|
||||||
}
|
}
|
||||||
|
/// Return `true` if the range contains a specified value.
|
||||||
|
#[rhai_fn(name = "contains")]
|
||||||
|
pub fn contains_exclusive(range: &mut ExclusiveRange, value: INT) -> bool {
|
||||||
|
range.contains(&value)
|
||||||
|
}
|
||||||
|
|
||||||
/// Return the start of the inclusive range.
|
/// Return the start of the inclusive range.
|
||||||
#[rhai_fn(get = "start", name = "start", pure)]
|
#[rhai_fn(get = "start", name = "start", pure)]
|
||||||
pub fn start_inclusive(range: &mut InclusiveRange) -> INT {
|
pub fn start_inclusive(range: &mut InclusiveRange) -> INT {
|
||||||
@ -695,4 +703,9 @@ mod range_functions {
|
|||||||
pub fn is_empty_inclusive(range: &mut InclusiveRange) -> bool {
|
pub fn is_empty_inclusive(range: &mut InclusiveRange) -> bool {
|
||||||
range.is_empty()
|
range.is_empty()
|
||||||
}
|
}
|
||||||
|
/// Return `true` if the range contains a specified value.
|
||||||
|
#[rhai_fn(name = "contains")]
|
||||||
|
pub fn contains_inclusive(range: &mut InclusiveRange, value: INT) -> bool {
|
||||||
|
range.contains(&value)
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
@ -88,7 +88,6 @@ mod core_functions {
|
|||||||
#[cfg(feature = "f32_float")]
|
#[cfg(feature = "f32_float")]
|
||||||
std::thread::sleep(std::time::Duration::from_secs_f32(seconds));
|
std::thread::sleep(std::time::Duration::from_secs_f32(seconds));
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Block the current thread for a particular number of `seconds`.
|
/// Block the current thread for a particular number of `seconds`.
|
||||||
#[cfg(not(feature = "no_std"))]
|
#[cfg(not(feature = "no_std"))]
|
||||||
pub fn sleep(seconds: INT) {
|
pub fn sleep(seconds: INT) {
|
||||||
@ -97,6 +96,23 @@ mod core_functions {
|
|||||||
}
|
}
|
||||||
std::thread::sleep(std::time::Duration::from_secs(seconds as u64));
|
std::thread::sleep(std::time::Duration::from_secs(seconds as u64));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// Parse a JSON string into a value.
|
||||||
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rhai
|
||||||
|
/// let m = parse_json(`{"a":1, "b":2, "c":3}`);
|
||||||
|
///
|
||||||
|
/// print(m); // prints #{"a":1, "b":2, "c":3}
|
||||||
|
/// ```
|
||||||
|
#[cfg(not(feature = "no_index"))]
|
||||||
|
#[cfg(not(feature = "no_object"))]
|
||||||
|
#[cfg(feature = "metadata")]
|
||||||
|
#[rhai_fn(return_raw)]
|
||||||
|
pub fn parse_json(_ctx: NativeCallContext, json: &str) -> RhaiResultOf<Dynamic> {
|
||||||
|
serde_json::from_str(json).map_err(|err| err.to_string().into())
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
|
@ -2,7 +2,7 @@
|
|||||||
|
|
||||||
use crate::engine::OP_EQUALS;
|
use crate::engine::OP_EQUALS;
|
||||||
use crate::plugin::*;
|
use crate::plugin::*;
|
||||||
use crate::{def_package, format_map_as_json, Dynamic, ImmutableString, Map, RhaiResultOf, INT};
|
use crate::{def_package, Dynamic, ImmutableString, Map, NativeCallContext, RhaiResultOf, INT};
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
|
|
||||||
@ -30,6 +30,20 @@ mod map_functions {
|
|||||||
pub fn is_empty(map: &mut Map) -> bool {
|
pub fn is_empty(map: &mut Map) -> bool {
|
||||||
map.len() == 0
|
map.len() == 0
|
||||||
}
|
}
|
||||||
|
/// Returns `true` if the object map contains a specified property.
|
||||||
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rhai
|
||||||
|
/// let m = #{a: 1, b: 2, c: 3};
|
||||||
|
///
|
||||||
|
/// print(m.contains("b")); // prints true
|
||||||
|
///
|
||||||
|
/// print(m.contains("x")); // prints false
|
||||||
|
/// ```
|
||||||
|
pub fn contains(map: &mut Map, property: &str) -> bool {
|
||||||
|
map.contains_key(property)
|
||||||
|
}
|
||||||
/// Get the value of the `property` in the object map and return a copy.
|
/// Get the value of the `property` in the object map and return a copy.
|
||||||
///
|
///
|
||||||
/// If `property` does not exist in the object map, `()` is returned.
|
/// If `property` does not exist in the object map, `()` is returned.
|
||||||
@ -68,12 +82,13 @@ mod map_functions {
|
|||||||
/// print(m); // prints "#{a: 1, b: 42, c: 3, x: 0}"
|
/// print(m); // prints "#{a: 1, b: 42, c: 3, x: 0}"
|
||||||
/// ```
|
/// ```
|
||||||
pub fn set(map: &mut Map, property: &str, value: Dynamic) {
|
pub fn set(map: &mut Map, property: &str, value: Dynamic) {
|
||||||
if let Some(value_ref) = map.get_mut(property) {
|
match map.get_mut(property) {
|
||||||
*value_ref = value;
|
Some(value_ref) => *value_ref = value,
|
||||||
} else {
|
_ => {
|
||||||
map.insert(property.into(), value);
|
map.insert(property.into(), value);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
}
|
||||||
/// Clear the object map.
|
/// Clear the object map.
|
||||||
pub fn clear(map: &mut Map) {
|
pub fn clear(map: &mut Map) {
|
||||||
if !map.is_empty() {
|
if !map.is_empty() {
|
||||||
@ -198,7 +213,7 @@ mod map_functions {
|
|||||||
for (m1, v1) in map1 {
|
for (m1, v1) in map1 {
|
||||||
if let Some(v2) = map2.get_mut(m1) {
|
if let Some(v2) = map2.get_mut(m1) {
|
||||||
let equals = ctx
|
let equals = ctx
|
||||||
.call_fn_raw(OP_EQUALS, true, false, &mut [v1, v2])?
|
.call_native_fn_raw(OP_EQUALS, true, &mut [v1, v2])?
|
||||||
.as_bool()
|
.as_bool()
|
||||||
.unwrap_or(false);
|
.unwrap_or(false);
|
||||||
|
|
||||||
@ -290,6 +305,9 @@ mod map_functions {
|
|||||||
/// print(m.to_json()); // prints {"a":1, "b":2, "c":3}
|
/// print(m.to_json()); // prints {"a":1, "b":2, "c":3}
|
||||||
/// ```
|
/// ```
|
||||||
pub fn to_json(map: &mut Map) -> String {
|
pub fn to_json(map: &mut Map) -> String {
|
||||||
format_map_as_json(map)
|
#[cfg(feature = "metadata")]
|
||||||
|
return serde_json::to_string(map).unwrap_or_else(|_| "ERROR".into());
|
||||||
|
#[cfg(not(feature = "metadata"))]
|
||||||
|
return crate::format_map_as_json(map);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -1,6 +1,6 @@
|
|||||||
//! Module containing all built-in _packages_ available to Rhai, plus facilities to define custom packages.
|
//! Module containing all built-in _packages_ available to Rhai, plus facilities to define custom packages.
|
||||||
|
|
||||||
use crate::{Engine, Module, Shared};
|
use crate::{Engine, Module, SharedModule};
|
||||||
|
|
||||||
pub(crate) mod arithmetic;
|
pub(crate) mod arithmetic;
|
||||||
pub(crate) mod array_basic;
|
pub(crate) mod array_basic;
|
||||||
@ -38,18 +38,21 @@ pub use pkg_core::CorePackage;
|
|||||||
pub use pkg_std::StandardPackage;
|
pub use pkg_std::StandardPackage;
|
||||||
pub use string_basic::BasicStringPackage;
|
pub use string_basic::BasicStringPackage;
|
||||||
pub use string_more::MoreStringPackage;
|
pub use string_more::MoreStringPackage;
|
||||||
#[cfg(not(feature = "no_std"))]
|
#[cfg(not(feature = "no_time"))]
|
||||||
pub use time_basic::BasicTimePackage;
|
pub use time_basic::BasicTimePackage;
|
||||||
|
|
||||||
/// Trait that all packages must implement.
|
/// Trait that all packages must implement.
|
||||||
pub trait Package {
|
pub trait Package {
|
||||||
/// Initialize the package.
|
/// Initialize the package.
|
||||||
/// Functions should be registered into `module` here.
|
/// Functions should be registered into `module` here.
|
||||||
|
#[cold]
|
||||||
fn init(module: &mut Module);
|
fn init(module: &mut Module);
|
||||||
|
|
||||||
/// Initialize the package with an [`Engine`].
|
/// Initialize the package with an [`Engine`].
|
||||||
///
|
///
|
||||||
/// Perform tasks such as registering custom operators/syntax.
|
/// Perform tasks such as registering custom operators/syntax.
|
||||||
|
#[cold]
|
||||||
|
#[inline]
|
||||||
#[allow(unused_variables)]
|
#[allow(unused_variables)]
|
||||||
fn init_engine(engine: &mut Engine) {}
|
fn init_engine(engine: &mut Engine) {}
|
||||||
|
|
||||||
@ -65,6 +68,8 @@ pub trait Package {
|
|||||||
///
|
///
|
||||||
/// package.register_into_engine(&mut engine);
|
/// package.register_into_engine(&mut engine);
|
||||||
/// ```
|
/// ```
|
||||||
|
#[cold]
|
||||||
|
#[inline]
|
||||||
fn register_into_engine(&self, engine: &mut Engine) -> &Self {
|
fn register_into_engine(&self, engine: &mut Engine) -> &Self {
|
||||||
Self::init_engine(engine);
|
Self::init_engine(engine);
|
||||||
engine.register_global_module(self.as_shared_module());
|
engine.register_global_module(self.as_shared_module());
|
||||||
@ -84,6 +89,8 @@ pub trait Package {
|
|||||||
/// package.register_into_engine_as(&mut engine, "core");
|
/// package.register_into_engine_as(&mut engine, "core");
|
||||||
/// ```
|
/// ```
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
|
#[cold]
|
||||||
|
#[inline]
|
||||||
fn register_into_engine_as(&self, engine: &mut Engine, name: &str) -> &Self {
|
fn register_into_engine_as(&self, engine: &mut Engine, name: &str) -> &Self {
|
||||||
Self::init_engine(engine);
|
Self::init_engine(engine);
|
||||||
engine.register_static_module(name, self.as_shared_module());
|
engine.register_static_module(name, self.as_shared_module());
|
||||||
@ -92,7 +99,7 @@ pub trait Package {
|
|||||||
|
|
||||||
/// Get a reference to a shared module from this package.
|
/// Get a reference to a shared module from this package.
|
||||||
#[must_use]
|
#[must_use]
|
||||||
fn as_shared_module(&self) -> Shared<Module>;
|
fn as_shared_module(&self) -> SharedModule;
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Macro that makes it easy to define a _package_ (which is basically a shared [module][Module])
|
/// Macro that makes it easy to define a _package_ (which is basically a shared [module][Module])
|
||||||
@ -133,7 +140,6 @@ macro_rules! def_package {
|
|||||||
fn as_shared_module(&self) -> $crate::Shared<$crate::Module> {
|
fn as_shared_module(&self) -> $crate::Shared<$crate::Module> {
|
||||||
self.0.clone()
|
self.0.clone()
|
||||||
}
|
}
|
||||||
#[inline]
|
|
||||||
fn init($lib: &mut $crate::Module) {
|
fn init($lib: &mut $crate::Module) {
|
||||||
$($(
|
$($(
|
||||||
$(#[$base_meta])* { <$base_pkg>::init($lib); }
|
$(#[$base_meta])* { <$base_pkg>::init($lib); }
|
||||||
@ -141,7 +147,6 @@ macro_rules! def_package {
|
|||||||
|
|
||||||
$block
|
$block
|
||||||
}
|
}
|
||||||
#[inline]
|
|
||||||
fn init_engine(_engine: &mut $crate::Engine) {
|
fn init_engine(_engine: &mut $crate::Engine) {
|
||||||
$($(
|
$($(
|
||||||
$(#[$base_meta])* { <$base_pkg>::init_engine(_engine); }
|
$(#[$base_meta])* { <$base_pkg>::init_engine(_engine); }
|
||||||
@ -156,6 +161,7 @@ macro_rules! def_package {
|
|||||||
|
|
||||||
impl Default for $package {
|
impl Default for $package {
|
||||||
#[inline(always)]
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
Self::new()
|
Self::new()
|
||||||
}
|
}
|
||||||
@ -193,12 +199,16 @@ macro_rules! def_package {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl Default for $package {
|
impl Default for $package {
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
Self::new()
|
Self::new()
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl $package {
|
impl $package {
|
||||||
|
#[inline]
|
||||||
|
#[must_use]
|
||||||
pub fn new() -> Self {
|
pub fn new() -> Self {
|
||||||
let mut module = $root::Module::new();
|
let mut module = $root::Module::new();
|
||||||
<Self as $root::packages::Package>::init(&mut module);
|
<Self as $root::packages::Package>::init(&mut module);
|
||||||
@ -229,12 +239,16 @@ macro_rules! def_package {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl Default for $package {
|
impl Default for $package {
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
Self::new()
|
Self::new()
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl $package {
|
impl $package {
|
||||||
|
#[inline]
|
||||||
|
#[must_use]
|
||||||
pub fn new() -> Self {
|
pub fn new() -> Self {
|
||||||
let mut module = $root::Module::new();
|
let mut module = $root::Module::new();
|
||||||
<Self as $root::packages::Package>::init(&mut module);
|
<Self as $root::packages::Package>::init(&mut module);
|
||||||
|
@ -26,7 +26,7 @@ def_package! {
|
|||||||
#[cfg(not(feature = "no_index"))] BasicArrayPackage,
|
#[cfg(not(feature = "no_index"))] BasicArrayPackage,
|
||||||
#[cfg(not(feature = "no_index"))] BasicBlobPackage,
|
#[cfg(not(feature = "no_index"))] BasicBlobPackage,
|
||||||
#[cfg(not(feature = "no_object"))] BasicMapPackage,
|
#[cfg(not(feature = "no_object"))] BasicMapPackage,
|
||||||
#[cfg(not(feature = "no_std"))] BasicTimePackage,
|
#[cfg(not(feature = "no_time"))] BasicTimePackage,
|
||||||
MoreStringPackage
|
MoreStringPackage
|
||||||
{
|
{
|
||||||
lib.standard = true;
|
lib.standard = true;
|
||||||
|
@ -38,7 +38,7 @@ pub fn print_with_func(
|
|||||||
ctx: &NativeCallContext,
|
ctx: &NativeCallContext,
|
||||||
value: &mut Dynamic,
|
value: &mut Dynamic,
|
||||||
) -> crate::ImmutableString {
|
) -> crate::ImmutableString {
|
||||||
match ctx.call_fn_raw(fn_name, true, false, &mut [value]) {
|
match ctx.call_native_fn_raw(fn_name, true, &mut [value]) {
|
||||||
Ok(result) if result.is::<crate::ImmutableString>() => {
|
Ok(result) if result.is::<crate::ImmutableString>() => {
|
||||||
result.into_immutable_string().expect("`ImmutableString`")
|
result.into_immutable_string().expect("`ImmutableString`")
|
||||||
}
|
}
|
||||||
|
@ -239,10 +239,9 @@ mod string_functions {
|
|||||||
/// Clear the string, making it empty.
|
/// Clear the string, making it empty.
|
||||||
pub fn clear(string: &mut ImmutableString) {
|
pub fn clear(string: &mut ImmutableString) {
|
||||||
if !string.is_empty() {
|
if !string.is_empty() {
|
||||||
if let Some(s) = string.get_mut() {
|
match string.get_mut() {
|
||||||
s.clear();
|
Some(s) => s.clear(),
|
||||||
} else {
|
_ => *string = ImmutableString::new(),
|
||||||
*string = ImmutableString::new();
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -287,13 +286,15 @@ mod string_functions {
|
|||||||
/// print(text); // prints "hello"
|
/// print(text); // prints "hello"
|
||||||
/// ```
|
/// ```
|
||||||
pub fn trim(string: &mut ImmutableString) {
|
pub fn trim(string: &mut ImmutableString) {
|
||||||
if let Some(s) = string.get_mut() {
|
match string.get_mut() {
|
||||||
|
Some(s) => {
|
||||||
let trimmed = s.trim();
|
let trimmed = s.trim();
|
||||||
|
|
||||||
if trimmed != s {
|
if trimmed != s {
|
||||||
*s = trimmed.into();
|
*s = trimmed.into();
|
||||||
}
|
}
|
||||||
} else {
|
}
|
||||||
|
None => {
|
||||||
let trimmed = string.trim();
|
let trimmed = string.trim();
|
||||||
|
|
||||||
if trimmed != string {
|
if trimmed != string {
|
||||||
@ -301,6 +302,7 @@ mod string_functions {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
}
|
||||||
/// Remove the last character from the string and return it.
|
/// Remove the last character from the string and return it.
|
||||||
///
|
///
|
||||||
/// If the string is empty, `()` is returned.
|
/// If the string is empty, `()` is returned.
|
||||||
@ -506,6 +508,37 @@ mod string_functions {
|
|||||||
*character = to_lower_char(*character);
|
*character = to_lower_char(*character);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// Return `true` if the string contains a specified string.
|
||||||
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rhai
|
||||||
|
/// let text = "hello, world!";
|
||||||
|
///
|
||||||
|
/// print(text.contains("hello")); // prints true
|
||||||
|
///
|
||||||
|
/// print(text.contains("hey")); // prints false
|
||||||
|
/// ```
|
||||||
|
pub fn contains(string: &str, match_string: &str) -> bool {
|
||||||
|
string.contains(match_string)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Return `true` if the string contains a specified character.
|
||||||
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rhai
|
||||||
|
/// let text = "hello, world!";
|
||||||
|
///
|
||||||
|
/// print(text.contains('h')); // prints true
|
||||||
|
///
|
||||||
|
/// print(text.contains('x')); // prints false
|
||||||
|
/// ```
|
||||||
|
#[rhai_fn(name = "contains")]
|
||||||
|
pub fn contains_char(string: &str, character: char) -> bool {
|
||||||
|
string.contains(character).into()
|
||||||
|
}
|
||||||
|
|
||||||
/// Return `true` if the string starts with a specified string.
|
/// Return `true` if the string starts with a specified string.
|
||||||
///
|
///
|
||||||
/// # Example
|
/// # Example
|
||||||
@ -1185,7 +1218,6 @@ mod string_functions {
|
|||||||
let _ctx = ctx;
|
let _ctx = ctx;
|
||||||
|
|
||||||
// Check if string will be over max size limit
|
// Check if string will be over max size limit
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
if _ctx.engine().max_string_size() > 0 && len > _ctx.engine().max_string_size() {
|
if _ctx.engine().max_string_size() > 0 && len > _ctx.engine().max_string_size() {
|
||||||
return Err(crate::ERR::ErrorDataTooLarge(
|
return Err(crate::ERR::ErrorDataTooLarge(
|
||||||
"Length of string".to_string(),
|
"Length of string".to_string(),
|
||||||
@ -1203,7 +1235,6 @@ mod string_functions {
|
|||||||
p.push(character);
|
p.push(character);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
if _ctx.engine().max_string_size() > 0 && string.len() > _ctx.engine().max_string_size()
|
if _ctx.engine().max_string_size() > 0 && string.len() > _ctx.engine().max_string_size()
|
||||||
{
|
{
|
||||||
return Err(crate::ERR::ErrorDataTooLarge(
|
return Err(crate::ERR::ErrorDataTooLarge(
|
||||||
@ -1247,7 +1278,6 @@ mod string_functions {
|
|||||||
let _ctx = ctx;
|
let _ctx = ctx;
|
||||||
|
|
||||||
// Check if string will be over max size limit
|
// Check if string will be over max size limit
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
if _ctx.engine().max_string_size() > 0 && len > _ctx.engine().max_string_size() {
|
if _ctx.engine().max_string_size() > 0 && len > _ctx.engine().max_string_size() {
|
||||||
return Err(crate::ERR::ErrorDataTooLarge(
|
return Err(crate::ERR::ErrorDataTooLarge(
|
||||||
"Length of string".to_string(),
|
"Length of string".to_string(),
|
||||||
@ -1272,7 +1302,6 @@ mod string_functions {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
if _ctx.engine().max_string_size() > 0 && string.len() > _ctx.engine().max_string_size()
|
if _ctx.engine().max_string_size() > 0 && string.len() > _ctx.engine().max_string_size()
|
||||||
{
|
{
|
||||||
return Err(crate::ERR::ErrorDataTooLarge(
|
return Err(crate::ERR::ErrorDataTooLarge(
|
||||||
|
@ -1,8 +1,8 @@
|
|||||||
#![cfg(not(feature = "no_std"))]
|
#![cfg(not(feature = "no_time"))]
|
||||||
|
|
||||||
use super::arithmetic::make_err as make_arithmetic_err;
|
use super::arithmetic::make_err as make_arithmetic_err;
|
||||||
use crate::plugin::*;
|
use crate::plugin::*;
|
||||||
use crate::{def_package, Dynamic, EvalAltResult, RhaiResult, RhaiResultOf, INT};
|
use crate::{def_package, Dynamic, RhaiResult, RhaiResultOf, INT};
|
||||||
|
|
||||||
#[cfg(not(feature = "no_float"))]
|
#[cfg(not(feature = "no_float"))]
|
||||||
use crate::FLOAT;
|
use crate::FLOAT;
|
||||||
|
431
src/parser.rs
431
src/parser.rs
@ -8,7 +8,7 @@ use crate::ast::{
|
|||||||
SwitchCasesCollection, TryCatchBlock,
|
SwitchCasesCollection, TryCatchBlock,
|
||||||
};
|
};
|
||||||
use crate::engine::{Precedence, KEYWORD_THIS, OP_CONTAINS};
|
use crate::engine::{Precedence, KEYWORD_THIS, OP_CONTAINS};
|
||||||
use crate::eval::GlobalRuntimeState;
|
use crate::eval::{Caches, GlobalRuntimeState};
|
||||||
use crate::func::{hashing::get_hasher, StraightHashMap};
|
use crate::func::{hashing::get_hasher, StraightHashMap};
|
||||||
use crate::tokenizer::{
|
use crate::tokenizer::{
|
||||||
is_keyword_function, is_valid_function_name, is_valid_identifier, Token, TokenStream,
|
is_keyword_function, is_valid_function_name, is_valid_identifier, Token, TokenStream,
|
||||||
@ -34,10 +34,6 @@ pub type ParseResult<T> = Result<T, ParseError>;
|
|||||||
|
|
||||||
type FnLib = StraightHashMap<Shared<ScriptFnDef>>;
|
type FnLib = StraightHashMap<Shared<ScriptFnDef>>;
|
||||||
|
|
||||||
const KEYWORD_SEMICOLON: &str = Token::SemiColon.literal_syntax();
|
|
||||||
|
|
||||||
const KEYWORD_CLOSE_BRACE: &str = Token::RightBrace.literal_syntax();
|
|
||||||
|
|
||||||
/// Invalid variable name that acts as a search barrier in a [`Scope`].
|
/// Invalid variable name that acts as a search barrier in a [`Scope`].
|
||||||
const SCOPE_SEARCH_BARRIER_MARKER: &str = "$ BARRIER $";
|
const SCOPE_SEARCH_BARRIER_MARKER: &str = "$ BARRIER $";
|
||||||
|
|
||||||
@ -47,9 +43,6 @@ const NEVER_ENDS: &str = "`Token`";
|
|||||||
/// Unroll `switch` ranges no larger than this.
|
/// Unroll `switch` ranges no larger than this.
|
||||||
const SMALL_SWITCH_RANGE: INT = 16;
|
const SMALL_SWITCH_RANGE: INT = 16;
|
||||||
|
|
||||||
/// Number of string interners used: two additional for property getters/setters if not `no_object`
|
|
||||||
const NUM_INTERNERS: usize = if cfg!(feature = "no_object") { 1 } else { 3 };
|
|
||||||
|
|
||||||
/// _(internals)_ A type that encapsulates the current state of the parser.
|
/// _(internals)_ A type that encapsulates the current state of the parser.
|
||||||
/// Exported under the `internals` feature only.
|
/// Exported under the `internals` feature only.
|
||||||
pub struct ParseState<'e> {
|
pub struct ParseState<'e> {
|
||||||
@ -58,11 +51,11 @@ pub struct ParseState<'e> {
|
|||||||
/// Controls whether parsing of an expression should stop given the next token.
|
/// Controls whether parsing of an expression should stop given the next token.
|
||||||
pub expr_filter: fn(&Token) -> bool,
|
pub expr_filter: fn(&Token) -> bool,
|
||||||
/// String interners.
|
/// String interners.
|
||||||
interned_strings: [StringsInterner<'e>; NUM_INTERNERS],
|
interned_strings: StringsInterner<'e>,
|
||||||
/// External [scope][Scope] with constants.
|
/// External [scope][Scope] with constants.
|
||||||
pub scope: &'e Scope<'e>,
|
pub scope: &'e Scope<'e>,
|
||||||
/// Global runtime state.
|
/// Global runtime state.
|
||||||
pub global: GlobalRuntimeState<'e>,
|
pub global: GlobalRuntimeState,
|
||||||
/// Encapsulates a local stack with variable names to simulate an actual runtime scope.
|
/// Encapsulates a local stack with variable names to simulate an actual runtime scope.
|
||||||
pub stack: Scope<'e>,
|
pub stack: Scope<'e>,
|
||||||
/// Size of the local variables stack upon entry of the current block scope.
|
/// Size of the local variables stack upon entry of the current block scope.
|
||||||
@ -88,6 +81,8 @@ pub struct ParseState<'e> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl fmt::Debug for ParseState<'_> {
|
impl fmt::Debug for ParseState<'_> {
|
||||||
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
let mut f = f.debug_struct("ParseState");
|
let mut f = f.debug_struct("ParseState");
|
||||||
|
|
||||||
@ -111,12 +106,12 @@ impl fmt::Debug for ParseState<'_> {
|
|||||||
|
|
||||||
impl<'e> ParseState<'e> {
|
impl<'e> ParseState<'e> {
|
||||||
/// Create a new [`ParseState`].
|
/// Create a new [`ParseState`].
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn new(
|
pub fn new(
|
||||||
engine: &Engine,
|
engine: &Engine,
|
||||||
scope: &'e Scope,
|
scope: &'e Scope,
|
||||||
interned_strings: [StringsInterner<'e>; NUM_INTERNERS],
|
interned_strings: StringsInterner<'e>,
|
||||||
tokenizer_control: TokenizerControl,
|
tokenizer_control: TokenizerControl,
|
||||||
) -> Self {
|
) -> Self {
|
||||||
Self {
|
Self {
|
||||||
@ -179,12 +174,11 @@ impl<'e> ParseState<'e> {
|
|||||||
///
|
///
|
||||||
/// # Return value: `(index, is_func_name)`
|
/// # Return value: `(index, is_func_name)`
|
||||||
///
|
///
|
||||||
/// * `index`: `None` when the variable name is not found in the `stack`,
|
/// * `index`: [`None`] when the variable name is not found in the `stack`,
|
||||||
/// otherwise the index value.
|
/// otherwise the index value.
|
||||||
///
|
///
|
||||||
/// * `is_func_name`: `true` if the variable is actually the name of a function
|
/// * `is_func_name`: `true` if the variable is actually the name of a function
|
||||||
/// (in which case it will be converted into a function pointer).
|
/// (in which case it will be converted into a function pointer).
|
||||||
#[inline]
|
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn access_var(
|
pub fn access_var(
|
||||||
&mut self,
|
&mut self,
|
||||||
@ -199,7 +193,6 @@ impl<'e> ParseState<'e> {
|
|||||||
|
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
let is_func_name = _lib.values().any(|f| f.name == name);
|
let is_func_name = _lib.values().any(|f| f.name == name);
|
||||||
|
|
||||||
#[cfg(feature = "no_function")]
|
#[cfg(feature = "no_function")]
|
||||||
let is_func_name = false;
|
let is_func_name = false;
|
||||||
|
|
||||||
@ -230,13 +223,12 @@ impl<'e> ParseState<'e> {
|
|||||||
/// Returns the offset to be deducted from `Stack::len`,
|
/// Returns the offset to be deducted from `Stack::len`,
|
||||||
/// i.e. the top element of the [`ParseState`] is offset 1.
|
/// i.e. the top element of the [`ParseState`] is offset 1.
|
||||||
///
|
///
|
||||||
/// Returns `None` when the variable name is not found in the [`ParseState`].
|
/// Returns [`None`] when the variable name is not found in the [`ParseState`].
|
||||||
///
|
///
|
||||||
/// # Panics
|
/// # Panics
|
||||||
///
|
///
|
||||||
/// Panics when called under `no_module`.
|
/// Panics when called under `no_module`.
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
#[inline]
|
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn find_module(&self, name: &str) -> Option<NonZeroUsize> {
|
pub fn find_module(&self, name: &str) -> Option<NonZeroUsize> {
|
||||||
self.imports
|
self.imports
|
||||||
@ -254,61 +246,69 @@ impl<'e> ParseState<'e> {
|
|||||||
&mut self,
|
&mut self,
|
||||||
text: impl AsRef<str> + Into<ImmutableString>,
|
text: impl AsRef<str> + Into<ImmutableString>,
|
||||||
) -> ImmutableString {
|
) -> ImmutableString {
|
||||||
self.interned_strings[0].get(text)
|
self.interned_strings.get(text)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Get an interned property getter, creating one if it is not yet interned.
|
/// Get an interned property getter, creating one if it is not yet interned.
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn get_interned_getter(
|
pub fn get_interned_getter(
|
||||||
&mut self,
|
&mut self,
|
||||||
text: impl AsRef<str> + Into<ImmutableString>,
|
text: impl AsRef<str> + Into<ImmutableString>,
|
||||||
) -> ImmutableString {
|
) -> ImmutableString {
|
||||||
self.interned_strings[1]
|
self.interned_strings.get_with_mapper(
|
||||||
.get_with_mapper(|s| crate::engine::make_getter(s.as_ref()).into(), text)
|
crate::engine::FN_GET,
|
||||||
|
|s| crate::engine::make_getter(s.as_ref()).into(),
|
||||||
|
text,
|
||||||
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Get an interned property setter, creating one if it is not yet interned.
|
/// Get an interned property setter, creating one if it is not yet interned.
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub fn get_interned_setter(
|
pub fn get_interned_setter(
|
||||||
&mut self,
|
&mut self,
|
||||||
text: impl AsRef<str> + Into<ImmutableString>,
|
text: impl AsRef<str> + Into<ImmutableString>,
|
||||||
) -> ImmutableString {
|
) -> ImmutableString {
|
||||||
self.interned_strings[2]
|
self.interned_strings.get_with_mapper(
|
||||||
.get_with_mapper(|s| crate::engine::make_setter(s.as_ref()).into(), text)
|
crate::engine::FN_SET,
|
||||||
|
|s| crate::engine::make_setter(s.as_ref()).into(),
|
||||||
|
text,
|
||||||
|
)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// A type that encapsulates all the settings for a particular parsing function.
|
/// A type that encapsulates all the settings for a particular parsing function.
|
||||||
#[derive(Debug, Copy, Clone, Eq, PartialEq, Hash)]
|
#[derive(Debug, Copy, Clone, Eq, PartialEq, Hash)]
|
||||||
struct ParseSettings {
|
pub(crate) struct ParseSettings {
|
||||||
/// Is the construct being parsed located at global level?
|
/// Is the construct being parsed located at global level?
|
||||||
at_global_level: bool,
|
pub at_global_level: bool,
|
||||||
/// Is the construct being parsed located inside a function definition?
|
/// Is the construct being parsed located inside a function definition?
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
in_fn_scope: bool,
|
pub in_fn_scope: bool,
|
||||||
/// Is the construct being parsed located inside a closure definition?
|
/// Is the construct being parsed located inside a closure definition?
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
#[cfg(not(feature = "no_closure"))]
|
#[cfg(not(feature = "no_closure"))]
|
||||||
in_closure: bool,
|
pub in_closure: bool,
|
||||||
/// Is the construct being parsed located inside a breakable loop?
|
/// Is the construct being parsed located inside a breakable loop?
|
||||||
is_breakable: bool,
|
pub is_breakable: bool,
|
||||||
/// Allow statements in blocks?
|
/// Allow statements in blocks?
|
||||||
allow_statements: bool,
|
pub allow_statements: bool,
|
||||||
|
/// Allow unquoted map properties?
|
||||||
|
pub allow_unquoted_map_properties: bool,
|
||||||
/// Language options in effect (overrides Engine options).
|
/// Language options in effect (overrides Engine options).
|
||||||
options: LangOptions,
|
pub options: LangOptions,
|
||||||
/// Current expression nesting level.
|
/// Current expression nesting level.
|
||||||
level: usize,
|
pub level: usize,
|
||||||
/// Current position.
|
/// Current position.
|
||||||
pos: Position,
|
pub pos: Position,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl ParseSettings {
|
impl ParseSettings {
|
||||||
/// Create a new `ParseSettings` with one higher expression level.
|
/// Create a new `ParseSettings` with one higher expression level.
|
||||||
#[inline(always)]
|
#[inline]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn level_up(&self) -> Self {
|
pub const fn level_up(&self) -> Self {
|
||||||
Self {
|
Self {
|
||||||
@ -412,7 +412,6 @@ impl Expr {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Make sure that the next expression is not a statement expression (i.e. wrapped in `{}`).
|
/// Make sure that the next expression is not a statement expression (i.e. wrapped in `{}`).
|
||||||
#[inline]
|
|
||||||
fn ensure_not_statement_expr(
|
fn ensure_not_statement_expr(
|
||||||
input: &mut TokenStream,
|
input: &mut TokenStream,
|
||||||
type_name: &(impl ToString + ?Sized),
|
type_name: &(impl ToString + ?Sized),
|
||||||
@ -424,7 +423,6 @@ fn ensure_not_statement_expr(
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Make sure that the next expression is not a mis-typed assignment (i.e. `a = b` instead of `a == b`).
|
/// Make sure that the next expression is not a mis-typed assignment (i.e. `a = b` instead of `a == b`).
|
||||||
#[inline]
|
|
||||||
fn ensure_not_assignment(input: &mut TokenStream) -> ParseResult<()> {
|
fn ensure_not_assignment(input: &mut TokenStream) -> ParseResult<()> {
|
||||||
match input.peek().expect(NEVER_ENDS) {
|
match input.peek().expect(NEVER_ENDS) {
|
||||||
(Token::Equals, pos) => Err(LexError::ImproperSymbol(
|
(Token::Equals, pos) => Err(LexError::ImproperSymbol(
|
||||||
@ -441,7 +439,6 @@ fn ensure_not_assignment(input: &mut TokenStream) -> ParseResult<()> {
|
|||||||
/// # Panics
|
/// # Panics
|
||||||
///
|
///
|
||||||
/// Panics if the next token is not the expected one.
|
/// Panics if the next token is not the expected one.
|
||||||
#[inline]
|
|
||||||
fn eat_token(input: &mut TokenStream, expected_token: Token) -> Position {
|
fn eat_token(input: &mut TokenStream, expected_token: Token) -> Position {
|
||||||
let (t, pos) = input.next().expect(NEVER_ENDS);
|
let (t, pos) = input.next().expect(NEVER_ENDS);
|
||||||
|
|
||||||
@ -457,7 +454,6 @@ fn eat_token(input: &mut TokenStream, expected_token: Token) -> Position {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Match a particular [token][Token], consuming it if matched.
|
/// Match a particular [token][Token], consuming it if matched.
|
||||||
#[inline]
|
|
||||||
fn match_token(input: &mut TokenStream, token: Token) -> (bool, Position) {
|
fn match_token(input: &mut TokenStream, token: Token) -> (bool, Position) {
|
||||||
let (t, pos) = input.peek().expect(NEVER_ENDS);
|
let (t, pos) = input.peek().expect(NEVER_ENDS);
|
||||||
if *t == token {
|
if *t == token {
|
||||||
@ -468,13 +464,12 @@ fn match_token(input: &mut TokenStream, token: Token) -> (bool, Position) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Parse a variable name.
|
/// Parse a variable name.
|
||||||
#[inline]
|
|
||||||
fn parse_var_name(input: &mut TokenStream) -> ParseResult<(SmartString, Position)> {
|
fn parse_var_name(input: &mut TokenStream) -> ParseResult<(SmartString, Position)> {
|
||||||
match input.next().expect(NEVER_ENDS) {
|
match input.next().expect(NEVER_ENDS) {
|
||||||
// Variable name
|
// Variable name
|
||||||
(Token::Identifier(s), pos) => Ok((s, pos)),
|
(Token::Identifier(s), pos) => Ok((*s, pos)),
|
||||||
// Reserved keyword
|
// Reserved keyword
|
||||||
(Token::Reserved(s), pos) if is_valid_identifier(s.chars()) => {
|
(Token::Reserved(s), pos) if is_valid_identifier(s.as_str()) => {
|
||||||
Err(PERR::Reserved(s.to_string()).into_err(pos))
|
Err(PERR::Reserved(s.to_string()).into_err(pos))
|
||||||
}
|
}
|
||||||
// Bad identifier
|
// Bad identifier
|
||||||
@ -486,13 +481,12 @@ fn parse_var_name(input: &mut TokenStream) -> ParseResult<(SmartString, Position
|
|||||||
|
|
||||||
/// Parse a symbol.
|
/// Parse a symbol.
|
||||||
#[cfg(not(feature = "no_custom_syntax"))]
|
#[cfg(not(feature = "no_custom_syntax"))]
|
||||||
#[inline]
|
|
||||||
fn parse_symbol(input: &mut TokenStream) -> ParseResult<(SmartString, Position)> {
|
fn parse_symbol(input: &mut TokenStream) -> ParseResult<(SmartString, Position)> {
|
||||||
match input.next().expect(NEVER_ENDS) {
|
match input.next().expect(NEVER_ENDS) {
|
||||||
// Symbol
|
// Symbol
|
||||||
(token, pos) if token.is_standard_symbol() => Ok((token.literal_syntax().into(), pos)),
|
(token, pos) if token.is_standard_symbol() => Ok((token.literal_syntax().into(), pos)),
|
||||||
// Reserved symbol
|
// Reserved symbol
|
||||||
(Token::Reserved(s), pos) if !is_valid_identifier(s.chars()) => Ok((s, pos)),
|
(Token::Reserved(s), pos) if !is_valid_identifier(s.as_str()) => Ok((*s, pos)),
|
||||||
// Bad symbol
|
// Bad symbol
|
||||||
(Token::LexError(err), pos) => Err(err.into_err(pos)),
|
(Token::LexError(err), pos) => Err(err.into_err(pos)),
|
||||||
// Not a symbol
|
// Not a symbol
|
||||||
@ -616,12 +610,11 @@ impl Engine {
|
|||||||
return Ok(FnCallExpr {
|
return Ok(FnCallExpr {
|
||||||
name: state.get_interned_string(id),
|
name: state.get_interned_string(id),
|
||||||
capture_parent_scope,
|
capture_parent_scope,
|
||||||
is_native_operator: false,
|
op_token: None,
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
namespace,
|
namespace,
|
||||||
hashes,
|
hashes,
|
||||||
args,
|
args,
|
||||||
pos: settings.pos,
|
|
||||||
}
|
}
|
||||||
.into_fn_call_expr(settings.pos));
|
.into_fn_call_expr(settings.pos));
|
||||||
}
|
}
|
||||||
@ -684,12 +677,11 @@ impl Engine {
|
|||||||
return Ok(FnCallExpr {
|
return Ok(FnCallExpr {
|
||||||
name: state.get_interned_string(id),
|
name: state.get_interned_string(id),
|
||||||
capture_parent_scope,
|
capture_parent_scope,
|
||||||
is_native_operator: false,
|
op_token: None,
|
||||||
#[cfg(not(feature = "no_module"))]
|
#[cfg(not(feature = "no_module"))]
|
||||||
namespace,
|
namespace,
|
||||||
hashes,
|
hashes,
|
||||||
args,
|
args,
|
||||||
pos: settings.pos,
|
|
||||||
}
|
}
|
||||||
.into_fn_call_expr(settings.pos));
|
.into_fn_call_expr(settings.pos));
|
||||||
}
|
}
|
||||||
@ -907,7 +899,6 @@ impl Engine {
|
|||||||
loop {
|
loop {
|
||||||
const MISSING_RBRACKET: &str = "to end this array literal";
|
const MISSING_RBRACKET: &str = "to end this array literal";
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
if self.max_array_size() > 0 && array.len() >= self.max_array_size() {
|
if self.max_array_size() > 0 && array.len() >= self.max_array_size() {
|
||||||
return Err(PERR::LiteralTooLarge(
|
return Err(PERR::LiteralTooLarge(
|
||||||
"Size of array literal".to_string(),
|
"Size of array literal".to_string(),
|
||||||
@ -999,16 +990,19 @@ impl Engine {
|
|||||||
}
|
}
|
||||||
|
|
||||||
let (name, pos) = match input.next().expect(NEVER_ENDS) {
|
let (name, pos) = match input.next().expect(NEVER_ENDS) {
|
||||||
|
(Token::Identifier(..), pos) if !settings.allow_unquoted_map_properties => {
|
||||||
|
return Err(PERR::PropertyExpected.into_err(pos))
|
||||||
|
}
|
||||||
(Token::Identifier(s) | Token::StringConstant(s), pos) => {
|
(Token::Identifier(s) | Token::StringConstant(s), pos) => {
|
||||||
if map.iter().any(|(p, ..)| **p == s) {
|
if map.iter().any(|(p, ..)| **p == *s) {
|
||||||
return Err(PERR::DuplicatedProperty(s.to_string()).into_err(pos));
|
return Err(PERR::DuplicatedProperty(s.to_string()).into_err(pos));
|
||||||
}
|
}
|
||||||
(s, pos)
|
(*s, pos)
|
||||||
}
|
}
|
||||||
(Token::InterpolatedString(..), pos) => {
|
(Token::InterpolatedString(..), pos) => {
|
||||||
return Err(PERR::PropertyExpected.into_err(pos))
|
return Err(PERR::PropertyExpected.into_err(pos))
|
||||||
}
|
}
|
||||||
(Token::Reserved(s), pos) if is_valid_identifier(s.chars()) => {
|
(Token::Reserved(s), pos) if is_valid_identifier(s.as_str()) => {
|
||||||
return Err(PERR::Reserved(s.to_string()).into_err(pos));
|
return Err(PERR::Reserved(s.to_string()).into_err(pos));
|
||||||
}
|
}
|
||||||
(Token::LexError(err), pos) => return Err(err.into_err(pos)),
|
(Token::LexError(err), pos) => return Err(err.into_err(pos)),
|
||||||
@ -1041,7 +1035,6 @@ impl Engine {
|
|||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
#[cfg(not(feature = "unchecked"))]
|
|
||||||
if self.max_map_size() > 0 && map.len() >= self.max_map_size() {
|
if self.max_map_size() > 0 && map.len() >= self.max_map_size() {
|
||||||
return Err(PERR::LiteralTooLarge(
|
return Err(PERR::LiteralTooLarge(
|
||||||
"Number of properties in object map literal".to_string(),
|
"Number of properties in object map literal".to_string(),
|
||||||
@ -1342,7 +1335,7 @@ impl Engine {
|
|||||||
Token::IntegerConstant(x) => Expr::IntegerConstant(x, settings.pos),
|
Token::IntegerConstant(x) => Expr::IntegerConstant(x, settings.pos),
|
||||||
Token::CharConstant(c) => Expr::CharConstant(c, settings.pos),
|
Token::CharConstant(c) => Expr::CharConstant(c, settings.pos),
|
||||||
Token::StringConstant(s) => {
|
Token::StringConstant(s) => {
|
||||||
Expr::StringConstant(state.get_interned_string(s), settings.pos)
|
Expr::StringConstant(state.get_interned_string(*s), settings.pos)
|
||||||
}
|
}
|
||||||
Token::True => Expr::BoolConstant(true, settings.pos),
|
Token::True => Expr::BoolConstant(true, settings.pos),
|
||||||
Token::False => Expr::BoolConstant(false, settings.pos),
|
Token::False => Expr::BoolConstant(false, settings.pos),
|
||||||
@ -1356,7 +1349,7 @@ impl Engine {
|
|||||||
}
|
}
|
||||||
#[cfg(feature = "decimal")]
|
#[cfg(feature = "decimal")]
|
||||||
Token::DecimalConstant(x) => {
|
Token::DecimalConstant(x) => {
|
||||||
let x = (*x).into();
|
let x = (**x).into();
|
||||||
input.next();
|
input.next();
|
||||||
Expr::DynamicConstant(Box::new(x), settings.pos)
|
Expr::DynamicConstant(Box::new(x), settings.pos)
|
||||||
}
|
}
|
||||||
@ -1377,6 +1370,23 @@ impl Engine {
|
|||||||
self.parse_if(input, state, lib, settings.level_up())?
|
self.parse_if(input, state, lib, settings.level_up())?
|
||||||
.into(),
|
.into(),
|
||||||
)),
|
)),
|
||||||
|
// Loops are allowed to act as expressions
|
||||||
|
Token::While | Token::Loop if settings.options.contains(LangOptions::LOOP_EXPR) => {
|
||||||
|
Expr::Stmt(Box::new(
|
||||||
|
self.parse_while_loop(input, state, lib, settings.level_up())?
|
||||||
|
.into(),
|
||||||
|
))
|
||||||
|
}
|
||||||
|
Token::Do if settings.options.contains(LangOptions::LOOP_EXPR) => Expr::Stmt(Box::new(
|
||||||
|
self.parse_do(input, state, lib, settings.level_up())?
|
||||||
|
.into(),
|
||||||
|
)),
|
||||||
|
Token::For if settings.options.contains(LangOptions::LOOP_EXPR) => {
|
||||||
|
Expr::Stmt(Box::new(
|
||||||
|
self.parse_for(input, state, lib, settings.level_up())?
|
||||||
|
.into(),
|
||||||
|
))
|
||||||
|
}
|
||||||
// Switch statement is allowed to act as expressions
|
// Switch statement is allowed to act as expressions
|
||||||
Token::Switch if settings.options.contains(LangOptions::SWITCH_EXPR) => {
|
Token::Switch if settings.options.contains(LangOptions::SWITCH_EXPR) => {
|
||||||
Expr::Stmt(Box::new(
|
Expr::Stmt(Box::new(
|
||||||
@ -1438,7 +1448,7 @@ impl Engine {
|
|||||||
..settings
|
..settings
|
||||||
};
|
};
|
||||||
|
|
||||||
let result = self.parse_anon_fn(input, &mut new_state, lib, new_settings);
|
let result = self.parse_anon_fn(input, &mut new_state, state, lib, new_settings);
|
||||||
|
|
||||||
// Restore parse state
|
// Restore parse state
|
||||||
state.interned_strings = new_state.interned_strings;
|
state.interned_strings = new_state.interned_strings;
|
||||||
@ -1461,7 +1471,7 @@ impl Engine {
|
|||||||
// Under Strict Variables mode, this is not allowed.
|
// Under Strict Variables mode, this is not allowed.
|
||||||
Err(PERR::VariableUndefined(name.to_string()).into_err(*pos))
|
Err(PERR::VariableUndefined(name.to_string()).into_err(*pos))
|
||||||
} else {
|
} else {
|
||||||
Ok::<_, ParseError>(())
|
Ok(())
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
)?;
|
)?;
|
||||||
@ -1479,7 +1489,7 @@ impl Engine {
|
|||||||
match input.next().expect(NEVER_ENDS) {
|
match input.next().expect(NEVER_ENDS) {
|
||||||
(Token::InterpolatedString(s), ..) if s.is_empty() => (),
|
(Token::InterpolatedString(s), ..) if s.is_empty() => (),
|
||||||
(Token::InterpolatedString(s), pos) => {
|
(Token::InterpolatedString(s), pos) => {
|
||||||
segments.push(Expr::StringConstant(s.into(), pos))
|
segments.push(Expr::StringConstant(state.get_interned_string(*s), pos))
|
||||||
}
|
}
|
||||||
token => {
|
token => {
|
||||||
unreachable!("Token::InterpolatedString expected but gets {:?}", token)
|
unreachable!("Token::InterpolatedString expected but gets {:?}", token)
|
||||||
@ -1502,14 +1512,16 @@ impl Engine {
|
|||||||
match input.next().expect(NEVER_ENDS) {
|
match input.next().expect(NEVER_ENDS) {
|
||||||
(Token::StringConstant(s), pos) => {
|
(Token::StringConstant(s), pos) => {
|
||||||
if !s.is_empty() {
|
if !s.is_empty() {
|
||||||
segments.push(Expr::StringConstant(s.into(), pos));
|
segments
|
||||||
|
.push(Expr::StringConstant(state.get_interned_string(*s), pos));
|
||||||
}
|
}
|
||||||
// End the interpolated string if it is terminated by a back-tick.
|
// End the interpolated string if it is terminated by a back-tick.
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
(Token::InterpolatedString(s), pos) => {
|
(Token::InterpolatedString(s), pos) => {
|
||||||
if !s.is_empty() {
|
if !s.is_empty() {
|
||||||
segments.push(Expr::StringConstant(s.into(), pos));
|
segments
|
||||||
|
.push(Expr::StringConstant(state.get_interned_string(*s), pos));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
(Token::LexError(err), pos)
|
(Token::LexError(err), pos)
|
||||||
@ -1574,7 +1586,7 @@ impl Engine {
|
|||||||
state.allow_capture = true;
|
state.allow_capture = true;
|
||||||
}
|
}
|
||||||
Expr::Variable(
|
Expr::Variable(
|
||||||
(None, ns, 0, state.get_interned_string(s)).into(),
|
(None, ns, 0, state.get_interned_string(*s)).into(),
|
||||||
None,
|
None,
|
||||||
settings.pos,
|
settings.pos,
|
||||||
)
|
)
|
||||||
@ -1587,7 +1599,7 @@ impl Engine {
|
|||||||
// Once the identifier consumed we must enable next variables capturing
|
// Once the identifier consumed we must enable next variables capturing
|
||||||
state.allow_capture = true;
|
state.allow_capture = true;
|
||||||
}
|
}
|
||||||
let name = state.get_interned_string(s);
|
let name = state.get_interned_string(*s);
|
||||||
Expr::Variable((None, ns, 0, name).into(), None, settings.pos)
|
Expr::Variable((None, ns, 0, name).into(), None, settings.pos)
|
||||||
}
|
}
|
||||||
// Normal variable access
|
// Normal variable access
|
||||||
@ -1612,7 +1624,7 @@ impl Engine {
|
|||||||
None
|
None
|
||||||
}
|
}
|
||||||
});
|
});
|
||||||
let name = state.get_interned_string(s);
|
let name = state.get_interned_string(*s);
|
||||||
Expr::Variable((index, ns, 0, name).into(), short_index, settings.pos)
|
Expr::Variable((index, ns, 0, name).into(), short_index, settings.pos)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -1634,7 +1646,7 @@ impl Engine {
|
|||||||
// Function call is allowed to have reserved keyword
|
// Function call is allowed to have reserved keyword
|
||||||
Token::LeftParen | Token::Bang | Token::Unit if is_keyword_function(&s) => {
|
Token::LeftParen | Token::Bang | Token::Unit if is_keyword_function(&s) => {
|
||||||
Expr::Variable(
|
Expr::Variable(
|
||||||
(None, ns, 0, state.get_interned_string(s)).into(),
|
(None, ns, 0, state.get_interned_string(*s)).into(),
|
||||||
None,
|
None,
|
||||||
settings.pos,
|
settings.pos,
|
||||||
)
|
)
|
||||||
@ -1642,7 +1654,7 @@ impl Engine {
|
|||||||
// Access to `this` as a variable is OK within a function scope
|
// Access to `this` as a variable is OK within a function scope
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
_ if &*s == KEYWORD_THIS && settings.in_fn_scope => Expr::Variable(
|
_ if &*s == KEYWORD_THIS && settings.in_fn_scope => Expr::Variable(
|
||||||
(None, ns, 0, state.get_interned_string(s)).into(),
|
(None, ns, 0, state.get_interned_string(*s)).into(),
|
||||||
None,
|
None,
|
||||||
settings.pos,
|
settings.pos,
|
||||||
),
|
),
|
||||||
@ -1888,7 +1900,7 @@ impl Engine {
|
|||||||
// -expr
|
// -expr
|
||||||
Token::Minus | Token::UnaryMinus => {
|
Token::Minus | Token::UnaryMinus => {
|
||||||
let token = token.clone();
|
let token = token.clone();
|
||||||
let pos = eat_token(input, token);
|
let pos = eat_token(input, token.clone());
|
||||||
|
|
||||||
match self.parse_unary(input, state, lib, settings.level_up())? {
|
match self.parse_unary(input, state, lib, settings.level_up())? {
|
||||||
// Negative integer
|
// Negative integer
|
||||||
@ -1914,12 +1926,13 @@ impl Engine {
|
|||||||
args.shrink_to_fit();
|
args.shrink_to_fit();
|
||||||
|
|
||||||
Ok(FnCallExpr {
|
Ok(FnCallExpr {
|
||||||
|
#[cfg(not(feature = "no_module"))]
|
||||||
|
namespace: Default::default(),
|
||||||
name: state.get_interned_string("-"),
|
name: state.get_interned_string("-"),
|
||||||
hashes: FnCallHashes::from_native(calc_fn_hash(None, "-", 1)),
|
hashes: FnCallHashes::from_native(calc_fn_hash(None, "-", 1)),
|
||||||
args,
|
args,
|
||||||
pos,
|
op_token: Some(token),
|
||||||
is_native_operator: true,
|
capture_parent_scope: false,
|
||||||
..Default::default()
|
|
||||||
}
|
}
|
||||||
.into_fn_call_expr(pos))
|
.into_fn_call_expr(pos))
|
||||||
}
|
}
|
||||||
@ -1928,7 +1941,7 @@ impl Engine {
|
|||||||
// +expr
|
// +expr
|
||||||
Token::Plus | Token::UnaryPlus => {
|
Token::Plus | Token::UnaryPlus => {
|
||||||
let token = token.clone();
|
let token = token.clone();
|
||||||
let pos = eat_token(input, token);
|
let pos = eat_token(input, token.clone());
|
||||||
|
|
||||||
match self.parse_unary(input, state, lib, settings.level_up())? {
|
match self.parse_unary(input, state, lib, settings.level_up())? {
|
||||||
expr @ Expr::IntegerConstant(..) => Ok(expr),
|
expr @ Expr::IntegerConstant(..) => Ok(expr),
|
||||||
@ -1942,12 +1955,13 @@ impl Engine {
|
|||||||
args.shrink_to_fit();
|
args.shrink_to_fit();
|
||||||
|
|
||||||
Ok(FnCallExpr {
|
Ok(FnCallExpr {
|
||||||
|
#[cfg(not(feature = "no_module"))]
|
||||||
|
namespace: Default::default(),
|
||||||
name: state.get_interned_string("+"),
|
name: state.get_interned_string("+"),
|
||||||
hashes: FnCallHashes::from_native(calc_fn_hash(None, "+", 1)),
|
hashes: FnCallHashes::from_native(calc_fn_hash(None, "+", 1)),
|
||||||
args,
|
args,
|
||||||
pos,
|
op_token: Some(token),
|
||||||
is_native_operator: true,
|
capture_parent_scope: false,
|
||||||
..Default::default()
|
|
||||||
}
|
}
|
||||||
.into_fn_call_expr(pos))
|
.into_fn_call_expr(pos))
|
||||||
}
|
}
|
||||||
@ -1955,18 +1969,21 @@ impl Engine {
|
|||||||
}
|
}
|
||||||
// !expr
|
// !expr
|
||||||
Token::Bang => {
|
Token::Bang => {
|
||||||
|
let token = token.clone();
|
||||||
let pos = eat_token(input, Token::Bang);
|
let pos = eat_token(input, Token::Bang);
|
||||||
|
|
||||||
let mut args = StaticVec::new_const();
|
let mut args = StaticVec::new_const();
|
||||||
args.push(self.parse_unary(input, state, lib, settings.level_up())?);
|
args.push(self.parse_unary(input, state, lib, settings.level_up())?);
|
||||||
args.shrink_to_fit();
|
args.shrink_to_fit();
|
||||||
|
|
||||||
Ok(FnCallExpr {
|
Ok(FnCallExpr {
|
||||||
|
#[cfg(not(feature = "no_module"))]
|
||||||
|
namespace: Default::default(),
|
||||||
name: state.get_interned_string("!"),
|
name: state.get_interned_string("!"),
|
||||||
hashes: FnCallHashes::from_native(calc_fn_hash(None, "!", 1)),
|
hashes: FnCallHashes::from_native(calc_fn_hash(None, "!", 1)),
|
||||||
args,
|
args,
|
||||||
pos,
|
op_token: Some(token),
|
||||||
is_native_operator: true,
|
capture_parent_scope: false,
|
||||||
..Default::default()
|
|
||||||
}
|
}
|
||||||
.into_fn_call_expr(pos))
|
.into_fn_call_expr(pos))
|
||||||
}
|
}
|
||||||
@ -2181,11 +2198,15 @@ impl Engine {
|
|||||||
// lhs.func(...)
|
// lhs.func(...)
|
||||||
(lhs, Expr::FnCall(mut func, func_pos)) => {
|
(lhs, Expr::FnCall(mut func, func_pos)) => {
|
||||||
// Recalculate hash
|
// Recalculate hash
|
||||||
func.hashes = FnCallHashes::from_all(
|
func.hashes = if is_valid_function_name(&func.name) {
|
||||||
|
FnCallHashes::from_all(
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
calc_fn_hash(None, &func.name, func.args.len()),
|
calc_fn_hash(None, &func.name, func.args.len()),
|
||||||
calc_fn_hash(None, &func.name, func.args.len() + 1),
|
calc_fn_hash(None, &func.name, func.args.len() + 1),
|
||||||
);
|
)
|
||||||
|
} else {
|
||||||
|
FnCallHashes::from_native(calc_fn_hash(None, &func.name, func.args.len() + 1))
|
||||||
|
};
|
||||||
|
|
||||||
let rhs = Expr::MethodCall(func, func_pos);
|
let rhs = Expr::MethodCall(func, func_pos);
|
||||||
Ok(Expr::Dot(BinaryExpr { lhs, rhs }.into(), op_flags, op_pos))
|
Ok(Expr::Dot(BinaryExpr { lhs, rhs }.into(), op_flags, op_pos))
|
||||||
@ -2227,11 +2248,19 @@ impl Engine {
|
|||||||
// lhs.func().dot_rhs or lhs.func()[idx_rhs]
|
// lhs.func().dot_rhs or lhs.func()[idx_rhs]
|
||||||
Expr::FnCall(mut func, func_pos) => {
|
Expr::FnCall(mut func, func_pos) => {
|
||||||
// Recalculate hash
|
// Recalculate hash
|
||||||
func.hashes = FnCallHashes::from_all(
|
func.hashes = if is_valid_function_name(&func.name) {
|
||||||
|
FnCallHashes::from_all(
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
calc_fn_hash(None, &func.name, func.args.len()),
|
calc_fn_hash(None, &func.name, func.args.len()),
|
||||||
calc_fn_hash(None, &func.name, func.args.len() + 1),
|
calc_fn_hash(None, &func.name, func.args.len() + 1),
|
||||||
);
|
)
|
||||||
|
} else {
|
||||||
|
FnCallHashes::from_native(calc_fn_hash(
|
||||||
|
None,
|
||||||
|
&func.name,
|
||||||
|
func.args.len() + 1,
|
||||||
|
))
|
||||||
|
};
|
||||||
|
|
||||||
let new_lhs = BinaryExpr {
|
let new_lhs = BinaryExpr {
|
||||||
lhs: Expr::MethodCall(func, func_pos),
|
lhs: Expr::MethodCall(func, func_pos),
|
||||||
@ -2283,10 +2312,10 @@ impl Engine {
|
|||||||
#[cfg(not(feature = "no_custom_syntax"))]
|
#[cfg(not(feature = "no_custom_syntax"))]
|
||||||
Token::Custom(c) => self
|
Token::Custom(c) => self
|
||||||
.custom_keywords
|
.custom_keywords
|
||||||
.get(c)
|
.get(&**c)
|
||||||
.copied()
|
.copied()
|
||||||
.ok_or_else(|| PERR::Reserved(c.to_string()).into_err(*current_pos))?,
|
.ok_or_else(|| PERR::Reserved(c.to_string()).into_err(*current_pos))?,
|
||||||
Token::Reserved(c) if !is_valid_identifier(c.chars()) => {
|
Token::Reserved(c) if !is_valid_identifier(c) => {
|
||||||
return Err(PERR::UnknownOperator(c.to_string()).into_err(*current_pos))
|
return Err(PERR::UnknownOperator(c.to_string()).into_err(*current_pos))
|
||||||
}
|
}
|
||||||
_ => current_op.precedence(),
|
_ => current_op.precedence(),
|
||||||
@ -2308,10 +2337,10 @@ impl Engine {
|
|||||||
#[cfg(not(feature = "no_custom_syntax"))]
|
#[cfg(not(feature = "no_custom_syntax"))]
|
||||||
Token::Custom(c) => self
|
Token::Custom(c) => self
|
||||||
.custom_keywords
|
.custom_keywords
|
||||||
.get(c)
|
.get(&**c)
|
||||||
.copied()
|
.copied()
|
||||||
.ok_or_else(|| PERR::Reserved(c.to_string()).into_err(*next_pos))?,
|
.ok_or_else(|| PERR::Reserved(c.to_string()).into_err(*next_pos))?,
|
||||||
Token::Reserved(c) if !is_valid_identifier(c.chars()) => {
|
Token::Reserved(c) if !is_valid_identifier(c) => {
|
||||||
return Err(PERR::UnknownOperator(c.to_string()).into_err(*next_pos))
|
return Err(PERR::UnknownOperator(c.to_string()).into_err(*next_pos))
|
||||||
}
|
}
|
||||||
_ => next_op.precedence(),
|
_ => next_op.precedence(),
|
||||||
@ -2335,13 +2364,11 @@ impl Engine {
|
|||||||
|
|
||||||
let op = op_token.syntax();
|
let op = op_token.syntax();
|
||||||
let hash = calc_fn_hash(None, &op, 2);
|
let hash = calc_fn_hash(None, &op, 2);
|
||||||
|
let is_valid_script_function = is_valid_function_name(&op);
|
||||||
let op_base = FnCallExpr {
|
let operator_token = if is_valid_script_function {
|
||||||
name: state.get_interned_string(op.as_ref()),
|
None
|
||||||
hashes: FnCallHashes::from_native(hash),
|
} else {
|
||||||
pos,
|
Some(op_token.clone())
|
||||||
is_native_operator: !is_valid_function_name(&op),
|
|
||||||
..Default::default()
|
|
||||||
};
|
};
|
||||||
|
|
||||||
let mut args = StaticVec::new_const();
|
let mut args = StaticVec::new_const();
|
||||||
@ -2349,9 +2376,19 @@ impl Engine {
|
|||||||
args.push(rhs);
|
args.push(rhs);
|
||||||
args.shrink_to_fit();
|
args.shrink_to_fit();
|
||||||
|
|
||||||
|
let mut op_base = FnCallExpr {
|
||||||
|
#[cfg(not(feature = "no_module"))]
|
||||||
|
namespace: Default::default(),
|
||||||
|
name: state.get_interned_string(op.as_ref()),
|
||||||
|
hashes: FnCallHashes::from_native(hash),
|
||||||
|
args,
|
||||||
|
op_token: operator_token,
|
||||||
|
capture_parent_scope: false,
|
||||||
|
};
|
||||||
|
|
||||||
root = match op_token {
|
root = match op_token {
|
||||||
// '!=' defaults to true when passed invalid operands
|
// '!=' defaults to true when passed invalid operands
|
||||||
Token::NotEqualsTo => FnCallExpr { args, ..op_base }.into_fn_call_expr(pos),
|
Token::NotEqualsTo => op_base.into_fn_call_expr(pos),
|
||||||
|
|
||||||
// Comparison operators default to false when passed invalid operands
|
// Comparison operators default to false when passed invalid operands
|
||||||
Token::EqualsTo
|
Token::EqualsTo
|
||||||
@ -2359,61 +2396,36 @@ impl Engine {
|
|||||||
| Token::LessThanEqualsTo
|
| Token::LessThanEqualsTo
|
||||||
| Token::GreaterThan
|
| Token::GreaterThan
|
||||||
| Token::GreaterThanEqualsTo => {
|
| Token::GreaterThanEqualsTo => {
|
||||||
let pos = args[0].start_position();
|
let pos = op_base.args[0].start_position();
|
||||||
FnCallExpr { args, ..op_base }.into_fn_call_expr(pos)
|
op_base.into_fn_call_expr(pos)
|
||||||
}
|
}
|
||||||
|
|
||||||
Token::Or => {
|
Token::Or => {
|
||||||
let rhs = args.pop().unwrap();
|
let rhs = op_base.args.pop().unwrap().ensure_bool_expr()?;
|
||||||
let current_lhs = args.pop().unwrap();
|
let lhs = op_base.args.pop().unwrap().ensure_bool_expr()?;
|
||||||
Expr::Or(
|
Expr::Or(BinaryExpr { lhs: lhs, rhs: rhs }.into(), pos)
|
||||||
BinaryExpr {
|
|
||||||
lhs: current_lhs.ensure_bool_expr()?,
|
|
||||||
rhs: rhs.ensure_bool_expr()?,
|
|
||||||
}
|
|
||||||
.into(),
|
|
||||||
pos,
|
|
||||||
)
|
|
||||||
}
|
}
|
||||||
Token::And => {
|
Token::And => {
|
||||||
let rhs = args.pop().unwrap();
|
let rhs = op_base.args.pop().unwrap().ensure_bool_expr()?;
|
||||||
let current_lhs = args.pop().unwrap();
|
let lhs = op_base.args.pop().unwrap().ensure_bool_expr()?;
|
||||||
Expr::And(
|
Expr::And(BinaryExpr { lhs: lhs, rhs: rhs }.into(), pos)
|
||||||
BinaryExpr {
|
|
||||||
lhs: current_lhs.ensure_bool_expr()?,
|
|
||||||
rhs: rhs.ensure_bool_expr()?,
|
|
||||||
}
|
|
||||||
.into(),
|
|
||||||
pos,
|
|
||||||
)
|
|
||||||
}
|
}
|
||||||
Token::DoubleQuestion => {
|
Token::DoubleQuestion => {
|
||||||
let rhs = args.pop().unwrap();
|
let rhs = op_base.args.pop().unwrap();
|
||||||
let current_lhs = args.pop().unwrap();
|
let lhs = op_base.args.pop().unwrap();
|
||||||
Expr::Coalesce(
|
Expr::Coalesce(BinaryExpr { lhs, rhs }.into(), pos)
|
||||||
BinaryExpr {
|
|
||||||
lhs: current_lhs,
|
|
||||||
rhs,
|
|
||||||
}
|
|
||||||
.into(),
|
|
||||||
pos,
|
|
||||||
)
|
|
||||||
}
|
}
|
||||||
Token::In => {
|
Token::In => {
|
||||||
// Swap the arguments
|
// Swap the arguments
|
||||||
let current_lhs = args.remove(0);
|
let lhs = op_base.args.remove(0);
|
||||||
let pos = current_lhs.start_position();
|
let pos = lhs.start_position();
|
||||||
args.push(current_lhs);
|
op_base.args.push(lhs);
|
||||||
args.shrink_to_fit();
|
op_base.args.shrink_to_fit();
|
||||||
|
|
||||||
// Convert into a call to `contains`
|
// Convert into a call to `contains`
|
||||||
FnCallExpr {
|
op_base.hashes = calc_fn_hash(None, OP_CONTAINS, 2).into();
|
||||||
hashes: calc_fn_hash(None, OP_CONTAINS, 2).into(),
|
op_base.name = state.get_interned_string(OP_CONTAINS);
|
||||||
args,
|
op_base.into_fn_call_expr(pos)
|
||||||
name: state.get_interned_string(OP_CONTAINS),
|
|
||||||
..op_base
|
|
||||||
}
|
|
||||||
.into_fn_call_expr(pos)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_custom_syntax"))]
|
#[cfg(not(feature = "no_custom_syntax"))]
|
||||||
@ -2423,24 +2435,17 @@ impl Engine {
|
|||||||
.get(s.as_str())
|
.get(s.as_str())
|
||||||
.map_or(false, Option::is_some) =>
|
.map_or(false, Option::is_some) =>
|
||||||
{
|
{
|
||||||
let hash = calc_fn_hash(None, &s, 2);
|
op_base.hashes = if is_valid_script_function {
|
||||||
let pos = args[0].start_position();
|
calc_fn_hash(None, &s, 2).into()
|
||||||
|
|
||||||
FnCallExpr {
|
|
||||||
hashes: if is_valid_function_name(&s) {
|
|
||||||
hash.into()
|
|
||||||
} else {
|
} else {
|
||||||
FnCallHashes::from_native(hash)
|
FnCallHashes::from_native(calc_fn_hash(None, &s, 2))
|
||||||
},
|
};
|
||||||
args,
|
op_base.into_fn_call_expr(pos)
|
||||||
..op_base
|
|
||||||
}
|
|
||||||
.into_fn_call_expr(pos)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
_ => {
|
_ => {
|
||||||
let pos = args[0].start_position();
|
let pos = op_base.args[0].start_position();
|
||||||
FnCallExpr { args, ..op_base }.into_fn_call_expr(pos)
|
op_base.into_fn_call_expr(pos)
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
@ -2459,9 +2464,11 @@ impl Engine {
|
|||||||
pos: Position,
|
pos: Position,
|
||||||
) -> ParseResult<Expr> {
|
) -> ParseResult<Expr> {
|
||||||
use crate::api::custom_syntax::markers::*;
|
use crate::api::custom_syntax::markers::*;
|
||||||
|
const KEYWORD_SEMICOLON: &str = Token::SemiColon.literal_syntax();
|
||||||
|
const KEYWORD_CLOSE_BRACE: &str = Token::RightBrace.literal_syntax();
|
||||||
|
|
||||||
let mut settings = settings;
|
let mut settings = settings;
|
||||||
let mut inputs = StaticVec::<Expr>::new();
|
let mut inputs = StaticVec::new_const();
|
||||||
let mut segments = StaticVec::new_const();
|
let mut segments = StaticVec::new_const();
|
||||||
let mut tokens = StaticVec::new_const();
|
let mut tokens = StaticVec::new_const();
|
||||||
|
|
||||||
@ -2578,7 +2585,7 @@ impl Engine {
|
|||||||
},
|
},
|
||||||
CUSTOM_SYNTAX_MARKER_STRING => match input.next().expect(NEVER_ENDS) {
|
CUSTOM_SYNTAX_MARKER_STRING => match input.next().expect(NEVER_ENDS) {
|
||||||
(Token::StringConstant(s), pos) => {
|
(Token::StringConstant(s), pos) => {
|
||||||
let s = state.get_interned_string(s);
|
let s = state.get_interned_string(*s);
|
||||||
inputs.push(Expr::StringConstant(s.clone(), pos));
|
inputs.push(Expr::StringConstant(s.clone(), pos));
|
||||||
segments.push(s);
|
segments.push(s);
|
||||||
tokens.push(state.get_interned_string(CUSTOM_SYNTAX_MARKER_STRING));
|
tokens.push(state.get_interned_string(CUSTOM_SYNTAX_MARKER_STRING));
|
||||||
@ -2891,23 +2898,24 @@ impl Engine {
|
|||||||
|
|
||||||
if let Some(ref filter) = self.def_var_filter {
|
if let Some(ref filter) = self.def_var_filter {
|
||||||
let will_shadow = state.stack.iter().any(|(v, ..)| v == name);
|
let will_shadow = state.stack.iter().any(|(v, ..)| v == name);
|
||||||
let level = settings.level;
|
state.global.level = settings.level;
|
||||||
let is_const = access == AccessMode::ReadOnly;
|
let is_const = access == AccessMode::ReadOnly;
|
||||||
let info = VarDefInfo {
|
let info = VarDefInfo {
|
||||||
name: &name,
|
name: &name,
|
||||||
is_const,
|
is_const,
|
||||||
nesting_level: level,
|
nesting_level: state.global.level,
|
||||||
will_shadow,
|
will_shadow,
|
||||||
};
|
};
|
||||||
let mut this_ptr = None;
|
let caches = &mut Caches::new();
|
||||||
|
let mut this = Dynamic::NULL;
|
||||||
|
|
||||||
let context = EvalContext::new(
|
let context = EvalContext::new(
|
||||||
self,
|
self,
|
||||||
&mut state.stack,
|
|
||||||
&mut state.global,
|
&mut state.global,
|
||||||
None,
|
caches,
|
||||||
&[],
|
&[],
|
||||||
&mut this_ptr,
|
&mut state.stack,
|
||||||
level,
|
&mut this,
|
||||||
);
|
);
|
||||||
|
|
||||||
match filter(false, info, context) {
|
match filter(false, info, context) {
|
||||||
@ -2986,24 +2994,24 @@ impl Engine {
|
|||||||
// import expr ...
|
// import expr ...
|
||||||
let expr = self.parse_expr(input, state, lib, settings.level_up())?;
|
let expr = self.parse_expr(input, state, lib, settings.level_up())?;
|
||||||
|
|
||||||
|
let export = if !match_token(input, Token::As).0 {
|
||||||
// import expr;
|
// import expr;
|
||||||
if !match_token(input, Token::As).0 {
|
Ident {
|
||||||
let empty = Ident {
|
|
||||||
name: state.get_interned_string(""),
|
name: state.get_interned_string(""),
|
||||||
pos: Position::NONE,
|
pos: Position::NONE,
|
||||||
};
|
|
||||||
return Ok(Stmt::Import((expr, empty).into(), settings.pos));
|
|
||||||
}
|
}
|
||||||
|
} else {
|
||||||
// import expr as name ...
|
// import expr as name ...
|
||||||
let (name, pos) = parse_var_name(input)?;
|
let (name, pos) = parse_var_name(input)?;
|
||||||
let name = state.get_interned_string(name);
|
Ident {
|
||||||
state.imports.push(name.clone());
|
name: state.get_interned_string(name),
|
||||||
|
pos,
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
Ok(Stmt::Import(
|
state.imports.push(export.name.clone());
|
||||||
(expr, Ident { name, pos }).into(),
|
|
||||||
settings.pos,
|
Ok(Stmt::Import((expr, export).into(), settings.pos))
|
||||||
))
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Parse an export statement.
|
/// Parse an export statement.
|
||||||
@ -3228,7 +3236,7 @@ impl Engine {
|
|||||||
|
|
||||||
match input.next().expect(NEVER_ENDS).0 {
|
match input.next().expect(NEVER_ENDS).0 {
|
||||||
Token::Comment(comment) => {
|
Token::Comment(comment) => {
|
||||||
comments.push(comment);
|
comments.push(*comment);
|
||||||
|
|
||||||
match input.peek().expect(NEVER_ENDS) {
|
match input.peek().expect(NEVER_ENDS) {
|
||||||
(Token::Fn | Token::Private, ..) => break,
|
(Token::Fn | Token::Private, ..) => break,
|
||||||
@ -3320,6 +3328,7 @@ impl Engine {
|
|||||||
in_closure: false,
|
in_closure: false,
|
||||||
is_breakable: false,
|
is_breakable: false,
|
||||||
allow_statements: true,
|
allow_statements: true,
|
||||||
|
allow_unquoted_map_properties: settings.allow_unquoted_map_properties,
|
||||||
level: 0,
|
level: 0,
|
||||||
options,
|
options,
|
||||||
pos,
|
pos,
|
||||||
@ -3378,11 +3387,26 @@ impl Engine {
|
|||||||
|
|
||||||
Token::Continue if self.allow_looping() && settings.is_breakable => {
|
Token::Continue if self.allow_looping() && settings.is_breakable => {
|
||||||
let pos = eat_token(input, Token::Continue);
|
let pos = eat_token(input, Token::Continue);
|
||||||
Ok(Stmt::BreakLoop(ASTFlags::NONE, pos))
|
Ok(Stmt::BreakLoop(None, ASTFlags::NONE, pos))
|
||||||
}
|
}
|
||||||
Token::Break if self.allow_looping() && settings.is_breakable => {
|
Token::Break if self.allow_looping() && settings.is_breakable => {
|
||||||
let pos = eat_token(input, Token::Break);
|
let pos = eat_token(input, Token::Break);
|
||||||
Ok(Stmt::BreakLoop(ASTFlags::BREAK, pos))
|
|
||||||
|
let expr = match input.peek().expect(NEVER_ENDS) {
|
||||||
|
// `break` at <EOF>
|
||||||
|
(Token::EOF, ..) => None,
|
||||||
|
// `break` at end of block
|
||||||
|
(Token::RightBrace, ..) => None,
|
||||||
|
// `break;`
|
||||||
|
(Token::SemiColon, ..) => None,
|
||||||
|
// `break` with expression
|
||||||
|
_ => Some(
|
||||||
|
self.parse_expr(input, state, lib, settings.level_up())?
|
||||||
|
.into(),
|
||||||
|
),
|
||||||
|
};
|
||||||
|
|
||||||
|
Ok(Stmt::BreakLoop(expr, ASTFlags::BREAK, pos))
|
||||||
}
|
}
|
||||||
Token::Continue | Token::Break if self.allow_looping() => {
|
Token::Continue | Token::Break if self.allow_looping() => {
|
||||||
Err(PERR::LoopBreak.into_err(token_pos))
|
Err(PERR::LoopBreak.into_err(token_pos))
|
||||||
@ -3562,7 +3586,7 @@ impl Engine {
|
|||||||
return Err(PERR::FnDuplicatedParam(name.to_string(), s.to_string())
|
return Err(PERR::FnDuplicatedParam(name.to_string(), s.to_string())
|
||||||
.into_err(pos));
|
.into_err(pos));
|
||||||
}
|
}
|
||||||
let s = state.get_interned_string(s);
|
let s = state.get_interned_string(*s);
|
||||||
state.stack.push(s.clone(), ());
|
state.stack.push(s.clone(), ());
|
||||||
params.push((s, pos));
|
params.push((s, pos));
|
||||||
}
|
}
|
||||||
@ -3622,6 +3646,8 @@ impl Engine {
|
|||||||
#[cfg(not(feature = "no_closure"))]
|
#[cfg(not(feature = "no_closure"))]
|
||||||
fn make_curry_from_externals(
|
fn make_curry_from_externals(
|
||||||
state: &mut ParseState,
|
state: &mut ParseState,
|
||||||
|
parent: &mut ParseState,
|
||||||
|
lib: &FnLib,
|
||||||
fn_expr: Expr,
|
fn_expr: Expr,
|
||||||
externals: StaticVec<crate::ast::Ident>,
|
externals: StaticVec<crate::ast::Ident>,
|
||||||
pos: Position,
|
pos: Position,
|
||||||
@ -3641,16 +3667,20 @@ impl Engine {
|
|||||||
.iter()
|
.iter()
|
||||||
.cloned()
|
.cloned()
|
||||||
.map(|crate::ast::Ident { name, pos }| {
|
.map(|crate::ast::Ident { name, pos }| {
|
||||||
#[cfg(not(feature = "no_module"))]
|
let (index, is_func) = parent.access_var(&name, lib, pos);
|
||||||
let ns = crate::ast::Namespace::NONE;
|
let idx = match index {
|
||||||
#[cfg(feature = "no_module")]
|
Some(n) if !is_func && n.get() <= u8::MAX as usize => {
|
||||||
let ns = ();
|
NonZeroU8::new(n.get() as u8)
|
||||||
|
}
|
||||||
Expr::Variable((None, ns, 0, name).into(), None, pos)
|
_ => None,
|
||||||
|
};
|
||||||
|
Expr::Variable((index, Default::default(), 0, name).into(), idx, pos)
|
||||||
}),
|
}),
|
||||||
);
|
);
|
||||||
|
|
||||||
let expr = FnCallExpr {
|
let expr = FnCallExpr {
|
||||||
|
#[cfg(not(feature = "no_module"))]
|
||||||
|
namespace: Default::default(),
|
||||||
name: state.get_interned_string(crate::engine::KEYWORD_FN_PTR_CURRY),
|
name: state.get_interned_string(crate::engine::KEYWORD_FN_PTR_CURRY),
|
||||||
hashes: FnCallHashes::from_native(calc_fn_hash(
|
hashes: FnCallHashes::from_native(calc_fn_hash(
|
||||||
None,
|
None,
|
||||||
@ -3658,19 +3688,24 @@ impl Engine {
|
|||||||
num_externals + 1,
|
num_externals + 1,
|
||||||
)),
|
)),
|
||||||
args,
|
args,
|
||||||
pos,
|
op_token: None,
|
||||||
..Default::default()
|
capture_parent_scope: false,
|
||||||
}
|
}
|
||||||
.into_fn_call_expr(pos);
|
.into_fn_call_expr(pos);
|
||||||
|
|
||||||
// Convert the entire expression into a statement block, then insert the relevant
|
// Convert the entire expression into a statement block, then insert the relevant
|
||||||
// [`Share`][Stmt::Share] statements.
|
// [`Share`][Stmt::Share] statements.
|
||||||
let mut statements = StaticVec::with_capacity(externals.len() + 1);
|
let mut statements = StaticVec::with_capacity(2);
|
||||||
statements.extend(
|
statements.push(Stmt::Share(
|
||||||
externals
|
externals
|
||||||
.into_iter()
|
.into_iter()
|
||||||
.map(|crate::ast::Ident { name, pos }| Stmt::Share(name, pos)),
|
.map(|crate::ast::Ident { name, pos }| {
|
||||||
);
|
let (index, _) = parent.access_var(&name, lib, pos);
|
||||||
|
(name, index, pos)
|
||||||
|
})
|
||||||
|
.collect::<crate::FnArgsVec<_>>()
|
||||||
|
.into(),
|
||||||
|
));
|
||||||
statements.push(Stmt::Expr(expr.into()));
|
statements.push(Stmt::Expr(expr.into()));
|
||||||
Expr::Stmt(crate::ast::StmtBlock::new(statements, pos, Position::NONE).into())
|
Expr::Stmt(crate::ast::StmtBlock::new(statements, pos, Position::NONE).into())
|
||||||
}
|
}
|
||||||
@ -3681,6 +3716,7 @@ impl Engine {
|
|||||||
&self,
|
&self,
|
||||||
input: &mut TokenStream,
|
input: &mut TokenStream,
|
||||||
state: &mut ParseState,
|
state: &mut ParseState,
|
||||||
|
parent: &mut ParseState,
|
||||||
lib: &mut FnLib,
|
lib: &mut FnLib,
|
||||||
settings: ParseSettings,
|
settings: ParseSettings,
|
||||||
) -> ParseResult<(Expr, ScriptFnDef)> {
|
) -> ParseResult<(Expr, ScriptFnDef)> {
|
||||||
@ -3700,7 +3736,7 @@ impl Engine {
|
|||||||
PERR::FnDuplicatedParam(String::new(), s.to_string()).into_err(pos)
|
PERR::FnDuplicatedParam(String::new(), s.to_string()).into_err(pos)
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
let s = state.get_interned_string(s);
|
let s = state.get_interned_string(*s);
|
||||||
state.stack.push(s.clone(), ());
|
state.stack.push(s.clone(), ());
|
||||||
params_list.push(s);
|
params_list.push(s);
|
||||||
}
|
}
|
||||||
@ -3777,7 +3813,8 @@ impl Engine {
|
|||||||
let expr = Expr::DynamicConstant(Box::new(fn_ptr.into()), settings.pos);
|
let expr = Expr::DynamicConstant(Box::new(fn_ptr.into()), settings.pos);
|
||||||
|
|
||||||
#[cfg(not(feature = "no_closure"))]
|
#[cfg(not(feature = "no_closure"))]
|
||||||
let expr = Self::make_curry_from_externals(state, expr, externals, settings.pos);
|
let expr =
|
||||||
|
Self::make_curry_from_externals(state, parent, lib, expr, externals, settings.pos);
|
||||||
|
|
||||||
Ok((expr, script))
|
Ok((expr, script))
|
||||||
}
|
}
|
||||||
@ -3787,16 +3824,17 @@ impl Engine {
|
|||||||
&self,
|
&self,
|
||||||
input: &mut TokenStream,
|
input: &mut TokenStream,
|
||||||
state: &mut ParseState,
|
state: &mut ParseState,
|
||||||
|
process_settings: impl Fn(&mut ParseSettings),
|
||||||
_optimization_level: OptimizationLevel,
|
_optimization_level: OptimizationLevel,
|
||||||
) -> ParseResult<AST> {
|
) -> ParseResult<AST> {
|
||||||
let mut functions = StraightHashMap::default();
|
let mut functions = StraightHashMap::default();
|
||||||
|
|
||||||
let mut options = self.options;
|
let mut options = self.options;
|
||||||
options.remove(LangOptions::STMT_EXPR);
|
options.remove(LangOptions::STMT_EXPR | LangOptions::LOOP_EXPR);
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
options.remove(LangOptions::ANON_FN);
|
options.remove(LangOptions::ANON_FN);
|
||||||
|
|
||||||
let settings = ParseSettings {
|
let mut settings = ParseSettings {
|
||||||
at_global_level: true,
|
at_global_level: true,
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
in_fn_scope: false,
|
in_fn_scope: false,
|
||||||
@ -3805,10 +3843,13 @@ impl Engine {
|
|||||||
in_closure: false,
|
in_closure: false,
|
||||||
is_breakable: false,
|
is_breakable: false,
|
||||||
allow_statements: false,
|
allow_statements: false,
|
||||||
|
allow_unquoted_map_properties: true,
|
||||||
level: 0,
|
level: 0,
|
||||||
options,
|
options,
|
||||||
pos: Position::NONE,
|
pos: Position::START,
|
||||||
};
|
};
|
||||||
|
process_settings(&mut settings);
|
||||||
|
|
||||||
let expr = self.parse_expr(input, state, &mut functions, settings)?;
|
let expr = self.parse_expr(input, state, &mut functions, settings)?;
|
||||||
|
|
||||||
assert!(functions.is_empty());
|
assert!(functions.is_empty());
|
||||||
@ -3847,12 +3888,11 @@ impl Engine {
|
|||||||
&self,
|
&self,
|
||||||
input: &mut TokenStream,
|
input: &mut TokenStream,
|
||||||
state: &mut ParseState,
|
state: &mut ParseState,
|
||||||
|
process_settings: impl Fn(&mut ParseSettings),
|
||||||
) -> ParseResult<(StmtBlockContainer, StaticVec<Shared<ScriptFnDef>>)> {
|
) -> ParseResult<(StmtBlockContainer, StaticVec<Shared<ScriptFnDef>>)> {
|
||||||
let mut statements = StmtBlockContainer::new_const();
|
let mut statements = StmtBlockContainer::new_const();
|
||||||
let mut functions = StraightHashMap::default();
|
let mut functions = StraightHashMap::default();
|
||||||
|
let mut settings = ParseSettings {
|
||||||
while !input.peek().expect(NEVER_ENDS).0.is_eof() {
|
|
||||||
let settings = ParseSettings {
|
|
||||||
at_global_level: true,
|
at_global_level: true,
|
||||||
#[cfg(not(feature = "no_function"))]
|
#[cfg(not(feature = "no_function"))]
|
||||||
in_fn_scope: false,
|
in_fn_scope: false,
|
||||||
@ -3861,11 +3901,14 @@ impl Engine {
|
|||||||
in_closure: false,
|
in_closure: false,
|
||||||
is_breakable: false,
|
is_breakable: false,
|
||||||
allow_statements: true,
|
allow_statements: true,
|
||||||
|
allow_unquoted_map_properties: true,
|
||||||
options: self.options,
|
options: self.options,
|
||||||
level: 0,
|
level: 0,
|
||||||
pos: Position::NONE,
|
pos: Position::START,
|
||||||
};
|
};
|
||||||
|
process_settings(&mut settings);
|
||||||
|
|
||||||
|
while !input.peek().expect(NEVER_ENDS).0.is_eof() {
|
||||||
let stmt = self.parse_stmt(input, state, &mut functions, settings)?;
|
let stmt = self.parse_stmt(input, state, &mut functions, settings)?;
|
||||||
|
|
||||||
if stmt.is_noop() {
|
if stmt.is_noop() {
|
||||||
@ -3912,7 +3955,7 @@ impl Engine {
|
|||||||
state: &mut ParseState,
|
state: &mut ParseState,
|
||||||
_optimization_level: OptimizationLevel,
|
_optimization_level: OptimizationLevel,
|
||||||
) -> ParseResult<AST> {
|
) -> ParseResult<AST> {
|
||||||
let (statements, _lib) = self.parse_global_level(input, state)?;
|
let (statements, _lib) = self.parse_global_level(input, state, |_| {})?;
|
||||||
|
|
||||||
#[cfg(not(feature = "no_optimize"))]
|
#[cfg(not(feature = "no_optimize"))]
|
||||||
return Ok(crate::optimizer::optimize_into_ast(
|
return Ok(crate::optimizer::optimize_into_ast(
|
||||||
|
181
src/serde/de.rs
181
src/serde/de.rs
@ -8,12 +8,17 @@ use serde::{Deserialize, Deserializer};
|
|||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
use std::{any::type_name, fmt};
|
use std::{any::type_name, fmt};
|
||||||
|
|
||||||
/// Deserializer for [`Dynamic`][crate::Dynamic] which is kept as a reference.
|
/// Deserializer for [`Dynamic`][crate::Dynamic].
|
||||||
///
|
pub struct DynamicDeserializer<'de>(&'de Dynamic);
|
||||||
/// The reference is necessary because the deserialized type may hold references
|
|
||||||
/// (especially `&str`) to the source [`Dynamic`][crate::Dynamic].
|
impl<'de> IntoDeserializer<'de, RhaiError> for &'de Dynamic {
|
||||||
struct DynamicDeserializer<'a> {
|
type Deserializer = DynamicDeserializer<'de>;
|
||||||
value: &'a Dynamic,
|
|
||||||
|
#[inline(always)]
|
||||||
|
#[must_use]
|
||||||
|
fn into_deserializer(self) -> Self::Deserializer {
|
||||||
|
DynamicDeserializer(self)
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<'de> DynamicDeserializer<'de> {
|
impl<'de> DynamicDeserializer<'de> {
|
||||||
@ -21,28 +26,28 @@ impl<'de> DynamicDeserializer<'de> {
|
|||||||
///
|
///
|
||||||
/// The reference is necessary because the deserialized type may hold references
|
/// The reference is necessary because the deserialized type may hold references
|
||||||
/// (especially `&str`) to the source [`Dynamic`][crate::Dynamic].
|
/// (especially `&str`) to the source [`Dynamic`][crate::Dynamic].
|
||||||
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn from_dynamic(value: &'de Dynamic) -> Self {
|
pub const fn new(value: &'de Dynamic) -> Self {
|
||||||
Self { value }
|
Self(value)
|
||||||
}
|
}
|
||||||
/// Shortcut for a type conversion error.
|
/// Shortcut for a type conversion error.
|
||||||
|
#[cold]
|
||||||
|
#[inline(always)]
|
||||||
fn type_error<T>(&self) -> RhaiResultOf<T> {
|
fn type_error<T>(&self) -> RhaiResultOf<T> {
|
||||||
self.type_error_str(type_name::<T>())
|
self.type_error_str(type_name::<T>())
|
||||||
}
|
}
|
||||||
/// Shortcut for a type conversion error.
|
/// Shortcut for a type conversion error.
|
||||||
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn type_error_str<T>(&self, error: &str) -> RhaiResultOf<T> {
|
fn type_error_str<T>(&self, error: &str) -> RhaiResultOf<T> {
|
||||||
Err(ERR::ErrorMismatchOutputType(
|
Err(
|
||||||
error.into(),
|
ERR::ErrorMismatchOutputType(error.into(), self.0.type_name().into(), Position::NONE)
|
||||||
self.value.type_name().into(),
|
.into(),
|
||||||
Position::NONE,
|
|
||||||
)
|
)
|
||||||
.into())
|
|
||||||
}
|
}
|
||||||
fn deserialize_int<V: Visitor<'de>>(
|
#[inline(always)]
|
||||||
&mut self,
|
fn deserialize_int<V: Visitor<'de>>(self, v: crate::INT, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
v: crate::INT,
|
|
||||||
visitor: V,
|
|
||||||
) -> RhaiResultOf<V::Value> {
|
|
||||||
#[cfg(not(feature = "only_i32"))]
|
#[cfg(not(feature = "only_i32"))]
|
||||||
return visitor.visit_i64(v);
|
return visitor.visit_i64(v);
|
||||||
#[cfg(feature = "only_i32")]
|
#[cfg(feature = "only_i32")]
|
||||||
@ -102,10 +107,12 @@ impl<'de> DynamicDeserializer<'de> {
|
|||||||
/// # }
|
/// # }
|
||||||
/// ```
|
/// ```
|
||||||
pub fn from_dynamic<'de, T: Deserialize<'de>>(value: &'de Dynamic) -> RhaiResultOf<T> {
|
pub fn from_dynamic<'de, T: Deserialize<'de>>(value: &'de Dynamic) -> RhaiResultOf<T> {
|
||||||
T::deserialize(&mut DynamicDeserializer::from_dynamic(value))
|
T::deserialize(DynamicDeserializer::new(value))
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Error for RhaiError {
|
impl Error for RhaiError {
|
||||||
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn custom<T: fmt::Display>(err: T) -> Self {
|
fn custom<T: fmt::Display>(err: T) -> Self {
|
||||||
LexError::ImproperSymbol(String::new(), err.to_string())
|
LexError::ImproperSymbol(String::new(), err.to_string())
|
||||||
.into_err(Position::NONE)
|
.into_err(Position::NONE)
|
||||||
@ -113,11 +120,13 @@ impl Error for RhaiError {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
impl<'de> Deserializer<'de> for DynamicDeserializer<'de> {
|
||||||
type Error = RhaiError;
|
type Error = RhaiError;
|
||||||
|
|
||||||
fn deserialize_any<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_any<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
match self.value.0 {
|
match self.0 .0 {
|
||||||
|
Union::Null => unreachable!(),
|
||||||
|
|
||||||
Union::Unit(..) => self.deserialize_unit(visitor),
|
Union::Unit(..) => self.deserialize_unit(visitor),
|
||||||
Union::Bool(..) => self.deserialize_bool(visitor),
|
Union::Bool(..) => self.deserialize_bool(visitor),
|
||||||
Union::Str(..) => self.deserialize_str(visitor),
|
Union::Str(..) => self.deserialize_str(visitor),
|
||||||
@ -149,7 +158,7 @@ impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
|||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
Union::Map(..) => self.deserialize_map(visitor),
|
Union::Map(..) => self.deserialize_map(visitor),
|
||||||
Union::FnPtr(..) => self.type_error(),
|
Union::FnPtr(..) => self.type_error(),
|
||||||
#[cfg(not(feature = "no_std"))]
|
#[cfg(not(feature = "no_time"))]
|
||||||
Union::TimeStamp(..) => self.type_error(),
|
Union::TimeStamp(..) => self.type_error(),
|
||||||
|
|
||||||
Union::Variant(ref value, ..) if value.is::<i8>() => self.deserialize_i8(visitor),
|
Union::Variant(ref value, ..) if value.is::<i8>() => self.deserialize_i8(visitor),
|
||||||
@ -171,110 +180,110 @@ impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn deserialize_bool<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_bool<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
visitor.visit_bool(self.value.as_bool().or_else(|_| self.type_error())?)
|
visitor.visit_bool(self.0.as_bool().or_else(|_| self.type_error())?)
|
||||||
}
|
}
|
||||||
|
|
||||||
fn deserialize_i8<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_i8<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
if let Ok(v) = self.value.as_int() {
|
if let Ok(v) = self.0.as_int() {
|
||||||
self.deserialize_int(v, visitor)
|
self.deserialize_int(v, visitor)
|
||||||
} else {
|
} else {
|
||||||
self.value
|
self.0
|
||||||
.downcast_ref::<i8>()
|
.downcast_ref::<i8>()
|
||||||
.map_or_else(|| self.type_error(), |&x| visitor.visit_i8(x))
|
.map_or_else(|| self.type_error(), |&x| visitor.visit_i8(x))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn deserialize_i16<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_i16<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
if let Ok(v) = self.value.as_int() {
|
if let Ok(v) = self.0.as_int() {
|
||||||
self.deserialize_int(v, visitor)
|
self.deserialize_int(v, visitor)
|
||||||
} else {
|
} else {
|
||||||
self.value
|
self.0
|
||||||
.downcast_ref::<i16>()
|
.downcast_ref::<i16>()
|
||||||
.map_or_else(|| self.type_error(), |&x| visitor.visit_i16(x))
|
.map_or_else(|| self.type_error(), |&x| visitor.visit_i16(x))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn deserialize_i32<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_i32<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
if let Ok(v) = self.value.as_int() {
|
if let Ok(v) = self.0.as_int() {
|
||||||
self.deserialize_int(v, visitor)
|
self.deserialize_int(v, visitor)
|
||||||
} else if cfg!(feature = "only_i32") {
|
} else if cfg!(feature = "only_i32") {
|
||||||
self.type_error()
|
self.type_error()
|
||||||
} else {
|
} else {
|
||||||
self.value
|
self.0
|
||||||
.downcast_ref::<i32>()
|
.downcast_ref::<i32>()
|
||||||
.map_or_else(|| self.type_error(), |&x| visitor.visit_i32(x))
|
.map_or_else(|| self.type_error(), |&x| visitor.visit_i32(x))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn deserialize_i64<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_i64<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
if let Ok(v) = self.value.as_int() {
|
if let Ok(v) = self.0.as_int() {
|
||||||
self.deserialize_int(v, visitor)
|
self.deserialize_int(v, visitor)
|
||||||
} else if cfg!(not(feature = "only_i32")) {
|
} else if cfg!(not(feature = "only_i32")) {
|
||||||
self.type_error()
|
self.type_error()
|
||||||
} else {
|
} else {
|
||||||
self.value
|
self.0
|
||||||
.downcast_ref::<i64>()
|
.downcast_ref::<i64>()
|
||||||
.map_or_else(|| self.type_error(), |&x| visitor.visit_i64(x))
|
.map_or_else(|| self.type_error(), |&x| visitor.visit_i64(x))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn deserialize_i128<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_i128<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
if let Ok(v) = self.value.as_int() {
|
if let Ok(v) = self.0.as_int() {
|
||||||
self.deserialize_int(v, visitor)
|
self.deserialize_int(v, visitor)
|
||||||
} else if cfg!(not(feature = "only_i32")) {
|
} else if cfg!(not(feature = "only_i32")) {
|
||||||
self.type_error()
|
self.type_error()
|
||||||
} else {
|
} else {
|
||||||
self.value
|
self.0
|
||||||
.downcast_ref::<i128>()
|
.downcast_ref::<i128>()
|
||||||
.map_or_else(|| self.type_error(), |&x| visitor.visit_i128(x))
|
.map_or_else(|| self.type_error(), |&x| visitor.visit_i128(x))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn deserialize_u8<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_u8<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
if let Ok(v) = self.value.as_int() {
|
if let Ok(v) = self.0.as_int() {
|
||||||
self.deserialize_int(v, visitor)
|
self.deserialize_int(v, visitor)
|
||||||
} else {
|
} else {
|
||||||
self.value
|
self.0
|
||||||
.downcast_ref::<u8>()
|
.downcast_ref::<u8>()
|
||||||
.map_or_else(|| self.type_error(), |&x| visitor.visit_u8(x))
|
.map_or_else(|| self.type_error(), |&x| visitor.visit_u8(x))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn deserialize_u16<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_u16<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
if let Ok(v) = self.value.as_int() {
|
if let Ok(v) = self.0.as_int() {
|
||||||
self.deserialize_int(v, visitor)
|
self.deserialize_int(v, visitor)
|
||||||
} else {
|
} else {
|
||||||
self.value
|
self.0
|
||||||
.downcast_ref::<u16>()
|
.downcast_ref::<u16>()
|
||||||
.map_or_else(|| self.type_error(), |&x| visitor.visit_u16(x))
|
.map_or_else(|| self.type_error(), |&x| visitor.visit_u16(x))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn deserialize_u32<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_u32<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
if let Ok(v) = self.value.as_int() {
|
if let Ok(v) = self.0.as_int() {
|
||||||
self.deserialize_int(v, visitor)
|
self.deserialize_int(v, visitor)
|
||||||
} else {
|
} else {
|
||||||
self.value
|
self.0
|
||||||
.downcast_ref::<u32>()
|
.downcast_ref::<u32>()
|
||||||
.map_or_else(|| self.type_error(), |&x| visitor.visit_u32(x))
|
.map_or_else(|| self.type_error(), |&x| visitor.visit_u32(x))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn deserialize_u64<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_u64<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
if let Ok(v) = self.value.as_int() {
|
if let Ok(v) = self.0.as_int() {
|
||||||
self.deserialize_int(v, visitor)
|
self.deserialize_int(v, visitor)
|
||||||
} else {
|
} else {
|
||||||
self.value
|
self.0
|
||||||
.downcast_ref::<u64>()
|
.downcast_ref::<u64>()
|
||||||
.map_or_else(|| self.type_error(), |&x| visitor.visit_u64(x))
|
.map_or_else(|| self.type_error(), |&x| visitor.visit_u64(x))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn deserialize_u128<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_u128<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
if let Ok(v) = self.value.as_int() {
|
if let Ok(v) = self.0.as_int() {
|
||||||
self.deserialize_int(v, visitor)
|
self.deserialize_int(v, visitor)
|
||||||
} else {
|
} else {
|
||||||
self.value
|
self.0
|
||||||
.downcast_ref::<u128>()
|
.downcast_ref::<u128>()
|
||||||
.map_or_else(|| self.type_error(), |&x| visitor.visit_u128(x))
|
.map_or_else(|| self.type_error(), |&x| visitor.visit_u128(x))
|
||||||
}
|
}
|
||||||
@ -283,7 +292,7 @@ impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
|||||||
fn deserialize_f32<V: Visitor<'de>>(self, _visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_f32<V: Visitor<'de>>(self, _visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
#[cfg(not(feature = "no_float"))]
|
#[cfg(not(feature = "no_float"))]
|
||||||
return self
|
return self
|
||||||
.value
|
.0
|
||||||
.downcast_ref::<f32>()
|
.downcast_ref::<f32>()
|
||||||
.map_or_else(|| self.type_error(), |&x| _visitor.visit_f32(x));
|
.map_or_else(|| self.type_error(), |&x| _visitor.visit_f32(x));
|
||||||
|
|
||||||
@ -293,7 +302,7 @@ impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
|||||||
use rust_decimal::prelude::ToPrimitive;
|
use rust_decimal::prelude::ToPrimitive;
|
||||||
|
|
||||||
return self
|
return self
|
||||||
.value
|
.0
|
||||||
.downcast_ref::<rust_decimal::Decimal>()
|
.downcast_ref::<rust_decimal::Decimal>()
|
||||||
.and_then(|&x| x.to_f32())
|
.and_then(|&x| x.to_f32())
|
||||||
.map_or_else(|| self.type_error(), |v| _visitor.visit_f32(v));
|
.map_or_else(|| self.type_error(), |v| _visitor.visit_f32(v));
|
||||||
@ -307,7 +316,7 @@ impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
|||||||
fn deserialize_f64<V: Visitor<'de>>(self, _visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_f64<V: Visitor<'de>>(self, _visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
#[cfg(not(feature = "no_float"))]
|
#[cfg(not(feature = "no_float"))]
|
||||||
return self
|
return self
|
||||||
.value
|
.0
|
||||||
.downcast_ref::<f64>()
|
.downcast_ref::<f64>()
|
||||||
.map_or_else(|| self.type_error(), |&x| _visitor.visit_f64(x));
|
.map_or_else(|| self.type_error(), |&x| _visitor.visit_f64(x));
|
||||||
|
|
||||||
@ -317,7 +326,7 @@ impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
|||||||
use rust_decimal::prelude::ToPrimitive;
|
use rust_decimal::prelude::ToPrimitive;
|
||||||
|
|
||||||
return self
|
return self
|
||||||
.value
|
.0
|
||||||
.downcast_ref::<rust_decimal::Decimal>()
|
.downcast_ref::<rust_decimal::Decimal>()
|
||||||
.and_then(|&x| x.to_f64())
|
.and_then(|&x| x.to_f64())
|
||||||
.map_or_else(|| self.type_error(), |v| _visitor.visit_f64(v));
|
.map_or_else(|| self.type_error(), |v| _visitor.visit_f64(v));
|
||||||
@ -329,13 +338,13 @@ impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn deserialize_char<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_char<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
self.value
|
self.0
|
||||||
.downcast_ref::<char>()
|
.downcast_ref::<char>()
|
||||||
.map_or_else(|| self.type_error(), |&x| visitor.visit_char(x))
|
.map_or_else(|| self.type_error(), |&x| visitor.visit_char(x))
|
||||||
}
|
}
|
||||||
|
|
||||||
fn deserialize_str<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_str<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
self.value.downcast_ref::<ImmutableString>().map_or_else(
|
self.0.downcast_ref::<ImmutableString>().map_or_else(
|
||||||
|| self.type_error(),
|
|| self.type_error(),
|
||||||
|x| visitor.visit_borrowed_str(x.as_str()),
|
|x| visitor.visit_borrowed_str(x.as_str()),
|
||||||
)
|
)
|
||||||
@ -348,7 +357,7 @@ impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
|||||||
fn deserialize_bytes<V: Visitor<'de>>(self, _visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_bytes<V: Visitor<'de>>(self, _visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
return self
|
return self
|
||||||
.value
|
.0
|
||||||
.downcast_ref::<crate::Blob>()
|
.downcast_ref::<crate::Blob>()
|
||||||
.map_or_else(|| self.type_error(), |x| _visitor.visit_bytes(x));
|
.map_or_else(|| self.type_error(), |x| _visitor.visit_bytes(x));
|
||||||
|
|
||||||
@ -361,7 +370,7 @@ impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn deserialize_option<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_option<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
if self.value.is::<()>() {
|
if self.0.is::<()>() {
|
||||||
visitor.visit_none()
|
visitor.visit_none()
|
||||||
} else {
|
} else {
|
||||||
visitor.visit_some(self)
|
visitor.visit_some(self)
|
||||||
@ -369,7 +378,7 @@ impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn deserialize_unit<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_unit<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
self.value
|
self.0
|
||||||
.downcast_ref::<()>()
|
.downcast_ref::<()>()
|
||||||
.map_or_else(|| self.type_error(), |_| visitor.visit_unit())
|
.map_or_else(|| self.type_error(), |_| visitor.visit_unit())
|
||||||
}
|
}
|
||||||
@ -392,7 +401,7 @@ impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
|||||||
|
|
||||||
fn deserialize_seq<V: Visitor<'de>>(self, _visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_seq<V: Visitor<'de>>(self, _visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
return self.value.downcast_ref::<crate::Array>().map_or_else(
|
return self.0.downcast_ref::<crate::Array>().map_or_else(
|
||||||
|| self.type_error(),
|
|| self.type_error(),
|
||||||
|arr| _visitor.visit_seq(IterateDynamicArray::new(arr.iter())),
|
|arr| _visitor.visit_seq(IterateDynamicArray::new(arr.iter())),
|
||||||
);
|
);
|
||||||
@ -416,7 +425,7 @@ impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
|||||||
|
|
||||||
fn deserialize_map<V: Visitor<'de>>(self, _visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_map<V: Visitor<'de>>(self, _visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
return self.value.downcast_ref::<crate::Map>().map_or_else(
|
return self.0.downcast_ref::<crate::Map>().map_or_else(
|
||||||
|| self.type_error(),
|
|| self.type_error(),
|
||||||
|map| {
|
|map| {
|
||||||
_visitor.visit_map(IterateMap::new(
|
_visitor.visit_map(IterateMap::new(
|
||||||
@ -445,11 +454,11 @@ impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
|||||||
_variants: &'static [&'static str],
|
_variants: &'static [&'static str],
|
||||||
visitor: V,
|
visitor: V,
|
||||||
) -> RhaiResultOf<V::Value> {
|
) -> RhaiResultOf<V::Value> {
|
||||||
if let Some(s) = self.value.read_lock::<ImmutableString>() {
|
if let Some(s) = self.0.read_lock::<ImmutableString>() {
|
||||||
visitor.visit_enum(s.as_str().into_deserializer())
|
visitor.visit_enum(s.as_str().into_deserializer())
|
||||||
} else {
|
} else {
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
return self.value.downcast_ref::<crate::Map>().map_or_else(
|
return self.0.downcast_ref::<crate::Map>().map_or_else(
|
||||||
|| self.type_error(),
|
|| self.type_error(),
|
||||||
|map| {
|
|map| {
|
||||||
let mut iter = map.iter();
|
let mut iter = map.iter();
|
||||||
@ -458,7 +467,7 @@ impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
|||||||
if let (Some((key, value)), None) = (first, second) {
|
if let (Some((key, value)), None) = (first, second) {
|
||||||
visitor.visit_enum(EnumDeserializer {
|
visitor.visit_enum(EnumDeserializer {
|
||||||
tag: key,
|
tag: key,
|
||||||
content: DynamicDeserializer::from_dynamic(value),
|
content: DynamicDeserializer::new(value),
|
||||||
})
|
})
|
||||||
} else {
|
} else {
|
||||||
self.type_error()
|
self.type_error()
|
||||||
@ -470,10 +479,12 @@ impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn deserialize_identifier<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_identifier<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
self.deserialize_str(visitor)
|
self.deserialize_str(visitor)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn deserialize_ignored_any<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
fn deserialize_ignored_any<V: Visitor<'de>>(self, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
self.deserialize_any(visitor)
|
self.deserialize_any(visitor)
|
||||||
}
|
}
|
||||||
@ -481,13 +492,14 @@ impl<'de> Deserializer<'de> for &mut DynamicDeserializer<'de> {
|
|||||||
|
|
||||||
/// `SeqAccess` implementation for arrays.
|
/// `SeqAccess` implementation for arrays.
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
struct IterateDynamicArray<'a, ITER: Iterator<Item = &'a Dynamic>> {
|
struct IterateDynamicArray<'de, ITER: Iterator<Item = &'de Dynamic>> {
|
||||||
/// Iterator for a stream of [`Dynamic`][crate::Dynamic] values.
|
/// Iterator for a stream of [`Dynamic`][crate::Dynamic] values.
|
||||||
iter: ITER,
|
iter: ITER,
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
impl<'a, ITER: Iterator<Item = &'a Dynamic>> IterateDynamicArray<'a, ITER> {
|
impl<'de, ITER: Iterator<Item = &'de Dynamic>> IterateDynamicArray<'de, ITER> {
|
||||||
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn new(iter: ITER) -> Self {
|
pub const fn new(iter: ITER) -> Self {
|
||||||
Self { iter }
|
Self { iter }
|
||||||
@ -495,8 +507,8 @@ impl<'a, ITER: Iterator<Item = &'a Dynamic>> IterateDynamicArray<'a, ITER> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
impl<'a: 'de, 'de, ITER: Iterator<Item = &'a Dynamic>> serde::de::SeqAccess<'de>
|
impl<'de, ITER: Iterator<Item = &'de Dynamic>> serde::de::SeqAccess<'de>
|
||||||
for IterateDynamicArray<'a, ITER>
|
for IterateDynamicArray<'de, ITER>
|
||||||
{
|
{
|
||||||
type Error = RhaiError;
|
type Error = RhaiError;
|
||||||
|
|
||||||
@ -506,17 +518,15 @@ impl<'a: 'de, 'de, ITER: Iterator<Item = &'a Dynamic>> serde::de::SeqAccess<'de>
|
|||||||
) -> RhaiResultOf<Option<T::Value>> {
|
) -> RhaiResultOf<Option<T::Value>> {
|
||||||
// Deserialize each item coming out of the iterator.
|
// Deserialize each item coming out of the iterator.
|
||||||
match self.iter.next() {
|
match self.iter.next() {
|
||||||
|
Some(item) => seed.deserialize(item.into_deserializer()).map(Some),
|
||||||
None => Ok(None),
|
None => Ok(None),
|
||||||
Some(item) => seed
|
|
||||||
.deserialize(&mut DynamicDeserializer::from_dynamic(item))
|
|
||||||
.map(Some),
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// `MapAccess` implementation for maps.
|
/// `MapAccess` implementation for maps.
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
struct IterateMap<'a, K: Iterator<Item = &'a str>, V: Iterator<Item = &'a Dynamic>> {
|
struct IterateMap<'de, K: Iterator<Item = &'de str>, V: Iterator<Item = &'de Dynamic>> {
|
||||||
// Iterator for a stream of [`Dynamic`][crate::Dynamic] keys.
|
// Iterator for a stream of [`Dynamic`][crate::Dynamic] keys.
|
||||||
keys: K,
|
keys: K,
|
||||||
// Iterator for a stream of [`Dynamic`][crate::Dynamic] values.
|
// Iterator for a stream of [`Dynamic`][crate::Dynamic] values.
|
||||||
@ -524,7 +534,8 @@ struct IterateMap<'a, K: Iterator<Item = &'a str>, V: Iterator<Item = &'a Dynami
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
impl<'a, K: Iterator<Item = &'a str>, V: Iterator<Item = &'a Dynamic>> IterateMap<'a, K, V> {
|
impl<'de, K: Iterator<Item = &'de str>, V: Iterator<Item = &'de Dynamic>> IterateMap<'de, K, V> {
|
||||||
|
#[inline(always)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn new(keys: K, values: V) -> Self {
|
pub const fn new(keys: K, values: V) -> Self {
|
||||||
Self { keys, values }
|
Self { keys, values }
|
||||||
@ -532,8 +543,8 @@ impl<'a, K: Iterator<Item = &'a str>, V: Iterator<Item = &'a Dynamic>> IterateMa
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
impl<'a: 'de, 'de, K: Iterator<Item = &'a str>, V: Iterator<Item = &'a Dynamic>>
|
impl<'de, K: Iterator<Item = &'de str>, V: Iterator<Item = &'de Dynamic>> serde::de::MapAccess<'de>
|
||||||
serde::de::MapAccess<'de> for IterateMap<'a, K, V>
|
for IterateMap<'de, K, V>
|
||||||
{
|
{
|
||||||
type Error = RhaiError;
|
type Error = RhaiError;
|
||||||
|
|
||||||
@ -542,11 +553,9 @@ impl<'a: 'de, 'de, K: Iterator<Item = &'a str>, V: Iterator<Item = &'a Dynamic>>
|
|||||||
seed: S,
|
seed: S,
|
||||||
) -> RhaiResultOf<Option<S::Value>> {
|
) -> RhaiResultOf<Option<S::Value>> {
|
||||||
// Deserialize each `Identifier` key coming out of the keys iterator.
|
// Deserialize each `Identifier` key coming out of the keys iterator.
|
||||||
match self.keys.next() {
|
match self.keys.next().map(<_>::into_deserializer) {
|
||||||
|
Some(d) => seed.deserialize(d).map(Some),
|
||||||
None => Ok(None),
|
None => Ok(None),
|
||||||
Some(item) => seed
|
|
||||||
.deserialize(&mut super::str::StringSliceDeserializer::from_str(item))
|
|
||||||
.map(Some),
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -555,20 +564,18 @@ impl<'a: 'de, 'de, K: Iterator<Item = &'a str>, V: Iterator<Item = &'a Dynamic>>
|
|||||||
seed: S,
|
seed: S,
|
||||||
) -> RhaiResultOf<S::Value> {
|
) -> RhaiResultOf<S::Value> {
|
||||||
// Deserialize each value item coming out of the iterator.
|
// Deserialize each value item coming out of the iterator.
|
||||||
seed.deserialize(&mut DynamicDeserializer::from_dynamic(
|
seed.deserialize(self.values.next().unwrap().into_deserializer())
|
||||||
self.values.next().unwrap(),
|
|
||||||
))
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
struct EnumDeserializer<'t, 'de: 't> {
|
struct EnumDeserializer<'de> {
|
||||||
tag: &'t str,
|
tag: &'de str,
|
||||||
content: DynamicDeserializer<'de>,
|
content: DynamicDeserializer<'de>,
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
impl<'t, 'de> serde::de::EnumAccess<'de> for EnumDeserializer<'t, 'de> {
|
impl<'de> serde::de::EnumAccess<'de> for EnumDeserializer<'de> {
|
||||||
type Error = RhaiError;
|
type Error = RhaiError;
|
||||||
type Variant = Self;
|
type Variant = Self;
|
||||||
|
|
||||||
@ -582,26 +589,30 @@ impl<'t, 'de> serde::de::EnumAccess<'de> for EnumDeserializer<'t, 'de> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
impl<'t, 'de> serde::de::VariantAccess<'de> for EnumDeserializer<'t, 'de> {
|
impl<'de> serde::de::VariantAccess<'de> for EnumDeserializer<'de> {
|
||||||
type Error = RhaiError;
|
type Error = RhaiError;
|
||||||
|
|
||||||
fn unit_variant(mut self) -> RhaiResultOf<()> {
|
#[inline(always)]
|
||||||
Deserialize::deserialize(&mut self.content)
|
fn unit_variant(self) -> RhaiResultOf<()> {
|
||||||
|
Deserialize::deserialize(self.content)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn newtype_variant_seed<T: serde::de::DeserializeSeed<'de>>(
|
fn newtype_variant_seed<T: serde::de::DeserializeSeed<'de>>(
|
||||||
mut self,
|
self,
|
||||||
seed: T,
|
seed: T,
|
||||||
) -> RhaiResultOf<T::Value> {
|
) -> RhaiResultOf<T::Value> {
|
||||||
seed.deserialize(&mut self.content)
|
seed.deserialize(self.content)
|
||||||
}
|
}
|
||||||
|
|
||||||
fn tuple_variant<V: Visitor<'de>>(mut self, len: usize, visitor: V) -> RhaiResultOf<V::Value> {
|
#[inline(always)]
|
||||||
|
fn tuple_variant<V: Visitor<'de>>(self, len: usize, visitor: V) -> RhaiResultOf<V::Value> {
|
||||||
self.content.deserialize_tuple(len, visitor)
|
self.content.deserialize_tuple(len, visitor)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn struct_variant<V: Visitor<'de>>(
|
fn struct_variant<V: Visitor<'de>>(
|
||||||
mut self,
|
self,
|
||||||
fields: &'static [&'static str],
|
fields: &'static [&'static str],
|
||||||
visitor: V,
|
visitor: V,
|
||||||
) -> RhaiResultOf<V::Value> {
|
) -> RhaiResultOf<V::Value> {
|
||||||
|
@ -1,31 +1,41 @@
|
|||||||
//! Implementations of [`serde::Deserialize`].
|
//! Implementations of [`serde::Deserialize`].
|
||||||
|
|
||||||
use crate::{Dynamic, ImmutableString, INT};
|
use crate::{Dynamic, Identifier, ImmutableString, Scope, INT};
|
||||||
use serde::de::{Deserialize, Deserializer, Error, Visitor};
|
use serde::{
|
||||||
|
de::{Error, SeqAccess, Visitor},
|
||||||
|
Deserialize, Deserializer,
|
||||||
|
};
|
||||||
use std::fmt;
|
use std::fmt;
|
||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
|
|
||||||
struct DynamicVisitor;
|
struct DynamicVisitor;
|
||||||
|
|
||||||
impl<'d> Visitor<'d> for DynamicVisitor {
|
impl<'de> Visitor<'de> for DynamicVisitor {
|
||||||
type Value = Dynamic;
|
type Value = Dynamic;
|
||||||
|
|
||||||
|
#[cold]
|
||||||
|
#[inline(never)]
|
||||||
fn expecting(&self, f: &mut fmt::Formatter) -> fmt::Result {
|
fn expecting(&self, f: &mut fmt::Formatter) -> fmt::Result {
|
||||||
f.write_str("any type that can be converted into a Dynamic")
|
f.write_str("any type that can be converted into a Dynamic")
|
||||||
}
|
}
|
||||||
|
#[inline(always)]
|
||||||
fn visit_bool<E: Error>(self, v: bool) -> Result<Self::Value, E> {
|
fn visit_bool<E: Error>(self, v: bool) -> Result<Self::Value, E> {
|
||||||
Ok(v.into())
|
Ok(v.into())
|
||||||
}
|
}
|
||||||
|
#[inline(always)]
|
||||||
fn visit_i8<E: Error>(self, v: i8) -> Result<Self::Value, E> {
|
fn visit_i8<E: Error>(self, v: i8) -> Result<Self::Value, E> {
|
||||||
Ok(INT::from(v).into())
|
Ok(INT::from(v).into())
|
||||||
}
|
}
|
||||||
|
#[inline(always)]
|
||||||
fn visit_i16<E: Error>(self, v: i16) -> Result<Self::Value, E> {
|
fn visit_i16<E: Error>(self, v: i16) -> Result<Self::Value, E> {
|
||||||
Ok(INT::from(v).into())
|
Ok(INT::from(v).into())
|
||||||
}
|
}
|
||||||
|
#[inline(always)]
|
||||||
fn visit_i32<E: Error>(self, v: i32) -> Result<Self::Value, E> {
|
fn visit_i32<E: Error>(self, v: i32) -> Result<Self::Value, E> {
|
||||||
Ok(INT::from(v).into())
|
Ok(INT::from(v).into())
|
||||||
}
|
}
|
||||||
|
#[inline]
|
||||||
fn visit_i64<E: Error>(self, v: i64) -> Result<Self::Value, E> {
|
fn visit_i64<E: Error>(self, v: i64) -> Result<Self::Value, E> {
|
||||||
#[cfg(not(feature = "only_i32"))]
|
#[cfg(not(feature = "only_i32"))]
|
||||||
{
|
{
|
||||||
@ -38,12 +48,15 @@ impl<'d> Visitor<'d> for DynamicVisitor {
|
|||||||
self.visit_i32(v as i32)
|
self.visit_i32(v as i32)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
#[inline(always)]
|
||||||
fn visit_u8<E: Error>(self, v: u8) -> Result<Self::Value, E> {
|
fn visit_u8<E: Error>(self, v: u8) -> Result<Self::Value, E> {
|
||||||
Ok(INT::from(v).into())
|
Ok(INT::from(v).into())
|
||||||
}
|
}
|
||||||
|
#[inline(always)]
|
||||||
fn visit_u16<E: Error>(self, v: u16) -> Result<Self::Value, E> {
|
fn visit_u16<E: Error>(self, v: u16) -> Result<Self::Value, E> {
|
||||||
Ok(INT::from(v).into())
|
Ok(INT::from(v).into())
|
||||||
}
|
}
|
||||||
|
#[inline]
|
||||||
fn visit_u32<E: Error>(self, v: u32) -> Result<Self::Value, E> {
|
fn visit_u32<E: Error>(self, v: u32) -> Result<Self::Value, E> {
|
||||||
#[cfg(not(feature = "only_i32"))]
|
#[cfg(not(feature = "only_i32"))]
|
||||||
{
|
{
|
||||||
@ -56,6 +69,7 @@ impl<'d> Visitor<'d> for DynamicVisitor {
|
|||||||
self.visit_i32(v as i32)
|
self.visit_i32(v as i32)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
#[inline]
|
||||||
fn visit_u64<E: Error>(self, v: u64) -> Result<Self::Value, E> {
|
fn visit_u64<E: Error>(self, v: u64) -> Result<Self::Value, E> {
|
||||||
#[cfg(not(feature = "only_i32"))]
|
#[cfg(not(feature = "only_i32"))]
|
||||||
if v > i64::MAX as u64 {
|
if v > i64::MAX as u64 {
|
||||||
@ -72,6 +86,7 @@ impl<'d> Visitor<'d> for DynamicVisitor {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_float"))]
|
#[cfg(not(feature = "no_float"))]
|
||||||
|
#[inline(always)]
|
||||||
fn visit_f32<E: Error>(self, v: f32) -> Result<Self::Value, E> {
|
fn visit_f32<E: Error>(self, v: f32) -> Result<Self::Value, E> {
|
||||||
#[cfg(not(feature = "f32_float"))]
|
#[cfg(not(feature = "f32_float"))]
|
||||||
return self.visit_f64(v as f64);
|
return self.visit_f64(v as f64);
|
||||||
@ -79,6 +94,7 @@ impl<'d> Visitor<'d> for DynamicVisitor {
|
|||||||
return Ok(v.into());
|
return Ok(v.into());
|
||||||
}
|
}
|
||||||
#[cfg(not(feature = "no_float"))]
|
#[cfg(not(feature = "no_float"))]
|
||||||
|
#[inline(always)]
|
||||||
fn visit_f64<E: Error>(self, v: f64) -> Result<Self::Value, E> {
|
fn visit_f64<E: Error>(self, v: f64) -> Result<Self::Value, E> {
|
||||||
#[cfg(not(feature = "f32_float"))]
|
#[cfg(not(feature = "f32_float"))]
|
||||||
return Ok(v.into());
|
return Ok(v.into());
|
||||||
@ -88,6 +104,7 @@ impl<'d> Visitor<'d> for DynamicVisitor {
|
|||||||
|
|
||||||
#[cfg(feature = "no_float")]
|
#[cfg(feature = "no_float")]
|
||||||
#[cfg(feature = "decimal")]
|
#[cfg(feature = "decimal")]
|
||||||
|
#[inline]
|
||||||
fn visit_f32<E: Error>(self, v: f32) -> Result<Self::Value, E> {
|
fn visit_f32<E: Error>(self, v: f32) -> Result<Self::Value, E> {
|
||||||
use rust_decimal::Decimal;
|
use rust_decimal::Decimal;
|
||||||
use std::convert::TryFrom;
|
use std::convert::TryFrom;
|
||||||
@ -98,6 +115,7 @@ impl<'d> Visitor<'d> for DynamicVisitor {
|
|||||||
}
|
}
|
||||||
#[cfg(feature = "no_float")]
|
#[cfg(feature = "no_float")]
|
||||||
#[cfg(feature = "decimal")]
|
#[cfg(feature = "decimal")]
|
||||||
|
#[inline]
|
||||||
fn visit_f64<E: Error>(self, v: f64) -> Result<Self::Value, E> {
|
fn visit_f64<E: Error>(self, v: f64) -> Result<Self::Value, E> {
|
||||||
use rust_decimal::Decimal;
|
use rust_decimal::Decimal;
|
||||||
use std::convert::TryFrom;
|
use std::convert::TryFrom;
|
||||||
@ -107,29 +125,35 @@ impl<'d> Visitor<'d> for DynamicVisitor {
|
|||||||
.map_err(Error::custom)
|
.map_err(Error::custom)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn visit_char<E: Error>(self, v: char) -> Result<Self::Value, E> {
|
fn visit_char<E: Error>(self, v: char) -> Result<Self::Value, E> {
|
||||||
self.visit_string(v.to_string())
|
self.visit_string(v.to_string())
|
||||||
}
|
}
|
||||||
|
#[inline(always)]
|
||||||
fn visit_str<E: Error>(self, v: &str) -> Result<Self::Value, E> {
|
fn visit_str<E: Error>(self, v: &str) -> Result<Self::Value, E> {
|
||||||
Ok(v.into())
|
Ok(v.into())
|
||||||
}
|
}
|
||||||
|
#[inline(always)]
|
||||||
fn visit_borrowed_str<E: Error>(self, v: &str) -> Result<Self::Value, E> {
|
fn visit_borrowed_str<E: Error>(self, v: &str) -> Result<Self::Value, E> {
|
||||||
self.visit_str(v)
|
self.visit_str(v)
|
||||||
}
|
}
|
||||||
|
#[inline(always)]
|
||||||
fn visit_string<E: Error>(self, v: String) -> Result<Self::Value, E> {
|
fn visit_string<E: Error>(self, v: String) -> Result<Self::Value, E> {
|
||||||
Ok(v.into())
|
Ok(v.into())
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn visit_unit<E: Error>(self) -> Result<Self::Value, E> {
|
fn visit_unit<E: Error>(self) -> Result<Self::Value, E> {
|
||||||
Ok(Dynamic::UNIT)
|
Ok(Dynamic::UNIT)
|
||||||
}
|
}
|
||||||
|
|
||||||
fn visit_newtype_struct<D: Deserializer<'d>>(self, de: D) -> Result<Self::Value, D::Error> {
|
#[inline(always)]
|
||||||
|
fn visit_newtype_struct<D: Deserializer<'de>>(self, de: D) -> Result<Self::Value, D::Error> {
|
||||||
Deserialize::deserialize(de)
|
Deserialize::deserialize(de)
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
fn visit_seq<A: serde::de::SeqAccess<'d>>(self, mut seq: A) -> Result<Self::Value, A::Error> {
|
fn visit_seq<A: serde::de::SeqAccess<'de>>(self, mut seq: A) -> Result<Self::Value, A::Error> {
|
||||||
let mut arr = crate::Array::new();
|
let mut arr = crate::Array::new();
|
||||||
|
|
||||||
while let Some(v) = seq.next_element()? {
|
while let Some(v) = seq.next_element()? {
|
||||||
@ -140,7 +164,7 @@ impl<'d> Visitor<'d> for DynamicVisitor {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
fn visit_map<M: serde::de::MapAccess<'d>>(self, mut map: M) -> Result<Self::Value, M::Error> {
|
fn visit_map<M: serde::de::MapAccess<'de>>(self, mut map: M) -> Result<Self::Value, M::Error> {
|
||||||
let mut m = crate::Map::new();
|
let mut m = crate::Map::new();
|
||||||
|
|
||||||
while let Some((k, v)) = map.next_entry()? {
|
while let Some((k, v)) = map.next_entry()? {
|
||||||
@ -151,15 +175,68 @@ impl<'d> Visitor<'d> for DynamicVisitor {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<'d> Deserialize<'d> for Dynamic {
|
impl<'de> Deserialize<'de> for Dynamic {
|
||||||
fn deserialize<D: Deserializer<'d>>(de: D) -> Result<Self, D::Error> {
|
#[inline(always)]
|
||||||
de.deserialize_any(DynamicVisitor)
|
fn deserialize<D: Deserializer<'de>>(deserializer: D) -> Result<Self, D::Error> {
|
||||||
|
deserializer.deserialize_any(DynamicVisitor)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<'d> Deserialize<'d> for ImmutableString {
|
impl<'de> Deserialize<'de> for ImmutableString {
|
||||||
fn deserialize<D: Deserializer<'d>>(de: D) -> Result<Self, D::Error> {
|
#[inline(always)]
|
||||||
let s: String = Deserialize::deserialize(de)?;
|
fn deserialize<D: Deserializer<'de>>(deserializer: D) -> Result<Self, D::Error> {
|
||||||
|
let s: String = Deserialize::deserialize(deserializer)?;
|
||||||
Ok(s.into())
|
Ok(s.into())
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl<'de> Deserialize<'de> for Scope<'de> {
|
||||||
|
#[inline(always)]
|
||||||
|
fn deserialize<D: Deserializer<'de>>(deserializer: D) -> Result<Self, D::Error> {
|
||||||
|
#[derive(Debug, Clone, Hash, Deserialize)]
|
||||||
|
struct ScopeEntry {
|
||||||
|
pub name: Identifier,
|
||||||
|
pub value: Dynamic,
|
||||||
|
#[serde(default)]
|
||||||
|
pub is_constant: bool,
|
||||||
|
}
|
||||||
|
|
||||||
|
struct VecVisitor;
|
||||||
|
|
||||||
|
impl<'de> Visitor<'de> for VecVisitor {
|
||||||
|
type Value = Scope<'static>;
|
||||||
|
|
||||||
|
fn expecting(&self, formatter: &mut fmt::Formatter) -> fmt::Result {
|
||||||
|
formatter.write_str("a sequence")
|
||||||
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
|
fn visit_seq<A>(self, mut access: A) -> Result<Self::Value, A::Error>
|
||||||
|
where
|
||||||
|
A: SeqAccess<'de>,
|
||||||
|
{
|
||||||
|
let mut scope = match access.size_hint() {
|
||||||
|
Some(size) => Scope::with_capacity(size),
|
||||||
|
None => Scope::new(),
|
||||||
|
};
|
||||||
|
|
||||||
|
while let Some(ScopeEntry {
|
||||||
|
name,
|
||||||
|
value,
|
||||||
|
is_constant,
|
||||||
|
}) = access.next_element()?
|
||||||
|
{
|
||||||
|
if is_constant {
|
||||||
|
scope.push_constant_dynamic(name, value);
|
||||||
|
} else {
|
||||||
|
scope.push_dynamic(name, value);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(scope)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
deserializer.deserialize_seq(VecVisitor)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
@ -6,7 +6,6 @@ mod deserialize;
|
|||||||
mod metadata;
|
mod metadata;
|
||||||
mod ser;
|
mod ser;
|
||||||
mod serialize;
|
mod serialize;
|
||||||
mod str;
|
|
||||||
|
|
||||||
pub use de::from_dynamic;
|
pub use de::{from_dynamic, DynamicDeserializer};
|
||||||
pub use ser::to_dynamic;
|
pub use ser::{to_dynamic, DynamicSerializer};
|
||||||
|
109
src/serde/ser.rs
109
src/serde/ser.rs
@ -1,6 +1,6 @@
|
|||||||
//! Implement serialization support of [`Dynamic`][crate::Dynamic] for [`serde`].
|
//! Implement serialization support of [`Dynamic`][crate::Dynamic] for [`serde`].
|
||||||
|
|
||||||
use crate::{Dynamic, Position, RhaiError, RhaiResult, RhaiResultOf, ERR};
|
use crate::{Dynamic, Identifier, Position, RhaiError, RhaiResult, RhaiResultOf, ERR};
|
||||||
use serde::ser::{
|
use serde::ser::{
|
||||||
Error, SerializeMap, SerializeSeq, SerializeStruct, SerializeTuple, SerializeTupleStruct,
|
Error, SerializeMap, SerializeSeq, SerializeStruct, SerializeTuple, SerializeTupleStruct,
|
||||||
};
|
};
|
||||||
@ -9,10 +9,10 @@ use std::fmt;
|
|||||||
#[cfg(feature = "no_std")]
|
#[cfg(feature = "no_std")]
|
||||||
use std::prelude::v1::*;
|
use std::prelude::v1::*;
|
||||||
|
|
||||||
/// Serializer for [`Dynamic`][crate::Dynamic] which is kept as a reference.
|
/// Serializer for [`Dynamic`][crate::Dynamic].
|
||||||
struct DynamicSerializer {
|
pub struct DynamicSerializer {
|
||||||
/// Buffer to hold a temporary key.
|
/// Buffer to hold a temporary key.
|
||||||
_key: Dynamic,
|
_key: Identifier,
|
||||||
/// Buffer to hold a temporary value.
|
/// Buffer to hold a temporary value.
|
||||||
_value: Dynamic,
|
_value: Dynamic,
|
||||||
}
|
}
|
||||||
@ -20,10 +20,10 @@ struct DynamicSerializer {
|
|||||||
impl DynamicSerializer {
|
impl DynamicSerializer {
|
||||||
/// Create a [`DynamicSerializer`] from a [`Dynamic`][crate::Dynamic] value.
|
/// Create a [`DynamicSerializer`] from a [`Dynamic`][crate::Dynamic] value.
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub const fn new(_value: Dynamic) -> Self {
|
pub const fn new(value: Dynamic) -> Self {
|
||||||
Self {
|
Self {
|
||||||
_key: Dynamic::UNIT,
|
_key: Identifier::new_const(),
|
||||||
_value,
|
_value: value,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -105,10 +105,12 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
#[cfg(feature = "no_object")]
|
#[cfg(feature = "no_object")]
|
||||||
type SerializeStructVariant = serde::ser::Impossible<Dynamic, RhaiError>;
|
type SerializeStructVariant = serde::ser::Impossible<Dynamic, RhaiError>;
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_bool(self, v: bool) -> RhaiResultOf<Self::Ok> {
|
fn serialize_bool(self, v: bool) -> RhaiResultOf<Self::Ok> {
|
||||||
Ok(v.into())
|
Ok(v.into())
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_i8(self, v: i8) -> RhaiResultOf<Self::Ok> {
|
fn serialize_i8(self, v: i8) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(not(feature = "only_i32"))]
|
#[cfg(not(feature = "only_i32"))]
|
||||||
return self.serialize_i64(i64::from(v));
|
return self.serialize_i64(i64::from(v));
|
||||||
@ -116,6 +118,7 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
return self.serialize_i32(i32::from(v));
|
return self.serialize_i32(i32::from(v));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_i16(self, v: i16) -> RhaiResultOf<Self::Ok> {
|
fn serialize_i16(self, v: i16) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(not(feature = "only_i32"))]
|
#[cfg(not(feature = "only_i32"))]
|
||||||
return self.serialize_i64(i64::from(v));
|
return self.serialize_i64(i64::from(v));
|
||||||
@ -123,6 +126,7 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
return self.serialize_i32(i32::from(v));
|
return self.serialize_i32(i32::from(v));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_i32(self, v: i32) -> RhaiResultOf<Self::Ok> {
|
fn serialize_i32(self, v: i32) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(not(feature = "only_i32"))]
|
#[cfg(not(feature = "only_i32"))]
|
||||||
return self.serialize_i64(i64::from(v));
|
return self.serialize_i64(i64::from(v));
|
||||||
@ -130,6 +134,7 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
return Ok(v.into());
|
return Ok(v.into());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn serialize_i64(self, v: i64) -> RhaiResultOf<Self::Ok> {
|
fn serialize_i64(self, v: i64) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(not(feature = "only_i32"))]
|
#[cfg(not(feature = "only_i32"))]
|
||||||
{
|
{
|
||||||
@ -143,6 +148,7 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn serialize_i128(self, v: i128) -> RhaiResultOf<Self::Ok> {
|
fn serialize_i128(self, v: i128) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(not(feature = "only_i32"))]
|
#[cfg(not(feature = "only_i32"))]
|
||||||
if v > i64::MAX as i128 {
|
if v > i64::MAX as i128 {
|
||||||
@ -158,6 +164,7 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_u8(self, v: u8) -> RhaiResultOf<Self::Ok> {
|
fn serialize_u8(self, v: u8) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(not(feature = "only_i32"))]
|
#[cfg(not(feature = "only_i32"))]
|
||||||
return self.serialize_i64(i64::from(v));
|
return self.serialize_i64(i64::from(v));
|
||||||
@ -165,6 +172,7 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
return self.serialize_i32(i32::from(v));
|
return self.serialize_i32(i32::from(v));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_u16(self, v: u16) -> RhaiResultOf<Self::Ok> {
|
fn serialize_u16(self, v: u16) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(not(feature = "only_i32"))]
|
#[cfg(not(feature = "only_i32"))]
|
||||||
return self.serialize_i64(i64::from(v));
|
return self.serialize_i64(i64::from(v));
|
||||||
@ -172,6 +180,7 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
return self.serialize_i32(i32::from(v));
|
return self.serialize_i32(i32::from(v));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn serialize_u32(self, v: u32) -> RhaiResultOf<Self::Ok> {
|
fn serialize_u32(self, v: u32) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(not(feature = "only_i32"))]
|
#[cfg(not(feature = "only_i32"))]
|
||||||
{
|
{
|
||||||
@ -185,6 +194,7 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn serialize_u64(self, v: u64) -> RhaiResultOf<Self::Ok> {
|
fn serialize_u64(self, v: u64) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(not(feature = "only_i32"))]
|
#[cfg(not(feature = "only_i32"))]
|
||||||
if v > i64::MAX as u64 {
|
if v > i64::MAX as u64 {
|
||||||
@ -200,6 +210,7 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn serialize_u128(self, v: u128) -> RhaiResultOf<Self::Ok> {
|
fn serialize_u128(self, v: u128) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(not(feature = "only_i32"))]
|
#[cfg(not(feature = "only_i32"))]
|
||||||
if v > i64::MAX as u128 {
|
if v > i64::MAX as u128 {
|
||||||
@ -215,6 +226,7 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn serialize_f32(self, v: f32) -> RhaiResultOf<Self::Ok> {
|
fn serialize_f32(self, v: f32) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(any(not(feature = "no_float"), not(feature = "decimal")))]
|
#[cfg(any(not(feature = "no_float"), not(feature = "decimal")))]
|
||||||
return Ok(Dynamic::from(v));
|
return Ok(Dynamic::from(v));
|
||||||
@ -231,6 +243,7 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn serialize_f64(self, v: f64) -> RhaiResultOf<Self::Ok> {
|
fn serialize_f64(self, v: f64) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(any(not(feature = "no_float"), not(feature = "decimal")))]
|
#[cfg(any(not(feature = "no_float"), not(feature = "decimal")))]
|
||||||
return Ok(Dynamic::from(v));
|
return Ok(Dynamic::from(v));
|
||||||
@ -247,14 +260,17 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_char(self, v: char) -> RhaiResultOf<Self::Ok> {
|
fn serialize_char(self, v: char) -> RhaiResultOf<Self::Ok> {
|
||||||
Ok(v.into())
|
Ok(v.into())
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_str(self, v: &str) -> RhaiResultOf<Self::Ok> {
|
fn serialize_str(self, v: &str) -> RhaiResultOf<Self::Ok> {
|
||||||
Ok(v.into())
|
Ok(v.into())
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn serialize_bytes(self, _v: &[u8]) -> RhaiResultOf<Self::Ok> {
|
fn serialize_bytes(self, _v: &[u8]) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
return Ok(Dynamic::from_blob(_v.to_vec()));
|
return Ok(Dynamic::from_blob(_v.to_vec()));
|
||||||
@ -262,28 +278,33 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
#[cfg(feature = "no_index")]
|
#[cfg(feature = "no_index")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"BLOB's are not supported with 'no_index'".into(),
|
"BLOB's are not supported under 'no_index'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_none(self) -> RhaiResultOf<Self::Ok> {
|
fn serialize_none(self) -> RhaiResultOf<Self::Ok> {
|
||||||
Ok(Dynamic::UNIT)
|
Ok(Dynamic::UNIT)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_some<T: ?Sized + Serialize>(self, value: &T) -> RhaiResultOf<Self::Ok> {
|
fn serialize_some<T: ?Sized + Serialize>(self, value: &T) -> RhaiResultOf<Self::Ok> {
|
||||||
value.serialize(&mut *self)
|
value.serialize(&mut *self)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_unit(self) -> RhaiResultOf<Self::Ok> {
|
fn serialize_unit(self) -> RhaiResultOf<Self::Ok> {
|
||||||
Ok(Dynamic::UNIT)
|
Ok(Dynamic::UNIT)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_unit_struct(self, _name: &'static str) -> RhaiResultOf<Self::Ok> {
|
fn serialize_unit_struct(self, _name: &'static str) -> RhaiResultOf<Self::Ok> {
|
||||||
self.serialize_unit()
|
self.serialize_unit()
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_unit_variant(
|
fn serialize_unit_variant(
|
||||||
self,
|
self,
|
||||||
_name: &'static str,
|
_name: &'static str,
|
||||||
@ -293,6 +314,7 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
self.serialize_str(variant)
|
self.serialize_str(variant)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_newtype_struct<T: ?Sized + Serialize>(
|
fn serialize_newtype_struct<T: ?Sized + Serialize>(
|
||||||
self,
|
self,
|
||||||
_name: &'static str,
|
_name: &'static str,
|
||||||
@ -301,6 +323,7 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
value.serialize(&mut *self)
|
value.serialize(&mut *self)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn serialize_newtype_variant<T: ?Sized + Serialize>(
|
fn serialize_newtype_variant<T: ?Sized + Serialize>(
|
||||||
self,
|
self,
|
||||||
_name: &'static str,
|
_name: &'static str,
|
||||||
@ -316,28 +339,31 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
#[cfg(feature = "no_object")]
|
#[cfg(feature = "no_object")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"object maps are not supported with 'no_object'".into(),
|
"object maps are not supported under 'no_object'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn serialize_seq(self, _len: Option<usize>) -> RhaiResultOf<Self::SerializeSeq> {
|
fn serialize_seq(self, _len: Option<usize>) -> RhaiResultOf<Self::SerializeSeq> {
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
return Ok(DynamicSerializer::new(crate::Array::new().into()));
|
return Ok(DynamicSerializer::new(crate::Array::new().into()));
|
||||||
#[cfg(feature = "no_index")]
|
#[cfg(feature = "no_index")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"arrays are not supported with 'no_index'".into(),
|
"arrays are not supported under 'no_index'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_tuple(self, len: usize) -> RhaiResultOf<Self::SerializeTuple> {
|
fn serialize_tuple(self, len: usize) -> RhaiResultOf<Self::SerializeTuple> {
|
||||||
self.serialize_seq(Some(len))
|
self.serialize_seq(Some(len))
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_tuple_struct(
|
fn serialize_tuple_struct(
|
||||||
self,
|
self,
|
||||||
_name: &'static str,
|
_name: &'static str,
|
||||||
@ -346,6 +372,7 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
self.serialize_seq(Some(len))
|
self.serialize_seq(Some(len))
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn serialize_tuple_variant(
|
fn serialize_tuple_variant(
|
||||||
self,
|
self,
|
||||||
_name: &'static str,
|
_name: &'static str,
|
||||||
@ -362,24 +389,26 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
#[cfg(any(feature = "no_object", feature = "no_index"))]
|
#[cfg(any(feature = "no_object", feature = "no_index"))]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"tuples are not supported with 'no_index' or 'no_object'".into(),
|
"tuples are not supported under 'no_index' or 'no_object'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn serialize_map(self, _len: Option<usize>) -> RhaiResultOf<Self::SerializeMap> {
|
fn serialize_map(self, _len: Option<usize>) -> RhaiResultOf<Self::SerializeMap> {
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
return Ok(DynamicSerializer::new(crate::Map::new().into()));
|
return Ok(DynamicSerializer::new(crate::Map::new().into()));
|
||||||
#[cfg(feature = "no_object")]
|
#[cfg(feature = "no_object")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"object maps are not supported with 'no_object'".into(),
|
"object maps are not supported under 'no_object'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline(always)]
|
||||||
fn serialize_struct(
|
fn serialize_struct(
|
||||||
self,
|
self,
|
||||||
_name: &'static str,
|
_name: &'static str,
|
||||||
@ -388,6 +417,7 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
self.serialize_map(Some(len))
|
self.serialize_map(Some(len))
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn serialize_struct_variant(
|
fn serialize_struct_variant(
|
||||||
self,
|
self,
|
||||||
_name: &'static str,
|
_name: &'static str,
|
||||||
@ -403,7 +433,7 @@ impl Serializer for &mut DynamicSerializer {
|
|||||||
#[cfg(feature = "no_object")]
|
#[cfg(feature = "no_object")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"object maps are not supported with 'no_object'".into(),
|
"object maps are not supported under 'no_object'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
@ -425,20 +455,21 @@ impl SerializeSeq for DynamicSerializer {
|
|||||||
#[cfg(feature = "no_index")]
|
#[cfg(feature = "no_index")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"arrays are not supported with 'no_index'".into(),
|
"arrays are not supported under 'no_index'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
}
|
}
|
||||||
|
|
||||||
// Close the sequence.
|
// Close the sequence.
|
||||||
|
#[inline]
|
||||||
fn end(self) -> RhaiResultOf<Self::Ok> {
|
fn end(self) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
return Ok(self._value);
|
return Ok(self._value);
|
||||||
#[cfg(feature = "no_index")]
|
#[cfg(feature = "no_index")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"arrays are not supported with 'no_index'".into(),
|
"arrays are not supported under 'no_index'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
@ -460,19 +491,20 @@ impl SerializeTuple for DynamicSerializer {
|
|||||||
#[cfg(feature = "no_index")]
|
#[cfg(feature = "no_index")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"tuples are not supported with 'no_index'".into(),
|
"tuples are not supported under 'no_index'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn end(self) -> RhaiResultOf<Self::Ok> {
|
fn end(self) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
return Ok(self._value);
|
return Ok(self._value);
|
||||||
#[cfg(feature = "no_index")]
|
#[cfg(feature = "no_index")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"tuples are not supported with 'no_index'".into(),
|
"tuples are not supported under 'no_index'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
@ -494,19 +526,20 @@ impl SerializeTupleStruct for DynamicSerializer {
|
|||||||
#[cfg(feature = "no_index")]
|
#[cfg(feature = "no_index")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"tuples are not supported with 'no_index'".into(),
|
"tuples are not supported under 'no_index'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn end(self) -> RhaiResultOf<Self::Ok> {
|
fn end(self) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
return Ok(self._value);
|
return Ok(self._value);
|
||||||
#[cfg(feature = "no_index")]
|
#[cfg(feature = "no_index")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"tuples are not supported with 'no_index'".into(),
|
"tuples are not supported under 'no_index'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
@ -520,13 +553,19 @@ impl SerializeMap for DynamicSerializer {
|
|||||||
fn serialize_key<T: ?Sized + Serialize>(&mut self, _key: &T) -> RhaiResultOf<()> {
|
fn serialize_key<T: ?Sized + Serialize>(&mut self, _key: &T) -> RhaiResultOf<()> {
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
{
|
{
|
||||||
self._key = _key.serialize(&mut *self)?;
|
let key = _key.serialize(&mut *self)?;
|
||||||
|
self._key = key
|
||||||
|
.into_immutable_string()
|
||||||
|
.map_err(|typ| {
|
||||||
|
ERR::ErrorMismatchDataType("string".into(), typ.into(), Position::NONE)
|
||||||
|
})?
|
||||||
|
.into();
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
#[cfg(feature = "no_object")]
|
#[cfg(feature = "no_object")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"object maps are not supported with 'no_object'".into(),
|
"object maps are not supported under 'no_object'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
@ -535,20 +574,16 @@ impl SerializeMap for DynamicSerializer {
|
|||||||
fn serialize_value<T: ?Sized + Serialize>(&mut self, _value: &T) -> RhaiResultOf<()> {
|
fn serialize_value<T: ?Sized + Serialize>(&mut self, _value: &T) -> RhaiResultOf<()> {
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
{
|
{
|
||||||
let key = std::mem::take(&mut self._key)
|
let key = std::mem::take(&mut self._key);
|
||||||
.into_immutable_string()
|
|
||||||
.map_err(|typ| {
|
|
||||||
ERR::ErrorMismatchDataType("string".into(), typ.into(), Position::NONE)
|
|
||||||
})?;
|
|
||||||
let value = _value.serialize(&mut *self)?;
|
let value = _value.serialize(&mut *self)?;
|
||||||
let map = self._value.downcast_mut::<crate::Map>().unwrap();
|
let map = self._value.downcast_mut::<crate::Map>().unwrap();
|
||||||
map.insert(key.into(), value);
|
map.insert(key, value);
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
#[cfg(feature = "no_object")]
|
#[cfg(feature = "no_object")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"object maps are not supported with 'no_object'".into(),
|
"object maps are not supported under 'no_object'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
@ -573,19 +608,20 @@ impl SerializeMap for DynamicSerializer {
|
|||||||
#[cfg(feature = "no_object")]
|
#[cfg(feature = "no_object")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"object maps are not supported with 'no_object'".into(),
|
"object maps are not supported under 'no_object'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn end(self) -> RhaiResultOf<Self::Ok> {
|
fn end(self) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
return Ok(self._value);
|
return Ok(self._value);
|
||||||
#[cfg(feature = "no_object")]
|
#[cfg(feature = "no_object")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"object maps are not supported with 'no_object'".into(),
|
"object maps are not supported under 'no_object'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
@ -611,19 +647,20 @@ impl SerializeStruct for DynamicSerializer {
|
|||||||
#[cfg(feature = "no_object")]
|
#[cfg(feature = "no_object")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"object maps are not supported with 'no_object'".into(),
|
"object maps are not supported under 'no_object'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn end(self) -> RhaiResultOf<Self::Ok> {
|
fn end(self) -> RhaiResultOf<Self::Ok> {
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
return Ok(self._value);
|
return Ok(self._value);
|
||||||
#[cfg(feature = "no_object")]
|
#[cfg(feature = "no_object")]
|
||||||
return Err(ERR::ErrorMismatchDataType(
|
return Err(ERR::ErrorMismatchDataType(
|
||||||
"".into(),
|
"".into(),
|
||||||
"object maps are not supported with 'no_object'".into(),
|
"object maps are not supported under 'no_object'".into(),
|
||||||
Position::NONE,
|
Position::NONE,
|
||||||
)
|
)
|
||||||
.into());
|
.into());
|
||||||
@ -632,7 +669,7 @@ impl SerializeStruct for DynamicSerializer {
|
|||||||
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
#[cfg(not(feature = "no_index"))]
|
#[cfg(not(feature = "no_index"))]
|
||||||
struct TupleVariantSerializer {
|
pub struct TupleVariantSerializer {
|
||||||
variant: &'static str,
|
variant: &'static str,
|
||||||
array: crate::Array,
|
array: crate::Array,
|
||||||
}
|
}
|
||||||
@ -649,13 +686,14 @@ impl serde::ser::SerializeTupleVariant for TupleVariantSerializer {
|
|||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn end(self) -> RhaiResultOf<Self::Ok> {
|
fn end(self) -> RhaiResultOf<Self::Ok> {
|
||||||
make_variant(self.variant, self.array.into())
|
make_variant(self.variant, self.array.into())
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
struct StructVariantSerializer {
|
pub struct StructVariantSerializer {
|
||||||
variant: &'static str,
|
variant: &'static str,
|
||||||
map: crate::Map,
|
map: crate::Map,
|
||||||
}
|
}
|
||||||
@ -665,6 +703,7 @@ impl serde::ser::SerializeStructVariant for StructVariantSerializer {
|
|||||||
type Ok = Dynamic;
|
type Ok = Dynamic;
|
||||||
type Error = RhaiError;
|
type Error = RhaiError;
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn serialize_field<T: ?Sized + Serialize>(
|
fn serialize_field<T: ?Sized + Serialize>(
|
||||||
&mut self,
|
&mut self,
|
||||||
key: &'static str,
|
key: &'static str,
|
||||||
@ -675,12 +714,14 @@ impl serde::ser::SerializeStructVariant for StructVariantSerializer {
|
|||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
fn end(self) -> RhaiResultOf<Self::Ok> {
|
fn end(self) -> RhaiResultOf<Self::Ok> {
|
||||||
make_variant(self.variant, self.map.into())
|
make_variant(self.variant, self.map.into())
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(not(feature = "no_object"))]
|
#[cfg(not(feature = "no_object"))]
|
||||||
|
#[inline]
|
||||||
fn make_variant(variant: &'static str, value: Dynamic) -> RhaiResult {
|
fn make_variant(variant: &'static str, value: Dynamic) -> RhaiResult {
|
||||||
let mut map = crate::Map::new();
|
let mut map = crate::Map::new();
|
||||||
map.insert(variant.into(), value);
|
map.insert(variant.into(), value);
|
||||||
|
Some files were not shown because too many files have changed in this diff Show More
Loading…
x
Reference in New Issue
Block a user